28990 lines
541 KiB
CSS
28990 lines
541 KiB
CSS
@charset "UTF-8";
|
|
/*
|
|
$custom-select-indicator: url("data:image/svg+xml;charset=utf8,%3Csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 512 512'%3E%3Cpath fill='currentColor' d='M509.121,125.966c-3.838-3.838-10.055-3.838-13.893,0L256.005,365.194L16.771,125.966c-3.838-3.838-10.055-3.838-13.893,0 c-3.838,3.838-3.838,10.055,0,13.893l246.18,246.175c1.842,1.842,4.337,2.878,6.947,2.878c2.61,0,5.104-1.036,6.946-2.878 l246.17-246.175C512.959,136.021,512.959,129.804,509.121,125.966z'/%3E%3C/svg%3E");
|
|
*/
|
|
/*!
|
|
* Bootstrap v5.3.3 (https://getbootstrap.com/)
|
|
* Copyright 2011-2024 The Bootstrap Authors
|
|
* Licensed under MIT (https://github.com/twbs/bootstrap/blob/main/LICENSE)
|
|
*/
|
|
:root,
|
|
[data-bs-theme=light] {
|
|
--bs-blue: #0d6efd;
|
|
--bs-indigo: #6610f2;
|
|
--bs-purple: #6f42c1;
|
|
--bs-pink: #d63384;
|
|
--bs-red: #dc3545;
|
|
--bs-orange: #fd7e14;
|
|
--bs-yellow: #ffc107;
|
|
--bs-green: #198754;
|
|
--bs-teal: #20c997;
|
|
--bs-cyan: #0dcaf0;
|
|
--bs-black: #000;
|
|
--bs-white: #fff;
|
|
--bs-gray: #6c757d;
|
|
--bs-gray-dark: #343a40;
|
|
--bs-gray-100: #f8f9fa;
|
|
--bs-gray-200: #e9ecef;
|
|
--bs-gray-300: #dee2e6;
|
|
--bs-gray-400: #ced4da;
|
|
--bs-gray-500: #adb5bd;
|
|
--bs-gray-600: #6c757d;
|
|
--bs-gray-700: #495057;
|
|
--bs-gray-800: #343a40;
|
|
--bs-gray-900: #212529;
|
|
--bs-primary: #0070f0;
|
|
--bs-secondary: #6c757d;
|
|
--bs-success: #198754;
|
|
--bs-info: #0dcaf0;
|
|
--bs-warning: #ffc107;
|
|
--bs-danger: #dc3545;
|
|
--bs-light: #f8f9fa;
|
|
--bs-dark: #212529;
|
|
--bs-primary-rgb: 0, 112, 240;
|
|
--bs-secondary-rgb: 108, 117, 125;
|
|
--bs-success-rgb: 25, 135, 84;
|
|
--bs-info-rgb: 13, 202, 240;
|
|
--bs-warning-rgb: 255, 193, 7;
|
|
--bs-danger-rgb: 220, 53, 69;
|
|
--bs-light-rgb: 248, 249, 250;
|
|
--bs-dark-rgb: 33, 37, 41;
|
|
--bs-primary-text-emphasis: #002d60;
|
|
--bs-secondary-text-emphasis: #2b2f32;
|
|
--bs-success-text-emphasis: #0a3622;
|
|
--bs-info-text-emphasis: #055160;
|
|
--bs-warning-text-emphasis: #664d03;
|
|
--bs-danger-text-emphasis: #58151c;
|
|
--bs-light-text-emphasis: #495057;
|
|
--bs-dark-text-emphasis: #495057;
|
|
--bs-primary-bg-subtle: #cce2fc;
|
|
--bs-secondary-bg-subtle: #e2e3e5;
|
|
--bs-success-bg-subtle: #d1e7dd;
|
|
--bs-info-bg-subtle: #cff4fc;
|
|
--bs-warning-bg-subtle: #fff3cd;
|
|
--bs-danger-bg-subtle: #f8d7da;
|
|
--bs-light-bg-subtle: #fcfcfd;
|
|
--bs-dark-bg-subtle: #ced4da;
|
|
--bs-primary-border-subtle: #99c6f9;
|
|
--bs-secondary-border-subtle: #c4c8cb;
|
|
--bs-success-border-subtle: #a3cfbb;
|
|
--bs-info-border-subtle: #9eeaf9;
|
|
--bs-warning-border-subtle: #ffe69c;
|
|
--bs-danger-border-subtle: #f1aeb5;
|
|
--bs-light-border-subtle: #e9ecef;
|
|
--bs-dark-border-subtle: #adb5bd;
|
|
--bs-white-rgb: 255, 255, 255;
|
|
--bs-black-rgb: 0, 0, 0;
|
|
--bs-font-sans-serif: Inter, -apple-system, system-ui, BlinkMacSystemFont, "Segoe UI", Roboto, "Helvetica Neue", Arial, sans-serif;
|
|
--bs-font-monospace: SFMono-Regular, Menlo, Monaco, Consolas, "Liberation Mono", "Courier New", monospace;
|
|
--bs-gradient: linear-gradient(180deg, rgba(255, 255, 255, 0.15), rgba(255, 255, 255, 0));
|
|
--bs-body-font-family: var(--bs-font-sans-serif);
|
|
--bs-body-font-size: 1rem;
|
|
--bs-body-font-weight: 400;
|
|
--bs-body-line-height: 1.5;
|
|
--bs-body-color: #212529;
|
|
--bs-body-color-rgb: 33, 37, 41;
|
|
--bs-body-bg: #fff;
|
|
--bs-body-bg-rgb: 255, 255, 255;
|
|
--bs-emphasis-color: #000;
|
|
--bs-emphasis-color-rgb: 0, 0, 0;
|
|
--bs-secondary-color: rgba(33, 37, 41, 0.75);
|
|
--bs-secondary-color-rgb: 33, 37, 41;
|
|
--bs-secondary-bg: #e9ecef;
|
|
--bs-secondary-bg-rgb: 233, 236, 239;
|
|
--bs-tertiary-color: rgba(33, 37, 41, 0.5);
|
|
--bs-tertiary-color-rgb: 33, 37, 41;
|
|
--bs-tertiary-bg: #f8f9fa;
|
|
--bs-tertiary-bg-rgb: 248, 249, 250;
|
|
--bs-heading-color: inherit;
|
|
--bs-link-color: #0070f0;
|
|
--bs-link-color-rgb: 0, 112, 240;
|
|
--bs-link-decoration: underline;
|
|
--bs-link-hover-color: #005ac0;
|
|
--bs-link-hover-color-rgb: 0, 90, 192;
|
|
--bs-code-color: #d63384;
|
|
--bs-highlight-color: #212529;
|
|
--bs-highlight-bg: #fff3cd;
|
|
--bs-border-width: 1px;
|
|
--bs-border-style: solid;
|
|
--bs-border-color: rgba(var(--bs-body-color-rgb), 0.1);
|
|
--bs-border-color-translucent: rgba(0, 0, 0, 0.175);
|
|
--bs-border-radius: 0.25rem;
|
|
--bs-border-radius-sm: 0.25rem;
|
|
--bs-border-radius-lg: 0.5rem;
|
|
--bs-border-radius-xl: 1rem;
|
|
--bs-border-radius-xxl: 2rem;
|
|
--bs-border-radius-2xl: var(--bs-border-radius-xxl);
|
|
--bs-border-radius-pill: 50rem;
|
|
--bs-box-shadow: 0 0.5rem 1rem rgba(0, 0, 0, 0.15);
|
|
--bs-box-shadow-sm: 0 0.125rem 0.25rem rgba(0, 0, 0, 0.075);
|
|
--bs-box-shadow-lg: 0 1rem 3rem rgba(0, 0, 0, 0.175);
|
|
--bs-box-shadow-inset: inset 0 1px 2px rgba(0, 0, 0, 0.075);
|
|
--bs-focus-ring-width: 0.25rem;
|
|
--bs-focus-ring-opacity: 0.25;
|
|
--bs-focus-ring-color: rgba(0, 112, 240, 0.25);
|
|
--bs-form-valid-color: #198754;
|
|
--bs-form-valid-border-color: #198754;
|
|
--bs-form-invalid-color: #dc3545;
|
|
--bs-form-invalid-border-color: #dc3545;
|
|
}
|
|
|
|
[data-bs-theme=dark] {
|
|
color-scheme: dark;
|
|
--bs-body-color: #dee2e6;
|
|
--bs-body-color-rgb: 222, 226, 230;
|
|
--bs-body-bg: #212529;
|
|
--bs-body-bg-rgb: 33, 37, 41;
|
|
--bs-emphasis-color: #fff;
|
|
--bs-emphasis-color-rgb: 255, 255, 255;
|
|
--bs-secondary-color: rgba(222, 226, 230, 0.75);
|
|
--bs-secondary-color-rgb: 222, 226, 230;
|
|
--bs-secondary-bg: #343a40;
|
|
--bs-secondary-bg-rgb: 52, 58, 64;
|
|
--bs-tertiary-color: rgba(222, 226, 230, 0.5);
|
|
--bs-tertiary-color-rgb: 222, 226, 230;
|
|
--bs-tertiary-bg: #2b3035;
|
|
--bs-tertiary-bg-rgb: 43, 48, 53;
|
|
--bs-primary-text-emphasis: #66a9f6;
|
|
--bs-secondary-text-emphasis: #a7acb1;
|
|
--bs-success-text-emphasis: #75b798;
|
|
--bs-info-text-emphasis: #6edff6;
|
|
--bs-warning-text-emphasis: #ffda6a;
|
|
--bs-danger-text-emphasis: #ea868f;
|
|
--bs-light-text-emphasis: #f8f9fa;
|
|
--bs-dark-text-emphasis: #dee2e6;
|
|
--bs-primary-bg-subtle: #001630;
|
|
--bs-secondary-bg-subtle: #161719;
|
|
--bs-success-bg-subtle: #051b11;
|
|
--bs-info-bg-subtle: #032830;
|
|
--bs-warning-bg-subtle: #332701;
|
|
--bs-danger-bg-subtle: #2c0b0e;
|
|
--bs-light-bg-subtle: #343a40;
|
|
--bs-dark-bg-subtle: #1a1d20;
|
|
--bs-primary-border-subtle: #004390;
|
|
--bs-secondary-border-subtle: #41464b;
|
|
--bs-success-border-subtle: #0f5132;
|
|
--bs-info-border-subtle: #087990;
|
|
--bs-warning-border-subtle: #997404;
|
|
--bs-danger-border-subtle: #842029;
|
|
--bs-light-border-subtle: #495057;
|
|
--bs-dark-border-subtle: #343a40;
|
|
--bs-heading-color: inherit;
|
|
--bs-link-color: #66a9f6;
|
|
--bs-link-hover-color: #85baf8;
|
|
--bs-link-color-rgb: 102, 169, 246;
|
|
--bs-link-hover-color-rgb: 133, 186, 248;
|
|
--bs-code-color: #e685b5;
|
|
--bs-highlight-color: #dee2e6;
|
|
--bs-highlight-bg: #664d03;
|
|
--bs-border-color: #495057;
|
|
--bs-border-color-translucent: rgba(255, 255, 255, 0.15);
|
|
--bs-form-valid-color: #75b798;
|
|
--bs-form-valid-border-color: #75b798;
|
|
--bs-form-invalid-color: #ea868f;
|
|
--bs-form-invalid-border-color: #ea868f;
|
|
}
|
|
|
|
*,
|
|
*::before,
|
|
*::after {
|
|
box-sizing: border-box;
|
|
}
|
|
|
|
@media (prefers-reduced-motion: no-preference) {
|
|
:root {
|
|
scroll-behavior: smooth;
|
|
}
|
|
}
|
|
|
|
body {
|
|
margin: 0;
|
|
font-family: var(--bs-body-font-family);
|
|
font-size: var(--bs-body-font-size);
|
|
font-weight: var(--bs-body-font-weight);
|
|
line-height: var(--bs-body-line-height);
|
|
color: var(--bs-body-color);
|
|
text-align: var(--bs-body-text-align);
|
|
background-color: var(--bs-body-bg);
|
|
-webkit-text-size-adjust: 100%;
|
|
-webkit-tap-highlight-color: rgba(0, 0, 0, 0);
|
|
}
|
|
|
|
hr {
|
|
margin: 1rem 0;
|
|
color: inherit;
|
|
border: 0;
|
|
border-top: var(--bs-border-width) solid;
|
|
opacity: 0.25;
|
|
}
|
|
|
|
h6, .h6, h5, .h5, h4, .h4, h3, .h3, h2, .h2, h1, .h1 {
|
|
margin-top: 0;
|
|
margin-bottom: 0.5rem;
|
|
font-weight: 500;
|
|
line-height: 1.2;
|
|
color: var(--bs-heading-color);
|
|
}
|
|
|
|
h1, .h1 {
|
|
font-size: calc(1.375rem + 1.5vw);
|
|
}
|
|
@media (min-width: 1200px) {
|
|
h1, .h1 {
|
|
font-size: 2.5rem;
|
|
}
|
|
}
|
|
|
|
h2, .h2 {
|
|
font-size: calc(1.325rem + 0.9vw);
|
|
}
|
|
@media (min-width: 1200px) {
|
|
h2, .h2 {
|
|
font-size: 2rem;
|
|
}
|
|
}
|
|
|
|
h3, .h3 {
|
|
font-size: calc(1.3rem + 0.6vw);
|
|
}
|
|
@media (min-width: 1200px) {
|
|
h3, .h3 {
|
|
font-size: 1.75rem;
|
|
}
|
|
}
|
|
|
|
h4, .h4 {
|
|
font-size: calc(1.275rem + 0.3vw);
|
|
}
|
|
@media (min-width: 1200px) {
|
|
h4, .h4 {
|
|
font-size: 1.5rem;
|
|
}
|
|
}
|
|
|
|
h5, .h5 {
|
|
font-size: 1.25rem;
|
|
}
|
|
|
|
h6, .h6 {
|
|
font-size: 1rem;
|
|
}
|
|
|
|
p {
|
|
margin-top: 0;
|
|
margin-bottom: 1rem;
|
|
}
|
|
|
|
abbr[title] {
|
|
text-decoration: underline dotted;
|
|
cursor: help;
|
|
text-decoration-skip-ink: none;
|
|
}
|
|
|
|
address {
|
|
margin-bottom: 1rem;
|
|
font-style: normal;
|
|
line-height: inherit;
|
|
}
|
|
|
|
ol,
|
|
ul {
|
|
padding-left: 2rem;
|
|
}
|
|
|
|
ol,
|
|
ul,
|
|
dl {
|
|
margin-top: 0;
|
|
margin-bottom: 1rem;
|
|
}
|
|
|
|
ol ol,
|
|
ul ul,
|
|
ol ul,
|
|
ul ol {
|
|
margin-bottom: 0;
|
|
}
|
|
|
|
dt {
|
|
font-weight: 700;
|
|
}
|
|
|
|
dd {
|
|
margin-bottom: 0.5rem;
|
|
margin-left: 0;
|
|
}
|
|
|
|
blockquote {
|
|
margin: 0 0 1rem;
|
|
}
|
|
|
|
b,
|
|
strong {
|
|
font-weight: bolder;
|
|
}
|
|
|
|
small, .small {
|
|
font-size: 0.875em;
|
|
}
|
|
|
|
mark, .mark {
|
|
padding: 0.1875em;
|
|
color: var(--bs-highlight-color);
|
|
background-color: var(--bs-highlight-bg);
|
|
}
|
|
|
|
sub,
|
|
sup {
|
|
position: relative;
|
|
font-size: 0.75em;
|
|
line-height: 0;
|
|
vertical-align: baseline;
|
|
}
|
|
|
|
sub {
|
|
bottom: -0.25em;
|
|
}
|
|
|
|
sup {
|
|
top: -0.5em;
|
|
}
|
|
|
|
a {
|
|
color: rgba(var(--bs-link-color-rgb), var(--bs-link-opacity, 1));
|
|
text-decoration: underline;
|
|
}
|
|
a:hover {
|
|
--bs-link-color-rgb: var(--bs-link-hover-color-rgb);
|
|
}
|
|
|
|
a:not([href]):not([class]), a:not([href]):not([class]):hover {
|
|
color: inherit;
|
|
text-decoration: none;
|
|
}
|
|
|
|
pre,
|
|
code,
|
|
kbd,
|
|
samp {
|
|
font-family: var(--bs-font-monospace);
|
|
font-size: 1em;
|
|
}
|
|
|
|
pre {
|
|
display: block;
|
|
margin-top: 0;
|
|
margin-bottom: 1rem;
|
|
font-size: 0.875em;
|
|
}
|
|
pre code {
|
|
font-size: inherit;
|
|
color: inherit;
|
|
word-break: normal;
|
|
}
|
|
|
|
code {
|
|
font-size: 0.875em;
|
|
color: var(--bs-code-color);
|
|
word-wrap: break-word;
|
|
}
|
|
a > code {
|
|
color: inherit;
|
|
}
|
|
|
|
kbd {
|
|
padding: 0.1875rem 0.375rem;
|
|
font-size: 0.875em;
|
|
color: var(--bs-body-bg);
|
|
background-color: var(--bs-body-color);
|
|
border-radius: 0.25rem;
|
|
}
|
|
kbd kbd {
|
|
padding: 0;
|
|
font-size: 1em;
|
|
}
|
|
|
|
figure {
|
|
margin: 0 0 1rem;
|
|
}
|
|
|
|
img,
|
|
svg {
|
|
vertical-align: middle;
|
|
}
|
|
|
|
table {
|
|
caption-side: bottom;
|
|
border-collapse: collapse;
|
|
}
|
|
|
|
caption {
|
|
padding-top: 1rem;
|
|
padding-bottom: 1rem;
|
|
color: var(--bs-secondary-color);
|
|
text-align: left;
|
|
}
|
|
|
|
th {
|
|
text-align: inherit;
|
|
text-align: -webkit-match-parent;
|
|
}
|
|
|
|
thead,
|
|
tbody,
|
|
tfoot,
|
|
tr,
|
|
td,
|
|
th {
|
|
border-color: inherit;
|
|
border-style: solid;
|
|
border-width: 0;
|
|
}
|
|
|
|
label {
|
|
display: inline-block;
|
|
}
|
|
|
|
button {
|
|
border-radius: 0;
|
|
}
|
|
|
|
button:focus:not(:focus-visible) {
|
|
outline: 0;
|
|
}
|
|
|
|
input,
|
|
button,
|
|
select,
|
|
optgroup,
|
|
textarea {
|
|
margin: 0;
|
|
font-family: inherit;
|
|
font-size: inherit;
|
|
line-height: inherit;
|
|
}
|
|
|
|
button,
|
|
select {
|
|
text-transform: none;
|
|
}
|
|
|
|
[role=button] {
|
|
cursor: pointer;
|
|
}
|
|
|
|
select {
|
|
word-wrap: normal;
|
|
}
|
|
select:disabled {
|
|
opacity: 1;
|
|
}
|
|
|
|
[list]:not([type=date]):not([type=datetime-local]):not([type=month]):not([type=week]):not([type=time])::-webkit-calendar-picker-indicator {
|
|
display: none !important;
|
|
}
|
|
|
|
button,
|
|
[type=button],
|
|
[type=reset],
|
|
[type=submit] {
|
|
-webkit-appearance: button;
|
|
}
|
|
button:not(:disabled),
|
|
[type=button]:not(:disabled),
|
|
[type=reset]:not(:disabled),
|
|
[type=submit]:not(:disabled) {
|
|
cursor: pointer;
|
|
}
|
|
|
|
::-moz-focus-inner {
|
|
padding: 0;
|
|
border-style: none;
|
|
}
|
|
|
|
textarea {
|
|
resize: vertical;
|
|
}
|
|
|
|
fieldset {
|
|
min-width: 0;
|
|
padding: 0;
|
|
margin: 0;
|
|
border: 0;
|
|
}
|
|
|
|
legend {
|
|
float: left;
|
|
width: 100%;
|
|
padding: 0;
|
|
margin-bottom: 0.5rem;
|
|
font-size: calc(1.275rem + 0.3vw);
|
|
line-height: inherit;
|
|
}
|
|
@media (min-width: 1200px) {
|
|
legend {
|
|
font-size: 1.5rem;
|
|
}
|
|
}
|
|
legend + * {
|
|
clear: left;
|
|
}
|
|
|
|
::-webkit-datetime-edit-fields-wrapper,
|
|
::-webkit-datetime-edit-text,
|
|
::-webkit-datetime-edit-minute,
|
|
::-webkit-datetime-edit-hour-field,
|
|
::-webkit-datetime-edit-day-field,
|
|
::-webkit-datetime-edit-month-field,
|
|
::-webkit-datetime-edit-year-field {
|
|
padding: 0;
|
|
}
|
|
|
|
::-webkit-inner-spin-button {
|
|
height: auto;
|
|
}
|
|
|
|
[type=search] {
|
|
-webkit-appearance: textfield;
|
|
outline-offset: -2px;
|
|
}
|
|
|
|
/* rtl:raw:
|
|
[type="tel"],
|
|
[type="url"],
|
|
[type="email"],
|
|
[type="number"] {
|
|
direction: ltr;
|
|
}
|
|
*/
|
|
::-webkit-search-decoration {
|
|
-webkit-appearance: none;
|
|
}
|
|
|
|
::-webkit-color-swatch-wrapper {
|
|
padding: 0;
|
|
}
|
|
|
|
::file-selector-button {
|
|
font: inherit;
|
|
-webkit-appearance: button;
|
|
}
|
|
|
|
output {
|
|
display: inline-block;
|
|
}
|
|
|
|
iframe {
|
|
border: 0;
|
|
}
|
|
|
|
summary {
|
|
display: list-item;
|
|
cursor: pointer;
|
|
}
|
|
|
|
progress {
|
|
vertical-align: baseline;
|
|
}
|
|
|
|
[hidden] {
|
|
display: none !important;
|
|
}
|
|
|
|
.lead {
|
|
font-size: 1.25rem;
|
|
font-weight: 300;
|
|
}
|
|
|
|
.display-1 {
|
|
font-size: calc(1.625rem + 4.5vw);
|
|
font-weight: 300;
|
|
line-height: 1.2;
|
|
}
|
|
@media (min-width: 1200px) {
|
|
.display-1 {
|
|
font-size: 5rem;
|
|
}
|
|
}
|
|
|
|
.display-2 {
|
|
font-size: calc(1.575rem + 3.9vw);
|
|
font-weight: 300;
|
|
line-height: 1.2;
|
|
}
|
|
@media (min-width: 1200px) {
|
|
.display-2 {
|
|
font-size: 4.5rem;
|
|
}
|
|
}
|
|
|
|
.display-3 {
|
|
font-size: calc(1.525rem + 3.3vw);
|
|
font-weight: 300;
|
|
line-height: 1.2;
|
|
}
|
|
@media (min-width: 1200px) {
|
|
.display-3 {
|
|
font-size: 4rem;
|
|
}
|
|
}
|
|
|
|
.display-4 {
|
|
font-size: calc(1.475rem + 2.7vw);
|
|
font-weight: 300;
|
|
line-height: 1.2;
|
|
}
|
|
@media (min-width: 1200px) {
|
|
.display-4 {
|
|
font-size: 3.5rem;
|
|
}
|
|
}
|
|
|
|
.display-5 {
|
|
font-size: calc(1.425rem + 2.1vw);
|
|
font-weight: 300;
|
|
line-height: 1.2;
|
|
}
|
|
@media (min-width: 1200px) {
|
|
.display-5 {
|
|
font-size: 3rem;
|
|
}
|
|
}
|
|
|
|
.display-6 {
|
|
font-size: calc(1.375rem + 1.5vw);
|
|
font-weight: 300;
|
|
line-height: 1.2;
|
|
}
|
|
@media (min-width: 1200px) {
|
|
.display-6 {
|
|
font-size: 2.5rem;
|
|
}
|
|
}
|
|
|
|
.list-unstyled {
|
|
padding-left: 0;
|
|
list-style: none;
|
|
}
|
|
|
|
.list-inline {
|
|
padding-left: 0;
|
|
list-style: none;
|
|
}
|
|
|
|
.list-inline-item {
|
|
display: inline-block;
|
|
}
|
|
.list-inline-item:not(:last-child) {
|
|
margin-right: 0.5rem;
|
|
}
|
|
|
|
.initialism {
|
|
font-size: 0.875em;
|
|
text-transform: uppercase;
|
|
}
|
|
|
|
.blockquote {
|
|
margin-bottom: 1rem;
|
|
font-size: 1.25rem;
|
|
}
|
|
.blockquote > :last-child {
|
|
margin-bottom: 0;
|
|
}
|
|
|
|
.blockquote-footer {
|
|
margin-top: -1rem;
|
|
margin-bottom: 1rem;
|
|
font-size: 0.875em;
|
|
color: #6c757d;
|
|
}
|
|
.blockquote-footer::before {
|
|
content: "— ";
|
|
}
|
|
|
|
.img-fluid {
|
|
max-width: 100%;
|
|
height: auto;
|
|
}
|
|
|
|
.img-thumbnail {
|
|
padding: 0.25rem;
|
|
background-color: var(--bs-body-bg);
|
|
border: var(--bs-border-width) solid var(--bs-border-color);
|
|
border-radius: var(--bs-border-radius);
|
|
max-width: 100%;
|
|
height: auto;
|
|
}
|
|
|
|
.figure {
|
|
display: inline-block;
|
|
}
|
|
|
|
.figure-img {
|
|
margin-bottom: 0.5rem;
|
|
line-height: 1;
|
|
}
|
|
|
|
.figure-caption {
|
|
font-size: 0.875em;
|
|
color: var(--bs-secondary-color);
|
|
}
|
|
|
|
.container,
|
|
.container-fluid,
|
|
.container-xxl,
|
|
.container-xl,
|
|
.container-lg,
|
|
.container-md,
|
|
.container-sm {
|
|
--bs-gutter-x: 1.5rem;
|
|
--bs-gutter-y: 0;
|
|
width: 100%;
|
|
padding-right: calc(var(--bs-gutter-x) * 0.5);
|
|
padding-left: calc(var(--bs-gutter-x) * 0.5);
|
|
margin-right: auto;
|
|
margin-left: auto;
|
|
}
|
|
|
|
@media (min-width: 576px) {
|
|
.container-sm, .container {
|
|
max-width: 540px;
|
|
}
|
|
}
|
|
@media (min-width: 768px) {
|
|
.container-md, .container-sm, .container {
|
|
max-width: 720px;
|
|
}
|
|
}
|
|
@media (min-width: 992px) {
|
|
.container-lg, .container-md, .container-sm, .container {
|
|
max-width: 960px;
|
|
}
|
|
}
|
|
@media (min-width: 1200px) {
|
|
.container-xl, .container-lg, .container-md, .container-sm, .container {
|
|
max-width: 1140px;
|
|
}
|
|
}
|
|
@media (min-width: 1400px) {
|
|
.container-xxl, .container-xl, .container-lg, .container-md, .container-sm, .container {
|
|
max-width: 1320px;
|
|
}
|
|
}
|
|
:root {
|
|
--bs-breakpoint-xs: 0;
|
|
--bs-breakpoint-sm: 576px;
|
|
--bs-breakpoint-md: 768px;
|
|
--bs-breakpoint-lg: 992px;
|
|
--bs-breakpoint-xl: 1200px;
|
|
--bs-breakpoint-xxl: 1400px;
|
|
}
|
|
|
|
.row {
|
|
--bs-gutter-x: 1.5rem;
|
|
--bs-gutter-y: 0;
|
|
display: flex;
|
|
flex-wrap: wrap;
|
|
margin-top: calc(-1 * var(--bs-gutter-y));
|
|
margin-right: calc(-0.5 * var(--bs-gutter-x));
|
|
margin-left: calc(-0.5 * var(--bs-gutter-x));
|
|
}
|
|
.row > * {
|
|
flex-shrink: 0;
|
|
width: 100%;
|
|
max-width: 100%;
|
|
padding-right: calc(var(--bs-gutter-x) * 0.5);
|
|
padding-left: calc(var(--bs-gutter-x) * 0.5);
|
|
margin-top: var(--bs-gutter-y);
|
|
}
|
|
|
|
.col {
|
|
flex: 1 0 0%;
|
|
}
|
|
|
|
.row-cols-auto > * {
|
|
flex: 0 0 auto;
|
|
width: auto;
|
|
}
|
|
|
|
.row-cols-1 > * {
|
|
flex: 0 0 auto;
|
|
width: 100%;
|
|
}
|
|
|
|
.row-cols-2 > * {
|
|
flex: 0 0 auto;
|
|
width: 50%;
|
|
}
|
|
|
|
.row-cols-3 > * {
|
|
flex: 0 0 auto;
|
|
width: 33.33333333%;
|
|
}
|
|
|
|
.row-cols-4 > * {
|
|
flex: 0 0 auto;
|
|
width: 25%;
|
|
}
|
|
|
|
.row-cols-5 > * {
|
|
flex: 0 0 auto;
|
|
width: 20%;
|
|
}
|
|
|
|
.row-cols-6 > * {
|
|
flex: 0 0 auto;
|
|
width: 16.66666667%;
|
|
}
|
|
|
|
.col-auto {
|
|
flex: 0 0 auto;
|
|
width: auto;
|
|
}
|
|
|
|
.col-1 {
|
|
flex: 0 0 auto;
|
|
width: 8.33333333%;
|
|
}
|
|
|
|
.col-2 {
|
|
flex: 0 0 auto;
|
|
width: 16.66666667%;
|
|
}
|
|
|
|
.col-3 {
|
|
flex: 0 0 auto;
|
|
width: 25%;
|
|
}
|
|
|
|
.col-4 {
|
|
flex: 0 0 auto;
|
|
width: 33.33333333%;
|
|
}
|
|
|
|
.col-5 {
|
|
flex: 0 0 auto;
|
|
width: 41.66666667%;
|
|
}
|
|
|
|
.col-6 {
|
|
flex: 0 0 auto;
|
|
width: 50%;
|
|
}
|
|
|
|
.col-7 {
|
|
flex: 0 0 auto;
|
|
width: 58.33333333%;
|
|
}
|
|
|
|
.col-8 {
|
|
flex: 0 0 auto;
|
|
width: 66.66666667%;
|
|
}
|
|
|
|
.col-9 {
|
|
flex: 0 0 auto;
|
|
width: 75%;
|
|
}
|
|
|
|
.col-10 {
|
|
flex: 0 0 auto;
|
|
width: 83.33333333%;
|
|
}
|
|
|
|
.col-11 {
|
|
flex: 0 0 auto;
|
|
width: 91.66666667%;
|
|
}
|
|
|
|
.col-12 {
|
|
flex: 0 0 auto;
|
|
width: 100%;
|
|
}
|
|
|
|
.offset-1 {
|
|
margin-left: 8.33333333%;
|
|
}
|
|
|
|
.offset-2 {
|
|
margin-left: 16.66666667%;
|
|
}
|
|
|
|
.offset-3 {
|
|
margin-left: 25%;
|
|
}
|
|
|
|
.offset-4 {
|
|
margin-left: 33.33333333%;
|
|
}
|
|
|
|
.offset-5 {
|
|
margin-left: 41.66666667%;
|
|
}
|
|
|
|
.offset-6 {
|
|
margin-left: 50%;
|
|
}
|
|
|
|
.offset-7 {
|
|
margin-left: 58.33333333%;
|
|
}
|
|
|
|
.offset-8 {
|
|
margin-left: 66.66666667%;
|
|
}
|
|
|
|
.offset-9 {
|
|
margin-left: 75%;
|
|
}
|
|
|
|
.offset-10 {
|
|
margin-left: 83.33333333%;
|
|
}
|
|
|
|
.offset-11 {
|
|
margin-left: 91.66666667%;
|
|
}
|
|
|
|
.g-0,
|
|
.gx-0 {
|
|
--bs-gutter-x: 0;
|
|
}
|
|
|
|
.g-0,
|
|
.gy-0 {
|
|
--bs-gutter-y: 0;
|
|
}
|
|
|
|
.g-1,
|
|
.gx-1 {
|
|
--bs-gutter-x: 0.25rem;
|
|
}
|
|
|
|
.g-1,
|
|
.gy-1 {
|
|
--bs-gutter-y: 0.25rem;
|
|
}
|
|
|
|
.g-2,
|
|
.gx-2 {
|
|
--bs-gutter-x: 0.5rem;
|
|
}
|
|
|
|
.g-2,
|
|
.gy-2 {
|
|
--bs-gutter-y: 0.5rem;
|
|
}
|
|
|
|
.g-3,
|
|
.gx-3 {
|
|
--bs-gutter-x: 1rem;
|
|
}
|
|
|
|
.g-3,
|
|
.gy-3 {
|
|
--bs-gutter-y: 1rem;
|
|
}
|
|
|
|
.g-4,
|
|
.gx-4 {
|
|
--bs-gutter-x: 1.5rem;
|
|
}
|
|
|
|
.g-4,
|
|
.gy-4 {
|
|
--bs-gutter-y: 1.5rem;
|
|
}
|
|
|
|
.g-5,
|
|
.gx-5 {
|
|
--bs-gutter-x: 3rem;
|
|
}
|
|
|
|
.g-5,
|
|
.gy-5 {
|
|
--bs-gutter-y: 3rem;
|
|
}
|
|
|
|
@media (min-width: 576px) {
|
|
.col-sm {
|
|
flex: 1 0 0%;
|
|
}
|
|
.row-cols-sm-auto > * {
|
|
flex: 0 0 auto;
|
|
width: auto;
|
|
}
|
|
.row-cols-sm-1 > * {
|
|
flex: 0 0 auto;
|
|
width: 100%;
|
|
}
|
|
.row-cols-sm-2 > * {
|
|
flex: 0 0 auto;
|
|
width: 50%;
|
|
}
|
|
.row-cols-sm-3 > * {
|
|
flex: 0 0 auto;
|
|
width: 33.33333333%;
|
|
}
|
|
.row-cols-sm-4 > * {
|
|
flex: 0 0 auto;
|
|
width: 25%;
|
|
}
|
|
.row-cols-sm-5 > * {
|
|
flex: 0 0 auto;
|
|
width: 20%;
|
|
}
|
|
.row-cols-sm-6 > * {
|
|
flex: 0 0 auto;
|
|
width: 16.66666667%;
|
|
}
|
|
.col-sm-auto {
|
|
flex: 0 0 auto;
|
|
width: auto;
|
|
}
|
|
.col-sm-1 {
|
|
flex: 0 0 auto;
|
|
width: 8.33333333%;
|
|
}
|
|
.col-sm-2 {
|
|
flex: 0 0 auto;
|
|
width: 16.66666667%;
|
|
}
|
|
.col-sm-3 {
|
|
flex: 0 0 auto;
|
|
width: 25%;
|
|
}
|
|
.col-sm-4 {
|
|
flex: 0 0 auto;
|
|
width: 33.33333333%;
|
|
}
|
|
.col-sm-5 {
|
|
flex: 0 0 auto;
|
|
width: 41.66666667%;
|
|
}
|
|
.col-sm-6 {
|
|
flex: 0 0 auto;
|
|
width: 50%;
|
|
}
|
|
.col-sm-7 {
|
|
flex: 0 0 auto;
|
|
width: 58.33333333%;
|
|
}
|
|
.col-sm-8 {
|
|
flex: 0 0 auto;
|
|
width: 66.66666667%;
|
|
}
|
|
.col-sm-9 {
|
|
flex: 0 0 auto;
|
|
width: 75%;
|
|
}
|
|
.col-sm-10 {
|
|
flex: 0 0 auto;
|
|
width: 83.33333333%;
|
|
}
|
|
.col-sm-11 {
|
|
flex: 0 0 auto;
|
|
width: 91.66666667%;
|
|
}
|
|
.col-sm-12 {
|
|
flex: 0 0 auto;
|
|
width: 100%;
|
|
}
|
|
.offset-sm-0 {
|
|
margin-left: 0;
|
|
}
|
|
.offset-sm-1 {
|
|
margin-left: 8.33333333%;
|
|
}
|
|
.offset-sm-2 {
|
|
margin-left: 16.66666667%;
|
|
}
|
|
.offset-sm-3 {
|
|
margin-left: 25%;
|
|
}
|
|
.offset-sm-4 {
|
|
margin-left: 33.33333333%;
|
|
}
|
|
.offset-sm-5 {
|
|
margin-left: 41.66666667%;
|
|
}
|
|
.offset-sm-6 {
|
|
margin-left: 50%;
|
|
}
|
|
.offset-sm-7 {
|
|
margin-left: 58.33333333%;
|
|
}
|
|
.offset-sm-8 {
|
|
margin-left: 66.66666667%;
|
|
}
|
|
.offset-sm-9 {
|
|
margin-left: 75%;
|
|
}
|
|
.offset-sm-10 {
|
|
margin-left: 83.33333333%;
|
|
}
|
|
.offset-sm-11 {
|
|
margin-left: 91.66666667%;
|
|
}
|
|
.g-sm-0,
|
|
.gx-sm-0 {
|
|
--bs-gutter-x: 0;
|
|
}
|
|
.g-sm-0,
|
|
.gy-sm-0 {
|
|
--bs-gutter-y: 0;
|
|
}
|
|
.g-sm-1,
|
|
.gx-sm-1 {
|
|
--bs-gutter-x: 0.25rem;
|
|
}
|
|
.g-sm-1,
|
|
.gy-sm-1 {
|
|
--bs-gutter-y: 0.25rem;
|
|
}
|
|
.g-sm-2,
|
|
.gx-sm-2 {
|
|
--bs-gutter-x: 0.5rem;
|
|
}
|
|
.g-sm-2,
|
|
.gy-sm-2 {
|
|
--bs-gutter-y: 0.5rem;
|
|
}
|
|
.g-sm-3,
|
|
.gx-sm-3 {
|
|
--bs-gutter-x: 1rem;
|
|
}
|
|
.g-sm-3,
|
|
.gy-sm-3 {
|
|
--bs-gutter-y: 1rem;
|
|
}
|
|
.g-sm-4,
|
|
.gx-sm-4 {
|
|
--bs-gutter-x: 1.5rem;
|
|
}
|
|
.g-sm-4,
|
|
.gy-sm-4 {
|
|
--bs-gutter-y: 1.5rem;
|
|
}
|
|
.g-sm-5,
|
|
.gx-sm-5 {
|
|
--bs-gutter-x: 3rem;
|
|
}
|
|
.g-sm-5,
|
|
.gy-sm-5 {
|
|
--bs-gutter-y: 3rem;
|
|
}
|
|
}
|
|
@media (min-width: 768px) {
|
|
.col-md {
|
|
flex: 1 0 0%;
|
|
}
|
|
.row-cols-md-auto > * {
|
|
flex: 0 0 auto;
|
|
width: auto;
|
|
}
|
|
.row-cols-md-1 > * {
|
|
flex: 0 0 auto;
|
|
width: 100%;
|
|
}
|
|
.row-cols-md-2 > * {
|
|
flex: 0 0 auto;
|
|
width: 50%;
|
|
}
|
|
.row-cols-md-3 > * {
|
|
flex: 0 0 auto;
|
|
width: 33.33333333%;
|
|
}
|
|
.row-cols-md-4 > * {
|
|
flex: 0 0 auto;
|
|
width: 25%;
|
|
}
|
|
.row-cols-md-5 > * {
|
|
flex: 0 0 auto;
|
|
width: 20%;
|
|
}
|
|
.row-cols-md-6 > * {
|
|
flex: 0 0 auto;
|
|
width: 16.66666667%;
|
|
}
|
|
.col-md-auto {
|
|
flex: 0 0 auto;
|
|
width: auto;
|
|
}
|
|
.col-md-1 {
|
|
flex: 0 0 auto;
|
|
width: 8.33333333%;
|
|
}
|
|
.col-md-2 {
|
|
flex: 0 0 auto;
|
|
width: 16.66666667%;
|
|
}
|
|
.col-md-3 {
|
|
flex: 0 0 auto;
|
|
width: 25%;
|
|
}
|
|
.col-md-4 {
|
|
flex: 0 0 auto;
|
|
width: 33.33333333%;
|
|
}
|
|
.col-md-5 {
|
|
flex: 0 0 auto;
|
|
width: 41.66666667%;
|
|
}
|
|
.col-md-6 {
|
|
flex: 0 0 auto;
|
|
width: 50%;
|
|
}
|
|
.col-md-7 {
|
|
flex: 0 0 auto;
|
|
width: 58.33333333%;
|
|
}
|
|
.col-md-8 {
|
|
flex: 0 0 auto;
|
|
width: 66.66666667%;
|
|
}
|
|
.col-md-9 {
|
|
flex: 0 0 auto;
|
|
width: 75%;
|
|
}
|
|
.col-md-10 {
|
|
flex: 0 0 auto;
|
|
width: 83.33333333%;
|
|
}
|
|
.col-md-11 {
|
|
flex: 0 0 auto;
|
|
width: 91.66666667%;
|
|
}
|
|
.col-md-12 {
|
|
flex: 0 0 auto;
|
|
width: 100%;
|
|
}
|
|
.offset-md-0 {
|
|
margin-left: 0;
|
|
}
|
|
.offset-md-1 {
|
|
margin-left: 8.33333333%;
|
|
}
|
|
.offset-md-2 {
|
|
margin-left: 16.66666667%;
|
|
}
|
|
.offset-md-3 {
|
|
margin-left: 25%;
|
|
}
|
|
.offset-md-4 {
|
|
margin-left: 33.33333333%;
|
|
}
|
|
.offset-md-5 {
|
|
margin-left: 41.66666667%;
|
|
}
|
|
.offset-md-6 {
|
|
margin-left: 50%;
|
|
}
|
|
.offset-md-7 {
|
|
margin-left: 58.33333333%;
|
|
}
|
|
.offset-md-8 {
|
|
margin-left: 66.66666667%;
|
|
}
|
|
.offset-md-9 {
|
|
margin-left: 75%;
|
|
}
|
|
.offset-md-10 {
|
|
margin-left: 83.33333333%;
|
|
}
|
|
.offset-md-11 {
|
|
margin-left: 91.66666667%;
|
|
}
|
|
.g-md-0,
|
|
.gx-md-0 {
|
|
--bs-gutter-x: 0;
|
|
}
|
|
.g-md-0,
|
|
.gy-md-0 {
|
|
--bs-gutter-y: 0;
|
|
}
|
|
.g-md-1,
|
|
.gx-md-1 {
|
|
--bs-gutter-x: 0.25rem;
|
|
}
|
|
.g-md-1,
|
|
.gy-md-1 {
|
|
--bs-gutter-y: 0.25rem;
|
|
}
|
|
.g-md-2,
|
|
.gx-md-2 {
|
|
--bs-gutter-x: 0.5rem;
|
|
}
|
|
.g-md-2,
|
|
.gy-md-2 {
|
|
--bs-gutter-y: 0.5rem;
|
|
}
|
|
.g-md-3,
|
|
.gx-md-3 {
|
|
--bs-gutter-x: 1rem;
|
|
}
|
|
.g-md-3,
|
|
.gy-md-3 {
|
|
--bs-gutter-y: 1rem;
|
|
}
|
|
.g-md-4,
|
|
.gx-md-4 {
|
|
--bs-gutter-x: 1.5rem;
|
|
}
|
|
.g-md-4,
|
|
.gy-md-4 {
|
|
--bs-gutter-y: 1.5rem;
|
|
}
|
|
.g-md-5,
|
|
.gx-md-5 {
|
|
--bs-gutter-x: 3rem;
|
|
}
|
|
.g-md-5,
|
|
.gy-md-5 {
|
|
--bs-gutter-y: 3rem;
|
|
}
|
|
}
|
|
@media (min-width: 992px) {
|
|
.col-lg {
|
|
flex: 1 0 0%;
|
|
}
|
|
.row-cols-lg-auto > * {
|
|
flex: 0 0 auto;
|
|
width: auto;
|
|
}
|
|
.row-cols-lg-1 > * {
|
|
flex: 0 0 auto;
|
|
width: 100%;
|
|
}
|
|
.row-cols-lg-2 > * {
|
|
flex: 0 0 auto;
|
|
width: 50%;
|
|
}
|
|
.row-cols-lg-3 > * {
|
|
flex: 0 0 auto;
|
|
width: 33.33333333%;
|
|
}
|
|
.row-cols-lg-4 > * {
|
|
flex: 0 0 auto;
|
|
width: 25%;
|
|
}
|
|
.row-cols-lg-5 > * {
|
|
flex: 0 0 auto;
|
|
width: 20%;
|
|
}
|
|
.row-cols-lg-6 > * {
|
|
flex: 0 0 auto;
|
|
width: 16.66666667%;
|
|
}
|
|
.col-lg-auto {
|
|
flex: 0 0 auto;
|
|
width: auto;
|
|
}
|
|
.col-lg-1 {
|
|
flex: 0 0 auto;
|
|
width: 8.33333333%;
|
|
}
|
|
.col-lg-2 {
|
|
flex: 0 0 auto;
|
|
width: 16.66666667%;
|
|
}
|
|
.col-lg-3 {
|
|
flex: 0 0 auto;
|
|
width: 25%;
|
|
}
|
|
.col-lg-4 {
|
|
flex: 0 0 auto;
|
|
width: 33.33333333%;
|
|
}
|
|
.col-lg-5 {
|
|
flex: 0 0 auto;
|
|
width: 41.66666667%;
|
|
}
|
|
.col-lg-6 {
|
|
flex: 0 0 auto;
|
|
width: 50%;
|
|
}
|
|
.col-lg-7 {
|
|
flex: 0 0 auto;
|
|
width: 58.33333333%;
|
|
}
|
|
.col-lg-8 {
|
|
flex: 0 0 auto;
|
|
width: 66.66666667%;
|
|
}
|
|
.col-lg-9 {
|
|
flex: 0 0 auto;
|
|
width: 75%;
|
|
}
|
|
.col-lg-10 {
|
|
flex: 0 0 auto;
|
|
width: 83.33333333%;
|
|
}
|
|
.col-lg-11 {
|
|
flex: 0 0 auto;
|
|
width: 91.66666667%;
|
|
}
|
|
.col-lg-12 {
|
|
flex: 0 0 auto;
|
|
width: 100%;
|
|
}
|
|
.offset-lg-0 {
|
|
margin-left: 0;
|
|
}
|
|
.offset-lg-1 {
|
|
margin-left: 8.33333333%;
|
|
}
|
|
.offset-lg-2 {
|
|
margin-left: 16.66666667%;
|
|
}
|
|
.offset-lg-3 {
|
|
margin-left: 25%;
|
|
}
|
|
.offset-lg-4 {
|
|
margin-left: 33.33333333%;
|
|
}
|
|
.offset-lg-5 {
|
|
margin-left: 41.66666667%;
|
|
}
|
|
.offset-lg-6 {
|
|
margin-left: 50%;
|
|
}
|
|
.offset-lg-7 {
|
|
margin-left: 58.33333333%;
|
|
}
|
|
.offset-lg-8 {
|
|
margin-left: 66.66666667%;
|
|
}
|
|
.offset-lg-9 {
|
|
margin-left: 75%;
|
|
}
|
|
.offset-lg-10 {
|
|
margin-left: 83.33333333%;
|
|
}
|
|
.offset-lg-11 {
|
|
margin-left: 91.66666667%;
|
|
}
|
|
.g-lg-0,
|
|
.gx-lg-0 {
|
|
--bs-gutter-x: 0;
|
|
}
|
|
.g-lg-0,
|
|
.gy-lg-0 {
|
|
--bs-gutter-y: 0;
|
|
}
|
|
.g-lg-1,
|
|
.gx-lg-1 {
|
|
--bs-gutter-x: 0.25rem;
|
|
}
|
|
.g-lg-1,
|
|
.gy-lg-1 {
|
|
--bs-gutter-y: 0.25rem;
|
|
}
|
|
.g-lg-2,
|
|
.gx-lg-2 {
|
|
--bs-gutter-x: 0.5rem;
|
|
}
|
|
.g-lg-2,
|
|
.gy-lg-2 {
|
|
--bs-gutter-y: 0.5rem;
|
|
}
|
|
.g-lg-3,
|
|
.gx-lg-3 {
|
|
--bs-gutter-x: 1rem;
|
|
}
|
|
.g-lg-3,
|
|
.gy-lg-3 {
|
|
--bs-gutter-y: 1rem;
|
|
}
|
|
.g-lg-4,
|
|
.gx-lg-4 {
|
|
--bs-gutter-x: 1.5rem;
|
|
}
|
|
.g-lg-4,
|
|
.gy-lg-4 {
|
|
--bs-gutter-y: 1.5rem;
|
|
}
|
|
.g-lg-5,
|
|
.gx-lg-5 {
|
|
--bs-gutter-x: 3rem;
|
|
}
|
|
.g-lg-5,
|
|
.gy-lg-5 {
|
|
--bs-gutter-y: 3rem;
|
|
}
|
|
}
|
|
@media (min-width: 1200px) {
|
|
.col-xl {
|
|
flex: 1 0 0%;
|
|
}
|
|
.row-cols-xl-auto > * {
|
|
flex: 0 0 auto;
|
|
width: auto;
|
|
}
|
|
.row-cols-xl-1 > * {
|
|
flex: 0 0 auto;
|
|
width: 100%;
|
|
}
|
|
.row-cols-xl-2 > * {
|
|
flex: 0 0 auto;
|
|
width: 50%;
|
|
}
|
|
.row-cols-xl-3 > * {
|
|
flex: 0 0 auto;
|
|
width: 33.33333333%;
|
|
}
|
|
.row-cols-xl-4 > * {
|
|
flex: 0 0 auto;
|
|
width: 25%;
|
|
}
|
|
.row-cols-xl-5 > * {
|
|
flex: 0 0 auto;
|
|
width: 20%;
|
|
}
|
|
.row-cols-xl-6 > * {
|
|
flex: 0 0 auto;
|
|
width: 16.66666667%;
|
|
}
|
|
.col-xl-auto {
|
|
flex: 0 0 auto;
|
|
width: auto;
|
|
}
|
|
.col-xl-1 {
|
|
flex: 0 0 auto;
|
|
width: 8.33333333%;
|
|
}
|
|
.col-xl-2 {
|
|
flex: 0 0 auto;
|
|
width: 16.66666667%;
|
|
}
|
|
.col-xl-3 {
|
|
flex: 0 0 auto;
|
|
width: 25%;
|
|
}
|
|
.col-xl-4 {
|
|
flex: 0 0 auto;
|
|
width: 33.33333333%;
|
|
}
|
|
.col-xl-5 {
|
|
flex: 0 0 auto;
|
|
width: 41.66666667%;
|
|
}
|
|
.col-xl-6 {
|
|
flex: 0 0 auto;
|
|
width: 50%;
|
|
}
|
|
.col-xl-7 {
|
|
flex: 0 0 auto;
|
|
width: 58.33333333%;
|
|
}
|
|
.col-xl-8 {
|
|
flex: 0 0 auto;
|
|
width: 66.66666667%;
|
|
}
|
|
.col-xl-9 {
|
|
flex: 0 0 auto;
|
|
width: 75%;
|
|
}
|
|
.col-xl-10 {
|
|
flex: 0 0 auto;
|
|
width: 83.33333333%;
|
|
}
|
|
.col-xl-11 {
|
|
flex: 0 0 auto;
|
|
width: 91.66666667%;
|
|
}
|
|
.col-xl-12 {
|
|
flex: 0 0 auto;
|
|
width: 100%;
|
|
}
|
|
.offset-xl-0 {
|
|
margin-left: 0;
|
|
}
|
|
.offset-xl-1 {
|
|
margin-left: 8.33333333%;
|
|
}
|
|
.offset-xl-2 {
|
|
margin-left: 16.66666667%;
|
|
}
|
|
.offset-xl-3 {
|
|
margin-left: 25%;
|
|
}
|
|
.offset-xl-4 {
|
|
margin-left: 33.33333333%;
|
|
}
|
|
.offset-xl-5 {
|
|
margin-left: 41.66666667%;
|
|
}
|
|
.offset-xl-6 {
|
|
margin-left: 50%;
|
|
}
|
|
.offset-xl-7 {
|
|
margin-left: 58.33333333%;
|
|
}
|
|
.offset-xl-8 {
|
|
margin-left: 66.66666667%;
|
|
}
|
|
.offset-xl-9 {
|
|
margin-left: 75%;
|
|
}
|
|
.offset-xl-10 {
|
|
margin-left: 83.33333333%;
|
|
}
|
|
.offset-xl-11 {
|
|
margin-left: 91.66666667%;
|
|
}
|
|
.g-xl-0,
|
|
.gx-xl-0 {
|
|
--bs-gutter-x: 0;
|
|
}
|
|
.g-xl-0,
|
|
.gy-xl-0 {
|
|
--bs-gutter-y: 0;
|
|
}
|
|
.g-xl-1,
|
|
.gx-xl-1 {
|
|
--bs-gutter-x: 0.25rem;
|
|
}
|
|
.g-xl-1,
|
|
.gy-xl-1 {
|
|
--bs-gutter-y: 0.25rem;
|
|
}
|
|
.g-xl-2,
|
|
.gx-xl-2 {
|
|
--bs-gutter-x: 0.5rem;
|
|
}
|
|
.g-xl-2,
|
|
.gy-xl-2 {
|
|
--bs-gutter-y: 0.5rem;
|
|
}
|
|
.g-xl-3,
|
|
.gx-xl-3 {
|
|
--bs-gutter-x: 1rem;
|
|
}
|
|
.g-xl-3,
|
|
.gy-xl-3 {
|
|
--bs-gutter-y: 1rem;
|
|
}
|
|
.g-xl-4,
|
|
.gx-xl-4 {
|
|
--bs-gutter-x: 1.5rem;
|
|
}
|
|
.g-xl-4,
|
|
.gy-xl-4 {
|
|
--bs-gutter-y: 1.5rem;
|
|
}
|
|
.g-xl-5,
|
|
.gx-xl-5 {
|
|
--bs-gutter-x: 3rem;
|
|
}
|
|
.g-xl-5,
|
|
.gy-xl-5 {
|
|
--bs-gutter-y: 3rem;
|
|
}
|
|
}
|
|
@media (min-width: 1400px) {
|
|
.col-xxl {
|
|
flex: 1 0 0%;
|
|
}
|
|
.row-cols-xxl-auto > * {
|
|
flex: 0 0 auto;
|
|
width: auto;
|
|
}
|
|
.row-cols-xxl-1 > * {
|
|
flex: 0 0 auto;
|
|
width: 100%;
|
|
}
|
|
.row-cols-xxl-2 > * {
|
|
flex: 0 0 auto;
|
|
width: 50%;
|
|
}
|
|
.row-cols-xxl-3 > * {
|
|
flex: 0 0 auto;
|
|
width: 33.33333333%;
|
|
}
|
|
.row-cols-xxl-4 > * {
|
|
flex: 0 0 auto;
|
|
width: 25%;
|
|
}
|
|
.row-cols-xxl-5 > * {
|
|
flex: 0 0 auto;
|
|
width: 20%;
|
|
}
|
|
.row-cols-xxl-6 > * {
|
|
flex: 0 0 auto;
|
|
width: 16.66666667%;
|
|
}
|
|
.col-xxl-auto {
|
|
flex: 0 0 auto;
|
|
width: auto;
|
|
}
|
|
.col-xxl-1 {
|
|
flex: 0 0 auto;
|
|
width: 8.33333333%;
|
|
}
|
|
.col-xxl-2 {
|
|
flex: 0 0 auto;
|
|
width: 16.66666667%;
|
|
}
|
|
.col-xxl-3 {
|
|
flex: 0 0 auto;
|
|
width: 25%;
|
|
}
|
|
.col-xxl-4 {
|
|
flex: 0 0 auto;
|
|
width: 33.33333333%;
|
|
}
|
|
.col-xxl-5 {
|
|
flex: 0 0 auto;
|
|
width: 41.66666667%;
|
|
}
|
|
.col-xxl-6 {
|
|
flex: 0 0 auto;
|
|
width: 50%;
|
|
}
|
|
.col-xxl-7 {
|
|
flex: 0 0 auto;
|
|
width: 58.33333333%;
|
|
}
|
|
.col-xxl-8 {
|
|
flex: 0 0 auto;
|
|
width: 66.66666667%;
|
|
}
|
|
.col-xxl-9 {
|
|
flex: 0 0 auto;
|
|
width: 75%;
|
|
}
|
|
.col-xxl-10 {
|
|
flex: 0 0 auto;
|
|
width: 83.33333333%;
|
|
}
|
|
.col-xxl-11 {
|
|
flex: 0 0 auto;
|
|
width: 91.66666667%;
|
|
}
|
|
.col-xxl-12 {
|
|
flex: 0 0 auto;
|
|
width: 100%;
|
|
}
|
|
.offset-xxl-0 {
|
|
margin-left: 0;
|
|
}
|
|
.offset-xxl-1 {
|
|
margin-left: 8.33333333%;
|
|
}
|
|
.offset-xxl-2 {
|
|
margin-left: 16.66666667%;
|
|
}
|
|
.offset-xxl-3 {
|
|
margin-left: 25%;
|
|
}
|
|
.offset-xxl-4 {
|
|
margin-left: 33.33333333%;
|
|
}
|
|
.offset-xxl-5 {
|
|
margin-left: 41.66666667%;
|
|
}
|
|
.offset-xxl-6 {
|
|
margin-left: 50%;
|
|
}
|
|
.offset-xxl-7 {
|
|
margin-left: 58.33333333%;
|
|
}
|
|
.offset-xxl-8 {
|
|
margin-left: 66.66666667%;
|
|
}
|
|
.offset-xxl-9 {
|
|
margin-left: 75%;
|
|
}
|
|
.offset-xxl-10 {
|
|
margin-left: 83.33333333%;
|
|
}
|
|
.offset-xxl-11 {
|
|
margin-left: 91.66666667%;
|
|
}
|
|
.g-xxl-0,
|
|
.gx-xxl-0 {
|
|
--bs-gutter-x: 0;
|
|
}
|
|
.g-xxl-0,
|
|
.gy-xxl-0 {
|
|
--bs-gutter-y: 0;
|
|
}
|
|
.g-xxl-1,
|
|
.gx-xxl-1 {
|
|
--bs-gutter-x: 0.25rem;
|
|
}
|
|
.g-xxl-1,
|
|
.gy-xxl-1 {
|
|
--bs-gutter-y: 0.25rem;
|
|
}
|
|
.g-xxl-2,
|
|
.gx-xxl-2 {
|
|
--bs-gutter-x: 0.5rem;
|
|
}
|
|
.g-xxl-2,
|
|
.gy-xxl-2 {
|
|
--bs-gutter-y: 0.5rem;
|
|
}
|
|
.g-xxl-3,
|
|
.gx-xxl-3 {
|
|
--bs-gutter-x: 1rem;
|
|
}
|
|
.g-xxl-3,
|
|
.gy-xxl-3 {
|
|
--bs-gutter-y: 1rem;
|
|
}
|
|
.g-xxl-4,
|
|
.gx-xxl-4 {
|
|
--bs-gutter-x: 1.5rem;
|
|
}
|
|
.g-xxl-4,
|
|
.gy-xxl-4 {
|
|
--bs-gutter-y: 1.5rem;
|
|
}
|
|
.g-xxl-5,
|
|
.gx-xxl-5 {
|
|
--bs-gutter-x: 3rem;
|
|
}
|
|
.g-xxl-5,
|
|
.gy-xxl-5 {
|
|
--bs-gutter-y: 3rem;
|
|
}
|
|
}
|
|
.table {
|
|
--bs-table-color-type: initial;
|
|
--bs-table-bg-type: initial;
|
|
--bs-table-color-state: initial;
|
|
--bs-table-bg-state: initial;
|
|
--bs-table-color: var(--bs-emphasis-color);
|
|
--bs-table-bg: var(--bs-body-bg);
|
|
--bs-table-border-color: var(--bs-border-color);
|
|
--bs-table-accent-bg: transparent;
|
|
--bs-table-striped-color: var(--bs-emphasis-color);
|
|
--bs-table-striped-bg: rgba(var(--bs-emphasis-color-rgb), 0.05);
|
|
--bs-table-active-color: var(--bs-emphasis-color);
|
|
--bs-table-active-bg: rgba(var(--bs-emphasis-color-rgb), 0.1);
|
|
--bs-table-hover-color: var(--bs-emphasis-color);
|
|
--bs-table-hover-bg: rgba(var(--bs-emphasis-color-rgb), 0.075);
|
|
width: 100%;
|
|
margin-bottom: 1rem;
|
|
vertical-align: top;
|
|
border-color: var(--bs-table-border-color);
|
|
}
|
|
.table > :not(caption) > * > * {
|
|
padding: 1rem 0.7rem;
|
|
color: var(--bs-table-color-state, var(--bs-table-color-type, var(--bs-table-color)));
|
|
background-color: var(--bs-table-bg);
|
|
border-bottom-width: var(--bs-border-width);
|
|
box-shadow: inset 0 0 0 9999px var(--bs-table-bg-state, var(--bs-table-bg-type, var(--bs-table-accent-bg)));
|
|
}
|
|
.table > tbody {
|
|
vertical-align: inherit;
|
|
}
|
|
.table > thead {
|
|
vertical-align: bottom;
|
|
}
|
|
|
|
.table-group-divider {
|
|
border-top: calc(var(--bs-border-width) * 2) solid currentcolor;
|
|
}
|
|
|
|
.caption-top {
|
|
caption-side: top;
|
|
}
|
|
|
|
.table-sm > :not(caption) > * > * {
|
|
padding: 0.25rem 0.25rem;
|
|
}
|
|
|
|
.table-bordered > :not(caption) > * {
|
|
border-width: var(--bs-border-width) 0;
|
|
}
|
|
.table-bordered > :not(caption) > * > * {
|
|
border-width: 0 var(--bs-border-width);
|
|
}
|
|
|
|
.table-borderless > :not(caption) > * > * {
|
|
border-bottom-width: 0;
|
|
}
|
|
.table-borderless > :not(:first-child) {
|
|
border-top-width: 0;
|
|
}
|
|
|
|
.table-striped > tbody > tr:nth-of-type(odd) > * {
|
|
--bs-table-color-type: var(--bs-table-striped-color);
|
|
--bs-table-bg-type: var(--bs-table-striped-bg);
|
|
}
|
|
|
|
.table-striped-columns > :not(caption) > tr > :nth-child(even) {
|
|
--bs-table-color-type: var(--bs-table-striped-color);
|
|
--bs-table-bg-type: var(--bs-table-striped-bg);
|
|
}
|
|
|
|
.table-active {
|
|
--bs-table-color-state: var(--bs-table-active-color);
|
|
--bs-table-bg-state: var(--bs-table-active-bg);
|
|
}
|
|
|
|
.table-hover > tbody > tr:hover > * {
|
|
--bs-table-color-state: var(--bs-table-hover-color);
|
|
--bs-table-bg-state: var(--bs-table-hover-bg);
|
|
}
|
|
|
|
.table-primary {
|
|
--bs-table-color: #000;
|
|
--bs-table-bg: #cce2fc;
|
|
--bs-table-border-color: #a3b5ca;
|
|
--bs-table-striped-bg: #c2d7ef;
|
|
--bs-table-striped-color: #000;
|
|
--bs-table-active-bg: #b8cbe3;
|
|
--bs-table-active-color: #000;
|
|
--bs-table-hover-bg: #bdd1e9;
|
|
--bs-table-hover-color: #000;
|
|
color: var(--bs-table-color);
|
|
border-color: var(--bs-table-border-color);
|
|
}
|
|
|
|
.table-secondary {
|
|
--bs-table-color: #000;
|
|
--bs-table-bg: #e2e3e5;
|
|
--bs-table-border-color: #b5b6b7;
|
|
--bs-table-striped-bg: #d7d8da;
|
|
--bs-table-striped-color: #000;
|
|
--bs-table-active-bg: #cbccce;
|
|
--bs-table-active-color: #000;
|
|
--bs-table-hover-bg: #d1d2d4;
|
|
--bs-table-hover-color: #000;
|
|
color: var(--bs-table-color);
|
|
border-color: var(--bs-table-border-color);
|
|
}
|
|
|
|
.table-success {
|
|
--bs-table-color: #000;
|
|
--bs-table-bg: #d1e7dd;
|
|
--bs-table-border-color: #a7b9b1;
|
|
--bs-table-striped-bg: #c7dbd2;
|
|
--bs-table-striped-color: #000;
|
|
--bs-table-active-bg: #bcd0c7;
|
|
--bs-table-active-color: #000;
|
|
--bs-table-hover-bg: #c1d6cc;
|
|
--bs-table-hover-color: #000;
|
|
color: var(--bs-table-color);
|
|
border-color: var(--bs-table-border-color);
|
|
}
|
|
|
|
.table-info {
|
|
--bs-table-color: #000;
|
|
--bs-table-bg: #cff4fc;
|
|
--bs-table-border-color: #a6c3ca;
|
|
--bs-table-striped-bg: #c5e8ef;
|
|
--bs-table-striped-color: #000;
|
|
--bs-table-active-bg: #badce3;
|
|
--bs-table-active-color: #000;
|
|
--bs-table-hover-bg: #bfe2e9;
|
|
--bs-table-hover-color: #000;
|
|
color: var(--bs-table-color);
|
|
border-color: var(--bs-table-border-color);
|
|
}
|
|
|
|
.table-warning {
|
|
--bs-table-color: #000;
|
|
--bs-table-bg: #fff3cd;
|
|
--bs-table-border-color: #ccc2a4;
|
|
--bs-table-striped-bg: #f2e7c3;
|
|
--bs-table-striped-color: #000;
|
|
--bs-table-active-bg: #e6dbb9;
|
|
--bs-table-active-color: #000;
|
|
--bs-table-hover-bg: #ece1be;
|
|
--bs-table-hover-color: #000;
|
|
color: var(--bs-table-color);
|
|
border-color: var(--bs-table-border-color);
|
|
}
|
|
|
|
.table-danger {
|
|
--bs-table-color: #000;
|
|
--bs-table-bg: #f8d7da;
|
|
--bs-table-border-color: #c6acae;
|
|
--bs-table-striped-bg: #eccccf;
|
|
--bs-table-striped-color: #000;
|
|
--bs-table-active-bg: #dfc2c4;
|
|
--bs-table-active-color: #000;
|
|
--bs-table-hover-bg: #e5c7ca;
|
|
--bs-table-hover-color: #000;
|
|
color: var(--bs-table-color);
|
|
border-color: var(--bs-table-border-color);
|
|
}
|
|
|
|
.table-light {
|
|
--bs-table-color: #000;
|
|
--bs-table-bg: #f8f9fa;
|
|
--bs-table-border-color: #c6c7c8;
|
|
--bs-table-striped-bg: #ecedee;
|
|
--bs-table-striped-color: #000;
|
|
--bs-table-active-bg: #dfe0e1;
|
|
--bs-table-active-color: #000;
|
|
--bs-table-hover-bg: #e5e6e7;
|
|
--bs-table-hover-color: #000;
|
|
color: var(--bs-table-color);
|
|
border-color: var(--bs-table-border-color);
|
|
}
|
|
|
|
.table-dark {
|
|
--bs-table-color: #fff;
|
|
--bs-table-bg: #212529;
|
|
--bs-table-border-color: #4d5154;
|
|
--bs-table-striped-bg: #2c3034;
|
|
--bs-table-striped-color: #fff;
|
|
--bs-table-active-bg: #373b3e;
|
|
--bs-table-active-color: #fff;
|
|
--bs-table-hover-bg: #323539;
|
|
--bs-table-hover-color: #fff;
|
|
color: var(--bs-table-color);
|
|
border-color: var(--bs-table-border-color);
|
|
}
|
|
|
|
.table-responsive {
|
|
overflow-x: auto;
|
|
-webkit-overflow-scrolling: touch;
|
|
}
|
|
|
|
@media (max-width: 575.98px) {
|
|
.table-responsive-sm {
|
|
overflow-x: auto;
|
|
-webkit-overflow-scrolling: touch;
|
|
}
|
|
}
|
|
@media (max-width: 767.98px) {
|
|
.table-responsive-md {
|
|
overflow-x: auto;
|
|
-webkit-overflow-scrolling: touch;
|
|
}
|
|
}
|
|
@media (max-width: 991.98px) {
|
|
.table-responsive-lg {
|
|
overflow-x: auto;
|
|
-webkit-overflow-scrolling: touch;
|
|
}
|
|
}
|
|
@media (max-width: 1199.98px) {
|
|
.table-responsive-xl {
|
|
overflow-x: auto;
|
|
-webkit-overflow-scrolling: touch;
|
|
}
|
|
}
|
|
@media (max-width: 1399.98px) {
|
|
.table-responsive-xxl {
|
|
overflow-x: auto;
|
|
-webkit-overflow-scrolling: touch;
|
|
}
|
|
}
|
|
.form-label {
|
|
margin-bottom: 0.5rem;
|
|
}
|
|
|
|
.col-form-label {
|
|
padding-top: calc(0.375rem + var(--bs-border-width));
|
|
padding-bottom: calc(0.375rem + var(--bs-border-width));
|
|
margin-bottom: 0;
|
|
font-size: inherit;
|
|
line-height: 1.5;
|
|
}
|
|
|
|
.col-form-label-lg {
|
|
padding-top: calc(0.5rem + var(--bs-border-width));
|
|
padding-bottom: calc(0.5rem + var(--bs-border-width));
|
|
font-size: 1.25rem;
|
|
}
|
|
|
|
.col-form-label-sm {
|
|
padding-top: calc(0.25rem + var(--bs-border-width));
|
|
padding-bottom: calc(0.25rem + var(--bs-border-width));
|
|
font-size: 0.875rem;
|
|
}
|
|
|
|
.form-text {
|
|
margin-top: 0.25rem;
|
|
font-size: 0.875em;
|
|
color: var(--bs-secondary-color);
|
|
}
|
|
|
|
.form-control {
|
|
display: block;
|
|
width: 100%;
|
|
padding: 0.375rem 0.75rem;
|
|
font-size: 1rem;
|
|
font-weight: 400;
|
|
line-height: 1.5;
|
|
color: var(--bs-body-color);
|
|
appearance: none;
|
|
background-color: var(--bs-body-bg);
|
|
background-clip: padding-box;
|
|
border: var(--bs-border-width) solid var(--bs-border-color);
|
|
border-radius: var(--bs-border-radius);
|
|
transition: border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
|
|
}
|
|
@media (prefers-reduced-motion: reduce) {
|
|
.form-control {
|
|
transition: none;
|
|
}
|
|
}
|
|
.form-control[type=file] {
|
|
overflow: hidden;
|
|
}
|
|
.form-control[type=file]:not(:disabled):not([readonly]) {
|
|
cursor: pointer;
|
|
}
|
|
.form-control:focus {
|
|
color: var(--bs-body-color);
|
|
background-color: var(--bs-body-bg);
|
|
border-color: #80b8f8;
|
|
outline: 0;
|
|
box-shadow: 0 0 0 0.25rem rgba(0, 112, 240, 0.25);
|
|
}
|
|
.form-control::-webkit-date-and-time-value {
|
|
min-width: 85px;
|
|
height: 1.5em;
|
|
margin: 0;
|
|
}
|
|
.form-control::-webkit-datetime-edit {
|
|
display: block;
|
|
padding: 0;
|
|
}
|
|
.form-control::placeholder {
|
|
color: var(--bs-secondary-color);
|
|
opacity: 1;
|
|
}
|
|
.form-control:disabled {
|
|
background-color: var(--bs-secondary-bg);
|
|
opacity: 1;
|
|
}
|
|
.form-control::file-selector-button {
|
|
padding: 0.375rem 0.75rem;
|
|
margin: -0.375rem -0.75rem;
|
|
margin-inline-end: 0.75rem;
|
|
color: var(--bs-body-color);
|
|
background-color: var(--bs-tertiary-bg);
|
|
pointer-events: none;
|
|
border-color: inherit;
|
|
border-style: solid;
|
|
border-width: 0;
|
|
border-inline-end-width: var(--bs-border-width);
|
|
border-radius: 0;
|
|
transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
|
|
}
|
|
@media (prefers-reduced-motion: reduce) {
|
|
.form-control::file-selector-button {
|
|
transition: none;
|
|
}
|
|
}
|
|
.form-control:hover:not(:disabled):not([readonly])::file-selector-button {
|
|
background-color: var(--bs-secondary-bg);
|
|
}
|
|
|
|
.form-control-plaintext {
|
|
display: block;
|
|
width: 100%;
|
|
padding: 0.375rem 0;
|
|
margin-bottom: 0;
|
|
line-height: 1.5;
|
|
color: var(--bs-body-color);
|
|
background-color: transparent;
|
|
border: solid transparent;
|
|
border-width: var(--bs-border-width) 0;
|
|
}
|
|
.form-control-plaintext:focus {
|
|
outline: 0;
|
|
}
|
|
.form-control-plaintext.form-control-sm, .form-control-plaintext.form-control-lg {
|
|
padding-right: 0;
|
|
padding-left: 0;
|
|
}
|
|
|
|
.form-control-sm {
|
|
min-height: calc(1.5em + 0.5rem + calc(var(--bs-border-width) * 2));
|
|
padding: 0.25rem 0.5rem;
|
|
font-size: 0.875rem;
|
|
border-radius: var(--bs-border-radius-sm);
|
|
}
|
|
.form-control-sm::file-selector-button {
|
|
padding: 0.25rem 0.5rem;
|
|
margin: -0.25rem -0.5rem;
|
|
margin-inline-end: 0.5rem;
|
|
}
|
|
|
|
.form-control-lg {
|
|
min-height: calc(1.5em + 1rem + calc(var(--bs-border-width) * 2));
|
|
padding: 0.5rem 1rem;
|
|
font-size: 1.25rem;
|
|
border-radius: var(--bs-border-radius-lg);
|
|
}
|
|
.form-control-lg::file-selector-button {
|
|
padding: 0.5rem 1rem;
|
|
margin: -0.5rem -1rem;
|
|
margin-inline-end: 1rem;
|
|
}
|
|
|
|
textarea.form-control {
|
|
min-height: calc(1.5em + 0.75rem + calc(var(--bs-border-width) * 2));
|
|
}
|
|
textarea.form-control-sm {
|
|
min-height: calc(1.5em + 0.5rem + calc(var(--bs-border-width) * 2));
|
|
}
|
|
textarea.form-control-lg {
|
|
min-height: calc(1.5em + 1rem + calc(var(--bs-border-width) * 2));
|
|
}
|
|
|
|
.form-control-color {
|
|
width: 3rem;
|
|
height: calc(1.5em + 0.75rem + calc(var(--bs-border-width) * 2));
|
|
padding: 0.375rem;
|
|
}
|
|
.form-control-color:not(:disabled):not([readonly]) {
|
|
cursor: pointer;
|
|
}
|
|
.form-control-color::-moz-color-swatch {
|
|
border: 0 !important;
|
|
border-radius: var(--bs-border-radius);
|
|
}
|
|
.form-control-color::-webkit-color-swatch {
|
|
border: 0 !important;
|
|
border-radius: var(--bs-border-radius);
|
|
}
|
|
.form-control-color.form-control-sm {
|
|
height: calc(1.5em + 0.5rem + calc(var(--bs-border-width) * 2));
|
|
}
|
|
.form-control-color.form-control-lg {
|
|
height: calc(1.5em + 1rem + calc(var(--bs-border-width) * 2));
|
|
}
|
|
|
|
.form-select {
|
|
--bs-form-select-bg-img: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23343a40' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e");
|
|
display: block;
|
|
width: 100%;
|
|
padding: 0.375rem 2.25rem 0.375rem 0.75rem;
|
|
font-size: 1rem;
|
|
font-weight: 400;
|
|
line-height: 1.5;
|
|
color: var(--bs-body-color);
|
|
appearance: none;
|
|
background-color: var(--bs-body-bg);
|
|
background-image: var(--bs-form-select-bg-img), var(--bs-form-select-bg-icon, none);
|
|
background-repeat: no-repeat;
|
|
background-position: right 0.75rem center;
|
|
background-size: 16px 12px;
|
|
border: var(--bs-border-width) solid var(--bs-border-color);
|
|
border-radius: var(--bs-border-radius);
|
|
transition: border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
|
|
}
|
|
@media (prefers-reduced-motion: reduce) {
|
|
.form-select {
|
|
transition: none;
|
|
}
|
|
}
|
|
.form-select:focus {
|
|
border-color: #80b8f8;
|
|
outline: 0;
|
|
box-shadow: 0 0 0 0.25rem rgba(0, 112, 240, 0.25);
|
|
}
|
|
.form-select[multiple], .form-select[size]:not([size="1"]) {
|
|
padding-right: 0.75rem;
|
|
background-image: none;
|
|
}
|
|
.form-select:disabled {
|
|
background-color: var(--bs-secondary-bg);
|
|
}
|
|
.form-select:-moz-focusring {
|
|
color: transparent;
|
|
text-shadow: 0 0 0 var(--bs-body-color);
|
|
}
|
|
|
|
.form-select-sm {
|
|
padding-top: 0.25rem;
|
|
padding-bottom: 0.25rem;
|
|
padding-left: 0.5rem;
|
|
font-size: 0.875rem;
|
|
border-radius: var(--bs-border-radius-sm);
|
|
}
|
|
|
|
.form-select-lg {
|
|
padding-top: 0.5rem;
|
|
padding-bottom: 0.5rem;
|
|
padding-left: 1rem;
|
|
font-size: 1.25rem;
|
|
border-radius: var(--bs-border-radius-lg);
|
|
}
|
|
|
|
[data-bs-theme=dark] .form-select {
|
|
--bs-form-select-bg-img: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16'%3e%3cpath fill='none' stroke='%23dee2e6' stroke-linecap='round' stroke-linejoin='round' stroke-width='2' d='m2 5 6 6 6-6'/%3e%3c/svg%3e");
|
|
}
|
|
|
|
.form-check {
|
|
display: block;
|
|
min-height: 1.5rem;
|
|
padding-left: 1.5em;
|
|
margin-bottom: 0.125rem;
|
|
}
|
|
.form-check .form-check-input {
|
|
float: left;
|
|
margin-left: -1.5em;
|
|
}
|
|
|
|
.form-check-reverse {
|
|
padding-right: 1.5em;
|
|
padding-left: 0;
|
|
text-align: right;
|
|
}
|
|
.form-check-reverse .form-check-input {
|
|
float: right;
|
|
margin-right: -1.5em;
|
|
margin-left: 0;
|
|
}
|
|
|
|
.form-check-input {
|
|
--bs-form-check-bg: var(--bs-body-bg);
|
|
flex-shrink: 0;
|
|
width: 1em;
|
|
height: 1em;
|
|
margin-top: 0.25em;
|
|
vertical-align: top;
|
|
appearance: none;
|
|
background-color: var(--bs-form-check-bg);
|
|
background-image: var(--bs-form-check-bg-image);
|
|
background-repeat: no-repeat;
|
|
background-position: center;
|
|
background-size: contain;
|
|
border: var(--bs-border-width) solid var(--bs-border-color);
|
|
print-color-adjust: exact;
|
|
}
|
|
.form-check-input[type=checkbox] {
|
|
border-radius: 0.25em;
|
|
}
|
|
.form-check-input[type=radio] {
|
|
border-radius: 50%;
|
|
}
|
|
.form-check-input:active {
|
|
filter: brightness(90%);
|
|
}
|
|
.form-check-input:focus {
|
|
border-color: #80b8f8;
|
|
outline: 0;
|
|
box-shadow: 0 0 0 0.25rem rgba(0, 112, 240, 0.25);
|
|
}
|
|
.form-check-input:checked {
|
|
background-color: #0070f0;
|
|
border-color: #0070f0;
|
|
}
|
|
.form-check-input:checked[type=checkbox] {
|
|
--bs-form-check-bg-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='m6 10 3 3 6-6'/%3e%3c/svg%3e");
|
|
}
|
|
.form-check-input:checked[type=radio] {
|
|
--bs-form-check-bg-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='2' fill='%23fff'/%3e%3c/svg%3e");
|
|
}
|
|
.form-check-input[type=checkbox]:indeterminate {
|
|
background-color: #0070f0;
|
|
border-color: #0070f0;
|
|
--bs-form-check-bg-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 20 20'%3e%3cpath fill='none' stroke='%23fff' stroke-linecap='round' stroke-linejoin='round' stroke-width='3' d='M6 10h8'/%3e%3c/svg%3e");
|
|
}
|
|
.form-check-input:disabled {
|
|
pointer-events: none;
|
|
filter: none;
|
|
opacity: 0.5;
|
|
}
|
|
.form-check-input[disabled] ~ .form-check-label, .form-check-input:disabled ~ .form-check-label {
|
|
cursor: default;
|
|
opacity: 0.5;
|
|
}
|
|
|
|
.form-switch {
|
|
padding-left: 2.5em;
|
|
}
|
|
.form-switch .form-check-input {
|
|
--bs-form-switch-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='rgba%280, 0, 0, 0.25%29'/%3e%3c/svg%3e");
|
|
width: 2em;
|
|
margin-left: -2.5em;
|
|
background-image: var(--bs-form-switch-bg);
|
|
background-position: left center;
|
|
border-radius: 2em;
|
|
transition: background-position 0.15s ease-in-out;
|
|
}
|
|
@media (prefers-reduced-motion: reduce) {
|
|
.form-switch .form-check-input {
|
|
transition: none;
|
|
}
|
|
}
|
|
.form-switch .form-check-input:focus {
|
|
--bs-form-switch-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%2380b8f8'/%3e%3c/svg%3e");
|
|
}
|
|
.form-switch .form-check-input:checked {
|
|
background-position: right center;
|
|
--bs-form-switch-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='%23fff'/%3e%3c/svg%3e");
|
|
}
|
|
.form-switch.form-check-reverse {
|
|
padding-right: 2.5em;
|
|
padding-left: 0;
|
|
}
|
|
.form-switch.form-check-reverse .form-check-input {
|
|
margin-right: -2.5em;
|
|
margin-left: 0;
|
|
}
|
|
|
|
.form-check-inline {
|
|
display: inline-block;
|
|
margin-right: 1rem;
|
|
}
|
|
|
|
.btn-check {
|
|
position: absolute;
|
|
clip: rect(0, 0, 0, 0);
|
|
pointer-events: none;
|
|
}
|
|
.btn-check[disabled] + .btn, .btn-check:disabled + .btn {
|
|
pointer-events: none;
|
|
filter: none;
|
|
opacity: 0.35;
|
|
}
|
|
|
|
[data-bs-theme=dark] .form-switch .form-check-input:not(:checked):not(:focus) {
|
|
--bs-form-switch-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='-4 -4 8 8'%3e%3ccircle r='3' fill='rgba%28255, 255, 255, 0.25%29'/%3e%3c/svg%3e");
|
|
}
|
|
|
|
.form-range {
|
|
width: 100%;
|
|
height: 1.5rem;
|
|
padding: 0;
|
|
appearance: none;
|
|
background-color: transparent;
|
|
}
|
|
.form-range:focus {
|
|
outline: 0;
|
|
}
|
|
.form-range:focus::-webkit-slider-thumb {
|
|
box-shadow: 0 0 0 1px #fff, 0 0 0 0.25rem rgba(0, 112, 240, 0.25);
|
|
}
|
|
.form-range:focus::-moz-range-thumb {
|
|
box-shadow: 0 0 0 1px #fff, 0 0 0 0.25rem rgba(0, 112, 240, 0.25);
|
|
}
|
|
.form-range::-moz-focus-outer {
|
|
border: 0;
|
|
}
|
|
.form-range::-webkit-slider-thumb {
|
|
width: 1rem;
|
|
height: 1rem;
|
|
margin-top: -0.25rem;
|
|
appearance: none;
|
|
background-color: var(--bs-link-hover-color);
|
|
border: 0;
|
|
border-radius: 1rem;
|
|
transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
|
|
}
|
|
@media (prefers-reduced-motion: reduce) {
|
|
.form-range::-webkit-slider-thumb {
|
|
transition: none;
|
|
}
|
|
}
|
|
.form-range::-webkit-slider-thumb:active {
|
|
background-color: #b3d4fb;
|
|
}
|
|
.form-range::-webkit-slider-runnable-track {
|
|
width: 100%;
|
|
height: 0.5rem;
|
|
color: transparent;
|
|
cursor: pointer;
|
|
background-color: var(--bs-secondary-bg);
|
|
border-color: transparent;
|
|
border-radius: 1rem;
|
|
}
|
|
.form-range::-moz-range-thumb {
|
|
width: 1rem;
|
|
height: 1rem;
|
|
appearance: none;
|
|
background-color: var(--bs-link-hover-color);
|
|
border: 0;
|
|
border-radius: 1rem;
|
|
transition: background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
|
|
}
|
|
@media (prefers-reduced-motion: reduce) {
|
|
.form-range::-moz-range-thumb {
|
|
transition: none;
|
|
}
|
|
}
|
|
.form-range::-moz-range-thumb:active {
|
|
background-color: #b3d4fb;
|
|
}
|
|
.form-range::-moz-range-track {
|
|
width: 100%;
|
|
height: 0.5rem;
|
|
color: transparent;
|
|
cursor: pointer;
|
|
background-color: var(--bs-secondary-bg);
|
|
border-color: transparent;
|
|
border-radius: 1rem;
|
|
}
|
|
.form-range:disabled {
|
|
pointer-events: none;
|
|
}
|
|
.form-range:disabled::-webkit-slider-thumb {
|
|
background-color: var(--bs-secondary-color);
|
|
}
|
|
.form-range:disabled::-moz-range-thumb {
|
|
background-color: var(--bs-secondary-color);
|
|
}
|
|
|
|
.form-floating {
|
|
position: relative;
|
|
}
|
|
.form-floating > .form-control,
|
|
.form-floating > .form-control-plaintext,
|
|
.form-floating > .form-select {
|
|
height: calc(3.5rem + calc(var(--bs-border-width) * 2));
|
|
min-height: calc(3.5rem + calc(var(--bs-border-width) * 2));
|
|
line-height: 1.25;
|
|
}
|
|
.form-floating > label {
|
|
position: absolute;
|
|
top: 0;
|
|
left: 0;
|
|
z-index: 2;
|
|
height: 100%;
|
|
padding: 1rem 0.75rem;
|
|
overflow: hidden;
|
|
text-align: start;
|
|
text-overflow: ellipsis;
|
|
white-space: nowrap;
|
|
pointer-events: none;
|
|
border: var(--bs-border-width) solid transparent;
|
|
transform-origin: 0 0;
|
|
transition: opacity 0.1s ease-in-out, transform 0.1s ease-in-out;
|
|
}
|
|
@media (prefers-reduced-motion: reduce) {
|
|
.form-floating > label {
|
|
transition: none;
|
|
}
|
|
}
|
|
.form-floating > .form-control,
|
|
.form-floating > .form-control-plaintext {
|
|
padding: 1rem 0.75rem;
|
|
}
|
|
.form-floating > .form-control::placeholder,
|
|
.form-floating > .form-control-plaintext::placeholder {
|
|
color: transparent;
|
|
}
|
|
.form-floating > .form-control:focus, .form-floating > .form-control:not(:placeholder-shown),
|
|
.form-floating > .form-control-plaintext:focus,
|
|
.form-floating > .form-control-plaintext:not(:placeholder-shown) {
|
|
padding-top: 1.625rem;
|
|
padding-bottom: 0.625rem;
|
|
}
|
|
.form-floating > .form-control:-webkit-autofill,
|
|
.form-floating > .form-control-plaintext:-webkit-autofill {
|
|
padding-top: 1.625rem;
|
|
padding-bottom: 0.625rem;
|
|
}
|
|
.form-floating > .form-select {
|
|
padding-top: 1.625rem;
|
|
padding-bottom: 0.625rem;
|
|
}
|
|
.form-floating > .form-control:focus ~ label,
|
|
.form-floating > .form-control:not(:placeholder-shown) ~ label,
|
|
.form-floating > .form-control-plaintext ~ label,
|
|
.form-floating > .form-select ~ label {
|
|
color: rgba(var(--bs-body-color-rgb), 0.65);
|
|
transform: scale(0.85) translateY(-0.5rem) translateX(0.15rem);
|
|
}
|
|
.form-floating > .form-control:focus ~ label::after,
|
|
.form-floating > .form-control:not(:placeholder-shown) ~ label::after,
|
|
.form-floating > .form-control-plaintext ~ label::after,
|
|
.form-floating > .form-select ~ label::after {
|
|
position: absolute;
|
|
inset: 1rem 0.375rem;
|
|
z-index: -1;
|
|
height: 1.5em;
|
|
content: "";
|
|
background-color: var(--bs-body-bg);
|
|
border-radius: var(--bs-border-radius);
|
|
}
|
|
.form-floating > .form-control:-webkit-autofill ~ label {
|
|
color: rgba(var(--bs-body-color-rgb), 0.65);
|
|
transform: scale(0.85) translateY(-0.5rem) translateX(0.15rem);
|
|
}
|
|
.form-floating > .form-control-plaintext ~ label {
|
|
border-width: var(--bs-border-width) 0;
|
|
}
|
|
.form-floating > :disabled ~ label,
|
|
.form-floating > .form-control:disabled ~ label {
|
|
color: #6c757d;
|
|
}
|
|
.form-floating > :disabled ~ label::after,
|
|
.form-floating > .form-control:disabled ~ label::after {
|
|
background-color: var(--bs-secondary-bg);
|
|
}
|
|
|
|
.input-group {
|
|
position: relative;
|
|
display: flex;
|
|
flex-wrap: wrap;
|
|
align-items: stretch;
|
|
width: 100%;
|
|
}
|
|
.input-group > .form-control,
|
|
.input-group > .form-select,
|
|
.input-group > .form-floating {
|
|
position: relative;
|
|
flex: 1 1 auto;
|
|
width: 1%;
|
|
min-width: 0;
|
|
}
|
|
.input-group > .form-control:focus,
|
|
.input-group > .form-select:focus,
|
|
.input-group > .form-floating:focus-within {
|
|
z-index: 5;
|
|
}
|
|
.input-group .btn {
|
|
position: relative;
|
|
z-index: 2;
|
|
}
|
|
.input-group .btn:focus {
|
|
z-index: 5;
|
|
}
|
|
|
|
.input-group-text {
|
|
display: flex;
|
|
align-items: center;
|
|
padding: 0.375rem 0.75rem;
|
|
font-size: 1rem;
|
|
font-weight: 400;
|
|
line-height: 1.5;
|
|
color: var(--bs-body-color);
|
|
text-align: center;
|
|
white-space: nowrap;
|
|
background-color: var(--bs-tertiary-bg);
|
|
border: var(--bs-border-width) solid var(--bs-border-color);
|
|
border-radius: var(--bs-border-radius);
|
|
}
|
|
|
|
.input-group-lg > .form-control,
|
|
.input-group-lg > .form-select,
|
|
.input-group-lg > .input-group-text,
|
|
.input-group-lg > .btn {
|
|
padding: 0.5rem 1rem;
|
|
font-size: 1.25rem;
|
|
border-radius: var(--bs-border-radius-lg);
|
|
}
|
|
|
|
.input-group-sm > .form-control,
|
|
.input-group-sm > .form-select,
|
|
.input-group-sm > .input-group-text,
|
|
.input-group-sm > .btn {
|
|
padding: 0.25rem 0.5rem;
|
|
font-size: 0.875rem;
|
|
border-radius: var(--bs-border-radius-sm);
|
|
}
|
|
|
|
.input-group-lg > .form-select,
|
|
.input-group-sm > .form-select {
|
|
padding-right: 3rem;
|
|
}
|
|
|
|
.input-group:not(.has-validation) > :not(:last-child):not(.dropdown-toggle):not(.dropdown-menu):not(.form-floating),
|
|
.input-group:not(.has-validation) > .dropdown-toggle:nth-last-child(n+3),
|
|
.input-group:not(.has-validation) > .form-floating:not(:last-child) > .form-control,
|
|
.input-group:not(.has-validation) > .form-floating:not(:last-child) > .form-select {
|
|
border-top-right-radius: 0;
|
|
border-bottom-right-radius: 0;
|
|
}
|
|
.input-group.has-validation > :nth-last-child(n+3):not(.dropdown-toggle):not(.dropdown-menu):not(.form-floating),
|
|
.input-group.has-validation > .dropdown-toggle:nth-last-child(n+4),
|
|
.input-group.has-validation > .form-floating:nth-last-child(n+3) > .form-control,
|
|
.input-group.has-validation > .form-floating:nth-last-child(n+3) > .form-select {
|
|
border-top-right-radius: 0;
|
|
border-bottom-right-radius: 0;
|
|
}
|
|
.input-group > :not(:first-child):not(.dropdown-menu):not(.valid-tooltip):not(.valid-feedback):not(.invalid-tooltip):not(.invalid-feedback) {
|
|
margin-left: calc(var(--bs-border-width) * -1);
|
|
border-top-left-radius: 0;
|
|
border-bottom-left-radius: 0;
|
|
}
|
|
.input-group > .form-floating:not(:first-child) > .form-control,
|
|
.input-group > .form-floating:not(:first-child) > .form-select {
|
|
border-top-left-radius: 0;
|
|
border-bottom-left-radius: 0;
|
|
}
|
|
|
|
.valid-feedback {
|
|
display: none;
|
|
width: 100%;
|
|
margin-top: 0.25rem;
|
|
font-size: 0.875em;
|
|
color: var(--bs-form-valid-color);
|
|
}
|
|
|
|
.valid-tooltip {
|
|
position: absolute;
|
|
top: 100%;
|
|
z-index: 5;
|
|
display: none;
|
|
max-width: 100%;
|
|
padding: 0.25rem 0.5rem;
|
|
margin-top: 0.1rem;
|
|
font-size: 0.875rem;
|
|
color: #fff;
|
|
background-color: var(--bs-success);
|
|
border-radius: var(--bs-border-radius);
|
|
}
|
|
|
|
.was-validated :valid ~ .valid-feedback,
|
|
.was-validated :valid ~ .valid-tooltip,
|
|
.is-valid ~ .valid-feedback,
|
|
.is-valid ~ .valid-tooltip {
|
|
display: block;
|
|
}
|
|
|
|
.was-validated .form-control:valid, .form-control.is-valid {
|
|
border-color: var(--bs-form-valid-border-color);
|
|
padding-right: calc(1.5em + 0.75rem);
|
|
background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%23198754' d='M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e");
|
|
background-repeat: no-repeat;
|
|
background-position: right calc(0.375em + 0.1875rem) center;
|
|
background-size: calc(0.75em + 0.375rem) calc(0.75em + 0.375rem);
|
|
}
|
|
.was-validated .form-control:valid:focus, .form-control.is-valid:focus {
|
|
border-color: var(--bs-form-valid-border-color);
|
|
box-shadow: 0 0 0 0.25rem rgba(var(--bs-success-rgb), 0.25);
|
|
}
|
|
|
|
.was-validated textarea.form-control:valid, textarea.form-control.is-valid {
|
|
padding-right: calc(1.5em + 0.75rem);
|
|
background-position: top calc(0.375em + 0.1875rem) right calc(0.375em + 0.1875rem);
|
|
}
|
|
|
|
.was-validated .form-select:valid, .form-select.is-valid {
|
|
border-color: var(--bs-form-valid-border-color);
|
|
}
|
|
.was-validated .form-select:valid:not([multiple]):not([size]), .was-validated .form-select:valid:not([multiple])[size="1"], .form-select.is-valid:not([multiple]):not([size]), .form-select.is-valid:not([multiple])[size="1"] {
|
|
--bs-form-select-bg-icon: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 8 8'%3e%3cpath fill='%23198754' d='M2.3 6.73.6 4.53c-.4-1.04.46-1.4 1.1-.8l1.1 1.4 3.4-3.8c.6-.63 1.6-.27 1.2.7l-4 4.6c-.43.5-.8.4-1.1.1z'/%3e%3c/svg%3e");
|
|
padding-right: 4.125rem;
|
|
background-position: right 0.75rem center, center right 2.25rem;
|
|
background-size: 16px 12px, calc(0.75em + 0.375rem) calc(0.75em + 0.375rem);
|
|
}
|
|
.was-validated .form-select:valid:focus, .form-select.is-valid:focus {
|
|
border-color: var(--bs-form-valid-border-color);
|
|
box-shadow: 0 0 0 0.25rem rgba(var(--bs-success-rgb), 0.25);
|
|
}
|
|
|
|
.was-validated .form-control-color:valid, .form-control-color.is-valid {
|
|
width: calc(3rem + calc(1.5em + 0.75rem));
|
|
}
|
|
|
|
.was-validated .form-check-input:valid, .form-check-input.is-valid {
|
|
border-color: var(--bs-form-valid-border-color);
|
|
}
|
|
.was-validated .form-check-input:valid:checked, .form-check-input.is-valid:checked {
|
|
background-color: var(--bs-form-valid-color);
|
|
}
|
|
.was-validated .form-check-input:valid:focus, .form-check-input.is-valid:focus {
|
|
box-shadow: 0 0 0 0.25rem rgba(var(--bs-success-rgb), 0.25);
|
|
}
|
|
.was-validated .form-check-input:valid ~ .form-check-label, .form-check-input.is-valid ~ .form-check-label {
|
|
color: var(--bs-form-valid-color);
|
|
}
|
|
|
|
.form-check-inline .form-check-input ~ .valid-feedback {
|
|
margin-left: 0.5em;
|
|
}
|
|
|
|
.was-validated .input-group > .form-control:not(:focus):valid, .input-group > .form-control:not(:focus).is-valid,
|
|
.was-validated .input-group > .form-select:not(:focus):valid,
|
|
.input-group > .form-select:not(:focus).is-valid,
|
|
.was-validated .input-group > .form-floating:not(:focus-within):valid,
|
|
.input-group > .form-floating:not(:focus-within).is-valid {
|
|
z-index: 3;
|
|
}
|
|
|
|
.invalid-feedback {
|
|
display: none;
|
|
width: 100%;
|
|
margin-top: 0.25rem;
|
|
font-size: 0.875em;
|
|
color: var(--bs-form-invalid-color);
|
|
}
|
|
|
|
.invalid-tooltip {
|
|
position: absolute;
|
|
top: 100%;
|
|
z-index: 5;
|
|
display: none;
|
|
max-width: 100%;
|
|
padding: 0.25rem 0.5rem;
|
|
margin-top: 0.1rem;
|
|
font-size: 0.875rem;
|
|
color: #fff;
|
|
background-color: var(--bs-danger);
|
|
border-radius: var(--bs-border-radius);
|
|
}
|
|
|
|
.was-validated :invalid ~ .invalid-feedback,
|
|
.was-validated :invalid ~ .invalid-tooltip,
|
|
.is-invalid ~ .invalid-feedback,
|
|
.is-invalid ~ .invalid-tooltip {
|
|
display: block;
|
|
}
|
|
|
|
.was-validated .form-control:invalid, .form-control.is-invalid {
|
|
border-color: var(--bs-form-invalid-border-color);
|
|
padding-right: calc(1.5em + 0.75rem);
|
|
background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 12 12' width='12' height='12' fill='none' stroke='%23dc3545'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23dc3545' stroke='none'/%3e%3c/svg%3e");
|
|
background-repeat: no-repeat;
|
|
background-position: right calc(0.375em + 0.1875rem) center;
|
|
background-size: calc(0.75em + 0.375rem) calc(0.75em + 0.375rem);
|
|
}
|
|
.was-validated .form-control:invalid:focus, .form-control.is-invalid:focus {
|
|
border-color: var(--bs-form-invalid-border-color);
|
|
box-shadow: 0 0 0 0.25rem rgba(var(--bs-danger-rgb), 0.25);
|
|
}
|
|
|
|
.was-validated textarea.form-control:invalid, textarea.form-control.is-invalid {
|
|
padding-right: calc(1.5em + 0.75rem);
|
|
background-position: top calc(0.375em + 0.1875rem) right calc(0.375em + 0.1875rem);
|
|
}
|
|
|
|
.was-validated .form-select:invalid, .form-select.is-invalid {
|
|
border-color: var(--bs-form-invalid-border-color);
|
|
}
|
|
.was-validated .form-select:invalid:not([multiple]):not([size]), .was-validated .form-select:invalid:not([multiple])[size="1"], .form-select.is-invalid:not([multiple]):not([size]), .form-select.is-invalid:not([multiple])[size="1"] {
|
|
--bs-form-select-bg-icon: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 12 12' width='12' height='12' fill='none' stroke='%23dc3545'%3e%3ccircle cx='6' cy='6' r='4.5'/%3e%3cpath stroke-linejoin='round' d='M5.8 3.6h.4L6 6.5z'/%3e%3ccircle cx='6' cy='8.2' r='.6' fill='%23dc3545' stroke='none'/%3e%3c/svg%3e");
|
|
padding-right: 4.125rem;
|
|
background-position: right 0.75rem center, center right 2.25rem;
|
|
background-size: 16px 12px, calc(0.75em + 0.375rem) calc(0.75em + 0.375rem);
|
|
}
|
|
.was-validated .form-select:invalid:focus, .form-select.is-invalid:focus {
|
|
border-color: var(--bs-form-invalid-border-color);
|
|
box-shadow: 0 0 0 0.25rem rgba(var(--bs-danger-rgb), 0.25);
|
|
}
|
|
|
|
.was-validated .form-control-color:invalid, .form-control-color.is-invalid {
|
|
width: calc(3rem + calc(1.5em + 0.75rem));
|
|
}
|
|
|
|
.was-validated .form-check-input:invalid, .form-check-input.is-invalid {
|
|
border-color: var(--bs-form-invalid-border-color);
|
|
}
|
|
.was-validated .form-check-input:invalid:checked, .form-check-input.is-invalid:checked {
|
|
background-color: var(--bs-form-invalid-color);
|
|
}
|
|
.was-validated .form-check-input:invalid:focus, .form-check-input.is-invalid:focus {
|
|
box-shadow: 0 0 0 0.25rem rgba(var(--bs-danger-rgb), 0.25);
|
|
}
|
|
.was-validated .form-check-input:invalid ~ .form-check-label, .form-check-input.is-invalid ~ .form-check-label {
|
|
color: var(--bs-form-invalid-color);
|
|
}
|
|
|
|
.form-check-inline .form-check-input ~ .invalid-feedback {
|
|
margin-left: 0.5em;
|
|
}
|
|
|
|
.was-validated .input-group > .form-control:not(:focus):invalid, .input-group > .form-control:not(:focus).is-invalid,
|
|
.was-validated .input-group > .form-select:not(:focus):invalid,
|
|
.input-group > .form-select:not(:focus).is-invalid,
|
|
.was-validated .input-group > .form-floating:not(:focus-within):invalid,
|
|
.input-group > .form-floating:not(:focus-within).is-invalid {
|
|
z-index: 4;
|
|
}
|
|
|
|
.btn {
|
|
--bs-btn-padding-x: 0.75rem;
|
|
--bs-btn-padding-y: 0.375rem;
|
|
--bs-btn-font-family: ;
|
|
--bs-btn-font-size: 0.875rem;
|
|
--bs-btn-font-weight: 400;
|
|
--bs-btn-line-height: 1.5;
|
|
--bs-btn-color: var(--bs-body-color);
|
|
--bs-btn-bg: transparent;
|
|
--bs-btn-border-width: var(--bs-border-width);
|
|
--bs-btn-border-color: transparent;
|
|
--bs-btn-border-radius: var(--bs-border-radius);
|
|
--bs-btn-hover-border-color: transparent;
|
|
--bs-btn-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.15), 0 1px 1px rgba(0, 0, 0, 0.075);
|
|
--bs-btn-disabled-opacity: 0.35;
|
|
--bs-btn-focus-box-shadow: 0 0 0 0.25rem rgba(var(--bs-btn-focus-shadow-rgb), .5);
|
|
display: inline-block;
|
|
padding: var(--bs-btn-padding-y) var(--bs-btn-padding-x);
|
|
font-family: var(--bs-btn-font-family);
|
|
font-size: var(--bs-btn-font-size);
|
|
font-weight: var(--bs-btn-font-weight);
|
|
line-height: var(--bs-btn-line-height);
|
|
color: var(--bs-btn-color);
|
|
text-align: center;
|
|
text-decoration: none;
|
|
vertical-align: middle;
|
|
cursor: pointer;
|
|
user-select: none;
|
|
border: var(--bs-btn-border-width) solid var(--bs-btn-border-color);
|
|
border-radius: var(--bs-btn-border-radius);
|
|
background-color: var(--bs-btn-bg);
|
|
transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
|
|
}
|
|
@media (prefers-reduced-motion: reduce) {
|
|
.btn {
|
|
transition: none;
|
|
}
|
|
}
|
|
.btn:hover {
|
|
color: var(--bs-btn-hover-color);
|
|
background-color: var(--bs-btn-hover-bg);
|
|
border-color: var(--bs-btn-hover-border-color);
|
|
}
|
|
.btn-check + .btn:hover {
|
|
color: var(--bs-btn-color);
|
|
background-color: var(--bs-btn-bg);
|
|
border-color: var(--bs-btn-border-color);
|
|
}
|
|
.btn:focus-visible {
|
|
color: var(--bs-btn-hover-color);
|
|
background-color: var(--bs-btn-hover-bg);
|
|
border-color: var(--bs-btn-hover-border-color);
|
|
outline: 0;
|
|
box-shadow: var(--bs-btn-focus-box-shadow);
|
|
}
|
|
.btn-check:focus-visible + .btn {
|
|
border-color: var(--bs-btn-hover-border-color);
|
|
outline: 0;
|
|
box-shadow: var(--bs-btn-focus-box-shadow);
|
|
}
|
|
.btn-check:checked + .btn, :not(.btn-check) + .btn:active, .btn:first-child:active, .btn.active, .btn.show {
|
|
color: var(--bs-btn-active-color);
|
|
background-color: var(--bs-btn-active-bg);
|
|
border-color: var(--bs-btn-active-border-color);
|
|
}
|
|
.btn-check:checked + .btn:focus-visible, :not(.btn-check) + .btn:active:focus-visible, .btn:first-child:active:focus-visible, .btn.active:focus-visible, .btn.show:focus-visible {
|
|
box-shadow: var(--bs-btn-focus-box-shadow);
|
|
}
|
|
.btn-check:checked:focus-visible + .btn {
|
|
box-shadow: var(--bs-btn-focus-box-shadow);
|
|
}
|
|
.btn:disabled, .btn.disabled, fieldset:disabled .btn {
|
|
color: var(--bs-btn-disabled-color);
|
|
pointer-events: none;
|
|
background-color: var(--bs-btn-disabled-bg);
|
|
border-color: var(--bs-btn-disabled-border-color);
|
|
opacity: var(--bs-btn-disabled-opacity);
|
|
}
|
|
|
|
.btn-primary {
|
|
--bs-btn-color: #fff;
|
|
--bs-btn-bg: #0070f0;
|
|
--bs-btn-border-color: #0070f0;
|
|
--bs-btn-hover-color: #fff;
|
|
--bs-btn-hover-bg: #005fcc;
|
|
--bs-btn-hover-border-color: #005ac0;
|
|
--bs-btn-focus-shadow-rgb: 38, 133, 242;
|
|
--bs-btn-active-color: #fff;
|
|
--bs-btn-active-bg: #005ac0;
|
|
--bs-btn-active-border-color: #0054b4;
|
|
--bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
|
|
--bs-btn-disabled-color: #fff;
|
|
--bs-btn-disabled-bg: #0070f0;
|
|
--bs-btn-disabled-border-color: #0070f0;
|
|
}
|
|
|
|
.btn-secondary {
|
|
--bs-btn-color: #fff;
|
|
--bs-btn-bg: #6c757d;
|
|
--bs-btn-border-color: #6c757d;
|
|
--bs-btn-hover-color: #fff;
|
|
--bs-btn-hover-bg: #5c636a;
|
|
--bs-btn-hover-border-color: #565e64;
|
|
--bs-btn-focus-shadow-rgb: 130, 138, 145;
|
|
--bs-btn-active-color: #fff;
|
|
--bs-btn-active-bg: #565e64;
|
|
--bs-btn-active-border-color: #51585e;
|
|
--bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
|
|
--bs-btn-disabled-color: #fff;
|
|
--bs-btn-disabled-bg: #6c757d;
|
|
--bs-btn-disabled-border-color: #6c757d;
|
|
}
|
|
|
|
.btn-success {
|
|
--bs-btn-color: #fff;
|
|
--bs-btn-bg: #198754;
|
|
--bs-btn-border-color: #198754;
|
|
--bs-btn-hover-color: #fff;
|
|
--bs-btn-hover-bg: #157347;
|
|
--bs-btn-hover-border-color: #146c43;
|
|
--bs-btn-focus-shadow-rgb: 60, 153, 110;
|
|
--bs-btn-active-color: #fff;
|
|
--bs-btn-active-bg: #146c43;
|
|
--bs-btn-active-border-color: #13653f;
|
|
--bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
|
|
--bs-btn-disabled-color: #fff;
|
|
--bs-btn-disabled-bg: #198754;
|
|
--bs-btn-disabled-border-color: #198754;
|
|
}
|
|
|
|
.btn-info {
|
|
--bs-btn-color: #000;
|
|
--bs-btn-bg: #0dcaf0;
|
|
--bs-btn-border-color: #0dcaf0;
|
|
--bs-btn-hover-color: #000;
|
|
--bs-btn-hover-bg: #31d2f2;
|
|
--bs-btn-hover-border-color: #25cff2;
|
|
--bs-btn-focus-shadow-rgb: 11, 172, 204;
|
|
--bs-btn-active-color: #000;
|
|
--bs-btn-active-bg: #3dd5f3;
|
|
--bs-btn-active-border-color: #25cff2;
|
|
--bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
|
|
--bs-btn-disabled-color: #000;
|
|
--bs-btn-disabled-bg: #0dcaf0;
|
|
--bs-btn-disabled-border-color: #0dcaf0;
|
|
}
|
|
|
|
.btn-warning {
|
|
--bs-btn-color: #000;
|
|
--bs-btn-bg: #ffc107;
|
|
--bs-btn-border-color: #ffc107;
|
|
--bs-btn-hover-color: #000;
|
|
--bs-btn-hover-bg: #ffca2c;
|
|
--bs-btn-hover-border-color: #ffc720;
|
|
--bs-btn-focus-shadow-rgb: 217, 164, 6;
|
|
--bs-btn-active-color: #000;
|
|
--bs-btn-active-bg: #ffcd39;
|
|
--bs-btn-active-border-color: #ffc720;
|
|
--bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
|
|
--bs-btn-disabled-color: #000;
|
|
--bs-btn-disabled-bg: #ffc107;
|
|
--bs-btn-disabled-border-color: #ffc107;
|
|
}
|
|
|
|
.btn-danger {
|
|
--bs-btn-color: #fff;
|
|
--bs-btn-bg: #dc3545;
|
|
--bs-btn-border-color: #dc3545;
|
|
--bs-btn-hover-color: #fff;
|
|
--bs-btn-hover-bg: #bb2d3b;
|
|
--bs-btn-hover-border-color: #b02a37;
|
|
--bs-btn-focus-shadow-rgb: 225, 83, 97;
|
|
--bs-btn-active-color: #fff;
|
|
--bs-btn-active-bg: #b02a37;
|
|
--bs-btn-active-border-color: #a52834;
|
|
--bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
|
|
--bs-btn-disabled-color: #fff;
|
|
--bs-btn-disabled-bg: #dc3545;
|
|
--bs-btn-disabled-border-color: #dc3545;
|
|
}
|
|
|
|
.btn-light {
|
|
--bs-btn-color: #000;
|
|
--bs-btn-bg: #f8f9fa;
|
|
--bs-btn-border-color: #f8f9fa;
|
|
--bs-btn-hover-color: #000;
|
|
--bs-btn-hover-bg: #d3d4d5;
|
|
--bs-btn-hover-border-color: #c6c7c8;
|
|
--bs-btn-focus-shadow-rgb: 211, 212, 213;
|
|
--bs-btn-active-color: #000;
|
|
--bs-btn-active-bg: #c6c7c8;
|
|
--bs-btn-active-border-color: #babbbc;
|
|
--bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
|
|
--bs-btn-disabled-color: #000;
|
|
--bs-btn-disabled-bg: #f8f9fa;
|
|
--bs-btn-disabled-border-color: #f8f9fa;
|
|
}
|
|
|
|
.btn-dark {
|
|
--bs-btn-color: #fff;
|
|
--bs-btn-bg: #212529;
|
|
--bs-btn-border-color: #212529;
|
|
--bs-btn-hover-color: #fff;
|
|
--bs-btn-hover-bg: #424649;
|
|
--bs-btn-hover-border-color: #373b3e;
|
|
--bs-btn-focus-shadow-rgb: 66, 70, 73;
|
|
--bs-btn-active-color: #fff;
|
|
--bs-btn-active-bg: #4d5154;
|
|
--bs-btn-active-border-color: #373b3e;
|
|
--bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
|
|
--bs-btn-disabled-color: #fff;
|
|
--bs-btn-disabled-bg: #212529;
|
|
--bs-btn-disabled-border-color: #212529;
|
|
}
|
|
|
|
.btn-outline-primary {
|
|
--bs-btn-color: #0070f0;
|
|
--bs-btn-border-color: #0070f0;
|
|
--bs-btn-hover-color: #fff;
|
|
--bs-btn-hover-bg: #0070f0;
|
|
--bs-btn-hover-border-color: #0070f0;
|
|
--bs-btn-focus-shadow-rgb: 0, 112, 240;
|
|
--bs-btn-active-color: #fff;
|
|
--bs-btn-active-bg: #0070f0;
|
|
--bs-btn-active-border-color: #0070f0;
|
|
--bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
|
|
--bs-btn-disabled-color: #0070f0;
|
|
--bs-btn-disabled-bg: transparent;
|
|
--bs-btn-disabled-border-color: #0070f0;
|
|
--bs-gradient: none;
|
|
}
|
|
|
|
.btn-outline-secondary {
|
|
--bs-btn-color: #6c757d;
|
|
--bs-btn-border-color: #6c757d;
|
|
--bs-btn-hover-color: #fff;
|
|
--bs-btn-hover-bg: #6c757d;
|
|
--bs-btn-hover-border-color: #6c757d;
|
|
--bs-btn-focus-shadow-rgb: 108, 117, 125;
|
|
--bs-btn-active-color: #fff;
|
|
--bs-btn-active-bg: #6c757d;
|
|
--bs-btn-active-border-color: #6c757d;
|
|
--bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
|
|
--bs-btn-disabled-color: #6c757d;
|
|
--bs-btn-disabled-bg: transparent;
|
|
--bs-btn-disabled-border-color: #6c757d;
|
|
--bs-gradient: none;
|
|
}
|
|
|
|
.btn-outline-success {
|
|
--bs-btn-color: #198754;
|
|
--bs-btn-border-color: #198754;
|
|
--bs-btn-hover-color: #fff;
|
|
--bs-btn-hover-bg: #198754;
|
|
--bs-btn-hover-border-color: #198754;
|
|
--bs-btn-focus-shadow-rgb: 25, 135, 84;
|
|
--bs-btn-active-color: #fff;
|
|
--bs-btn-active-bg: #198754;
|
|
--bs-btn-active-border-color: #198754;
|
|
--bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
|
|
--bs-btn-disabled-color: #198754;
|
|
--bs-btn-disabled-bg: transparent;
|
|
--bs-btn-disabled-border-color: #198754;
|
|
--bs-gradient: none;
|
|
}
|
|
|
|
.btn-outline-info {
|
|
--bs-btn-color: #0dcaf0;
|
|
--bs-btn-border-color: #0dcaf0;
|
|
--bs-btn-hover-color: #000;
|
|
--bs-btn-hover-bg: #0dcaf0;
|
|
--bs-btn-hover-border-color: #0dcaf0;
|
|
--bs-btn-focus-shadow-rgb: 13, 202, 240;
|
|
--bs-btn-active-color: #000;
|
|
--bs-btn-active-bg: #0dcaf0;
|
|
--bs-btn-active-border-color: #0dcaf0;
|
|
--bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
|
|
--bs-btn-disabled-color: #0dcaf0;
|
|
--bs-btn-disabled-bg: transparent;
|
|
--bs-btn-disabled-border-color: #0dcaf0;
|
|
--bs-gradient: none;
|
|
}
|
|
|
|
.btn-outline-warning {
|
|
--bs-btn-color: #ffc107;
|
|
--bs-btn-border-color: #ffc107;
|
|
--bs-btn-hover-color: #000;
|
|
--bs-btn-hover-bg: #ffc107;
|
|
--bs-btn-hover-border-color: #ffc107;
|
|
--bs-btn-focus-shadow-rgb: 255, 193, 7;
|
|
--bs-btn-active-color: #000;
|
|
--bs-btn-active-bg: #ffc107;
|
|
--bs-btn-active-border-color: #ffc107;
|
|
--bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
|
|
--bs-btn-disabled-color: #ffc107;
|
|
--bs-btn-disabled-bg: transparent;
|
|
--bs-btn-disabled-border-color: #ffc107;
|
|
--bs-gradient: none;
|
|
}
|
|
|
|
.btn-outline-danger {
|
|
--bs-btn-color: #dc3545;
|
|
--bs-btn-border-color: #dc3545;
|
|
--bs-btn-hover-color: #fff;
|
|
--bs-btn-hover-bg: #dc3545;
|
|
--bs-btn-hover-border-color: #dc3545;
|
|
--bs-btn-focus-shadow-rgb: 220, 53, 69;
|
|
--bs-btn-active-color: #fff;
|
|
--bs-btn-active-bg: #dc3545;
|
|
--bs-btn-active-border-color: #dc3545;
|
|
--bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
|
|
--bs-btn-disabled-color: #dc3545;
|
|
--bs-btn-disabled-bg: transparent;
|
|
--bs-btn-disabled-border-color: #dc3545;
|
|
--bs-gradient: none;
|
|
}
|
|
|
|
.btn-outline-light {
|
|
--bs-btn-color: #f8f9fa;
|
|
--bs-btn-border-color: #f8f9fa;
|
|
--bs-btn-hover-color: #000;
|
|
--bs-btn-hover-bg: #f8f9fa;
|
|
--bs-btn-hover-border-color: #f8f9fa;
|
|
--bs-btn-focus-shadow-rgb: 248, 249, 250;
|
|
--bs-btn-active-color: #000;
|
|
--bs-btn-active-bg: #f8f9fa;
|
|
--bs-btn-active-border-color: #f8f9fa;
|
|
--bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
|
|
--bs-btn-disabled-color: #f8f9fa;
|
|
--bs-btn-disabled-bg: transparent;
|
|
--bs-btn-disabled-border-color: #f8f9fa;
|
|
--bs-gradient: none;
|
|
}
|
|
|
|
.btn-outline-dark {
|
|
--bs-btn-color: #212529;
|
|
--bs-btn-border-color: #212529;
|
|
--bs-btn-hover-color: #fff;
|
|
--bs-btn-hover-bg: #212529;
|
|
--bs-btn-hover-border-color: #212529;
|
|
--bs-btn-focus-shadow-rgb: 33, 37, 41;
|
|
--bs-btn-active-color: #fff;
|
|
--bs-btn-active-bg: #212529;
|
|
--bs-btn-active-border-color: #212529;
|
|
--bs-btn-active-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
|
|
--bs-btn-disabled-color: #212529;
|
|
--bs-btn-disabled-bg: transparent;
|
|
--bs-btn-disabled-border-color: #212529;
|
|
--bs-gradient: none;
|
|
}
|
|
|
|
.btn-link {
|
|
--bs-btn-font-weight: 400;
|
|
--bs-btn-color: var(--bs-link-color);
|
|
--bs-btn-bg: transparent;
|
|
--bs-btn-border-color: transparent;
|
|
--bs-btn-hover-color: var(--bs-link-hover-color);
|
|
--bs-btn-hover-border-color: transparent;
|
|
--bs-btn-active-color: var(--bs-link-hover-color);
|
|
--bs-btn-active-border-color: transparent;
|
|
--bs-btn-disabled-color: #6c757d;
|
|
--bs-btn-disabled-border-color: transparent;
|
|
--bs-btn-box-shadow: 0 0 0 #000;
|
|
--bs-btn-focus-shadow-rgb: 38, 133, 242;
|
|
text-decoration: underline;
|
|
}
|
|
.btn-link:focus-visible {
|
|
color: var(--bs-btn-color);
|
|
}
|
|
.btn-link:hover {
|
|
color: var(--bs-btn-hover-color);
|
|
}
|
|
|
|
.btn-lg, .btn-group-lg > .btn {
|
|
--bs-btn-padding-y: 0.5rem;
|
|
--bs-btn-padding-x: 1rem;
|
|
--bs-btn-font-size: 1.25rem;
|
|
--bs-btn-border-radius: var(--bs-border-radius-lg);
|
|
}
|
|
|
|
.btn-sm, .btn-group-sm > .btn {
|
|
--bs-btn-padding-y: 0.25rem;
|
|
--bs-btn-padding-x: 0.5rem;
|
|
--bs-btn-font-size: 0.875rem;
|
|
--bs-btn-border-radius: var(--bs-border-radius-sm);
|
|
}
|
|
|
|
.fade {
|
|
transition: opacity 0.15s linear;
|
|
}
|
|
@media (prefers-reduced-motion: reduce) {
|
|
.fade {
|
|
transition: none;
|
|
}
|
|
}
|
|
.fade:not(.show) {
|
|
opacity: 0;
|
|
}
|
|
|
|
.collapse:not(.show) {
|
|
display: none;
|
|
}
|
|
|
|
.collapsing {
|
|
height: 0;
|
|
overflow: hidden;
|
|
transition: height 0.35s ease;
|
|
}
|
|
@media (prefers-reduced-motion: reduce) {
|
|
.collapsing {
|
|
transition: none;
|
|
}
|
|
}
|
|
.collapsing.collapse-horizontal {
|
|
width: 0;
|
|
height: auto;
|
|
transition: width 0.35s ease;
|
|
}
|
|
@media (prefers-reduced-motion: reduce) {
|
|
.collapsing.collapse-horizontal {
|
|
transition: none;
|
|
}
|
|
}
|
|
|
|
.dropup,
|
|
.dropend,
|
|
.dropdown,
|
|
.dropstart,
|
|
.dropup-center,
|
|
.dropdown-center {
|
|
position: relative;
|
|
}
|
|
|
|
.dropdown-toggle {
|
|
white-space: nowrap;
|
|
}
|
|
.dropdown-toggle::after {
|
|
display: inline-block;
|
|
margin-left: 0.255em;
|
|
vertical-align: 0.255em;
|
|
content: "";
|
|
border-top: 0.3em solid;
|
|
border-right: 0.3em solid transparent;
|
|
border-bottom: 0;
|
|
border-left: 0.3em solid transparent;
|
|
}
|
|
.dropdown-toggle:empty::after {
|
|
margin-left: 0;
|
|
}
|
|
|
|
.dropdown-menu {
|
|
--bs-dropdown-zindex: 1400;
|
|
--bs-dropdown-min-width: 10rem;
|
|
--bs-dropdown-padding-x: 0;
|
|
--bs-dropdown-padding-y: 0.5rem;
|
|
--bs-dropdown-spacer: 0.125rem;
|
|
--bs-dropdown-font-size: 1rem;
|
|
--bs-dropdown-color: var(--bs-body-color);
|
|
--bs-dropdown-bg: var(--bs-body-bg);
|
|
--bs-dropdown-border-color: var(--bs-border-color-translucent);
|
|
--bs-dropdown-border-radius: var(--bs-border-radius);
|
|
--bs-dropdown-border-width: var(--bs-border-width);
|
|
--bs-dropdown-inner-border-radius: calc(var(--bs-border-radius) - var(--bs-border-width));
|
|
--bs-dropdown-divider-bg: var(--bs-border-color-translucent);
|
|
--bs-dropdown-divider-margin-y: 0.5rem;
|
|
--bs-dropdown-box-shadow: var(--bs-box-shadow);
|
|
--bs-dropdown-link-color: var(--bs-body-color);
|
|
--bs-dropdown-link-hover-color: var(--bs-body-color);
|
|
--bs-dropdown-link-hover-bg: var(--bs-tertiary-bg);
|
|
--bs-dropdown-link-active-color: #fff;
|
|
--bs-dropdown-link-active-bg: #0070f0;
|
|
--bs-dropdown-link-disabled-color: var(--bs-tertiary-color);
|
|
--bs-dropdown-item-padding-x: 1rem;
|
|
--bs-dropdown-item-padding-y: 0.25rem;
|
|
--bs-dropdown-header-color: #6c757d;
|
|
--bs-dropdown-header-padding-x: 1rem;
|
|
--bs-dropdown-header-padding-y: 0.5rem;
|
|
position: absolute;
|
|
z-index: var(--bs-dropdown-zindex);
|
|
display: none;
|
|
min-width: var(--bs-dropdown-min-width);
|
|
padding: var(--bs-dropdown-padding-y) var(--bs-dropdown-padding-x);
|
|
margin: 0;
|
|
font-size: var(--bs-dropdown-font-size);
|
|
color: var(--bs-dropdown-color);
|
|
text-align: left;
|
|
list-style: none;
|
|
background-color: var(--bs-dropdown-bg);
|
|
background-clip: padding-box;
|
|
border: var(--bs-dropdown-border-width) solid var(--bs-dropdown-border-color);
|
|
border-radius: var(--bs-dropdown-border-radius);
|
|
}
|
|
.dropdown-menu[data-bs-popper] {
|
|
top: 100%;
|
|
left: 0;
|
|
margin-top: var(--bs-dropdown-spacer);
|
|
}
|
|
|
|
.dropdown-menu-start {
|
|
--bs-position: start;
|
|
}
|
|
.dropdown-menu-start[data-bs-popper] {
|
|
right: auto;
|
|
left: 0;
|
|
}
|
|
|
|
.dropdown-menu-end {
|
|
--bs-position: end;
|
|
}
|
|
.dropdown-menu-end[data-bs-popper] {
|
|
right: 0;
|
|
left: auto;
|
|
}
|
|
|
|
@media (min-width: 576px) {
|
|
.dropdown-menu-sm-start {
|
|
--bs-position: start;
|
|
}
|
|
.dropdown-menu-sm-start[data-bs-popper] {
|
|
right: auto;
|
|
left: 0;
|
|
}
|
|
.dropdown-menu-sm-end {
|
|
--bs-position: end;
|
|
}
|
|
.dropdown-menu-sm-end[data-bs-popper] {
|
|
right: 0;
|
|
left: auto;
|
|
}
|
|
}
|
|
@media (min-width: 768px) {
|
|
.dropdown-menu-md-start {
|
|
--bs-position: start;
|
|
}
|
|
.dropdown-menu-md-start[data-bs-popper] {
|
|
right: auto;
|
|
left: 0;
|
|
}
|
|
.dropdown-menu-md-end {
|
|
--bs-position: end;
|
|
}
|
|
.dropdown-menu-md-end[data-bs-popper] {
|
|
right: 0;
|
|
left: auto;
|
|
}
|
|
}
|
|
@media (min-width: 992px) {
|
|
.dropdown-menu-lg-start {
|
|
--bs-position: start;
|
|
}
|
|
.dropdown-menu-lg-start[data-bs-popper] {
|
|
right: auto;
|
|
left: 0;
|
|
}
|
|
.dropdown-menu-lg-end {
|
|
--bs-position: end;
|
|
}
|
|
.dropdown-menu-lg-end[data-bs-popper] {
|
|
right: 0;
|
|
left: auto;
|
|
}
|
|
}
|
|
@media (min-width: 1200px) {
|
|
.dropdown-menu-xl-start {
|
|
--bs-position: start;
|
|
}
|
|
.dropdown-menu-xl-start[data-bs-popper] {
|
|
right: auto;
|
|
left: 0;
|
|
}
|
|
.dropdown-menu-xl-end {
|
|
--bs-position: end;
|
|
}
|
|
.dropdown-menu-xl-end[data-bs-popper] {
|
|
right: 0;
|
|
left: auto;
|
|
}
|
|
}
|
|
@media (min-width: 1400px) {
|
|
.dropdown-menu-xxl-start {
|
|
--bs-position: start;
|
|
}
|
|
.dropdown-menu-xxl-start[data-bs-popper] {
|
|
right: auto;
|
|
left: 0;
|
|
}
|
|
.dropdown-menu-xxl-end {
|
|
--bs-position: end;
|
|
}
|
|
.dropdown-menu-xxl-end[data-bs-popper] {
|
|
right: 0;
|
|
left: auto;
|
|
}
|
|
}
|
|
.dropup .dropdown-menu[data-bs-popper] {
|
|
top: auto;
|
|
bottom: 100%;
|
|
margin-top: 0;
|
|
margin-bottom: var(--bs-dropdown-spacer);
|
|
}
|
|
.dropup .dropdown-toggle::after {
|
|
display: inline-block;
|
|
margin-left: 0.255em;
|
|
vertical-align: 0.255em;
|
|
content: "";
|
|
border-top: 0;
|
|
border-right: 0.3em solid transparent;
|
|
border-bottom: 0.3em solid;
|
|
border-left: 0.3em solid transparent;
|
|
}
|
|
.dropup .dropdown-toggle:empty::after {
|
|
margin-left: 0;
|
|
}
|
|
|
|
.dropend .dropdown-menu[data-bs-popper] {
|
|
top: 0;
|
|
right: auto;
|
|
left: 100%;
|
|
margin-top: 0;
|
|
margin-left: var(--bs-dropdown-spacer);
|
|
}
|
|
.dropend .dropdown-toggle::after {
|
|
display: inline-block;
|
|
margin-left: 0.255em;
|
|
vertical-align: 0.255em;
|
|
content: "";
|
|
border-top: 0.3em solid transparent;
|
|
border-right: 0;
|
|
border-bottom: 0.3em solid transparent;
|
|
border-left: 0.3em solid;
|
|
}
|
|
.dropend .dropdown-toggle:empty::after {
|
|
margin-left: 0;
|
|
}
|
|
.dropend .dropdown-toggle::after {
|
|
vertical-align: 0;
|
|
}
|
|
|
|
.dropstart .dropdown-menu[data-bs-popper] {
|
|
top: 0;
|
|
right: 100%;
|
|
left: auto;
|
|
margin-top: 0;
|
|
margin-right: var(--bs-dropdown-spacer);
|
|
}
|
|
.dropstart .dropdown-toggle::after {
|
|
display: inline-block;
|
|
margin-left: 0.255em;
|
|
vertical-align: 0.255em;
|
|
content: "";
|
|
}
|
|
.dropstart .dropdown-toggle::after {
|
|
display: none;
|
|
}
|
|
.dropstart .dropdown-toggle::before {
|
|
display: inline-block;
|
|
margin-right: 0.255em;
|
|
vertical-align: 0.255em;
|
|
content: "";
|
|
border-top: 0.3em solid transparent;
|
|
border-right: 0.3em solid;
|
|
border-bottom: 0.3em solid transparent;
|
|
}
|
|
.dropstart .dropdown-toggle:empty::after {
|
|
margin-left: 0;
|
|
}
|
|
.dropstart .dropdown-toggle::before {
|
|
vertical-align: 0;
|
|
}
|
|
|
|
.dropdown-divider {
|
|
height: 0;
|
|
margin: var(--bs-dropdown-divider-margin-y) 0;
|
|
overflow: hidden;
|
|
border-top: 1px solid var(--bs-dropdown-divider-bg);
|
|
opacity: 1;
|
|
}
|
|
|
|
.dropdown-item {
|
|
display: block;
|
|
width: 100%;
|
|
padding: var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x);
|
|
clear: both;
|
|
font-weight: 400;
|
|
color: var(--bs-dropdown-link-color);
|
|
text-align: inherit;
|
|
text-decoration: none;
|
|
white-space: nowrap;
|
|
background-color: transparent;
|
|
border: 0;
|
|
border-radius: var(--bs-dropdown-item-border-radius, 0);
|
|
}
|
|
.dropdown-item:hover, .dropdown-item:focus {
|
|
color: var(--bs-dropdown-link-hover-color);
|
|
background-color: var(--bs-dropdown-link-hover-bg);
|
|
}
|
|
.dropdown-item.active, .dropdown-item:active {
|
|
color: var(--bs-dropdown-link-active-color);
|
|
text-decoration: none;
|
|
background-color: var(--bs-dropdown-link-active-bg);
|
|
}
|
|
.dropdown-item.disabled, .dropdown-item:disabled {
|
|
color: var(--bs-dropdown-link-disabled-color);
|
|
pointer-events: none;
|
|
background-color: transparent;
|
|
}
|
|
|
|
.dropdown-menu.show {
|
|
display: block;
|
|
}
|
|
|
|
.dropdown-header {
|
|
display: block;
|
|
padding: var(--bs-dropdown-header-padding-y) var(--bs-dropdown-header-padding-x);
|
|
margin-bottom: 0;
|
|
font-size: 0.875rem;
|
|
color: var(--bs-dropdown-header-color);
|
|
white-space: nowrap;
|
|
}
|
|
|
|
.dropdown-item-text {
|
|
display: block;
|
|
padding: var(--bs-dropdown-item-padding-y) var(--bs-dropdown-item-padding-x);
|
|
color: var(--bs-dropdown-link-color);
|
|
}
|
|
|
|
.dropdown-menu-dark {
|
|
--bs-dropdown-color: #dee2e6;
|
|
--bs-dropdown-bg: #343a40;
|
|
--bs-dropdown-border-color: var(--bs-border-color-translucent);
|
|
--bs-dropdown-box-shadow: ;
|
|
--bs-dropdown-link-color: #dee2e6;
|
|
--bs-dropdown-link-hover-color: #fff;
|
|
--bs-dropdown-divider-bg: var(--bs-border-color-translucent);
|
|
--bs-dropdown-link-hover-bg: rgba(255, 255, 255, 0.15);
|
|
--bs-dropdown-link-active-color: #fff;
|
|
--bs-dropdown-link-active-bg: #0070f0;
|
|
--bs-dropdown-link-disabled-color: #adb5bd;
|
|
--bs-dropdown-header-color: #adb5bd;
|
|
}
|
|
|
|
.btn-group,
|
|
.btn-group-vertical {
|
|
position: relative;
|
|
display: inline-flex;
|
|
vertical-align: middle;
|
|
}
|
|
.btn-group > .btn,
|
|
.btn-group-vertical > .btn {
|
|
position: relative;
|
|
flex: 1 1 auto;
|
|
}
|
|
.btn-group > .btn-check:checked + .btn,
|
|
.btn-group > .btn-check:focus + .btn,
|
|
.btn-group > .btn:hover,
|
|
.btn-group > .btn:focus,
|
|
.btn-group > .btn:active,
|
|
.btn-group > .btn.active,
|
|
.btn-group-vertical > .btn-check:checked + .btn,
|
|
.btn-group-vertical > .btn-check:focus + .btn,
|
|
.btn-group-vertical > .btn:hover,
|
|
.btn-group-vertical > .btn:focus,
|
|
.btn-group-vertical > .btn:active,
|
|
.btn-group-vertical > .btn.active {
|
|
z-index: 1;
|
|
}
|
|
|
|
.btn-toolbar {
|
|
display: flex;
|
|
flex-wrap: wrap;
|
|
justify-content: flex-start;
|
|
}
|
|
.btn-toolbar .input-group {
|
|
width: auto;
|
|
}
|
|
|
|
.btn-group {
|
|
border-radius: var(--bs-border-radius);
|
|
}
|
|
.btn-group > :not(.btn-check:first-child) + .btn,
|
|
.btn-group > .btn-group:not(:first-child) {
|
|
margin-left: calc(var(--bs-border-width) * -1);
|
|
}
|
|
.btn-group > .btn:not(:last-child):not(.dropdown-toggle),
|
|
.btn-group > .btn.dropdown-toggle-split:first-child,
|
|
.btn-group > .btn-group:not(:last-child) > .btn {
|
|
border-top-right-radius: 0;
|
|
border-bottom-right-radius: 0;
|
|
}
|
|
.btn-group > .btn:nth-child(n+3),
|
|
.btn-group > :not(.btn-check) + .btn,
|
|
.btn-group > .btn-group:not(:first-child) > .btn {
|
|
border-top-left-radius: 0;
|
|
border-bottom-left-radius: 0;
|
|
}
|
|
|
|
.dropdown-toggle-split {
|
|
padding-right: 0.5625rem;
|
|
padding-left: 0.5625rem;
|
|
}
|
|
.dropdown-toggle-split::after, .dropup .dropdown-toggle-split::after, .dropend .dropdown-toggle-split::after {
|
|
margin-left: 0;
|
|
}
|
|
.dropstart .dropdown-toggle-split::before {
|
|
margin-right: 0;
|
|
}
|
|
|
|
.btn-sm + .dropdown-toggle-split, .btn-group-sm > .btn + .dropdown-toggle-split {
|
|
padding-right: 0.375rem;
|
|
padding-left: 0.375rem;
|
|
}
|
|
|
|
.btn-lg + .dropdown-toggle-split, .btn-group-lg > .btn + .dropdown-toggle-split {
|
|
padding-right: 0.75rem;
|
|
padding-left: 0.75rem;
|
|
}
|
|
|
|
.btn-group-vertical {
|
|
flex-direction: column;
|
|
align-items: flex-start;
|
|
justify-content: center;
|
|
}
|
|
.btn-group-vertical > .btn,
|
|
.btn-group-vertical > .btn-group {
|
|
width: 100%;
|
|
}
|
|
.btn-group-vertical > .btn:not(:first-child),
|
|
.btn-group-vertical > .btn-group:not(:first-child) {
|
|
margin-top: calc(var(--bs-border-width) * -1);
|
|
}
|
|
.btn-group-vertical > .btn:not(:last-child):not(.dropdown-toggle),
|
|
.btn-group-vertical > .btn-group:not(:last-child) > .btn {
|
|
border-bottom-right-radius: 0;
|
|
border-bottom-left-radius: 0;
|
|
}
|
|
.btn-group-vertical > .btn ~ .btn,
|
|
.btn-group-vertical > .btn-group:not(:first-child) > .btn {
|
|
border-top-left-radius: 0;
|
|
border-top-right-radius: 0;
|
|
}
|
|
|
|
.nav {
|
|
--bs-nav-link-padding-x: 1rem;
|
|
--bs-nav-link-padding-y: 0.5rem;
|
|
--bs-nav-link-font-weight: ;
|
|
--bs-nav-link-color: var(--bs-link-color);
|
|
--bs-nav-link-hover-color: var(--bs-link-hover-color);
|
|
--bs-nav-link-disabled-color: var(--bs-secondary-color);
|
|
display: flex;
|
|
flex-wrap: wrap;
|
|
padding-left: 0;
|
|
margin-bottom: 0;
|
|
list-style: none;
|
|
}
|
|
|
|
.nav-link {
|
|
display: block;
|
|
padding: var(--bs-nav-link-padding-y) var(--bs-nav-link-padding-x);
|
|
font-size: var(--bs-nav-link-font-size);
|
|
font-weight: var(--bs-nav-link-font-weight);
|
|
color: var(--bs-nav-link-color);
|
|
text-decoration: none;
|
|
background: none;
|
|
border: 0;
|
|
transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out;
|
|
}
|
|
@media (prefers-reduced-motion: reduce) {
|
|
.nav-link {
|
|
transition: none;
|
|
}
|
|
}
|
|
.nav-link:hover, .nav-link:focus {
|
|
color: var(--bs-nav-link-hover-color);
|
|
}
|
|
.nav-link:focus-visible {
|
|
outline: 0;
|
|
box-shadow: 0 0 0 0.25rem rgba(0, 112, 240, 0.25);
|
|
}
|
|
.nav-link.disabled, .nav-link:disabled {
|
|
color: var(--bs-nav-link-disabled-color);
|
|
pointer-events: none;
|
|
cursor: default;
|
|
}
|
|
|
|
.nav-tabs {
|
|
--bs-nav-tabs-border-width: var(--bs-border-width);
|
|
--bs-nav-tabs-border-color: var(--bs-border-color);
|
|
--bs-nav-tabs-border-radius: var(--bs-border-radius);
|
|
--bs-nav-tabs-link-hover-border-color: var(--bs-secondary-bg) var(--bs-secondary-bg) var(--bs-border-color);
|
|
--bs-nav-tabs-link-active-color: var(--bs-emphasis-color);
|
|
--bs-nav-tabs-link-active-bg: var(--bs-body-bg);
|
|
--bs-nav-tabs-link-active-border-color: var(--bs-border-color) var(--bs-border-color) var(--bs-body-bg);
|
|
border-bottom: var(--bs-nav-tabs-border-width) solid var(--bs-nav-tabs-border-color);
|
|
}
|
|
.nav-tabs .nav-link {
|
|
margin-bottom: calc(-1 * var(--bs-nav-tabs-border-width));
|
|
border: var(--bs-nav-tabs-border-width) solid transparent;
|
|
border-top-left-radius: var(--bs-nav-tabs-border-radius);
|
|
border-top-right-radius: var(--bs-nav-tabs-border-radius);
|
|
}
|
|
.nav-tabs .nav-link:hover, .nav-tabs .nav-link:focus {
|
|
isolation: isolate;
|
|
border-color: var(--bs-nav-tabs-link-hover-border-color);
|
|
}
|
|
.nav-tabs .nav-link.active,
|
|
.nav-tabs .nav-item.show .nav-link {
|
|
color: var(--bs-nav-tabs-link-active-color);
|
|
background-color: var(--bs-nav-tabs-link-active-bg);
|
|
border-color: var(--bs-nav-tabs-link-active-border-color);
|
|
}
|
|
.nav-tabs .dropdown-menu {
|
|
margin-top: calc(-1 * var(--bs-nav-tabs-border-width));
|
|
border-top-left-radius: 0;
|
|
border-top-right-radius: 0;
|
|
}
|
|
|
|
.nav-pills {
|
|
--bs-nav-pills-border-radius: var(--bs-border-radius);
|
|
--bs-nav-pills-link-active-color: #fff;
|
|
--bs-nav-pills-link-active-bg: #0070f0;
|
|
}
|
|
.nav-pills .nav-link {
|
|
border-radius: var(--bs-nav-pills-border-radius);
|
|
}
|
|
.nav-pills .nav-link.active,
|
|
.nav-pills .show > .nav-link {
|
|
color: var(--bs-nav-pills-link-active-color);
|
|
background-color: var(--bs-nav-pills-link-active-bg);
|
|
}
|
|
|
|
.nav-underline {
|
|
--bs-nav-underline-gap: 1rem;
|
|
--bs-nav-underline-border-width: 0.125rem;
|
|
--bs-nav-underline-link-active-color: var(--bs-emphasis-color);
|
|
gap: var(--bs-nav-underline-gap);
|
|
}
|
|
.nav-underline .nav-link {
|
|
padding-right: 0;
|
|
padding-left: 0;
|
|
border-bottom: var(--bs-nav-underline-border-width) solid transparent;
|
|
}
|
|
.nav-underline .nav-link:hover, .nav-underline .nav-link:focus {
|
|
border-bottom-color: currentcolor;
|
|
}
|
|
.nav-underline .nav-link.active,
|
|
.nav-underline .show > .nav-link {
|
|
font-weight: 700;
|
|
color: var(--bs-nav-underline-link-active-color);
|
|
border-bottom-color: currentcolor;
|
|
}
|
|
|
|
.nav-fill > .nav-link,
|
|
.nav-fill .nav-item {
|
|
flex: 1 1 auto;
|
|
text-align: center;
|
|
}
|
|
|
|
.nav-justified > .nav-link,
|
|
.nav-justified .nav-item {
|
|
flex-basis: 0;
|
|
flex-grow: 1;
|
|
text-align: center;
|
|
}
|
|
|
|
.nav-fill .nav-item .nav-link,
|
|
.nav-justified .nav-item .nav-link {
|
|
width: 100%;
|
|
}
|
|
|
|
.tab-content > .tab-pane {
|
|
display: none;
|
|
}
|
|
.tab-content > .active {
|
|
display: block;
|
|
}
|
|
|
|
.navbar {
|
|
--bs-navbar-padding-x: 0;
|
|
--bs-navbar-padding-y: 0.5rem;
|
|
--bs-navbar-color: rgba(var(--bs-emphasis-color-rgb), 0.65);
|
|
--bs-navbar-hover-color: rgba(var(--bs-emphasis-color-rgb), 0.8);
|
|
--bs-navbar-disabled-color: rgba(var(--bs-emphasis-color-rgb), 0.3);
|
|
--bs-navbar-active-color: rgba(var(--bs-emphasis-color-rgb), 1);
|
|
--bs-navbar-brand-padding-y: 0.3125rem;
|
|
--bs-navbar-brand-margin-end: 1rem;
|
|
--bs-navbar-brand-font-size: 1.25rem;
|
|
--bs-navbar-brand-color: rgba(var(--bs-emphasis-color-rgb), 1);
|
|
--bs-navbar-brand-hover-color: rgba(var(--bs-emphasis-color-rgb), 1);
|
|
--bs-navbar-nav-link-padding-x: 0.5rem;
|
|
--bs-navbar-toggler-padding-y: 0.25rem;
|
|
--bs-navbar-toggler-padding-x: 0.75rem;
|
|
--bs-navbar-toggler-font-size: 1.25rem;
|
|
--bs-navbar-toggler-icon-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%2833, 37, 41, 0.75%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e");
|
|
--bs-navbar-toggler-border-color: rgba(var(--bs-emphasis-color-rgb), 0.15);
|
|
--bs-navbar-toggler-border-radius: var(--bs-border-radius);
|
|
--bs-navbar-toggler-focus-width: 0.25rem;
|
|
--bs-navbar-toggler-transition: box-shadow 0.15s ease-in-out;
|
|
position: relative;
|
|
display: flex;
|
|
flex-wrap: wrap;
|
|
align-items: center;
|
|
justify-content: space-between;
|
|
padding: var(--bs-navbar-padding-y) var(--bs-navbar-padding-x);
|
|
}
|
|
.navbar > .container,
|
|
.navbar > .container-fluid,
|
|
.navbar > .container-sm,
|
|
.navbar > .container-md,
|
|
.navbar > .container-lg,
|
|
.navbar > .container-xl,
|
|
.navbar > .container-xxl {
|
|
display: flex;
|
|
flex-wrap: inherit;
|
|
align-items: center;
|
|
justify-content: space-between;
|
|
}
|
|
.navbar-brand {
|
|
padding-top: var(--bs-navbar-brand-padding-y);
|
|
padding-bottom: var(--bs-navbar-brand-padding-y);
|
|
margin-right: var(--bs-navbar-brand-margin-end);
|
|
font-size: var(--bs-navbar-brand-font-size);
|
|
color: var(--bs-navbar-brand-color);
|
|
text-decoration: none;
|
|
white-space: nowrap;
|
|
}
|
|
.navbar-brand:hover, .navbar-brand:focus {
|
|
color: var(--bs-navbar-brand-hover-color);
|
|
}
|
|
|
|
.navbar-nav {
|
|
--bs-nav-link-padding-x: 0;
|
|
--bs-nav-link-padding-y: 0.5rem;
|
|
--bs-nav-link-font-weight: ;
|
|
--bs-nav-link-color: var(--bs-navbar-color);
|
|
--bs-nav-link-hover-color: var(--bs-navbar-hover-color);
|
|
--bs-nav-link-disabled-color: var(--bs-navbar-disabled-color);
|
|
display: flex;
|
|
flex-direction: column;
|
|
padding-left: 0;
|
|
margin-bottom: 0;
|
|
list-style: none;
|
|
}
|
|
.navbar-nav .nav-link.active, .navbar-nav .nav-link.show {
|
|
color: var(--bs-navbar-active-color);
|
|
}
|
|
.navbar-nav .dropdown-menu {
|
|
position: static;
|
|
}
|
|
|
|
.navbar-text {
|
|
padding-top: 0.5rem;
|
|
padding-bottom: 0.5rem;
|
|
color: var(--bs-navbar-color);
|
|
}
|
|
.navbar-text a,
|
|
.navbar-text a:hover,
|
|
.navbar-text a:focus {
|
|
color: var(--bs-navbar-active-color);
|
|
}
|
|
|
|
.navbar-collapse {
|
|
flex-basis: 100%;
|
|
flex-grow: 1;
|
|
align-items: center;
|
|
}
|
|
|
|
.navbar-toggler {
|
|
padding: var(--bs-navbar-toggler-padding-y) var(--bs-navbar-toggler-padding-x);
|
|
font-size: var(--bs-navbar-toggler-font-size);
|
|
line-height: 1;
|
|
color: var(--bs-navbar-color);
|
|
background-color: transparent;
|
|
border: var(--bs-border-width) solid var(--bs-navbar-toggler-border-color);
|
|
border-radius: var(--bs-navbar-toggler-border-radius);
|
|
transition: var(--bs-navbar-toggler-transition);
|
|
}
|
|
@media (prefers-reduced-motion: reduce) {
|
|
.navbar-toggler {
|
|
transition: none;
|
|
}
|
|
}
|
|
.navbar-toggler:hover {
|
|
text-decoration: none;
|
|
}
|
|
.navbar-toggler:focus {
|
|
text-decoration: none;
|
|
outline: 0;
|
|
box-shadow: 0 0 0 var(--bs-navbar-toggler-focus-width);
|
|
}
|
|
|
|
.navbar-toggler-icon {
|
|
display: inline-block;
|
|
width: 1.5em;
|
|
height: 1.5em;
|
|
vertical-align: middle;
|
|
background-image: var(--bs-navbar-toggler-icon-bg);
|
|
background-repeat: no-repeat;
|
|
background-position: center;
|
|
background-size: 100%;
|
|
}
|
|
|
|
.navbar-nav-scroll {
|
|
max-height: var(--bs-scroll-height, 75vh);
|
|
overflow-y: auto;
|
|
}
|
|
|
|
@media (min-width: 576px) {
|
|
.navbar-expand-sm {
|
|
flex-wrap: nowrap;
|
|
justify-content: flex-start;
|
|
}
|
|
.navbar-expand-sm .navbar-nav {
|
|
flex-direction: row;
|
|
}
|
|
.navbar-expand-sm .navbar-nav .dropdown-menu {
|
|
position: absolute;
|
|
}
|
|
.navbar-expand-sm .navbar-nav .nav-link {
|
|
padding-right: var(--bs-navbar-nav-link-padding-x);
|
|
padding-left: var(--bs-navbar-nav-link-padding-x);
|
|
}
|
|
.navbar-expand-sm .navbar-nav-scroll {
|
|
overflow: visible;
|
|
}
|
|
.navbar-expand-sm .navbar-collapse {
|
|
display: flex !important;
|
|
flex-basis: auto;
|
|
}
|
|
.navbar-expand-sm .navbar-toggler {
|
|
display: none;
|
|
}
|
|
.navbar-expand-sm .offcanvas {
|
|
position: static;
|
|
z-index: auto;
|
|
flex-grow: 1;
|
|
width: auto !important;
|
|
height: auto !important;
|
|
visibility: visible !important;
|
|
background-color: transparent !important;
|
|
border: 0 !important;
|
|
transform: none !important;
|
|
transition: none;
|
|
}
|
|
.navbar-expand-sm .offcanvas .offcanvas-header {
|
|
display: none;
|
|
}
|
|
.navbar-expand-sm .offcanvas .offcanvas-body {
|
|
display: flex;
|
|
flex-grow: 0;
|
|
padding: 0;
|
|
overflow-y: visible;
|
|
}
|
|
}
|
|
@media (min-width: 768px) {
|
|
.navbar-expand-md {
|
|
flex-wrap: nowrap;
|
|
justify-content: flex-start;
|
|
}
|
|
.navbar-expand-md .navbar-nav {
|
|
flex-direction: row;
|
|
}
|
|
.navbar-expand-md .navbar-nav .dropdown-menu {
|
|
position: absolute;
|
|
}
|
|
.navbar-expand-md .navbar-nav .nav-link {
|
|
padding-right: var(--bs-navbar-nav-link-padding-x);
|
|
padding-left: var(--bs-navbar-nav-link-padding-x);
|
|
}
|
|
.navbar-expand-md .navbar-nav-scroll {
|
|
overflow: visible;
|
|
}
|
|
.navbar-expand-md .navbar-collapse {
|
|
display: flex !important;
|
|
flex-basis: auto;
|
|
}
|
|
.navbar-expand-md .navbar-toggler {
|
|
display: none;
|
|
}
|
|
.navbar-expand-md .offcanvas {
|
|
position: static;
|
|
z-index: auto;
|
|
flex-grow: 1;
|
|
width: auto !important;
|
|
height: auto !important;
|
|
visibility: visible !important;
|
|
background-color: transparent !important;
|
|
border: 0 !important;
|
|
transform: none !important;
|
|
transition: none;
|
|
}
|
|
.navbar-expand-md .offcanvas .offcanvas-header {
|
|
display: none;
|
|
}
|
|
.navbar-expand-md .offcanvas .offcanvas-body {
|
|
display: flex;
|
|
flex-grow: 0;
|
|
padding: 0;
|
|
overflow-y: visible;
|
|
}
|
|
}
|
|
@media (min-width: 992px) {
|
|
.navbar-expand-lg {
|
|
flex-wrap: nowrap;
|
|
justify-content: flex-start;
|
|
}
|
|
.navbar-expand-lg .navbar-nav {
|
|
flex-direction: row;
|
|
}
|
|
.navbar-expand-lg .navbar-nav .dropdown-menu {
|
|
position: absolute;
|
|
}
|
|
.navbar-expand-lg .navbar-nav .nav-link {
|
|
padding-right: var(--bs-navbar-nav-link-padding-x);
|
|
padding-left: var(--bs-navbar-nav-link-padding-x);
|
|
}
|
|
.navbar-expand-lg .navbar-nav-scroll {
|
|
overflow: visible;
|
|
}
|
|
.navbar-expand-lg .navbar-collapse {
|
|
display: flex !important;
|
|
flex-basis: auto;
|
|
}
|
|
.navbar-expand-lg .navbar-toggler {
|
|
display: none;
|
|
}
|
|
.navbar-expand-lg .offcanvas {
|
|
position: static;
|
|
z-index: auto;
|
|
flex-grow: 1;
|
|
width: auto !important;
|
|
height: auto !important;
|
|
visibility: visible !important;
|
|
background-color: transparent !important;
|
|
border: 0 !important;
|
|
transform: none !important;
|
|
transition: none;
|
|
}
|
|
.navbar-expand-lg .offcanvas .offcanvas-header {
|
|
display: none;
|
|
}
|
|
.navbar-expand-lg .offcanvas .offcanvas-body {
|
|
display: flex;
|
|
flex-grow: 0;
|
|
padding: 0;
|
|
overflow-y: visible;
|
|
}
|
|
}
|
|
@media (min-width: 1200px) {
|
|
.navbar-expand-xl {
|
|
flex-wrap: nowrap;
|
|
justify-content: flex-start;
|
|
}
|
|
.navbar-expand-xl .navbar-nav {
|
|
flex-direction: row;
|
|
}
|
|
.navbar-expand-xl .navbar-nav .dropdown-menu {
|
|
position: absolute;
|
|
}
|
|
.navbar-expand-xl .navbar-nav .nav-link {
|
|
padding-right: var(--bs-navbar-nav-link-padding-x);
|
|
padding-left: var(--bs-navbar-nav-link-padding-x);
|
|
}
|
|
.navbar-expand-xl .navbar-nav-scroll {
|
|
overflow: visible;
|
|
}
|
|
.navbar-expand-xl .navbar-collapse {
|
|
display: flex !important;
|
|
flex-basis: auto;
|
|
}
|
|
.navbar-expand-xl .navbar-toggler {
|
|
display: none;
|
|
}
|
|
.navbar-expand-xl .offcanvas {
|
|
position: static;
|
|
z-index: auto;
|
|
flex-grow: 1;
|
|
width: auto !important;
|
|
height: auto !important;
|
|
visibility: visible !important;
|
|
background-color: transparent !important;
|
|
border: 0 !important;
|
|
transform: none !important;
|
|
transition: none;
|
|
}
|
|
.navbar-expand-xl .offcanvas .offcanvas-header {
|
|
display: none;
|
|
}
|
|
.navbar-expand-xl .offcanvas .offcanvas-body {
|
|
display: flex;
|
|
flex-grow: 0;
|
|
padding: 0;
|
|
overflow-y: visible;
|
|
}
|
|
}
|
|
@media (min-width: 1400px) {
|
|
.navbar-expand-xxl {
|
|
flex-wrap: nowrap;
|
|
justify-content: flex-start;
|
|
}
|
|
.navbar-expand-xxl .navbar-nav {
|
|
flex-direction: row;
|
|
}
|
|
.navbar-expand-xxl .navbar-nav .dropdown-menu {
|
|
position: absolute;
|
|
}
|
|
.navbar-expand-xxl .navbar-nav .nav-link {
|
|
padding-right: var(--bs-navbar-nav-link-padding-x);
|
|
padding-left: var(--bs-navbar-nav-link-padding-x);
|
|
}
|
|
.navbar-expand-xxl .navbar-nav-scroll {
|
|
overflow: visible;
|
|
}
|
|
.navbar-expand-xxl .navbar-collapse {
|
|
display: flex !important;
|
|
flex-basis: auto;
|
|
}
|
|
.navbar-expand-xxl .navbar-toggler {
|
|
display: none;
|
|
}
|
|
.navbar-expand-xxl .offcanvas {
|
|
position: static;
|
|
z-index: auto;
|
|
flex-grow: 1;
|
|
width: auto !important;
|
|
height: auto !important;
|
|
visibility: visible !important;
|
|
background-color: transparent !important;
|
|
border: 0 !important;
|
|
transform: none !important;
|
|
transition: none;
|
|
}
|
|
.navbar-expand-xxl .offcanvas .offcanvas-header {
|
|
display: none;
|
|
}
|
|
.navbar-expand-xxl .offcanvas .offcanvas-body {
|
|
display: flex;
|
|
flex-grow: 0;
|
|
padding: 0;
|
|
overflow-y: visible;
|
|
}
|
|
}
|
|
.navbar-expand {
|
|
flex-wrap: nowrap;
|
|
justify-content: flex-start;
|
|
}
|
|
.navbar-expand .navbar-nav {
|
|
flex-direction: row;
|
|
}
|
|
.navbar-expand .navbar-nav .dropdown-menu {
|
|
position: absolute;
|
|
}
|
|
.navbar-expand .navbar-nav .nav-link {
|
|
padding-right: var(--bs-navbar-nav-link-padding-x);
|
|
padding-left: var(--bs-navbar-nav-link-padding-x);
|
|
}
|
|
.navbar-expand .navbar-nav-scroll {
|
|
overflow: visible;
|
|
}
|
|
.navbar-expand .navbar-collapse {
|
|
display: flex !important;
|
|
flex-basis: auto;
|
|
}
|
|
.navbar-expand .navbar-toggler {
|
|
display: none;
|
|
}
|
|
.navbar-expand .offcanvas {
|
|
position: static;
|
|
z-index: auto;
|
|
flex-grow: 1;
|
|
width: auto !important;
|
|
height: auto !important;
|
|
visibility: visible !important;
|
|
background-color: transparent !important;
|
|
border: 0 !important;
|
|
transform: none !important;
|
|
transition: none;
|
|
}
|
|
.navbar-expand .offcanvas .offcanvas-header {
|
|
display: none;
|
|
}
|
|
.navbar-expand .offcanvas .offcanvas-body {
|
|
display: flex;
|
|
flex-grow: 0;
|
|
padding: 0;
|
|
overflow-y: visible;
|
|
}
|
|
|
|
.navbar-dark,
|
|
.navbar[data-bs-theme=dark] {
|
|
--bs-navbar-color: rgba(255, 255, 255, 0.55);
|
|
--bs-navbar-hover-color: rgba(255, 255, 255, 0.75);
|
|
--bs-navbar-disabled-color: rgba(255, 255, 255, 0.25);
|
|
--bs-navbar-active-color: #fff;
|
|
--bs-navbar-brand-color: #fff;
|
|
--bs-navbar-brand-hover-color: #fff;
|
|
--bs-navbar-toggler-border-color: rgba(255, 255, 255, 0.1);
|
|
--bs-navbar-toggler-icon-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%28255, 255, 255, 0.55%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e");
|
|
}
|
|
|
|
[data-bs-theme=dark] .navbar-toggler-icon {
|
|
--bs-navbar-toggler-icon-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 30 30'%3e%3cpath stroke='rgba%28255, 255, 255, 0.55%29' stroke-linecap='round' stroke-miterlimit='10' stroke-width='2' d='M4 7h22M4 15h22M4 23h22'/%3e%3c/svg%3e");
|
|
}
|
|
|
|
.card {
|
|
--bs-card-spacer-y: 1rem;
|
|
--bs-card-spacer-x: 1rem;
|
|
--bs-card-title-spacer-y: 0.5rem;
|
|
--bs-card-title-color: ;
|
|
--bs-card-subtitle-color: ;
|
|
--bs-card-border-width: var(--bs-border-width);
|
|
--bs-card-border-color: var(--bs-border-color);
|
|
--bs-card-border-radius: var(--bs-border-radius);
|
|
--bs-card-box-shadow: ;
|
|
--bs-card-inner-border-radius: calc(var(--bs-border-radius) - (var(--bs-border-width)));
|
|
--bs-card-cap-padding-y: 0.5rem;
|
|
--bs-card-cap-padding-x: 1rem;
|
|
--bs-card-cap-bg: rgba(var(--bs-body-color-rgb), 0.02);
|
|
--bs-card-cap-color: ;
|
|
--bs-card-height: ;
|
|
--bs-card-color: ;
|
|
--bs-card-bg: var(--bs-body-bg);
|
|
--bs-card-img-overlay-padding: 1rem;
|
|
--bs-card-group-margin: 0.75rem;
|
|
position: relative;
|
|
display: flex;
|
|
flex-direction: column;
|
|
min-width: 0;
|
|
height: var(--bs-card-height);
|
|
color: var(--bs-body-color);
|
|
word-wrap: break-word;
|
|
background-color: var(--bs-card-bg);
|
|
background-clip: border-box;
|
|
border: var(--bs-card-border-width) solid var(--bs-card-border-color);
|
|
border-radius: var(--bs-card-border-radius);
|
|
}
|
|
.card > hr {
|
|
margin-right: 0;
|
|
margin-left: 0;
|
|
}
|
|
.card > .list-group {
|
|
border-top: inherit;
|
|
border-bottom: inherit;
|
|
}
|
|
.card > .list-group:first-child {
|
|
border-top-width: 0;
|
|
border-top-left-radius: var(--bs-card-inner-border-radius);
|
|
border-top-right-radius: var(--bs-card-inner-border-radius);
|
|
}
|
|
.card > .list-group:last-child {
|
|
border-bottom-width: 0;
|
|
border-bottom-right-radius: var(--bs-card-inner-border-radius);
|
|
border-bottom-left-radius: var(--bs-card-inner-border-radius);
|
|
}
|
|
.card > .card-header + .list-group,
|
|
.card > .list-group + .card-footer {
|
|
border-top: 0;
|
|
}
|
|
|
|
.card-body {
|
|
flex: 1 1 auto;
|
|
padding: var(--bs-card-spacer-y) var(--bs-card-spacer-x);
|
|
color: var(--bs-card-color);
|
|
}
|
|
|
|
.card-title {
|
|
margin-bottom: var(--bs-card-title-spacer-y);
|
|
color: var(--bs-card-title-color);
|
|
}
|
|
|
|
.card-subtitle {
|
|
margin-top: calc(-0.5 * var(--bs-card-title-spacer-y));
|
|
margin-bottom: 0;
|
|
color: var(--bs-card-subtitle-color);
|
|
}
|
|
|
|
.card-text:last-child {
|
|
margin-bottom: 0;
|
|
}
|
|
|
|
.card-link + .card-link {
|
|
margin-left: var(--bs-card-spacer-x);
|
|
}
|
|
|
|
.card-header {
|
|
padding: var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x);
|
|
margin-bottom: 0;
|
|
color: var(--bs-card-cap-color);
|
|
background-color: var(--bs-card-cap-bg);
|
|
border-bottom: var(--bs-card-border-width) solid var(--bs-card-border-color);
|
|
}
|
|
.card-header:first-child {
|
|
border-radius: var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius) 0 0;
|
|
}
|
|
|
|
.card-footer {
|
|
padding: var(--bs-card-cap-padding-y) var(--bs-card-cap-padding-x);
|
|
color: var(--bs-card-cap-color);
|
|
background-color: var(--bs-card-cap-bg);
|
|
border-top: var(--bs-card-border-width) solid var(--bs-card-border-color);
|
|
}
|
|
.card-footer:last-child {
|
|
border-radius: 0 0 var(--bs-card-inner-border-radius) var(--bs-card-inner-border-radius);
|
|
}
|
|
|
|
.card-header-tabs {
|
|
margin-right: calc(-0.5 * var(--bs-card-cap-padding-x));
|
|
margin-bottom: calc(-1 * var(--bs-card-cap-padding-y));
|
|
margin-left: calc(-0.5 * var(--bs-card-cap-padding-x));
|
|
border-bottom: 0;
|
|
}
|
|
.card-header-tabs .nav-link.active {
|
|
background-color: var(--bs-card-bg);
|
|
border-bottom-color: var(--bs-card-bg);
|
|
}
|
|
|
|
.card-header-pills {
|
|
margin-right: calc(-0.5 * var(--bs-card-cap-padding-x));
|
|
margin-left: calc(-0.5 * var(--bs-card-cap-padding-x));
|
|
}
|
|
|
|
.card-img-overlay {
|
|
position: absolute;
|
|
top: 0;
|
|
right: 0;
|
|
bottom: 0;
|
|
left: 0;
|
|
padding: var(--bs-card-img-overlay-padding);
|
|
border-radius: var(--bs-card-inner-border-radius);
|
|
}
|
|
|
|
.card-img,
|
|
.card-img-top,
|
|
.card-img-bottom {
|
|
width: 100%;
|
|
}
|
|
|
|
.card-img,
|
|
.card-img-top {
|
|
border-top-left-radius: var(--bs-card-inner-border-radius);
|
|
border-top-right-radius: var(--bs-card-inner-border-radius);
|
|
}
|
|
|
|
.card-img,
|
|
.card-img-bottom {
|
|
border-bottom-right-radius: var(--bs-card-inner-border-radius);
|
|
border-bottom-left-radius: var(--bs-card-inner-border-radius);
|
|
}
|
|
|
|
.card-group > .card {
|
|
margin-bottom: var(--bs-card-group-margin);
|
|
}
|
|
@media (min-width: 576px) {
|
|
.card-group {
|
|
display: flex;
|
|
flex-flow: row wrap;
|
|
}
|
|
.card-group > .card {
|
|
flex: 1 0 0%;
|
|
margin-bottom: 0;
|
|
}
|
|
.card-group > .card + .card {
|
|
margin-left: 0;
|
|
border-left: 0;
|
|
}
|
|
.card-group > .card:not(:last-child) {
|
|
border-top-right-radius: 0;
|
|
border-bottom-right-radius: 0;
|
|
}
|
|
.card-group > .card:not(:last-child) .card-img-top,
|
|
.card-group > .card:not(:last-child) .card-header {
|
|
border-top-right-radius: 0;
|
|
}
|
|
.card-group > .card:not(:last-child) .card-img-bottom,
|
|
.card-group > .card:not(:last-child) .card-footer {
|
|
border-bottom-right-radius: 0;
|
|
}
|
|
.card-group > .card:not(:first-child) {
|
|
border-top-left-radius: 0;
|
|
border-bottom-left-radius: 0;
|
|
}
|
|
.card-group > .card:not(:first-child) .card-img-top,
|
|
.card-group > .card:not(:first-child) .card-header {
|
|
border-top-left-radius: 0;
|
|
}
|
|
.card-group > .card:not(:first-child) .card-img-bottom,
|
|
.card-group > .card:not(:first-child) .card-footer {
|
|
border-bottom-left-radius: 0;
|
|
}
|
|
}
|
|
|
|
.accordion {
|
|
--bs-accordion-color: var(--bs-body-color);
|
|
--bs-accordion-bg: var(--bs-body-bg);
|
|
--bs-accordion-transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out, border-radius 0.15s ease;
|
|
--bs-accordion-border-color: var(--bs-border-color);
|
|
--bs-accordion-border-width: var(--bs-border-width);
|
|
--bs-accordion-border-radius: var(--bs-border-radius);
|
|
--bs-accordion-inner-border-radius: calc(var(--bs-border-radius) - (var(--bs-border-width)));
|
|
--bs-accordion-btn-padding-x: 1.25rem;
|
|
--bs-accordion-btn-padding-y: 1rem;
|
|
--bs-accordion-btn-color: var(--bs-body-color);
|
|
--bs-accordion-btn-bg: var(--bs-accordion-bg);
|
|
--bs-accordion-btn-icon: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='none' stroke='%23212529' stroke-linecap='round' stroke-linejoin='round'%3e%3cpath d='M2 5L8 11L14 5'/%3e%3c/svg%3e");
|
|
--bs-accordion-btn-icon-width: 1.25rem;
|
|
--bs-accordion-btn-icon-transform: rotate(-180deg);
|
|
--bs-accordion-btn-icon-transition: transform 0.2s ease-in-out;
|
|
--bs-accordion-btn-active-icon: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='none' stroke='%23002d60' stroke-linecap='round' stroke-linejoin='round'%3e%3cpath d='M2 5L8 11L14 5'/%3e%3c/svg%3e");
|
|
--bs-accordion-btn-focus-box-shadow: 0 0 0 0.25rem rgba(0, 112, 240, 0.25);
|
|
--bs-accordion-body-padding-x: 1.25rem;
|
|
--bs-accordion-body-padding-y: 1rem;
|
|
--bs-accordion-active-color: var(--bs-primary-text-emphasis);
|
|
--bs-accordion-active-bg: var(--bs-primary-bg-subtle);
|
|
}
|
|
|
|
.accordion-button {
|
|
position: relative;
|
|
display: flex;
|
|
align-items: center;
|
|
width: 100%;
|
|
padding: var(--bs-accordion-btn-padding-y) var(--bs-accordion-btn-padding-x);
|
|
font-size: 1rem;
|
|
color: var(--bs-accordion-btn-color);
|
|
text-align: left;
|
|
background-color: var(--bs-accordion-btn-bg);
|
|
border: 0;
|
|
border-radius: 0;
|
|
overflow-anchor: none;
|
|
transition: var(--bs-accordion-transition);
|
|
}
|
|
@media (prefers-reduced-motion: reduce) {
|
|
.accordion-button {
|
|
transition: none;
|
|
}
|
|
}
|
|
.accordion-button:not(.collapsed) {
|
|
color: var(--bs-accordion-active-color);
|
|
background-color: var(--bs-accordion-active-bg);
|
|
box-shadow: inset 0 calc(-1 * var(--bs-accordion-border-width)) 0 var(--bs-accordion-border-color);
|
|
}
|
|
.accordion-button:not(.collapsed)::after {
|
|
background-image: var(--bs-accordion-btn-active-icon);
|
|
transform: var(--bs-accordion-btn-icon-transform);
|
|
}
|
|
.accordion-button::after {
|
|
flex-shrink: 0;
|
|
width: var(--bs-accordion-btn-icon-width);
|
|
height: var(--bs-accordion-btn-icon-width);
|
|
margin-left: auto;
|
|
content: "";
|
|
background-image: var(--bs-accordion-btn-icon);
|
|
background-repeat: no-repeat;
|
|
background-size: var(--bs-accordion-btn-icon-width);
|
|
transition: var(--bs-accordion-btn-icon-transition);
|
|
}
|
|
@media (prefers-reduced-motion: reduce) {
|
|
.accordion-button::after {
|
|
transition: none;
|
|
}
|
|
}
|
|
.accordion-button:hover {
|
|
z-index: 2;
|
|
}
|
|
.accordion-button:focus {
|
|
z-index: 3;
|
|
outline: 0;
|
|
box-shadow: var(--bs-accordion-btn-focus-box-shadow);
|
|
}
|
|
|
|
.accordion-header {
|
|
margin-bottom: 0;
|
|
}
|
|
|
|
.accordion-item {
|
|
color: var(--bs-accordion-color);
|
|
background-color: var(--bs-accordion-bg);
|
|
border: var(--bs-accordion-border-width) solid var(--bs-accordion-border-color);
|
|
}
|
|
.accordion-item:first-of-type {
|
|
border-top-left-radius: var(--bs-accordion-border-radius);
|
|
border-top-right-radius: var(--bs-accordion-border-radius);
|
|
}
|
|
.accordion-item:first-of-type > .accordion-header .accordion-button {
|
|
border-top-left-radius: var(--bs-accordion-inner-border-radius);
|
|
border-top-right-radius: var(--bs-accordion-inner-border-radius);
|
|
}
|
|
.accordion-item:not(:first-of-type) {
|
|
border-top: 0;
|
|
}
|
|
.accordion-item:last-of-type {
|
|
border-bottom-right-radius: var(--bs-accordion-border-radius);
|
|
border-bottom-left-radius: var(--bs-accordion-border-radius);
|
|
}
|
|
.accordion-item:last-of-type > .accordion-header .accordion-button.collapsed {
|
|
border-bottom-right-radius: var(--bs-accordion-inner-border-radius);
|
|
border-bottom-left-radius: var(--bs-accordion-inner-border-radius);
|
|
}
|
|
.accordion-item:last-of-type > .accordion-collapse {
|
|
border-bottom-right-radius: var(--bs-accordion-border-radius);
|
|
border-bottom-left-radius: var(--bs-accordion-border-radius);
|
|
}
|
|
|
|
.accordion-body {
|
|
padding: var(--bs-accordion-body-padding-y) var(--bs-accordion-body-padding-x);
|
|
}
|
|
|
|
.accordion-flush > .accordion-item {
|
|
border-right: 0;
|
|
border-left: 0;
|
|
border-radius: 0;
|
|
}
|
|
.accordion-flush > .accordion-item:first-child {
|
|
border-top: 0;
|
|
}
|
|
.accordion-flush > .accordion-item:last-child {
|
|
border-bottom: 0;
|
|
}
|
|
.accordion-flush > .accordion-item > .accordion-header .accordion-button, .accordion-flush > .accordion-item > .accordion-header .accordion-button.collapsed {
|
|
border-radius: 0;
|
|
}
|
|
.accordion-flush > .accordion-item > .accordion-collapse {
|
|
border-radius: 0;
|
|
}
|
|
|
|
[data-bs-theme=dark] .accordion-button::after {
|
|
--bs-accordion-btn-icon: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%2366a9f6'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e");
|
|
--bs-accordion-btn-active-icon: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%2366a9f6'%3e%3cpath fill-rule='evenodd' d='M1.646 4.646a.5.5 0 0 1 .708 0L8 10.293l5.646-5.647a.5.5 0 0 1 .708.708l-6 6a.5.5 0 0 1-.708 0l-6-6a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e");
|
|
}
|
|
|
|
.breadcrumb {
|
|
--bs-breadcrumb-padding-x: 0;
|
|
--bs-breadcrumb-padding-y: 0;
|
|
--bs-breadcrumb-margin-bottom: 1rem;
|
|
--bs-breadcrumb-bg: ;
|
|
--bs-breadcrumb-border-radius: ;
|
|
--bs-breadcrumb-divider-color: var(--bs-secondary-color);
|
|
--bs-breadcrumb-item-padding-x: 0.5rem;
|
|
--bs-breadcrumb-item-active-color: var(--bs-secondary-color);
|
|
display: flex;
|
|
flex-wrap: wrap;
|
|
padding: var(--bs-breadcrumb-padding-y) var(--bs-breadcrumb-padding-x);
|
|
margin-bottom: var(--bs-breadcrumb-margin-bottom);
|
|
font-size: var(--bs-breadcrumb-font-size);
|
|
list-style: none;
|
|
background-color: var(--bs-breadcrumb-bg);
|
|
border-radius: var(--bs-breadcrumb-border-radius);
|
|
}
|
|
|
|
.breadcrumb-item + .breadcrumb-item {
|
|
padding-left: var(--bs-breadcrumb-item-padding-x);
|
|
}
|
|
.breadcrumb-item + .breadcrumb-item::before {
|
|
float: left;
|
|
padding-right: var(--bs-breadcrumb-item-padding-x);
|
|
color: var(--bs-breadcrumb-divider-color);
|
|
content: var(--bs-breadcrumb-divider, "/") /* rtl: var(--bs-breadcrumb-divider, "/") */;
|
|
}
|
|
.breadcrumb-item.active {
|
|
color: var(--bs-breadcrumb-item-active-color);
|
|
}
|
|
|
|
.pagination {
|
|
--bs-pagination-padding-x: 0.75rem;
|
|
--bs-pagination-padding-y: 0.375rem;
|
|
--bs-pagination-font-size: 0.875rem;
|
|
--bs-pagination-color: var(--bs-link-color);
|
|
--bs-pagination-bg: var(--bs-body-bg);
|
|
--bs-pagination-border-width: var(--bs-border-width);
|
|
--bs-pagination-border-color: var(--bs-border-color);
|
|
--bs-pagination-border-radius: var(--bs-border-radius);
|
|
--bs-pagination-hover-color: var(--bs-link-hover-color);
|
|
--bs-pagination-hover-bg: var(--bs-tertiary-bg);
|
|
--bs-pagination-hover-border-color: var(--bs-border-color);
|
|
--bs-pagination-focus-color: var(--bs-link-hover-color);
|
|
--bs-pagination-focus-bg: var(--bs-secondary-bg);
|
|
--bs-pagination-focus-box-shadow: 0 0 0 0.25rem rgba(0, 112, 240, 0.25);
|
|
--bs-pagination-active-color: #fff;
|
|
--bs-pagination-active-bg: #0070f0;
|
|
--bs-pagination-active-border-color: #0070f0;
|
|
--bs-pagination-disabled-color: var(--bs-secondary-color);
|
|
--bs-pagination-disabled-bg: var(--bs-secondary-bg);
|
|
--bs-pagination-disabled-border-color: var(--bs-border-color);
|
|
display: flex;
|
|
padding-left: 0;
|
|
list-style: none;
|
|
}
|
|
|
|
.page-link {
|
|
position: relative;
|
|
display: block;
|
|
padding: var(--bs-pagination-padding-y) var(--bs-pagination-padding-x);
|
|
font-size: var(--bs-pagination-font-size);
|
|
color: var(--bs-pagination-color);
|
|
text-decoration: none;
|
|
background-color: var(--bs-pagination-bg);
|
|
border: var(--bs-pagination-border-width) solid var(--bs-pagination-border-color);
|
|
transition: color 0.15s ease-in-out, background-color 0.15s ease-in-out, border-color 0.15s ease-in-out, box-shadow 0.15s ease-in-out;
|
|
}
|
|
@media (prefers-reduced-motion: reduce) {
|
|
.page-link {
|
|
transition: none;
|
|
}
|
|
}
|
|
.page-link:hover {
|
|
z-index: 2;
|
|
color: var(--bs-pagination-hover-color);
|
|
background-color: var(--bs-pagination-hover-bg);
|
|
border-color: var(--bs-pagination-hover-border-color);
|
|
}
|
|
.page-link:focus {
|
|
z-index: 3;
|
|
color: var(--bs-pagination-focus-color);
|
|
background-color: var(--bs-pagination-focus-bg);
|
|
outline: 0;
|
|
box-shadow: var(--bs-pagination-focus-box-shadow);
|
|
}
|
|
.page-link.active, .active > .page-link {
|
|
z-index: 3;
|
|
color: var(--bs-pagination-active-color);
|
|
background-color: var(--bs-pagination-active-bg);
|
|
border-color: var(--bs-pagination-active-border-color);
|
|
}
|
|
.page-link.disabled, .disabled > .page-link {
|
|
color: var(--bs-pagination-disabled-color);
|
|
pointer-events: none;
|
|
background-color: var(--bs-pagination-disabled-bg);
|
|
border-color: var(--bs-pagination-disabled-border-color);
|
|
}
|
|
|
|
.page-item:not(:first-child) .page-link {
|
|
margin-left: calc(var(--bs-border-width) * -1);
|
|
}
|
|
.page-item:first-child .page-link {
|
|
border-top-left-radius: var(--bs-pagination-border-radius);
|
|
border-bottom-left-radius: var(--bs-pagination-border-radius);
|
|
}
|
|
.page-item:last-child .page-link {
|
|
border-top-right-radius: var(--bs-pagination-border-radius);
|
|
border-bottom-right-radius: var(--bs-pagination-border-radius);
|
|
}
|
|
|
|
.pagination-lg {
|
|
--bs-pagination-padding-x: 1.5rem;
|
|
--bs-pagination-padding-y: 0.75rem;
|
|
--bs-pagination-font-size: 1.25rem;
|
|
--bs-pagination-border-radius: var(--bs-border-radius-lg);
|
|
}
|
|
|
|
.pagination-sm {
|
|
--bs-pagination-padding-x: 0.5rem;
|
|
--bs-pagination-padding-y: 0.25rem;
|
|
--bs-pagination-font-size: 0.875rem;
|
|
--bs-pagination-border-radius: var(--bs-border-radius-sm);
|
|
}
|
|
|
|
.badge {
|
|
--bs-badge-padding-x: 0.65em;
|
|
--bs-badge-padding-y: 0.35em;
|
|
--bs-badge-font-size: 0.75em;
|
|
--bs-badge-font-weight: 700;
|
|
--bs-badge-color: #fff;
|
|
--bs-badge-border-radius: var(--bs-border-radius);
|
|
display: inline-block;
|
|
padding: var(--bs-badge-padding-y) var(--bs-badge-padding-x);
|
|
font-size: var(--bs-badge-font-size);
|
|
font-weight: var(--bs-badge-font-weight);
|
|
line-height: 1;
|
|
color: var(--bs-badge-color);
|
|
text-align: center;
|
|
white-space: nowrap;
|
|
vertical-align: baseline;
|
|
border-radius: var(--bs-badge-border-radius);
|
|
}
|
|
.badge:empty {
|
|
display: none;
|
|
}
|
|
|
|
.btn .badge {
|
|
position: relative;
|
|
top: -1px;
|
|
}
|
|
|
|
.alert {
|
|
--bs-alert-bg: transparent;
|
|
--bs-alert-padding-x: 1rem;
|
|
--bs-alert-padding-y: 1rem;
|
|
--bs-alert-margin-bottom: 1rem;
|
|
--bs-alert-color: inherit;
|
|
--bs-alert-border-color: transparent;
|
|
--bs-alert-border: var(--bs-border-width) solid var(--bs-alert-border-color);
|
|
--bs-alert-border-radius: var(--bs-border-radius);
|
|
--bs-alert-link-color: inherit;
|
|
position: relative;
|
|
padding: var(--bs-alert-padding-y) var(--bs-alert-padding-x);
|
|
margin-bottom: var(--bs-alert-margin-bottom);
|
|
color: var(--bs-alert-color);
|
|
background-color: var(--bs-alert-bg);
|
|
border: var(--bs-alert-border);
|
|
border-radius: var(--bs-alert-border-radius);
|
|
}
|
|
|
|
.alert-heading {
|
|
color: inherit;
|
|
}
|
|
|
|
.alert-link {
|
|
font-weight: 700;
|
|
color: var(--bs-alert-link-color);
|
|
}
|
|
|
|
.alert-dismissible {
|
|
padding-right: 3rem;
|
|
}
|
|
.alert-dismissible .btn-close {
|
|
position: absolute;
|
|
top: 0;
|
|
right: 0;
|
|
z-index: 2;
|
|
padding: 1.25rem 1rem;
|
|
}
|
|
|
|
.alert-primary {
|
|
--bs-alert-color: var(--bs-primary-text-emphasis);
|
|
--bs-alert-bg: var(--bs-primary-bg-subtle);
|
|
--bs-alert-border-color: var(--bs-primary-border-subtle);
|
|
--bs-alert-link-color: var(--bs-primary-text-emphasis);
|
|
}
|
|
|
|
.alert-secondary {
|
|
--bs-alert-color: var(--bs-secondary-text-emphasis);
|
|
--bs-alert-bg: var(--bs-secondary-bg-subtle);
|
|
--bs-alert-border-color: var(--bs-secondary-border-subtle);
|
|
--bs-alert-link-color: var(--bs-secondary-text-emphasis);
|
|
}
|
|
|
|
.alert-success {
|
|
--bs-alert-color: var(--bs-success-text-emphasis);
|
|
--bs-alert-bg: var(--bs-success-bg-subtle);
|
|
--bs-alert-border-color: var(--bs-success-border-subtle);
|
|
--bs-alert-link-color: var(--bs-success-text-emphasis);
|
|
}
|
|
|
|
.alert-info {
|
|
--bs-alert-color: var(--bs-info-text-emphasis);
|
|
--bs-alert-bg: var(--bs-info-bg-subtle);
|
|
--bs-alert-border-color: var(--bs-info-border-subtle);
|
|
--bs-alert-link-color: var(--bs-info-text-emphasis);
|
|
}
|
|
|
|
.alert-warning {
|
|
--bs-alert-color: var(--bs-warning-text-emphasis);
|
|
--bs-alert-bg: var(--bs-warning-bg-subtle);
|
|
--bs-alert-border-color: var(--bs-warning-border-subtle);
|
|
--bs-alert-link-color: var(--bs-warning-text-emphasis);
|
|
}
|
|
|
|
.alert-danger {
|
|
--bs-alert-color: var(--bs-danger-text-emphasis);
|
|
--bs-alert-bg: var(--bs-danger-bg-subtle);
|
|
--bs-alert-border-color: var(--bs-danger-border-subtle);
|
|
--bs-alert-link-color: var(--bs-danger-text-emphasis);
|
|
}
|
|
|
|
.alert-light {
|
|
--bs-alert-color: var(--bs-light-text-emphasis);
|
|
--bs-alert-bg: var(--bs-light-bg-subtle);
|
|
--bs-alert-border-color: var(--bs-light-border-subtle);
|
|
--bs-alert-link-color: var(--bs-light-text-emphasis);
|
|
}
|
|
|
|
.alert-dark {
|
|
--bs-alert-color: var(--bs-dark-text-emphasis);
|
|
--bs-alert-bg: var(--bs-dark-bg-subtle);
|
|
--bs-alert-border-color: var(--bs-dark-border-subtle);
|
|
--bs-alert-link-color: var(--bs-dark-text-emphasis);
|
|
}
|
|
|
|
@keyframes progress-bar-stripes {
|
|
0% {
|
|
background-position-x: 1rem;
|
|
}
|
|
}
|
|
.progress,
|
|
.progress-stacked {
|
|
--bs-progress-height: 1rem;
|
|
--bs-progress-font-size: 0.75rem;
|
|
--bs-progress-bg: var(--bs-secondary-bg);
|
|
--bs-progress-border-radius: var(--bs-border-radius);
|
|
--bs-progress-box-shadow: var(--bs-box-shadow-inset);
|
|
--bs-progress-bar-color: #fff;
|
|
--bs-progress-bar-bg: #0070f0;
|
|
--bs-progress-bar-transition: width 0.6s ease;
|
|
display: flex;
|
|
height: var(--bs-progress-height);
|
|
overflow: hidden;
|
|
font-size: var(--bs-progress-font-size);
|
|
background-color: var(--bs-progress-bg);
|
|
border-radius: var(--bs-progress-border-radius);
|
|
}
|
|
|
|
.progress-bar {
|
|
display: flex;
|
|
flex-direction: column;
|
|
justify-content: center;
|
|
overflow: hidden;
|
|
color: var(--bs-progress-bar-color);
|
|
text-align: center;
|
|
white-space: nowrap;
|
|
background-color: var(--bs-progress-bar-bg);
|
|
transition: var(--bs-progress-bar-transition);
|
|
}
|
|
@media (prefers-reduced-motion: reduce) {
|
|
.progress-bar {
|
|
transition: none;
|
|
}
|
|
}
|
|
|
|
.progress-bar-striped {
|
|
background-image: linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
|
|
background-size: var(--bs-progress-height) var(--bs-progress-height);
|
|
}
|
|
|
|
.progress-stacked > .progress {
|
|
overflow: visible;
|
|
}
|
|
|
|
.progress-stacked > .progress > .progress-bar {
|
|
width: 100%;
|
|
}
|
|
|
|
.progress-bar-animated {
|
|
animation: 1s linear infinite progress-bar-stripes;
|
|
}
|
|
@media (prefers-reduced-motion: reduce) {
|
|
.progress-bar-animated {
|
|
animation: none;
|
|
}
|
|
}
|
|
|
|
.list-group {
|
|
--bs-list-group-color: var(--bs-body-color);
|
|
--bs-list-group-bg: var(--bs-body-bg);
|
|
--bs-list-group-border-color: var(--bs-border-color);
|
|
--bs-list-group-border-width: var(--bs-border-width);
|
|
--bs-list-group-border-radius: var(--bs-border-radius);
|
|
--bs-list-group-item-padding-x: 1rem;
|
|
--bs-list-group-item-padding-y: 0.5rem;
|
|
--bs-list-group-action-color: var(--bs-secondary-color);
|
|
--bs-list-group-action-hover-color: var(--bs-emphasis-color);
|
|
--bs-list-group-action-hover-bg: var(--bs-tertiary-bg);
|
|
--bs-list-group-action-active-color: var(--bs-body-color);
|
|
--bs-list-group-action-active-bg: var(--bs-secondary-bg);
|
|
--bs-list-group-disabled-color: var(--bs-secondary-color);
|
|
--bs-list-group-disabled-bg: var(--bs-body-bg);
|
|
--bs-list-group-active-color: #fff;
|
|
--bs-list-group-active-bg: #0070f0;
|
|
--bs-list-group-active-border-color: #0070f0;
|
|
display: flex;
|
|
flex-direction: column;
|
|
padding-left: 0;
|
|
margin-bottom: 0;
|
|
border-radius: var(--bs-list-group-border-radius);
|
|
}
|
|
|
|
.list-group-numbered {
|
|
list-style-type: none;
|
|
counter-reset: section;
|
|
}
|
|
.list-group-numbered > .list-group-item::before {
|
|
content: counters(section, ".") ". ";
|
|
counter-increment: section;
|
|
}
|
|
|
|
.list-group-item-action {
|
|
width: 100%;
|
|
color: var(--bs-list-group-action-color);
|
|
text-align: inherit;
|
|
}
|
|
.list-group-item-action:hover, .list-group-item-action:focus {
|
|
z-index: 1;
|
|
color: var(--bs-list-group-action-hover-color);
|
|
text-decoration: none;
|
|
background-color: var(--bs-list-group-action-hover-bg);
|
|
}
|
|
.list-group-item-action:active {
|
|
color: var(--bs-list-group-action-active-color);
|
|
background-color: var(--bs-list-group-action-active-bg);
|
|
}
|
|
|
|
.list-group-item {
|
|
position: relative;
|
|
display: block;
|
|
padding: var(--bs-list-group-item-padding-y) var(--bs-list-group-item-padding-x);
|
|
color: var(--bs-list-group-color);
|
|
text-decoration: none;
|
|
background-color: var(--bs-list-group-bg);
|
|
border: var(--bs-list-group-border-width) solid var(--bs-list-group-border-color);
|
|
}
|
|
.list-group-item:first-child {
|
|
border-top-left-radius: inherit;
|
|
border-top-right-radius: inherit;
|
|
}
|
|
.list-group-item:last-child {
|
|
border-bottom-right-radius: inherit;
|
|
border-bottom-left-radius: inherit;
|
|
}
|
|
.list-group-item.disabled, .list-group-item:disabled {
|
|
color: var(--bs-list-group-disabled-color);
|
|
pointer-events: none;
|
|
background-color: var(--bs-list-group-disabled-bg);
|
|
}
|
|
.list-group-item.active {
|
|
z-index: 2;
|
|
color: var(--bs-list-group-active-color);
|
|
background-color: var(--bs-list-group-active-bg);
|
|
border-color: var(--bs-list-group-active-border-color);
|
|
}
|
|
.list-group-item + .list-group-item {
|
|
border-top-width: 0;
|
|
}
|
|
.list-group-item + .list-group-item.active {
|
|
margin-top: calc(-1 * var(--bs-list-group-border-width));
|
|
border-top-width: var(--bs-list-group-border-width);
|
|
}
|
|
|
|
.list-group-horizontal {
|
|
flex-direction: row;
|
|
}
|
|
.list-group-horizontal > .list-group-item:first-child:not(:last-child) {
|
|
border-bottom-left-radius: var(--bs-list-group-border-radius);
|
|
border-top-right-radius: 0;
|
|
}
|
|
.list-group-horizontal > .list-group-item:last-child:not(:first-child) {
|
|
border-top-right-radius: var(--bs-list-group-border-radius);
|
|
border-bottom-left-radius: 0;
|
|
}
|
|
.list-group-horizontal > .list-group-item.active {
|
|
margin-top: 0;
|
|
}
|
|
.list-group-horizontal > .list-group-item + .list-group-item {
|
|
border-top-width: var(--bs-list-group-border-width);
|
|
border-left-width: 0;
|
|
}
|
|
.list-group-horizontal > .list-group-item + .list-group-item.active {
|
|
margin-left: calc(-1 * var(--bs-list-group-border-width));
|
|
border-left-width: var(--bs-list-group-border-width);
|
|
}
|
|
|
|
@media (min-width: 576px) {
|
|
.list-group-horizontal-sm {
|
|
flex-direction: row;
|
|
}
|
|
.list-group-horizontal-sm > .list-group-item:first-child:not(:last-child) {
|
|
border-bottom-left-radius: var(--bs-list-group-border-radius);
|
|
border-top-right-radius: 0;
|
|
}
|
|
.list-group-horizontal-sm > .list-group-item:last-child:not(:first-child) {
|
|
border-top-right-radius: var(--bs-list-group-border-radius);
|
|
border-bottom-left-radius: 0;
|
|
}
|
|
.list-group-horizontal-sm > .list-group-item.active {
|
|
margin-top: 0;
|
|
}
|
|
.list-group-horizontal-sm > .list-group-item + .list-group-item {
|
|
border-top-width: var(--bs-list-group-border-width);
|
|
border-left-width: 0;
|
|
}
|
|
.list-group-horizontal-sm > .list-group-item + .list-group-item.active {
|
|
margin-left: calc(-1 * var(--bs-list-group-border-width));
|
|
border-left-width: var(--bs-list-group-border-width);
|
|
}
|
|
}
|
|
@media (min-width: 768px) {
|
|
.list-group-horizontal-md {
|
|
flex-direction: row;
|
|
}
|
|
.list-group-horizontal-md > .list-group-item:first-child:not(:last-child) {
|
|
border-bottom-left-radius: var(--bs-list-group-border-radius);
|
|
border-top-right-radius: 0;
|
|
}
|
|
.list-group-horizontal-md > .list-group-item:last-child:not(:first-child) {
|
|
border-top-right-radius: var(--bs-list-group-border-radius);
|
|
border-bottom-left-radius: 0;
|
|
}
|
|
.list-group-horizontal-md > .list-group-item.active {
|
|
margin-top: 0;
|
|
}
|
|
.list-group-horizontal-md > .list-group-item + .list-group-item {
|
|
border-top-width: var(--bs-list-group-border-width);
|
|
border-left-width: 0;
|
|
}
|
|
.list-group-horizontal-md > .list-group-item + .list-group-item.active {
|
|
margin-left: calc(-1 * var(--bs-list-group-border-width));
|
|
border-left-width: var(--bs-list-group-border-width);
|
|
}
|
|
}
|
|
@media (min-width: 992px) {
|
|
.list-group-horizontal-lg {
|
|
flex-direction: row;
|
|
}
|
|
.list-group-horizontal-lg > .list-group-item:first-child:not(:last-child) {
|
|
border-bottom-left-radius: var(--bs-list-group-border-radius);
|
|
border-top-right-radius: 0;
|
|
}
|
|
.list-group-horizontal-lg > .list-group-item:last-child:not(:first-child) {
|
|
border-top-right-radius: var(--bs-list-group-border-radius);
|
|
border-bottom-left-radius: 0;
|
|
}
|
|
.list-group-horizontal-lg > .list-group-item.active {
|
|
margin-top: 0;
|
|
}
|
|
.list-group-horizontal-lg > .list-group-item + .list-group-item {
|
|
border-top-width: var(--bs-list-group-border-width);
|
|
border-left-width: 0;
|
|
}
|
|
.list-group-horizontal-lg > .list-group-item + .list-group-item.active {
|
|
margin-left: calc(-1 * var(--bs-list-group-border-width));
|
|
border-left-width: var(--bs-list-group-border-width);
|
|
}
|
|
}
|
|
@media (min-width: 1200px) {
|
|
.list-group-horizontal-xl {
|
|
flex-direction: row;
|
|
}
|
|
.list-group-horizontal-xl > .list-group-item:first-child:not(:last-child) {
|
|
border-bottom-left-radius: var(--bs-list-group-border-radius);
|
|
border-top-right-radius: 0;
|
|
}
|
|
.list-group-horizontal-xl > .list-group-item:last-child:not(:first-child) {
|
|
border-top-right-radius: var(--bs-list-group-border-radius);
|
|
border-bottom-left-radius: 0;
|
|
}
|
|
.list-group-horizontal-xl > .list-group-item.active {
|
|
margin-top: 0;
|
|
}
|
|
.list-group-horizontal-xl > .list-group-item + .list-group-item {
|
|
border-top-width: var(--bs-list-group-border-width);
|
|
border-left-width: 0;
|
|
}
|
|
.list-group-horizontal-xl > .list-group-item + .list-group-item.active {
|
|
margin-left: calc(-1 * var(--bs-list-group-border-width));
|
|
border-left-width: var(--bs-list-group-border-width);
|
|
}
|
|
}
|
|
@media (min-width: 1400px) {
|
|
.list-group-horizontal-xxl {
|
|
flex-direction: row;
|
|
}
|
|
.list-group-horizontal-xxl > .list-group-item:first-child:not(:last-child) {
|
|
border-bottom-left-radius: var(--bs-list-group-border-radius);
|
|
border-top-right-radius: 0;
|
|
}
|
|
.list-group-horizontal-xxl > .list-group-item:last-child:not(:first-child) {
|
|
border-top-right-radius: var(--bs-list-group-border-radius);
|
|
border-bottom-left-radius: 0;
|
|
}
|
|
.list-group-horizontal-xxl > .list-group-item.active {
|
|
margin-top: 0;
|
|
}
|
|
.list-group-horizontal-xxl > .list-group-item + .list-group-item {
|
|
border-top-width: var(--bs-list-group-border-width);
|
|
border-left-width: 0;
|
|
}
|
|
.list-group-horizontal-xxl > .list-group-item + .list-group-item.active {
|
|
margin-left: calc(-1 * var(--bs-list-group-border-width));
|
|
border-left-width: var(--bs-list-group-border-width);
|
|
}
|
|
}
|
|
.list-group-flush {
|
|
border-radius: 0;
|
|
}
|
|
.list-group-flush > .list-group-item {
|
|
border-width: 0 0 var(--bs-list-group-border-width);
|
|
}
|
|
.list-group-flush > .list-group-item:last-child {
|
|
border-bottom-width: 0;
|
|
}
|
|
|
|
.list-group-item-primary {
|
|
--bs-list-group-color: var(--bs-primary-text-emphasis);
|
|
--bs-list-group-bg: var(--bs-primary-bg-subtle);
|
|
--bs-list-group-border-color: var(--bs-primary-border-subtle);
|
|
--bs-list-group-action-hover-color: var(--bs-emphasis-color);
|
|
--bs-list-group-action-hover-bg: var(--bs-primary-border-subtle);
|
|
--bs-list-group-action-active-color: var(--bs-emphasis-color);
|
|
--bs-list-group-action-active-bg: var(--bs-primary-border-subtle);
|
|
--bs-list-group-active-color: var(--bs-primary-bg-subtle);
|
|
--bs-list-group-active-bg: var(--bs-primary-text-emphasis);
|
|
--bs-list-group-active-border-color: var(--bs-primary-text-emphasis);
|
|
}
|
|
|
|
.list-group-item-secondary {
|
|
--bs-list-group-color: var(--bs-secondary-text-emphasis);
|
|
--bs-list-group-bg: var(--bs-secondary-bg-subtle);
|
|
--bs-list-group-border-color: var(--bs-secondary-border-subtle);
|
|
--bs-list-group-action-hover-color: var(--bs-emphasis-color);
|
|
--bs-list-group-action-hover-bg: var(--bs-secondary-border-subtle);
|
|
--bs-list-group-action-active-color: var(--bs-emphasis-color);
|
|
--bs-list-group-action-active-bg: var(--bs-secondary-border-subtle);
|
|
--bs-list-group-active-color: var(--bs-secondary-bg-subtle);
|
|
--bs-list-group-active-bg: var(--bs-secondary-text-emphasis);
|
|
--bs-list-group-active-border-color: var(--bs-secondary-text-emphasis);
|
|
}
|
|
|
|
.list-group-item-success {
|
|
--bs-list-group-color: var(--bs-success-text-emphasis);
|
|
--bs-list-group-bg: var(--bs-success-bg-subtle);
|
|
--bs-list-group-border-color: var(--bs-success-border-subtle);
|
|
--bs-list-group-action-hover-color: var(--bs-emphasis-color);
|
|
--bs-list-group-action-hover-bg: var(--bs-success-border-subtle);
|
|
--bs-list-group-action-active-color: var(--bs-emphasis-color);
|
|
--bs-list-group-action-active-bg: var(--bs-success-border-subtle);
|
|
--bs-list-group-active-color: var(--bs-success-bg-subtle);
|
|
--bs-list-group-active-bg: var(--bs-success-text-emphasis);
|
|
--bs-list-group-active-border-color: var(--bs-success-text-emphasis);
|
|
}
|
|
|
|
.list-group-item-info {
|
|
--bs-list-group-color: var(--bs-info-text-emphasis);
|
|
--bs-list-group-bg: var(--bs-info-bg-subtle);
|
|
--bs-list-group-border-color: var(--bs-info-border-subtle);
|
|
--bs-list-group-action-hover-color: var(--bs-emphasis-color);
|
|
--bs-list-group-action-hover-bg: var(--bs-info-border-subtle);
|
|
--bs-list-group-action-active-color: var(--bs-emphasis-color);
|
|
--bs-list-group-action-active-bg: var(--bs-info-border-subtle);
|
|
--bs-list-group-active-color: var(--bs-info-bg-subtle);
|
|
--bs-list-group-active-bg: var(--bs-info-text-emphasis);
|
|
--bs-list-group-active-border-color: var(--bs-info-text-emphasis);
|
|
}
|
|
|
|
.list-group-item-warning {
|
|
--bs-list-group-color: var(--bs-warning-text-emphasis);
|
|
--bs-list-group-bg: var(--bs-warning-bg-subtle);
|
|
--bs-list-group-border-color: var(--bs-warning-border-subtle);
|
|
--bs-list-group-action-hover-color: var(--bs-emphasis-color);
|
|
--bs-list-group-action-hover-bg: var(--bs-warning-border-subtle);
|
|
--bs-list-group-action-active-color: var(--bs-emphasis-color);
|
|
--bs-list-group-action-active-bg: var(--bs-warning-border-subtle);
|
|
--bs-list-group-active-color: var(--bs-warning-bg-subtle);
|
|
--bs-list-group-active-bg: var(--bs-warning-text-emphasis);
|
|
--bs-list-group-active-border-color: var(--bs-warning-text-emphasis);
|
|
}
|
|
|
|
.list-group-item-danger {
|
|
--bs-list-group-color: var(--bs-danger-text-emphasis);
|
|
--bs-list-group-bg: var(--bs-danger-bg-subtle);
|
|
--bs-list-group-border-color: var(--bs-danger-border-subtle);
|
|
--bs-list-group-action-hover-color: var(--bs-emphasis-color);
|
|
--bs-list-group-action-hover-bg: var(--bs-danger-border-subtle);
|
|
--bs-list-group-action-active-color: var(--bs-emphasis-color);
|
|
--bs-list-group-action-active-bg: var(--bs-danger-border-subtle);
|
|
--bs-list-group-active-color: var(--bs-danger-bg-subtle);
|
|
--bs-list-group-active-bg: var(--bs-danger-text-emphasis);
|
|
--bs-list-group-active-border-color: var(--bs-danger-text-emphasis);
|
|
}
|
|
|
|
.list-group-item-light {
|
|
--bs-list-group-color: var(--bs-light-text-emphasis);
|
|
--bs-list-group-bg: var(--bs-light-bg-subtle);
|
|
--bs-list-group-border-color: var(--bs-light-border-subtle);
|
|
--bs-list-group-action-hover-color: var(--bs-emphasis-color);
|
|
--bs-list-group-action-hover-bg: var(--bs-light-border-subtle);
|
|
--bs-list-group-action-active-color: var(--bs-emphasis-color);
|
|
--bs-list-group-action-active-bg: var(--bs-light-border-subtle);
|
|
--bs-list-group-active-color: var(--bs-light-bg-subtle);
|
|
--bs-list-group-active-bg: var(--bs-light-text-emphasis);
|
|
--bs-list-group-active-border-color: var(--bs-light-text-emphasis);
|
|
}
|
|
|
|
.list-group-item-dark {
|
|
--bs-list-group-color: var(--bs-dark-text-emphasis);
|
|
--bs-list-group-bg: var(--bs-dark-bg-subtle);
|
|
--bs-list-group-border-color: var(--bs-dark-border-subtle);
|
|
--bs-list-group-action-hover-color: var(--bs-emphasis-color);
|
|
--bs-list-group-action-hover-bg: var(--bs-dark-border-subtle);
|
|
--bs-list-group-action-active-color: var(--bs-emphasis-color);
|
|
--bs-list-group-action-active-bg: var(--bs-dark-border-subtle);
|
|
--bs-list-group-active-color: var(--bs-dark-bg-subtle);
|
|
--bs-list-group-active-bg: var(--bs-dark-text-emphasis);
|
|
--bs-list-group-active-border-color: var(--bs-dark-text-emphasis);
|
|
}
|
|
|
|
.btn-close {
|
|
--bs-btn-close-color: #000;
|
|
--bs-btn-close-bg: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23000'%3e%3cpath d='M.293.293a1 1 0 0 1 1.414 0L8 6.586 14.293.293a1 1 0 1 1 1.414 1.414L9.414 8l6.293 6.293a1 1 0 0 1-1.414 1.414L8 9.414l-6.293 6.293a1 1 0 0 1-1.414-1.414L6.586 8 .293 1.707a1 1 0 0 1 0-1.414z'/%3e%3c/svg%3e");
|
|
--bs-btn-close-opacity: 0.5;
|
|
--bs-btn-close-hover-opacity: 0.75;
|
|
--bs-btn-close-focus-shadow: 0 0 0 0.25rem rgba(0, 112, 240, 0.25);
|
|
--bs-btn-close-focus-opacity: 1;
|
|
--bs-btn-close-disabled-opacity: 0.25;
|
|
--bs-btn-close-white-filter: invert(1) grayscale(100%) brightness(200%);
|
|
box-sizing: content-box;
|
|
width: 1em;
|
|
height: 1em;
|
|
padding: 0.25em 0.25em;
|
|
color: var(--bs-btn-close-color);
|
|
background: transparent var(--bs-btn-close-bg) center/1em auto no-repeat;
|
|
border: 0;
|
|
border-radius: 0.25rem;
|
|
opacity: var(--bs-btn-close-opacity);
|
|
}
|
|
.btn-close:hover {
|
|
color: var(--bs-btn-close-color);
|
|
text-decoration: none;
|
|
opacity: var(--bs-btn-close-hover-opacity);
|
|
}
|
|
.btn-close:focus {
|
|
outline: 0;
|
|
box-shadow: var(--bs-btn-close-focus-shadow);
|
|
opacity: var(--bs-btn-close-focus-opacity);
|
|
}
|
|
.btn-close:disabled, .btn-close.disabled {
|
|
pointer-events: none;
|
|
user-select: none;
|
|
opacity: var(--bs-btn-close-disabled-opacity);
|
|
}
|
|
|
|
.btn-close-white {
|
|
filter: var(--bs-btn-close-white-filter);
|
|
}
|
|
|
|
[data-bs-theme=dark] .btn-close {
|
|
filter: var(--bs-btn-close-white-filter);
|
|
}
|
|
|
|
.toast {
|
|
--bs-toast-zindex: 1490;
|
|
--bs-toast-padding-x: 0.75rem;
|
|
--bs-toast-padding-y: 0.5rem;
|
|
--bs-toast-spacing: 1.5rem;
|
|
--bs-toast-max-width: 350px;
|
|
--bs-toast-font-size: 0.875rem;
|
|
--bs-toast-color: ;
|
|
--bs-toast-bg: rgba(var(--bs-body-bg-rgb), 0.85);
|
|
--bs-toast-border-width: var(--bs-border-width);
|
|
--bs-toast-border-color: var(--bs-border-color-translucent);
|
|
--bs-toast-border-radius: var(--bs-border-radius);
|
|
--bs-toast-box-shadow: var(--bs-box-shadow);
|
|
--bs-toast-header-color: var(--bs-secondary-color);
|
|
--bs-toast-header-bg: rgba(var(--bs-body-bg-rgb), 0.85);
|
|
--bs-toast-header-border-color: var(--bs-border-color-translucent);
|
|
width: var(--bs-toast-max-width);
|
|
max-width: 100%;
|
|
font-size: var(--bs-toast-font-size);
|
|
color: var(--bs-toast-color);
|
|
pointer-events: auto;
|
|
background-color: var(--bs-toast-bg);
|
|
background-clip: padding-box;
|
|
border: var(--bs-toast-border-width) solid var(--bs-toast-border-color);
|
|
box-shadow: var(--bs-toast-box-shadow);
|
|
border-radius: var(--bs-toast-border-radius);
|
|
}
|
|
.toast.showing {
|
|
opacity: 0;
|
|
}
|
|
.toast:not(.show) {
|
|
display: none;
|
|
}
|
|
|
|
.toast-container {
|
|
--bs-toast-zindex: 1490;
|
|
position: absolute;
|
|
z-index: var(--bs-toast-zindex);
|
|
width: max-content;
|
|
max-width: 100%;
|
|
pointer-events: none;
|
|
}
|
|
.toast-container > :not(:last-child) {
|
|
margin-bottom: var(--bs-toast-spacing);
|
|
}
|
|
|
|
.toast-header {
|
|
display: flex;
|
|
align-items: center;
|
|
padding: var(--bs-toast-padding-y) var(--bs-toast-padding-x);
|
|
color: var(--bs-toast-header-color);
|
|
background-color: var(--bs-toast-header-bg);
|
|
background-clip: padding-box;
|
|
border-bottom: var(--bs-toast-border-width) solid var(--bs-toast-header-border-color);
|
|
border-top-left-radius: calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width));
|
|
border-top-right-radius: calc(var(--bs-toast-border-radius) - var(--bs-toast-border-width));
|
|
}
|
|
.toast-header .btn-close {
|
|
margin-right: calc(-0.5 * var(--bs-toast-padding-x));
|
|
margin-left: var(--bs-toast-padding-x);
|
|
}
|
|
|
|
.toast-body {
|
|
padding: var(--bs-toast-padding-x);
|
|
word-wrap: break-word;
|
|
}
|
|
|
|
.modal {
|
|
--bs-modal-zindex: 1455;
|
|
--bs-modal-width: 500px;
|
|
--bs-modal-padding: 1rem;
|
|
--bs-modal-margin: 0.5rem;
|
|
--bs-modal-color: ;
|
|
--bs-modal-bg: var(--bs-body-bg);
|
|
--bs-modal-border-color: var(--bs-border-color-translucent);
|
|
--bs-modal-border-width: var(--bs-border-width);
|
|
--bs-modal-border-radius: var(--bs-border-radius-lg);
|
|
--bs-modal-box-shadow: var(--bs-box-shadow-sm);
|
|
--bs-modal-inner-border-radius: calc(var(--bs-border-radius-lg) - (var(--bs-border-width)));
|
|
--bs-modal-header-padding-x: 1rem;
|
|
--bs-modal-header-padding-y: 1rem;
|
|
--bs-modal-header-padding: 1rem 1rem;
|
|
--bs-modal-header-border-color: var(--bs-border-color);
|
|
--bs-modal-header-border-width: var(--bs-border-width);
|
|
--bs-modal-title-line-height: 1.5;
|
|
--bs-modal-footer-gap: 0.5rem;
|
|
--bs-modal-footer-bg: ;
|
|
--bs-modal-footer-border-color: var(--bs-border-color);
|
|
--bs-modal-footer-border-width: var(--bs-border-width);
|
|
position: fixed;
|
|
top: 0;
|
|
left: 0;
|
|
z-index: var(--bs-modal-zindex);
|
|
display: none;
|
|
width: 100%;
|
|
height: 100%;
|
|
overflow-x: hidden;
|
|
overflow-y: auto;
|
|
outline: 0;
|
|
}
|
|
|
|
.modal-dialog {
|
|
position: relative;
|
|
width: auto;
|
|
margin: var(--bs-modal-margin);
|
|
pointer-events: none;
|
|
}
|
|
.modal.fade .modal-dialog {
|
|
transition: transform 0.3s ease-out;
|
|
transform: translate(0, -50px);
|
|
}
|
|
@media (prefers-reduced-motion: reduce) {
|
|
.modal.fade .modal-dialog {
|
|
transition: none;
|
|
}
|
|
}
|
|
.modal.show .modal-dialog {
|
|
transform: none;
|
|
}
|
|
.modal.modal-static .modal-dialog {
|
|
transform: scale(1.02);
|
|
}
|
|
|
|
.modal-dialog-scrollable {
|
|
height: calc(100% - var(--bs-modal-margin) * 2);
|
|
}
|
|
.modal-dialog-scrollable .modal-content {
|
|
max-height: 100%;
|
|
overflow: hidden;
|
|
}
|
|
.modal-dialog-scrollable .modal-body {
|
|
overflow-y: auto;
|
|
}
|
|
|
|
.modal-dialog-centered {
|
|
display: flex;
|
|
align-items: center;
|
|
min-height: calc(100% - var(--bs-modal-margin) * 2);
|
|
}
|
|
|
|
.modal-content {
|
|
position: relative;
|
|
display: flex;
|
|
flex-direction: column;
|
|
width: 100%;
|
|
color: var(--bs-modal-color);
|
|
pointer-events: auto;
|
|
background-color: var(--bs-modal-bg);
|
|
background-clip: padding-box;
|
|
border: var(--bs-modal-border-width) solid var(--bs-modal-border-color);
|
|
border-radius: var(--bs-modal-border-radius);
|
|
outline: 0;
|
|
}
|
|
|
|
.modal-backdrop {
|
|
--bs-backdrop-zindex: 1450;
|
|
--bs-backdrop-bg: #000;
|
|
--bs-backdrop-opacity: 0.5;
|
|
position: fixed;
|
|
top: 0;
|
|
left: 0;
|
|
z-index: var(--bs-backdrop-zindex);
|
|
width: 100vw;
|
|
height: 100vh;
|
|
background-color: var(--bs-backdrop-bg);
|
|
}
|
|
.modal-backdrop.fade {
|
|
opacity: 0;
|
|
}
|
|
.modal-backdrop.show {
|
|
opacity: var(--bs-backdrop-opacity);
|
|
}
|
|
|
|
.modal-header {
|
|
display: flex;
|
|
flex-shrink: 0;
|
|
align-items: center;
|
|
padding: var(--bs-modal-header-padding);
|
|
border-bottom: var(--bs-modal-header-border-width) solid var(--bs-modal-header-border-color);
|
|
border-top-left-radius: var(--bs-modal-inner-border-radius);
|
|
border-top-right-radius: var(--bs-modal-inner-border-radius);
|
|
}
|
|
.modal-header .btn-close {
|
|
padding: calc(var(--bs-modal-header-padding-y) * 0.5) calc(var(--bs-modal-header-padding-x) * 0.5);
|
|
margin: calc(-0.5 * var(--bs-modal-header-padding-y)) calc(-0.5 * var(--bs-modal-header-padding-x)) calc(-0.5 * var(--bs-modal-header-padding-y)) auto;
|
|
}
|
|
|
|
.modal-title {
|
|
margin-bottom: 0;
|
|
line-height: var(--bs-modal-title-line-height);
|
|
}
|
|
|
|
.modal-body {
|
|
position: relative;
|
|
flex: 1 1 auto;
|
|
padding: var(--bs-modal-padding);
|
|
}
|
|
|
|
.modal-footer {
|
|
display: flex;
|
|
flex-shrink: 0;
|
|
flex-wrap: wrap;
|
|
align-items: center;
|
|
justify-content: flex-end;
|
|
padding: calc(var(--bs-modal-padding) - var(--bs-modal-footer-gap) * 0.5);
|
|
background-color: var(--bs-modal-footer-bg);
|
|
border-top: var(--bs-modal-footer-border-width) solid var(--bs-modal-footer-border-color);
|
|
border-bottom-right-radius: var(--bs-modal-inner-border-radius);
|
|
border-bottom-left-radius: var(--bs-modal-inner-border-radius);
|
|
}
|
|
.modal-footer > * {
|
|
margin: calc(var(--bs-modal-footer-gap) * 0.5);
|
|
}
|
|
|
|
@media (min-width: 576px) {
|
|
.modal {
|
|
--bs-modal-margin: 1.75rem;
|
|
--bs-modal-box-shadow: var(--bs-box-shadow);
|
|
}
|
|
.modal-dialog {
|
|
max-width: var(--bs-modal-width);
|
|
margin-right: auto;
|
|
margin-left: auto;
|
|
}
|
|
.modal-sm {
|
|
--bs-modal-width: 300px;
|
|
}
|
|
}
|
|
@media (min-width: 992px) {
|
|
.modal-lg,
|
|
.modal-xl {
|
|
--bs-modal-width: 800px;
|
|
}
|
|
}
|
|
@media (min-width: 1200px) {
|
|
.modal-xl {
|
|
--bs-modal-width: 1140px;
|
|
}
|
|
}
|
|
.modal-fullscreen {
|
|
width: 100vw;
|
|
max-width: none;
|
|
height: 100%;
|
|
margin: 0;
|
|
}
|
|
.modal-fullscreen .modal-content {
|
|
height: 100%;
|
|
border: 0;
|
|
border-radius: 0;
|
|
}
|
|
.modal-fullscreen .modal-header,
|
|
.modal-fullscreen .modal-footer {
|
|
border-radius: 0;
|
|
}
|
|
.modal-fullscreen .modal-body {
|
|
overflow-y: auto;
|
|
}
|
|
|
|
@media (max-width: 575.98px) {
|
|
.modal-fullscreen-sm-down {
|
|
width: 100vw;
|
|
max-width: none;
|
|
height: 100%;
|
|
margin: 0;
|
|
}
|
|
.modal-fullscreen-sm-down .modal-content {
|
|
height: 100%;
|
|
border: 0;
|
|
border-radius: 0;
|
|
}
|
|
.modal-fullscreen-sm-down .modal-header,
|
|
.modal-fullscreen-sm-down .modal-footer {
|
|
border-radius: 0;
|
|
}
|
|
.modal-fullscreen-sm-down .modal-body {
|
|
overflow-y: auto;
|
|
}
|
|
}
|
|
@media (max-width: 767.98px) {
|
|
.modal-fullscreen-md-down {
|
|
width: 100vw;
|
|
max-width: none;
|
|
height: 100%;
|
|
margin: 0;
|
|
}
|
|
.modal-fullscreen-md-down .modal-content {
|
|
height: 100%;
|
|
border: 0;
|
|
border-radius: 0;
|
|
}
|
|
.modal-fullscreen-md-down .modal-header,
|
|
.modal-fullscreen-md-down .modal-footer {
|
|
border-radius: 0;
|
|
}
|
|
.modal-fullscreen-md-down .modal-body {
|
|
overflow-y: auto;
|
|
}
|
|
}
|
|
@media (max-width: 991.98px) {
|
|
.modal-fullscreen-lg-down {
|
|
width: 100vw;
|
|
max-width: none;
|
|
height: 100%;
|
|
margin: 0;
|
|
}
|
|
.modal-fullscreen-lg-down .modal-content {
|
|
height: 100%;
|
|
border: 0;
|
|
border-radius: 0;
|
|
}
|
|
.modal-fullscreen-lg-down .modal-header,
|
|
.modal-fullscreen-lg-down .modal-footer {
|
|
border-radius: 0;
|
|
}
|
|
.modal-fullscreen-lg-down .modal-body {
|
|
overflow-y: auto;
|
|
}
|
|
}
|
|
@media (max-width: 1199.98px) {
|
|
.modal-fullscreen-xl-down {
|
|
width: 100vw;
|
|
max-width: none;
|
|
height: 100%;
|
|
margin: 0;
|
|
}
|
|
.modal-fullscreen-xl-down .modal-content {
|
|
height: 100%;
|
|
border: 0;
|
|
border-radius: 0;
|
|
}
|
|
.modal-fullscreen-xl-down .modal-header,
|
|
.modal-fullscreen-xl-down .modal-footer {
|
|
border-radius: 0;
|
|
}
|
|
.modal-fullscreen-xl-down .modal-body {
|
|
overflow-y: auto;
|
|
}
|
|
}
|
|
@media (max-width: 1399.98px) {
|
|
.modal-fullscreen-xxl-down {
|
|
width: 100vw;
|
|
max-width: none;
|
|
height: 100%;
|
|
margin: 0;
|
|
}
|
|
.modal-fullscreen-xxl-down .modal-content {
|
|
height: 100%;
|
|
border: 0;
|
|
border-radius: 0;
|
|
}
|
|
.modal-fullscreen-xxl-down .modal-header,
|
|
.modal-fullscreen-xxl-down .modal-footer {
|
|
border-radius: 0;
|
|
}
|
|
.modal-fullscreen-xxl-down .modal-body {
|
|
overflow-y: auto;
|
|
}
|
|
}
|
|
.tooltip {
|
|
--bs-tooltip-zindex: 1480;
|
|
--bs-tooltip-max-width: 200px;
|
|
--bs-tooltip-padding-x: 0.5rem;
|
|
--bs-tooltip-padding-y: 0.25rem;
|
|
--bs-tooltip-margin: ;
|
|
--bs-tooltip-font-size: 0.875rem;
|
|
--bs-tooltip-color: var(--bs-body-bg);
|
|
--bs-tooltip-bg: var(--bs-emphasis-color);
|
|
--bs-tooltip-border-radius: var(--bs-border-radius);
|
|
--bs-tooltip-opacity: 0.9;
|
|
--bs-tooltip-arrow-width: 0.8rem;
|
|
--bs-tooltip-arrow-height: 0.4rem;
|
|
z-index: var(--bs-tooltip-zindex);
|
|
display: block;
|
|
margin: var(--bs-tooltip-margin);
|
|
font-family: var(--bs-font-sans-serif);
|
|
font-style: normal;
|
|
font-weight: 400;
|
|
line-height: 1.5;
|
|
text-align: left;
|
|
text-align: start;
|
|
text-decoration: none;
|
|
text-shadow: none;
|
|
text-transform: none;
|
|
letter-spacing: normal;
|
|
word-break: normal;
|
|
white-space: normal;
|
|
word-spacing: normal;
|
|
line-break: auto;
|
|
font-size: var(--bs-tooltip-font-size);
|
|
word-wrap: break-word;
|
|
opacity: 0;
|
|
}
|
|
.tooltip.show {
|
|
opacity: var(--bs-tooltip-opacity);
|
|
}
|
|
.tooltip .tooltip-arrow {
|
|
display: block;
|
|
width: var(--bs-tooltip-arrow-width);
|
|
height: var(--bs-tooltip-arrow-height);
|
|
}
|
|
.tooltip .tooltip-arrow::before {
|
|
position: absolute;
|
|
content: "";
|
|
border-color: transparent;
|
|
border-style: solid;
|
|
}
|
|
|
|
.bs-tooltip-top .tooltip-arrow, .bs-tooltip-auto[data-popper-placement^=top] .tooltip-arrow {
|
|
bottom: calc(-1 * var(--bs-tooltip-arrow-height));
|
|
}
|
|
.bs-tooltip-top .tooltip-arrow::before, .bs-tooltip-auto[data-popper-placement^=top] .tooltip-arrow::before {
|
|
top: -1px;
|
|
border-width: var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width) * 0.5) 0;
|
|
border-top-color: var(--bs-tooltip-bg);
|
|
}
|
|
|
|
/* rtl:begin:ignore */
|
|
.bs-tooltip-end .tooltip-arrow, .bs-tooltip-auto[data-popper-placement^=right] .tooltip-arrow {
|
|
left: calc(-1 * var(--bs-tooltip-arrow-height));
|
|
width: var(--bs-tooltip-arrow-height);
|
|
height: var(--bs-tooltip-arrow-width);
|
|
}
|
|
.bs-tooltip-end .tooltip-arrow::before, .bs-tooltip-auto[data-popper-placement^=right] .tooltip-arrow::before {
|
|
right: -1px;
|
|
border-width: calc(var(--bs-tooltip-arrow-width) * 0.5) var(--bs-tooltip-arrow-height) calc(var(--bs-tooltip-arrow-width) * 0.5) 0;
|
|
border-right-color: var(--bs-tooltip-bg);
|
|
}
|
|
|
|
/* rtl:end:ignore */
|
|
.bs-tooltip-bottom .tooltip-arrow, .bs-tooltip-auto[data-popper-placement^=bottom] .tooltip-arrow {
|
|
top: calc(-1 * var(--bs-tooltip-arrow-height));
|
|
}
|
|
.bs-tooltip-bottom .tooltip-arrow::before, .bs-tooltip-auto[data-popper-placement^=bottom] .tooltip-arrow::before {
|
|
bottom: -1px;
|
|
border-width: 0 calc(var(--bs-tooltip-arrow-width) * 0.5) var(--bs-tooltip-arrow-height);
|
|
border-bottom-color: var(--bs-tooltip-bg);
|
|
}
|
|
|
|
/* rtl:begin:ignore */
|
|
.bs-tooltip-start .tooltip-arrow, .bs-tooltip-auto[data-popper-placement^=left] .tooltip-arrow {
|
|
right: calc(-1 * var(--bs-tooltip-arrow-height));
|
|
width: var(--bs-tooltip-arrow-height);
|
|
height: var(--bs-tooltip-arrow-width);
|
|
}
|
|
.bs-tooltip-start .tooltip-arrow::before, .bs-tooltip-auto[data-popper-placement^=left] .tooltip-arrow::before {
|
|
left: -1px;
|
|
border-width: calc(var(--bs-tooltip-arrow-width) * 0.5) 0 calc(var(--bs-tooltip-arrow-width) * 0.5) var(--bs-tooltip-arrow-height);
|
|
border-left-color: var(--bs-tooltip-bg);
|
|
}
|
|
|
|
/* rtl:end:ignore */
|
|
.tooltip-inner {
|
|
max-width: var(--bs-tooltip-max-width);
|
|
padding: var(--bs-tooltip-padding-y) var(--bs-tooltip-padding-x);
|
|
color: var(--bs-tooltip-color);
|
|
text-align: center;
|
|
background-color: var(--bs-tooltip-bg);
|
|
border-radius: var(--bs-tooltip-border-radius);
|
|
}
|
|
|
|
.popover {
|
|
--bs-popover-zindex: 1470;
|
|
--bs-popover-max-width: 276px;
|
|
--bs-popover-font-size: 0.875rem;
|
|
--bs-popover-bg: var(--bs-body-bg);
|
|
--bs-popover-border-width: var(--bs-border-width);
|
|
--bs-popover-border-color: var(--bs-border-color-translucent);
|
|
--bs-popover-border-radius: var(--bs-border-radius-lg);
|
|
--bs-popover-inner-border-radius: calc(var(--bs-border-radius-lg) - var(--bs-border-width));
|
|
--bs-popover-box-shadow: var(--bs-box-shadow);
|
|
--bs-popover-header-padding-x: 1rem;
|
|
--bs-popover-header-padding-y: 0.5rem;
|
|
--bs-popover-header-font-size: 1rem;
|
|
--bs-popover-header-color: inherit;
|
|
--bs-popover-header-bg: var(--bs-secondary-bg);
|
|
--bs-popover-body-padding-x: 1rem;
|
|
--bs-popover-body-padding-y: 1rem;
|
|
--bs-popover-body-color: var(--bs-body-color);
|
|
--bs-popover-arrow-width: 1rem;
|
|
--bs-popover-arrow-height: 0.5rem;
|
|
--bs-popover-arrow-border: var(--bs-popover-border-color);
|
|
z-index: var(--bs-popover-zindex);
|
|
display: block;
|
|
max-width: var(--bs-popover-max-width);
|
|
font-family: var(--bs-font-sans-serif);
|
|
font-style: normal;
|
|
font-weight: 400;
|
|
line-height: 1.5;
|
|
text-align: left;
|
|
text-align: start;
|
|
text-decoration: none;
|
|
text-shadow: none;
|
|
text-transform: none;
|
|
letter-spacing: normal;
|
|
word-break: normal;
|
|
white-space: normal;
|
|
word-spacing: normal;
|
|
line-break: auto;
|
|
font-size: var(--bs-popover-font-size);
|
|
word-wrap: break-word;
|
|
background-color: var(--bs-popover-bg);
|
|
background-clip: padding-box;
|
|
border: var(--bs-popover-border-width) solid var(--bs-popover-border-color);
|
|
border-radius: var(--bs-popover-border-radius);
|
|
}
|
|
.popover .popover-arrow {
|
|
display: block;
|
|
width: var(--bs-popover-arrow-width);
|
|
height: var(--bs-popover-arrow-height);
|
|
}
|
|
.popover .popover-arrow::before, .popover .popover-arrow::after {
|
|
position: absolute;
|
|
display: block;
|
|
content: "";
|
|
border-color: transparent;
|
|
border-style: solid;
|
|
border-width: 0;
|
|
}
|
|
|
|
.bs-popover-top > .popover-arrow, .bs-popover-auto[data-popper-placement^=top] > .popover-arrow {
|
|
bottom: calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width));
|
|
}
|
|
.bs-popover-top > .popover-arrow::before, .bs-popover-auto[data-popper-placement^=top] > .popover-arrow::before, .bs-popover-top > .popover-arrow::after, .bs-popover-auto[data-popper-placement^=top] > .popover-arrow::after {
|
|
border-width: var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width) * 0.5) 0;
|
|
}
|
|
.bs-popover-top > .popover-arrow::before, .bs-popover-auto[data-popper-placement^=top] > .popover-arrow::before {
|
|
bottom: 0;
|
|
border-top-color: var(--bs-popover-arrow-border);
|
|
}
|
|
.bs-popover-top > .popover-arrow::after, .bs-popover-auto[data-popper-placement^=top] > .popover-arrow::after {
|
|
bottom: var(--bs-popover-border-width);
|
|
border-top-color: var(--bs-popover-bg);
|
|
}
|
|
|
|
/* rtl:begin:ignore */
|
|
.bs-popover-end > .popover-arrow, .bs-popover-auto[data-popper-placement^=right] > .popover-arrow {
|
|
left: calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width));
|
|
width: var(--bs-popover-arrow-height);
|
|
height: var(--bs-popover-arrow-width);
|
|
}
|
|
.bs-popover-end > .popover-arrow::before, .bs-popover-auto[data-popper-placement^=right] > .popover-arrow::before, .bs-popover-end > .popover-arrow::after, .bs-popover-auto[data-popper-placement^=right] > .popover-arrow::after {
|
|
border-width: calc(var(--bs-popover-arrow-width) * 0.5) var(--bs-popover-arrow-height) calc(var(--bs-popover-arrow-width) * 0.5) 0;
|
|
}
|
|
.bs-popover-end > .popover-arrow::before, .bs-popover-auto[data-popper-placement^=right] > .popover-arrow::before {
|
|
left: 0;
|
|
border-right-color: var(--bs-popover-arrow-border);
|
|
}
|
|
.bs-popover-end > .popover-arrow::after, .bs-popover-auto[data-popper-placement^=right] > .popover-arrow::after {
|
|
left: var(--bs-popover-border-width);
|
|
border-right-color: var(--bs-popover-bg);
|
|
}
|
|
|
|
/* rtl:end:ignore */
|
|
.bs-popover-bottom > .popover-arrow, .bs-popover-auto[data-popper-placement^=bottom] > .popover-arrow {
|
|
top: calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width));
|
|
}
|
|
.bs-popover-bottom > .popover-arrow::before, .bs-popover-auto[data-popper-placement^=bottom] > .popover-arrow::before, .bs-popover-bottom > .popover-arrow::after, .bs-popover-auto[data-popper-placement^=bottom] > .popover-arrow::after {
|
|
border-width: 0 calc(var(--bs-popover-arrow-width) * 0.5) var(--bs-popover-arrow-height);
|
|
}
|
|
.bs-popover-bottom > .popover-arrow::before, .bs-popover-auto[data-popper-placement^=bottom] > .popover-arrow::before {
|
|
top: 0;
|
|
border-bottom-color: var(--bs-popover-arrow-border);
|
|
}
|
|
.bs-popover-bottom > .popover-arrow::after, .bs-popover-auto[data-popper-placement^=bottom] > .popover-arrow::after {
|
|
top: var(--bs-popover-border-width);
|
|
border-bottom-color: var(--bs-popover-bg);
|
|
}
|
|
.bs-popover-bottom .popover-header::before, .bs-popover-auto[data-popper-placement^=bottom] .popover-header::before {
|
|
position: absolute;
|
|
top: 0;
|
|
left: 50%;
|
|
display: block;
|
|
width: var(--bs-popover-arrow-width);
|
|
margin-left: calc(-0.5 * var(--bs-popover-arrow-width));
|
|
content: "";
|
|
border-bottom: var(--bs-popover-border-width) solid var(--bs-popover-header-bg);
|
|
}
|
|
|
|
/* rtl:begin:ignore */
|
|
.bs-popover-start > .popover-arrow, .bs-popover-auto[data-popper-placement^=left] > .popover-arrow {
|
|
right: calc(-1 * (var(--bs-popover-arrow-height)) - var(--bs-popover-border-width));
|
|
width: var(--bs-popover-arrow-height);
|
|
height: var(--bs-popover-arrow-width);
|
|
}
|
|
.bs-popover-start > .popover-arrow::before, .bs-popover-auto[data-popper-placement^=left] > .popover-arrow::before, .bs-popover-start > .popover-arrow::after, .bs-popover-auto[data-popper-placement^=left] > .popover-arrow::after {
|
|
border-width: calc(var(--bs-popover-arrow-width) * 0.5) 0 calc(var(--bs-popover-arrow-width) * 0.5) var(--bs-popover-arrow-height);
|
|
}
|
|
.bs-popover-start > .popover-arrow::before, .bs-popover-auto[data-popper-placement^=left] > .popover-arrow::before {
|
|
right: 0;
|
|
border-left-color: var(--bs-popover-arrow-border);
|
|
}
|
|
.bs-popover-start > .popover-arrow::after, .bs-popover-auto[data-popper-placement^=left] > .popover-arrow::after {
|
|
right: var(--bs-popover-border-width);
|
|
border-left-color: var(--bs-popover-bg);
|
|
}
|
|
|
|
/* rtl:end:ignore */
|
|
.popover-header {
|
|
padding: var(--bs-popover-header-padding-y) var(--bs-popover-header-padding-x);
|
|
margin-bottom: 0;
|
|
font-size: var(--bs-popover-header-font-size);
|
|
color: var(--bs-popover-header-color);
|
|
background-color: var(--bs-popover-header-bg);
|
|
border-bottom: var(--bs-popover-border-width) solid var(--bs-popover-border-color);
|
|
border-top-left-radius: var(--bs-popover-inner-border-radius);
|
|
border-top-right-radius: var(--bs-popover-inner-border-radius);
|
|
}
|
|
.popover-header:empty {
|
|
display: none;
|
|
}
|
|
|
|
.popover-body {
|
|
padding: var(--bs-popover-body-padding-y) var(--bs-popover-body-padding-x);
|
|
color: var(--bs-popover-body-color);
|
|
}
|
|
|
|
.carousel {
|
|
position: relative;
|
|
}
|
|
|
|
.carousel.pointer-event {
|
|
touch-action: pan-y;
|
|
}
|
|
|
|
.carousel-inner {
|
|
position: relative;
|
|
width: 100%;
|
|
overflow: hidden;
|
|
}
|
|
.carousel-inner::after {
|
|
display: block;
|
|
clear: both;
|
|
content: "";
|
|
}
|
|
|
|
.carousel-item {
|
|
position: relative;
|
|
display: none;
|
|
float: left;
|
|
width: 100%;
|
|
margin-right: -100%;
|
|
backface-visibility: hidden;
|
|
transition: transform 0.6s ease-in-out;
|
|
}
|
|
@media (prefers-reduced-motion: reduce) {
|
|
.carousel-item {
|
|
transition: none;
|
|
}
|
|
}
|
|
|
|
.carousel-item.active,
|
|
.carousel-item-next,
|
|
.carousel-item-prev {
|
|
display: block;
|
|
}
|
|
|
|
.carousel-item-next:not(.carousel-item-start),
|
|
.active.carousel-item-end {
|
|
transform: translateX(100%);
|
|
}
|
|
|
|
.carousel-item-prev:not(.carousel-item-end),
|
|
.active.carousel-item-start {
|
|
transform: translateX(-100%);
|
|
}
|
|
|
|
.carousel-fade .carousel-item {
|
|
opacity: 0;
|
|
transition-property: opacity;
|
|
transform: none;
|
|
}
|
|
.carousel-fade .carousel-item.active,
|
|
.carousel-fade .carousel-item-next.carousel-item-start,
|
|
.carousel-fade .carousel-item-prev.carousel-item-end {
|
|
z-index: 1;
|
|
opacity: 1;
|
|
}
|
|
.carousel-fade .active.carousel-item-start,
|
|
.carousel-fade .active.carousel-item-end {
|
|
z-index: 0;
|
|
opacity: 0;
|
|
transition: opacity 0s 0.6s;
|
|
}
|
|
@media (prefers-reduced-motion: reduce) {
|
|
.carousel-fade .active.carousel-item-start,
|
|
.carousel-fade .active.carousel-item-end {
|
|
transition: none;
|
|
}
|
|
}
|
|
|
|
.carousel-control-prev,
|
|
.carousel-control-next {
|
|
position: absolute;
|
|
top: 0;
|
|
bottom: 0;
|
|
z-index: 1;
|
|
display: flex;
|
|
align-items: center;
|
|
justify-content: center;
|
|
width: 15%;
|
|
padding: 0;
|
|
color: #fff;
|
|
text-align: center;
|
|
background: none;
|
|
border: 0;
|
|
opacity: 0.5;
|
|
transition: opacity 0.15s ease;
|
|
}
|
|
@media (prefers-reduced-motion: reduce) {
|
|
.carousel-control-prev,
|
|
.carousel-control-next {
|
|
transition: none;
|
|
}
|
|
}
|
|
.carousel-control-prev:hover, .carousel-control-prev:focus,
|
|
.carousel-control-next:hover,
|
|
.carousel-control-next:focus {
|
|
color: #fff;
|
|
text-decoration: none;
|
|
outline: 0;
|
|
opacity: 0.9;
|
|
}
|
|
|
|
.carousel-control-prev {
|
|
left: 0;
|
|
}
|
|
|
|
.carousel-control-next {
|
|
right: 0;
|
|
}
|
|
|
|
.carousel-control-prev-icon,
|
|
.carousel-control-next-icon {
|
|
display: inline-block;
|
|
width: 2rem;
|
|
height: 2rem;
|
|
background-repeat: no-repeat;
|
|
background-position: 50%;
|
|
background-size: 100% 100%;
|
|
}
|
|
|
|
.carousel-control-prev-icon {
|
|
background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M11.354 1.646a.5.5 0 0 1 0 .708L5.707 8l5.647 5.646a.5.5 0 0 1-.708.708l-6-6a.5.5 0 0 1 0-.708l6-6a.5.5 0 0 1 .708 0z'/%3e%3c/svg%3e") /*rtl:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M4.646 1.646a.5.5 0 0 1 .708 0l6 6a.5.5 0 0 1 0 .708l-6 6a.5.5 0 0 1-.708-.708L10.293 8 4.646 2.354a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e")*/;
|
|
}
|
|
|
|
.carousel-control-next-icon {
|
|
background-image: url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M4.646 1.646a.5.5 0 0 1 .708 0l6 6a.5.5 0 0 1 0 .708l-6 6a.5.5 0 0 1-.708-.708L10.293 8 4.646 2.354a.5.5 0 0 1 0-.708z'/%3e%3c/svg%3e") /*rtl:url("data:image/svg+xml,%3csvg xmlns='http://www.w3.org/2000/svg' viewBox='0 0 16 16' fill='%23fff'%3e%3cpath d='M11.354 1.646a.5.5 0 0 1 0 .708L5.707 8l5.647 5.646a.5.5 0 0 1-.708.708l-6-6a.5.5 0 0 1 0-.708l6-6a.5.5 0 0 1 .708 0z'/%3e%3c/svg%3e")*/;
|
|
}
|
|
|
|
.carousel-indicators {
|
|
position: absolute;
|
|
right: 0;
|
|
bottom: 0;
|
|
left: 0;
|
|
z-index: 2;
|
|
display: flex;
|
|
justify-content: center;
|
|
padding: 0;
|
|
margin-right: 15%;
|
|
margin-bottom: 1rem;
|
|
margin-left: 15%;
|
|
}
|
|
.carousel-indicators [data-bs-target] {
|
|
box-sizing: content-box;
|
|
flex: 0 1 auto;
|
|
width: 30px;
|
|
height: 3px;
|
|
padding: 0;
|
|
margin-right: 3px;
|
|
margin-left: 3px;
|
|
text-indent: -999px;
|
|
cursor: pointer;
|
|
background-color: #fff;
|
|
background-clip: padding-box;
|
|
border: 0;
|
|
border-top: 10px solid transparent;
|
|
border-bottom: 10px solid transparent;
|
|
opacity: 0.5;
|
|
transition: opacity 0.6s ease;
|
|
}
|
|
@media (prefers-reduced-motion: reduce) {
|
|
.carousel-indicators [data-bs-target] {
|
|
transition: none;
|
|
}
|
|
}
|
|
.carousel-indicators .active {
|
|
opacity: 1;
|
|
}
|
|
|
|
.carousel-caption {
|
|
position: absolute;
|
|
right: 15%;
|
|
bottom: 1.25rem;
|
|
left: 15%;
|
|
padding-top: 1.25rem;
|
|
padding-bottom: 1.25rem;
|
|
color: #fff;
|
|
text-align: center;
|
|
}
|
|
|
|
.carousel-dark .carousel-control-prev-icon,
|
|
.carousel-dark .carousel-control-next-icon {
|
|
filter: invert(1) grayscale(100);
|
|
}
|
|
.carousel-dark .carousel-indicators [data-bs-target] {
|
|
background-color: #000;
|
|
}
|
|
.carousel-dark .carousel-caption {
|
|
color: #000;
|
|
}
|
|
|
|
[data-bs-theme=dark] .carousel .carousel-control-prev-icon,
|
|
[data-bs-theme=dark] .carousel .carousel-control-next-icon, [data-bs-theme=dark].carousel .carousel-control-prev-icon,
|
|
[data-bs-theme=dark].carousel .carousel-control-next-icon {
|
|
filter: invert(1) grayscale(100);
|
|
}
|
|
[data-bs-theme=dark] .carousel .carousel-indicators [data-bs-target], [data-bs-theme=dark].carousel .carousel-indicators [data-bs-target] {
|
|
background-color: #000;
|
|
}
|
|
[data-bs-theme=dark] .carousel .carousel-caption, [data-bs-theme=dark].carousel .carousel-caption {
|
|
color: #000;
|
|
}
|
|
|
|
.spinner-grow,
|
|
.spinner-border {
|
|
display: inline-block;
|
|
width: var(--bs-spinner-width);
|
|
height: var(--bs-spinner-height);
|
|
vertical-align: var(--bs-spinner-vertical-align);
|
|
border-radius: 50%;
|
|
animation: var(--bs-spinner-animation-speed) linear infinite var(--bs-spinner-animation-name);
|
|
}
|
|
|
|
@keyframes spinner-border {
|
|
to {
|
|
transform: rotate(360deg) /* rtl:ignore */;
|
|
}
|
|
}
|
|
.spinner-border {
|
|
--bs-spinner-width: 2rem;
|
|
--bs-spinner-height: 2rem;
|
|
--bs-spinner-vertical-align: -0.125em;
|
|
--bs-spinner-border-width: 0.25em;
|
|
--bs-spinner-animation-speed: 0.75s;
|
|
--bs-spinner-animation-name: spinner-border;
|
|
border: var(--bs-spinner-border-width) solid currentcolor;
|
|
border-right-color: transparent;
|
|
}
|
|
|
|
.spinner-border-sm {
|
|
--bs-spinner-width: 1rem;
|
|
--bs-spinner-height: 1rem;
|
|
--bs-spinner-border-width: 0.2em;
|
|
}
|
|
|
|
@keyframes spinner-grow {
|
|
0% {
|
|
transform: scale(0);
|
|
}
|
|
50% {
|
|
opacity: 1;
|
|
transform: none;
|
|
}
|
|
}
|
|
.spinner-grow {
|
|
--bs-spinner-width: 2rem;
|
|
--bs-spinner-height: 2rem;
|
|
--bs-spinner-vertical-align: -0.125em;
|
|
--bs-spinner-animation-speed: 0.75s;
|
|
--bs-spinner-animation-name: spinner-grow;
|
|
background-color: currentcolor;
|
|
opacity: 0;
|
|
}
|
|
|
|
.spinner-grow-sm {
|
|
--bs-spinner-width: 1rem;
|
|
--bs-spinner-height: 1rem;
|
|
}
|
|
|
|
@media (prefers-reduced-motion: reduce) {
|
|
.spinner-border,
|
|
.spinner-grow {
|
|
--bs-spinner-animation-speed: 1.5s;
|
|
}
|
|
}
|
|
.offcanvas, .offcanvas-xxl, .offcanvas-xl, .offcanvas-lg, .offcanvas-md, .offcanvas-sm {
|
|
--bs-offcanvas-zindex: 1445;
|
|
--bs-offcanvas-width: 400px;
|
|
--bs-offcanvas-height: 30vh;
|
|
--bs-offcanvas-padding-x: 1rem;
|
|
--bs-offcanvas-padding-y: 1rem;
|
|
--bs-offcanvas-color: var(--bs-body-color);
|
|
--bs-offcanvas-bg: var(--bs-body-bg);
|
|
--bs-offcanvas-border-width: var(--bs-border-width);
|
|
--bs-offcanvas-border-color: var(--bs-border-color-translucent);
|
|
--bs-offcanvas-box-shadow: var(--bs-box-shadow-sm);
|
|
--bs-offcanvas-transition: transform 0.3s ease-in-out;
|
|
--bs-offcanvas-title-line-height: 1.5;
|
|
}
|
|
|
|
@media (max-width: 575.98px) {
|
|
.offcanvas-sm {
|
|
position: fixed;
|
|
bottom: 0;
|
|
z-index: var(--bs-offcanvas-zindex);
|
|
display: flex;
|
|
flex-direction: column;
|
|
max-width: 100%;
|
|
color: var(--bs-offcanvas-color);
|
|
visibility: hidden;
|
|
background-color: var(--bs-offcanvas-bg);
|
|
background-clip: padding-box;
|
|
outline: 0;
|
|
transition: var(--bs-offcanvas-transition);
|
|
}
|
|
}
|
|
@media (max-width: 575.98px) and (prefers-reduced-motion: reduce) {
|
|
.offcanvas-sm {
|
|
transition: none;
|
|
}
|
|
}
|
|
@media (max-width: 575.98px) {
|
|
.offcanvas-sm.offcanvas-start {
|
|
top: 0;
|
|
left: 0;
|
|
width: var(--bs-offcanvas-width);
|
|
border-right: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
|
|
transform: translateX(-100%);
|
|
}
|
|
}
|
|
@media (max-width: 575.98px) {
|
|
.offcanvas-sm.offcanvas-end {
|
|
top: 0;
|
|
right: 0;
|
|
width: var(--bs-offcanvas-width);
|
|
border-left: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
|
|
transform: translateX(100%);
|
|
}
|
|
}
|
|
@media (max-width: 575.98px) {
|
|
.offcanvas-sm.offcanvas-top {
|
|
top: 0;
|
|
right: 0;
|
|
left: 0;
|
|
height: var(--bs-offcanvas-height);
|
|
max-height: 100%;
|
|
border-bottom: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
|
|
transform: translateY(-100%);
|
|
}
|
|
}
|
|
@media (max-width: 575.98px) {
|
|
.offcanvas-sm.offcanvas-bottom {
|
|
right: 0;
|
|
left: 0;
|
|
height: var(--bs-offcanvas-height);
|
|
max-height: 100%;
|
|
border-top: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
|
|
transform: translateY(100%);
|
|
}
|
|
}
|
|
@media (max-width: 575.98px) {
|
|
.offcanvas-sm.showing, .offcanvas-sm.show:not(.hiding) {
|
|
transform: none;
|
|
}
|
|
}
|
|
@media (max-width: 575.98px) {
|
|
.offcanvas-sm.showing, .offcanvas-sm.hiding, .offcanvas-sm.show {
|
|
visibility: visible;
|
|
}
|
|
}
|
|
@media (min-width: 576px) {
|
|
.offcanvas-sm {
|
|
--bs-offcanvas-height: auto;
|
|
--bs-offcanvas-border-width: 0;
|
|
background-color: transparent !important;
|
|
}
|
|
.offcanvas-sm .offcanvas-header {
|
|
display: none;
|
|
}
|
|
.offcanvas-sm .offcanvas-body {
|
|
display: flex;
|
|
flex-grow: 0;
|
|
padding: 0;
|
|
overflow-y: visible;
|
|
background-color: transparent !important;
|
|
}
|
|
}
|
|
|
|
@media (max-width: 767.98px) {
|
|
.offcanvas-md {
|
|
position: fixed;
|
|
bottom: 0;
|
|
z-index: var(--bs-offcanvas-zindex);
|
|
display: flex;
|
|
flex-direction: column;
|
|
max-width: 100%;
|
|
color: var(--bs-offcanvas-color);
|
|
visibility: hidden;
|
|
background-color: var(--bs-offcanvas-bg);
|
|
background-clip: padding-box;
|
|
outline: 0;
|
|
transition: var(--bs-offcanvas-transition);
|
|
}
|
|
}
|
|
@media (max-width: 767.98px) and (prefers-reduced-motion: reduce) {
|
|
.offcanvas-md {
|
|
transition: none;
|
|
}
|
|
}
|
|
@media (max-width: 767.98px) {
|
|
.offcanvas-md.offcanvas-start {
|
|
top: 0;
|
|
left: 0;
|
|
width: var(--bs-offcanvas-width);
|
|
border-right: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
|
|
transform: translateX(-100%);
|
|
}
|
|
}
|
|
@media (max-width: 767.98px) {
|
|
.offcanvas-md.offcanvas-end {
|
|
top: 0;
|
|
right: 0;
|
|
width: var(--bs-offcanvas-width);
|
|
border-left: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
|
|
transform: translateX(100%);
|
|
}
|
|
}
|
|
@media (max-width: 767.98px) {
|
|
.offcanvas-md.offcanvas-top {
|
|
top: 0;
|
|
right: 0;
|
|
left: 0;
|
|
height: var(--bs-offcanvas-height);
|
|
max-height: 100%;
|
|
border-bottom: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
|
|
transform: translateY(-100%);
|
|
}
|
|
}
|
|
@media (max-width: 767.98px) {
|
|
.offcanvas-md.offcanvas-bottom {
|
|
right: 0;
|
|
left: 0;
|
|
height: var(--bs-offcanvas-height);
|
|
max-height: 100%;
|
|
border-top: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
|
|
transform: translateY(100%);
|
|
}
|
|
}
|
|
@media (max-width: 767.98px) {
|
|
.offcanvas-md.showing, .offcanvas-md.show:not(.hiding) {
|
|
transform: none;
|
|
}
|
|
}
|
|
@media (max-width: 767.98px) {
|
|
.offcanvas-md.showing, .offcanvas-md.hiding, .offcanvas-md.show {
|
|
visibility: visible;
|
|
}
|
|
}
|
|
@media (min-width: 768px) {
|
|
.offcanvas-md {
|
|
--bs-offcanvas-height: auto;
|
|
--bs-offcanvas-border-width: 0;
|
|
background-color: transparent !important;
|
|
}
|
|
.offcanvas-md .offcanvas-header {
|
|
display: none;
|
|
}
|
|
.offcanvas-md .offcanvas-body {
|
|
display: flex;
|
|
flex-grow: 0;
|
|
padding: 0;
|
|
overflow-y: visible;
|
|
background-color: transparent !important;
|
|
}
|
|
}
|
|
|
|
@media (max-width: 991.98px) {
|
|
.offcanvas-lg {
|
|
position: fixed;
|
|
bottom: 0;
|
|
z-index: var(--bs-offcanvas-zindex);
|
|
display: flex;
|
|
flex-direction: column;
|
|
max-width: 100%;
|
|
color: var(--bs-offcanvas-color);
|
|
visibility: hidden;
|
|
background-color: var(--bs-offcanvas-bg);
|
|
background-clip: padding-box;
|
|
outline: 0;
|
|
transition: var(--bs-offcanvas-transition);
|
|
}
|
|
}
|
|
@media (max-width: 991.98px) and (prefers-reduced-motion: reduce) {
|
|
.offcanvas-lg {
|
|
transition: none;
|
|
}
|
|
}
|
|
@media (max-width: 991.98px) {
|
|
.offcanvas-lg.offcanvas-start {
|
|
top: 0;
|
|
left: 0;
|
|
width: var(--bs-offcanvas-width);
|
|
border-right: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
|
|
transform: translateX(-100%);
|
|
}
|
|
}
|
|
@media (max-width: 991.98px) {
|
|
.offcanvas-lg.offcanvas-end {
|
|
top: 0;
|
|
right: 0;
|
|
width: var(--bs-offcanvas-width);
|
|
border-left: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
|
|
transform: translateX(100%);
|
|
}
|
|
}
|
|
@media (max-width: 991.98px) {
|
|
.offcanvas-lg.offcanvas-top {
|
|
top: 0;
|
|
right: 0;
|
|
left: 0;
|
|
height: var(--bs-offcanvas-height);
|
|
max-height: 100%;
|
|
border-bottom: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
|
|
transform: translateY(-100%);
|
|
}
|
|
}
|
|
@media (max-width: 991.98px) {
|
|
.offcanvas-lg.offcanvas-bottom {
|
|
right: 0;
|
|
left: 0;
|
|
height: var(--bs-offcanvas-height);
|
|
max-height: 100%;
|
|
border-top: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
|
|
transform: translateY(100%);
|
|
}
|
|
}
|
|
@media (max-width: 991.98px) {
|
|
.offcanvas-lg.showing, .offcanvas-lg.show:not(.hiding) {
|
|
transform: none;
|
|
}
|
|
}
|
|
@media (max-width: 991.98px) {
|
|
.offcanvas-lg.showing, .offcanvas-lg.hiding, .offcanvas-lg.show {
|
|
visibility: visible;
|
|
}
|
|
}
|
|
@media (min-width: 992px) {
|
|
.offcanvas-lg {
|
|
--bs-offcanvas-height: auto;
|
|
--bs-offcanvas-border-width: 0;
|
|
background-color: transparent !important;
|
|
}
|
|
.offcanvas-lg .offcanvas-header {
|
|
display: none;
|
|
}
|
|
.offcanvas-lg .offcanvas-body {
|
|
display: flex;
|
|
flex-grow: 0;
|
|
padding: 0;
|
|
overflow-y: visible;
|
|
background-color: transparent !important;
|
|
}
|
|
}
|
|
|
|
@media (max-width: 1199.98px) {
|
|
.offcanvas-xl {
|
|
position: fixed;
|
|
bottom: 0;
|
|
z-index: var(--bs-offcanvas-zindex);
|
|
display: flex;
|
|
flex-direction: column;
|
|
max-width: 100%;
|
|
color: var(--bs-offcanvas-color);
|
|
visibility: hidden;
|
|
background-color: var(--bs-offcanvas-bg);
|
|
background-clip: padding-box;
|
|
outline: 0;
|
|
transition: var(--bs-offcanvas-transition);
|
|
}
|
|
}
|
|
@media (max-width: 1199.98px) and (prefers-reduced-motion: reduce) {
|
|
.offcanvas-xl {
|
|
transition: none;
|
|
}
|
|
}
|
|
@media (max-width: 1199.98px) {
|
|
.offcanvas-xl.offcanvas-start {
|
|
top: 0;
|
|
left: 0;
|
|
width: var(--bs-offcanvas-width);
|
|
border-right: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
|
|
transform: translateX(-100%);
|
|
}
|
|
}
|
|
@media (max-width: 1199.98px) {
|
|
.offcanvas-xl.offcanvas-end {
|
|
top: 0;
|
|
right: 0;
|
|
width: var(--bs-offcanvas-width);
|
|
border-left: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
|
|
transform: translateX(100%);
|
|
}
|
|
}
|
|
@media (max-width: 1199.98px) {
|
|
.offcanvas-xl.offcanvas-top {
|
|
top: 0;
|
|
right: 0;
|
|
left: 0;
|
|
height: var(--bs-offcanvas-height);
|
|
max-height: 100%;
|
|
border-bottom: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
|
|
transform: translateY(-100%);
|
|
}
|
|
}
|
|
@media (max-width: 1199.98px) {
|
|
.offcanvas-xl.offcanvas-bottom {
|
|
right: 0;
|
|
left: 0;
|
|
height: var(--bs-offcanvas-height);
|
|
max-height: 100%;
|
|
border-top: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
|
|
transform: translateY(100%);
|
|
}
|
|
}
|
|
@media (max-width: 1199.98px) {
|
|
.offcanvas-xl.showing, .offcanvas-xl.show:not(.hiding) {
|
|
transform: none;
|
|
}
|
|
}
|
|
@media (max-width: 1199.98px) {
|
|
.offcanvas-xl.showing, .offcanvas-xl.hiding, .offcanvas-xl.show {
|
|
visibility: visible;
|
|
}
|
|
}
|
|
@media (min-width: 1200px) {
|
|
.offcanvas-xl {
|
|
--bs-offcanvas-height: auto;
|
|
--bs-offcanvas-border-width: 0;
|
|
background-color: transparent !important;
|
|
}
|
|
.offcanvas-xl .offcanvas-header {
|
|
display: none;
|
|
}
|
|
.offcanvas-xl .offcanvas-body {
|
|
display: flex;
|
|
flex-grow: 0;
|
|
padding: 0;
|
|
overflow-y: visible;
|
|
background-color: transparent !important;
|
|
}
|
|
}
|
|
|
|
@media (max-width: 1399.98px) {
|
|
.offcanvas-xxl {
|
|
position: fixed;
|
|
bottom: 0;
|
|
z-index: var(--bs-offcanvas-zindex);
|
|
display: flex;
|
|
flex-direction: column;
|
|
max-width: 100%;
|
|
color: var(--bs-offcanvas-color);
|
|
visibility: hidden;
|
|
background-color: var(--bs-offcanvas-bg);
|
|
background-clip: padding-box;
|
|
outline: 0;
|
|
transition: var(--bs-offcanvas-transition);
|
|
}
|
|
}
|
|
@media (max-width: 1399.98px) and (prefers-reduced-motion: reduce) {
|
|
.offcanvas-xxl {
|
|
transition: none;
|
|
}
|
|
}
|
|
@media (max-width: 1399.98px) {
|
|
.offcanvas-xxl.offcanvas-start {
|
|
top: 0;
|
|
left: 0;
|
|
width: var(--bs-offcanvas-width);
|
|
border-right: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
|
|
transform: translateX(-100%);
|
|
}
|
|
}
|
|
@media (max-width: 1399.98px) {
|
|
.offcanvas-xxl.offcanvas-end {
|
|
top: 0;
|
|
right: 0;
|
|
width: var(--bs-offcanvas-width);
|
|
border-left: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
|
|
transform: translateX(100%);
|
|
}
|
|
}
|
|
@media (max-width: 1399.98px) {
|
|
.offcanvas-xxl.offcanvas-top {
|
|
top: 0;
|
|
right: 0;
|
|
left: 0;
|
|
height: var(--bs-offcanvas-height);
|
|
max-height: 100%;
|
|
border-bottom: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
|
|
transform: translateY(-100%);
|
|
}
|
|
}
|
|
@media (max-width: 1399.98px) {
|
|
.offcanvas-xxl.offcanvas-bottom {
|
|
right: 0;
|
|
left: 0;
|
|
height: var(--bs-offcanvas-height);
|
|
max-height: 100%;
|
|
border-top: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
|
|
transform: translateY(100%);
|
|
}
|
|
}
|
|
@media (max-width: 1399.98px) {
|
|
.offcanvas-xxl.showing, .offcanvas-xxl.show:not(.hiding) {
|
|
transform: none;
|
|
}
|
|
}
|
|
@media (max-width: 1399.98px) {
|
|
.offcanvas-xxl.showing, .offcanvas-xxl.hiding, .offcanvas-xxl.show {
|
|
visibility: visible;
|
|
}
|
|
}
|
|
@media (min-width: 1400px) {
|
|
.offcanvas-xxl {
|
|
--bs-offcanvas-height: auto;
|
|
--bs-offcanvas-border-width: 0;
|
|
background-color: transparent !important;
|
|
}
|
|
.offcanvas-xxl .offcanvas-header {
|
|
display: none;
|
|
}
|
|
.offcanvas-xxl .offcanvas-body {
|
|
display: flex;
|
|
flex-grow: 0;
|
|
padding: 0;
|
|
overflow-y: visible;
|
|
background-color: transparent !important;
|
|
}
|
|
}
|
|
|
|
.offcanvas {
|
|
position: fixed;
|
|
bottom: 0;
|
|
z-index: var(--bs-offcanvas-zindex);
|
|
display: flex;
|
|
flex-direction: column;
|
|
max-width: 100%;
|
|
color: var(--bs-offcanvas-color);
|
|
visibility: hidden;
|
|
background-color: var(--bs-offcanvas-bg);
|
|
background-clip: padding-box;
|
|
outline: 0;
|
|
transition: var(--bs-offcanvas-transition);
|
|
}
|
|
@media (prefers-reduced-motion: reduce) {
|
|
.offcanvas {
|
|
transition: none;
|
|
}
|
|
}
|
|
.offcanvas.offcanvas-start {
|
|
top: 0;
|
|
left: 0;
|
|
width: var(--bs-offcanvas-width);
|
|
border-right: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
|
|
transform: translateX(-100%);
|
|
}
|
|
.offcanvas.offcanvas-end {
|
|
top: 0;
|
|
right: 0;
|
|
width: var(--bs-offcanvas-width);
|
|
border-left: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
|
|
transform: translateX(100%);
|
|
}
|
|
.offcanvas.offcanvas-top {
|
|
top: 0;
|
|
right: 0;
|
|
left: 0;
|
|
height: var(--bs-offcanvas-height);
|
|
max-height: 100%;
|
|
border-bottom: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
|
|
transform: translateY(-100%);
|
|
}
|
|
.offcanvas.offcanvas-bottom {
|
|
right: 0;
|
|
left: 0;
|
|
height: var(--bs-offcanvas-height);
|
|
max-height: 100%;
|
|
border-top: var(--bs-offcanvas-border-width) solid var(--bs-offcanvas-border-color);
|
|
transform: translateY(100%);
|
|
}
|
|
.offcanvas.showing, .offcanvas.show:not(.hiding) {
|
|
transform: none;
|
|
}
|
|
.offcanvas.showing, .offcanvas.hiding, .offcanvas.show {
|
|
visibility: visible;
|
|
}
|
|
|
|
.offcanvas-backdrop {
|
|
position: fixed;
|
|
top: 0;
|
|
left: 0;
|
|
z-index: 1440;
|
|
width: 100vw;
|
|
height: 100vh;
|
|
background-color: #000;
|
|
}
|
|
.offcanvas-backdrop.fade {
|
|
opacity: 0;
|
|
}
|
|
.offcanvas-backdrop.show {
|
|
opacity: 0.5;
|
|
}
|
|
|
|
.offcanvas-header {
|
|
display: flex;
|
|
align-items: center;
|
|
padding: var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x);
|
|
}
|
|
.offcanvas-header .btn-close {
|
|
padding: calc(var(--bs-offcanvas-padding-y) * 0.5) calc(var(--bs-offcanvas-padding-x) * 0.5);
|
|
margin: calc(-0.5 * var(--bs-offcanvas-padding-y)) calc(-0.5 * var(--bs-offcanvas-padding-x)) calc(-0.5 * var(--bs-offcanvas-padding-y)) auto;
|
|
}
|
|
|
|
.offcanvas-title {
|
|
margin-bottom: 0;
|
|
line-height: var(--bs-offcanvas-title-line-height);
|
|
}
|
|
|
|
.offcanvas-body {
|
|
flex-grow: 1;
|
|
padding: var(--bs-offcanvas-padding-y) var(--bs-offcanvas-padding-x);
|
|
overflow-y: auto;
|
|
}
|
|
|
|
.placeholder {
|
|
display: inline-block;
|
|
min-height: 1em;
|
|
vertical-align: middle;
|
|
cursor: wait;
|
|
background-color: currentcolor;
|
|
opacity: 0.5;
|
|
}
|
|
.placeholder.btn::before {
|
|
display: inline-block;
|
|
content: "";
|
|
}
|
|
|
|
.placeholder-xs {
|
|
min-height: 0.6em;
|
|
}
|
|
|
|
.placeholder-sm {
|
|
min-height: 0.8em;
|
|
}
|
|
|
|
.placeholder-lg {
|
|
min-height: 1.2em;
|
|
}
|
|
|
|
.placeholder-glow .placeholder {
|
|
animation: placeholder-glow 2s ease-in-out infinite;
|
|
}
|
|
|
|
@keyframes placeholder-glow {
|
|
50% {
|
|
opacity: 0.2;
|
|
}
|
|
}
|
|
.placeholder-wave {
|
|
mask-image: linear-gradient(130deg, #000 55%, rgba(0, 0, 0, 0.8) 75%, #000 95%);
|
|
mask-size: 200% 100%;
|
|
animation: placeholder-wave 2s linear infinite;
|
|
}
|
|
|
|
@keyframes placeholder-wave {
|
|
100% {
|
|
mask-position: -200% 0%;
|
|
}
|
|
}
|
|
.clearfix::after, .drag-elements-sidepane ul > li ol::after {
|
|
display: block;
|
|
clear: both;
|
|
content: "";
|
|
}
|
|
|
|
.text-bg-primary {
|
|
color: #fff !important;
|
|
background-color: RGBA(var(--bs-primary-rgb), var(--bs-bg-opacity, 1)) !important;
|
|
}
|
|
|
|
.text-bg-secondary {
|
|
color: #fff !important;
|
|
background-color: RGBA(var(--bs-secondary-rgb), var(--bs-bg-opacity, 1)) !important;
|
|
}
|
|
|
|
.text-bg-success {
|
|
color: #fff !important;
|
|
background-color: RGBA(var(--bs-success-rgb), var(--bs-bg-opacity, 1)) !important;
|
|
}
|
|
|
|
.text-bg-info {
|
|
color: #000 !important;
|
|
background-color: RGBA(var(--bs-info-rgb), var(--bs-bg-opacity, 1)) !important;
|
|
}
|
|
|
|
.text-bg-warning {
|
|
color: #000 !important;
|
|
background-color: RGBA(var(--bs-warning-rgb), var(--bs-bg-opacity, 1)) !important;
|
|
}
|
|
|
|
.text-bg-danger {
|
|
color: #fff !important;
|
|
background-color: RGBA(var(--bs-danger-rgb), var(--bs-bg-opacity, 1)) !important;
|
|
}
|
|
|
|
.text-bg-light {
|
|
color: #000 !important;
|
|
background-color: RGBA(var(--bs-light-rgb), var(--bs-bg-opacity, 1)) !important;
|
|
}
|
|
|
|
.text-bg-dark {
|
|
color: #fff !important;
|
|
background-color: RGBA(var(--bs-dark-rgb), var(--bs-bg-opacity, 1)) !important;
|
|
}
|
|
|
|
.link-primary {
|
|
color: RGBA(var(--bs-primary-rgb), var(--bs-link-opacity, 1)) !important;
|
|
text-decoration-color: RGBA(var(--bs-primary-rgb), var(--bs-link-underline-opacity, 1)) !important;
|
|
}
|
|
.link-primary:hover, .link-primary:focus {
|
|
color: RGBA(0, 90, 192, var(--bs-link-opacity, 1)) !important;
|
|
text-decoration-color: RGBA(0, 90, 192, var(--bs-link-underline-opacity, 1)) !important;
|
|
}
|
|
|
|
.link-secondary {
|
|
color: RGBA(var(--bs-secondary-rgb), var(--bs-link-opacity, 1)) !important;
|
|
text-decoration-color: RGBA(var(--bs-secondary-rgb), var(--bs-link-underline-opacity, 1)) !important;
|
|
}
|
|
.link-secondary:hover, .link-secondary:focus {
|
|
color: RGBA(86, 94, 100, var(--bs-link-opacity, 1)) !important;
|
|
text-decoration-color: RGBA(86, 94, 100, var(--bs-link-underline-opacity, 1)) !important;
|
|
}
|
|
|
|
.link-success {
|
|
color: RGBA(var(--bs-success-rgb), var(--bs-link-opacity, 1)) !important;
|
|
text-decoration-color: RGBA(var(--bs-success-rgb), var(--bs-link-underline-opacity, 1)) !important;
|
|
}
|
|
.link-success:hover, .link-success:focus {
|
|
color: RGBA(20, 108, 67, var(--bs-link-opacity, 1)) !important;
|
|
text-decoration-color: RGBA(20, 108, 67, var(--bs-link-underline-opacity, 1)) !important;
|
|
}
|
|
|
|
.link-info {
|
|
color: RGBA(var(--bs-info-rgb), var(--bs-link-opacity, 1)) !important;
|
|
text-decoration-color: RGBA(var(--bs-info-rgb), var(--bs-link-underline-opacity, 1)) !important;
|
|
}
|
|
.link-info:hover, .link-info:focus {
|
|
color: RGBA(61, 213, 243, var(--bs-link-opacity, 1)) !important;
|
|
text-decoration-color: RGBA(61, 213, 243, var(--bs-link-underline-opacity, 1)) !important;
|
|
}
|
|
|
|
.link-warning {
|
|
color: RGBA(var(--bs-warning-rgb), var(--bs-link-opacity, 1)) !important;
|
|
text-decoration-color: RGBA(var(--bs-warning-rgb), var(--bs-link-underline-opacity, 1)) !important;
|
|
}
|
|
.link-warning:hover, .link-warning:focus {
|
|
color: RGBA(255, 205, 57, var(--bs-link-opacity, 1)) !important;
|
|
text-decoration-color: RGBA(255, 205, 57, var(--bs-link-underline-opacity, 1)) !important;
|
|
}
|
|
|
|
.link-danger {
|
|
color: RGBA(var(--bs-danger-rgb), var(--bs-link-opacity, 1)) !important;
|
|
text-decoration-color: RGBA(var(--bs-danger-rgb), var(--bs-link-underline-opacity, 1)) !important;
|
|
}
|
|
.link-danger:hover, .link-danger:focus {
|
|
color: RGBA(176, 42, 55, var(--bs-link-opacity, 1)) !important;
|
|
text-decoration-color: RGBA(176, 42, 55, var(--bs-link-underline-opacity, 1)) !important;
|
|
}
|
|
|
|
.link-light {
|
|
color: RGBA(var(--bs-light-rgb), var(--bs-link-opacity, 1)) !important;
|
|
text-decoration-color: RGBA(var(--bs-light-rgb), var(--bs-link-underline-opacity, 1)) !important;
|
|
}
|
|
.link-light:hover, .link-light:focus {
|
|
color: RGBA(249, 250, 251, var(--bs-link-opacity, 1)) !important;
|
|
text-decoration-color: RGBA(249, 250, 251, var(--bs-link-underline-opacity, 1)) !important;
|
|
}
|
|
|
|
.link-dark {
|
|
color: RGBA(var(--bs-dark-rgb), var(--bs-link-opacity, 1)) !important;
|
|
text-decoration-color: RGBA(var(--bs-dark-rgb), var(--bs-link-underline-opacity, 1)) !important;
|
|
}
|
|
.link-dark:hover, .link-dark:focus {
|
|
color: RGBA(26, 30, 33, var(--bs-link-opacity, 1)) !important;
|
|
text-decoration-color: RGBA(26, 30, 33, var(--bs-link-underline-opacity, 1)) !important;
|
|
}
|
|
|
|
.link-body-emphasis {
|
|
color: RGBA(var(--bs-emphasis-color-rgb), var(--bs-link-opacity, 1)) !important;
|
|
text-decoration-color: RGBA(var(--bs-emphasis-color-rgb), var(--bs-link-underline-opacity, 1)) !important;
|
|
}
|
|
.link-body-emphasis:hover, .link-body-emphasis:focus {
|
|
color: RGBA(var(--bs-emphasis-color-rgb), var(--bs-link-opacity, 0.75)) !important;
|
|
text-decoration-color: RGBA(var(--bs-emphasis-color-rgb), var(--bs-link-underline-opacity, 0.75)) !important;
|
|
}
|
|
|
|
.focus-ring:focus {
|
|
outline: 0;
|
|
box-shadow: var(--bs-focus-ring-x, 0) var(--bs-focus-ring-y, 0) var(--bs-focus-ring-blur, 0) var(--bs-focus-ring-width) var(--bs-focus-ring-color);
|
|
}
|
|
|
|
.icon-link {
|
|
display: inline-flex;
|
|
gap: 0.375rem;
|
|
align-items: center;
|
|
text-decoration-color: rgba(var(--bs-link-color-rgb), var(--bs-link-opacity, 0.5));
|
|
text-underline-offset: 0.25em;
|
|
backface-visibility: hidden;
|
|
}
|
|
.icon-link > .bi {
|
|
flex-shrink: 0;
|
|
width: 1em;
|
|
height: 1em;
|
|
fill: currentcolor;
|
|
transition: 0.2s ease-in-out transform;
|
|
}
|
|
@media (prefers-reduced-motion: reduce) {
|
|
.icon-link > .bi {
|
|
transition: none;
|
|
}
|
|
}
|
|
|
|
.icon-link-hover:hover > .bi, .icon-link-hover:focus-visible > .bi {
|
|
transform: var(--bs-icon-link-transform, translate3d(0.25em, 0, 0));
|
|
}
|
|
|
|
.ratio {
|
|
position: relative;
|
|
width: 100%;
|
|
}
|
|
.ratio::before {
|
|
display: block;
|
|
padding-top: var(--bs-aspect-ratio);
|
|
content: "";
|
|
}
|
|
.ratio > * {
|
|
position: absolute;
|
|
top: 0;
|
|
left: 0;
|
|
width: 100%;
|
|
height: 100%;
|
|
}
|
|
|
|
.ratio-1x1 {
|
|
--bs-aspect-ratio: 100%;
|
|
}
|
|
|
|
.ratio-4x3 {
|
|
--bs-aspect-ratio: 75%;
|
|
}
|
|
|
|
.ratio-16x9 {
|
|
--bs-aspect-ratio: 56.25%;
|
|
}
|
|
|
|
.ratio-21x9 {
|
|
--bs-aspect-ratio: 42.8571428571%;
|
|
}
|
|
|
|
.fixed-top {
|
|
position: fixed;
|
|
top: 0;
|
|
right: 0;
|
|
left: 0;
|
|
z-index: 1430;
|
|
}
|
|
|
|
.fixed-bottom {
|
|
position: fixed;
|
|
right: 0;
|
|
bottom: 0;
|
|
left: 0;
|
|
z-index: 1430;
|
|
}
|
|
|
|
.sticky-top {
|
|
position: sticky;
|
|
top: 0;
|
|
z-index: 1420;
|
|
}
|
|
|
|
.sticky-bottom {
|
|
position: sticky;
|
|
bottom: 0;
|
|
z-index: 1420;
|
|
}
|
|
|
|
@media (min-width: 576px) {
|
|
.sticky-sm-top {
|
|
position: sticky;
|
|
top: 0;
|
|
z-index: 1420;
|
|
}
|
|
.sticky-sm-bottom {
|
|
position: sticky;
|
|
bottom: 0;
|
|
z-index: 1420;
|
|
}
|
|
}
|
|
@media (min-width: 768px) {
|
|
.sticky-md-top {
|
|
position: sticky;
|
|
top: 0;
|
|
z-index: 1420;
|
|
}
|
|
.sticky-md-bottom {
|
|
position: sticky;
|
|
bottom: 0;
|
|
z-index: 1420;
|
|
}
|
|
}
|
|
@media (min-width: 992px) {
|
|
.sticky-lg-top {
|
|
position: sticky;
|
|
top: 0;
|
|
z-index: 1420;
|
|
}
|
|
.sticky-lg-bottom {
|
|
position: sticky;
|
|
bottom: 0;
|
|
z-index: 1420;
|
|
}
|
|
}
|
|
@media (min-width: 1200px) {
|
|
.sticky-xl-top {
|
|
position: sticky;
|
|
top: 0;
|
|
z-index: 1420;
|
|
}
|
|
.sticky-xl-bottom {
|
|
position: sticky;
|
|
bottom: 0;
|
|
z-index: 1420;
|
|
}
|
|
}
|
|
@media (min-width: 1400px) {
|
|
.sticky-xxl-top {
|
|
position: sticky;
|
|
top: 0;
|
|
z-index: 1420;
|
|
}
|
|
.sticky-xxl-bottom {
|
|
position: sticky;
|
|
bottom: 0;
|
|
z-index: 1420;
|
|
}
|
|
}
|
|
.hstack {
|
|
display: flex;
|
|
flex-direction: row;
|
|
align-items: center;
|
|
align-self: stretch;
|
|
}
|
|
|
|
.vstack {
|
|
display: flex;
|
|
flex: 1 1 auto;
|
|
flex-direction: column;
|
|
align-self: stretch;
|
|
}
|
|
|
|
.visually-hidden,
|
|
.visually-hidden-focusable:not(:focus):not(:focus-within) {
|
|
width: 1px !important;
|
|
height: 1px !important;
|
|
padding: 0 !important;
|
|
margin: -1px !important;
|
|
overflow: hidden !important;
|
|
clip: rect(0, 0, 0, 0) !important;
|
|
white-space: nowrap !important;
|
|
border: 0 !important;
|
|
}
|
|
.visually-hidden:not(caption),
|
|
.visually-hidden-focusable:not(:focus):not(:focus-within):not(caption) {
|
|
position: absolute !important;
|
|
}
|
|
|
|
.stretched-link::after {
|
|
position: absolute;
|
|
top: 0;
|
|
right: 0;
|
|
bottom: 0;
|
|
left: 0;
|
|
z-index: 1;
|
|
content: "";
|
|
}
|
|
|
|
.text-truncate {
|
|
overflow: hidden;
|
|
text-overflow: ellipsis;
|
|
white-space: nowrap;
|
|
}
|
|
|
|
.vr {
|
|
display: inline-block;
|
|
align-self: stretch;
|
|
width: var(--bs-border-width);
|
|
min-height: 1em;
|
|
background-color: currentcolor;
|
|
opacity: 0.25;
|
|
}
|
|
|
|
.align-baseline {
|
|
vertical-align: baseline !important;
|
|
}
|
|
|
|
.align-top {
|
|
vertical-align: top !important;
|
|
}
|
|
|
|
.align-middle {
|
|
vertical-align: middle !important;
|
|
}
|
|
|
|
.align-bottom {
|
|
vertical-align: bottom !important;
|
|
}
|
|
|
|
.align-text-bottom {
|
|
vertical-align: text-bottom !important;
|
|
}
|
|
|
|
.align-text-top {
|
|
vertical-align: text-top !important;
|
|
}
|
|
|
|
.float-start {
|
|
float: left !important;
|
|
}
|
|
|
|
.float-end {
|
|
float: right !important;
|
|
}
|
|
|
|
.float-none {
|
|
float: none !important;
|
|
}
|
|
|
|
.object-fit-contain {
|
|
object-fit: contain !important;
|
|
}
|
|
|
|
.object-fit-cover {
|
|
object-fit: cover !important;
|
|
}
|
|
|
|
.object-fit-fill {
|
|
object-fit: fill !important;
|
|
}
|
|
|
|
.object-fit-scale {
|
|
object-fit: scale-down !important;
|
|
}
|
|
|
|
.object-fit-none {
|
|
object-fit: none !important;
|
|
}
|
|
|
|
.opacity-0 {
|
|
opacity: 0 !important;
|
|
}
|
|
|
|
.opacity-25 {
|
|
opacity: 0.25 !important;
|
|
}
|
|
|
|
.opacity-50 {
|
|
opacity: 0.5 !important;
|
|
}
|
|
|
|
.opacity-75 {
|
|
opacity: 0.75 !important;
|
|
}
|
|
|
|
.opacity-100 {
|
|
opacity: 1 !important;
|
|
}
|
|
|
|
.overflow-auto {
|
|
overflow: auto !important;
|
|
}
|
|
|
|
.overflow-hidden {
|
|
overflow: hidden !important;
|
|
}
|
|
|
|
.overflow-visible {
|
|
overflow: visible !important;
|
|
}
|
|
|
|
.overflow-scroll {
|
|
overflow: scroll !important;
|
|
}
|
|
|
|
.overflow-x-auto {
|
|
overflow-x: auto !important;
|
|
}
|
|
|
|
.overflow-x-hidden {
|
|
overflow-x: hidden !important;
|
|
}
|
|
|
|
.overflow-x-visible {
|
|
overflow-x: visible !important;
|
|
}
|
|
|
|
.overflow-x-scroll {
|
|
overflow-x: scroll !important;
|
|
}
|
|
|
|
.overflow-y-auto {
|
|
overflow-y: auto !important;
|
|
}
|
|
|
|
.overflow-y-hidden {
|
|
overflow-y: hidden !important;
|
|
}
|
|
|
|
.overflow-y-visible {
|
|
overflow-y: visible !important;
|
|
}
|
|
|
|
.overflow-y-scroll {
|
|
overflow-y: scroll !important;
|
|
}
|
|
|
|
.d-inline {
|
|
display: inline !important;
|
|
}
|
|
|
|
.d-inline-block {
|
|
display: inline-block !important;
|
|
}
|
|
|
|
.d-block {
|
|
display: block !important;
|
|
}
|
|
|
|
.d-grid {
|
|
display: grid !important;
|
|
}
|
|
|
|
.d-inline-grid {
|
|
display: inline-grid !important;
|
|
}
|
|
|
|
.d-table {
|
|
display: table !important;
|
|
}
|
|
|
|
.d-table-row {
|
|
display: table-row !important;
|
|
}
|
|
|
|
.d-table-cell {
|
|
display: table-cell !important;
|
|
}
|
|
|
|
.d-flex {
|
|
display: flex !important;
|
|
}
|
|
|
|
.d-inline-flex {
|
|
display: inline-flex !important;
|
|
}
|
|
|
|
.d-none {
|
|
display: none !important;
|
|
}
|
|
|
|
.shadow {
|
|
box-shadow: var(--bs-box-shadow) !important;
|
|
}
|
|
|
|
.shadow-sm {
|
|
box-shadow: var(--bs-box-shadow-sm) !important;
|
|
}
|
|
|
|
.shadow-lg {
|
|
box-shadow: var(--bs-box-shadow-lg) !important;
|
|
}
|
|
|
|
.shadow-none {
|
|
box-shadow: none !important;
|
|
}
|
|
|
|
.focus-ring-primary {
|
|
--bs-focus-ring-color: rgba(var(--bs-primary-rgb), var(--bs-focus-ring-opacity));
|
|
}
|
|
|
|
.focus-ring-secondary {
|
|
--bs-focus-ring-color: rgba(var(--bs-secondary-rgb), var(--bs-focus-ring-opacity));
|
|
}
|
|
|
|
.focus-ring-success {
|
|
--bs-focus-ring-color: rgba(var(--bs-success-rgb), var(--bs-focus-ring-opacity));
|
|
}
|
|
|
|
.focus-ring-info {
|
|
--bs-focus-ring-color: rgba(var(--bs-info-rgb), var(--bs-focus-ring-opacity));
|
|
}
|
|
|
|
.focus-ring-warning {
|
|
--bs-focus-ring-color: rgba(var(--bs-warning-rgb), var(--bs-focus-ring-opacity));
|
|
}
|
|
|
|
.focus-ring-danger {
|
|
--bs-focus-ring-color: rgba(var(--bs-danger-rgb), var(--bs-focus-ring-opacity));
|
|
}
|
|
|
|
.focus-ring-light {
|
|
--bs-focus-ring-color: rgba(var(--bs-light-rgb), var(--bs-focus-ring-opacity));
|
|
}
|
|
|
|
.focus-ring-dark {
|
|
--bs-focus-ring-color: rgba(var(--bs-dark-rgb), var(--bs-focus-ring-opacity));
|
|
}
|
|
|
|
.position-static {
|
|
position: static !important;
|
|
}
|
|
|
|
.position-relative {
|
|
position: relative !important;
|
|
}
|
|
|
|
.position-absolute {
|
|
position: absolute !important;
|
|
}
|
|
|
|
.position-fixed {
|
|
position: fixed !important;
|
|
}
|
|
|
|
.position-sticky {
|
|
position: sticky !important;
|
|
}
|
|
|
|
.top-0 {
|
|
top: 0 !important;
|
|
}
|
|
|
|
.top-50 {
|
|
top: 50% !important;
|
|
}
|
|
|
|
.top-100 {
|
|
top: 100% !important;
|
|
}
|
|
|
|
.bottom-0 {
|
|
bottom: 0 !important;
|
|
}
|
|
|
|
.bottom-50 {
|
|
bottom: 50% !important;
|
|
}
|
|
|
|
.bottom-100 {
|
|
bottom: 100% !important;
|
|
}
|
|
|
|
.start-0 {
|
|
left: 0 !important;
|
|
}
|
|
|
|
.start-50 {
|
|
left: 50% !important;
|
|
}
|
|
|
|
.start-100 {
|
|
left: 100% !important;
|
|
}
|
|
|
|
.end-0 {
|
|
right: 0 !important;
|
|
}
|
|
|
|
.end-50 {
|
|
right: 50% !important;
|
|
}
|
|
|
|
.end-100 {
|
|
right: 100% !important;
|
|
}
|
|
|
|
.translate-middle {
|
|
transform: translate(-50%, -50%) !important;
|
|
}
|
|
|
|
.translate-middle-x {
|
|
transform: translateX(-50%) !important;
|
|
}
|
|
|
|
.translate-middle-y {
|
|
transform: translateY(-50%) !important;
|
|
}
|
|
|
|
.border {
|
|
border: var(--bs-border-width) var(--bs-border-style) var(--bs-border-color) !important;
|
|
}
|
|
|
|
.border-0 {
|
|
border: 0 !important;
|
|
}
|
|
|
|
.border-top {
|
|
border-top: var(--bs-border-width) var(--bs-border-style) var(--bs-border-color) !important;
|
|
}
|
|
|
|
.border-top-0 {
|
|
border-top: 0 !important;
|
|
}
|
|
|
|
.border-end {
|
|
border-right: var(--bs-border-width) var(--bs-border-style) var(--bs-border-color) !important;
|
|
}
|
|
|
|
.border-end-0 {
|
|
border-right: 0 !important;
|
|
}
|
|
|
|
.border-bottom {
|
|
border-bottom: var(--bs-border-width) var(--bs-border-style) var(--bs-border-color) !important;
|
|
}
|
|
|
|
.border-bottom-0 {
|
|
border-bottom: 0 !important;
|
|
}
|
|
|
|
.border-start {
|
|
border-left: var(--bs-border-width) var(--bs-border-style) var(--bs-border-color) !important;
|
|
}
|
|
|
|
.border-start-0 {
|
|
border-left: 0 !important;
|
|
}
|
|
|
|
.border-primary {
|
|
--bs-border-opacity: 1;
|
|
border-color: rgba(var(--bs-primary-rgb), var(--bs-border-opacity)) !important;
|
|
}
|
|
|
|
.border-secondary {
|
|
--bs-border-opacity: 1;
|
|
border-color: rgba(var(--bs-secondary-rgb), var(--bs-border-opacity)) !important;
|
|
}
|
|
|
|
.border-success {
|
|
--bs-border-opacity: 1;
|
|
border-color: rgba(var(--bs-success-rgb), var(--bs-border-opacity)) !important;
|
|
}
|
|
|
|
.border-info {
|
|
--bs-border-opacity: 1;
|
|
border-color: rgba(var(--bs-info-rgb), var(--bs-border-opacity)) !important;
|
|
}
|
|
|
|
.border-warning {
|
|
--bs-border-opacity: 1;
|
|
border-color: rgba(var(--bs-warning-rgb), var(--bs-border-opacity)) !important;
|
|
}
|
|
|
|
.border-danger {
|
|
--bs-border-opacity: 1;
|
|
border-color: rgba(var(--bs-danger-rgb), var(--bs-border-opacity)) !important;
|
|
}
|
|
|
|
.border-light {
|
|
--bs-border-opacity: 1;
|
|
border-color: rgba(var(--bs-light-rgb), var(--bs-border-opacity)) !important;
|
|
}
|
|
|
|
.border-dark {
|
|
--bs-border-opacity: 1;
|
|
border-color: rgba(var(--bs-dark-rgb), var(--bs-border-opacity)) !important;
|
|
}
|
|
|
|
.border-black {
|
|
--bs-border-opacity: 1;
|
|
border-color: rgba(var(--bs-black-rgb), var(--bs-border-opacity)) !important;
|
|
}
|
|
|
|
.border-white {
|
|
--bs-border-opacity: 1;
|
|
border-color: rgba(var(--bs-white-rgb), var(--bs-border-opacity)) !important;
|
|
}
|
|
|
|
.border-primary-subtle {
|
|
border-color: var(--bs-primary-border-subtle) !important;
|
|
}
|
|
|
|
.border-secondary-subtle {
|
|
border-color: var(--bs-secondary-border-subtle) !important;
|
|
}
|
|
|
|
.border-success-subtle {
|
|
border-color: var(--bs-success-border-subtle) !important;
|
|
}
|
|
|
|
.border-info-subtle {
|
|
border-color: var(--bs-info-border-subtle) !important;
|
|
}
|
|
|
|
.border-warning-subtle {
|
|
border-color: var(--bs-warning-border-subtle) !important;
|
|
}
|
|
|
|
.border-danger-subtle {
|
|
border-color: var(--bs-danger-border-subtle) !important;
|
|
}
|
|
|
|
.border-light-subtle {
|
|
border-color: var(--bs-light-border-subtle) !important;
|
|
}
|
|
|
|
.border-dark-subtle {
|
|
border-color: var(--bs-dark-border-subtle) !important;
|
|
}
|
|
|
|
.border-1 {
|
|
border-width: 1px !important;
|
|
}
|
|
|
|
.border-2 {
|
|
border-width: 2px !important;
|
|
}
|
|
|
|
.border-3 {
|
|
border-width: 3px !important;
|
|
}
|
|
|
|
.border-4 {
|
|
border-width: 4px !important;
|
|
}
|
|
|
|
.border-5 {
|
|
border-width: 5px !important;
|
|
}
|
|
|
|
.border-opacity-10 {
|
|
--bs-border-opacity: 0.1;
|
|
}
|
|
|
|
.border-opacity-25 {
|
|
--bs-border-opacity: 0.25;
|
|
}
|
|
|
|
.border-opacity-50 {
|
|
--bs-border-opacity: 0.5;
|
|
}
|
|
|
|
.border-opacity-75 {
|
|
--bs-border-opacity: 0.75;
|
|
}
|
|
|
|
.border-opacity-100 {
|
|
--bs-border-opacity: 1;
|
|
}
|
|
|
|
.w-25 {
|
|
width: 25% !important;
|
|
}
|
|
|
|
.w-50 {
|
|
width: 50% !important;
|
|
}
|
|
|
|
.w-75 {
|
|
width: 75% !important;
|
|
}
|
|
|
|
.w-100 {
|
|
width: 100% !important;
|
|
}
|
|
|
|
.w-auto {
|
|
width: auto !important;
|
|
}
|
|
|
|
.mw-100 {
|
|
max-width: 100% !important;
|
|
}
|
|
|
|
.vw-100 {
|
|
width: 100vw !important;
|
|
}
|
|
|
|
.min-vw-100 {
|
|
min-width: 100vw !important;
|
|
}
|
|
|
|
.h-25 {
|
|
height: 25% !important;
|
|
}
|
|
|
|
.h-50 {
|
|
height: 50% !important;
|
|
}
|
|
|
|
.h-75 {
|
|
height: 75% !important;
|
|
}
|
|
|
|
.h-100 {
|
|
height: 100% !important;
|
|
}
|
|
|
|
.h-auto {
|
|
height: auto !important;
|
|
}
|
|
|
|
.mh-100 {
|
|
max-height: 100% !important;
|
|
}
|
|
|
|
.vh-100 {
|
|
height: 100vh !important;
|
|
}
|
|
|
|
.min-vh-100 {
|
|
min-height: 100vh !important;
|
|
}
|
|
|
|
.flex-fill {
|
|
flex: 1 1 auto !important;
|
|
}
|
|
|
|
.flex-row {
|
|
flex-direction: row !important;
|
|
}
|
|
|
|
.flex-column {
|
|
flex-direction: column !important;
|
|
}
|
|
|
|
.flex-row-reverse {
|
|
flex-direction: row-reverse !important;
|
|
}
|
|
|
|
.flex-column-reverse {
|
|
flex-direction: column-reverse !important;
|
|
}
|
|
|
|
.flex-grow-0 {
|
|
flex-grow: 0 !important;
|
|
}
|
|
|
|
.flex-grow-1 {
|
|
flex-grow: 1 !important;
|
|
}
|
|
|
|
.flex-shrink-0 {
|
|
flex-shrink: 0 !important;
|
|
}
|
|
|
|
.flex-shrink-1 {
|
|
flex-shrink: 1 !important;
|
|
}
|
|
|
|
.flex-wrap {
|
|
flex-wrap: wrap !important;
|
|
}
|
|
|
|
.flex-nowrap {
|
|
flex-wrap: nowrap !important;
|
|
}
|
|
|
|
.flex-wrap-reverse {
|
|
flex-wrap: wrap-reverse !important;
|
|
}
|
|
|
|
.justify-content-start {
|
|
justify-content: flex-start !important;
|
|
}
|
|
|
|
.justify-content-end {
|
|
justify-content: flex-end !important;
|
|
}
|
|
|
|
.justify-content-center {
|
|
justify-content: center !important;
|
|
}
|
|
|
|
.justify-content-between {
|
|
justify-content: space-between !important;
|
|
}
|
|
|
|
.justify-content-around {
|
|
justify-content: space-around !important;
|
|
}
|
|
|
|
.justify-content-evenly {
|
|
justify-content: space-evenly !important;
|
|
}
|
|
|
|
.align-items-start {
|
|
align-items: flex-start !important;
|
|
}
|
|
|
|
.align-items-end {
|
|
align-items: flex-end !important;
|
|
}
|
|
|
|
.align-items-center {
|
|
align-items: center !important;
|
|
}
|
|
|
|
.align-items-baseline {
|
|
align-items: baseline !important;
|
|
}
|
|
|
|
.align-items-stretch {
|
|
align-items: stretch !important;
|
|
}
|
|
|
|
.align-content-start {
|
|
align-content: flex-start !important;
|
|
}
|
|
|
|
.align-content-end {
|
|
align-content: flex-end !important;
|
|
}
|
|
|
|
.align-content-center {
|
|
align-content: center !important;
|
|
}
|
|
|
|
.align-content-between {
|
|
align-content: space-between !important;
|
|
}
|
|
|
|
.align-content-around {
|
|
align-content: space-around !important;
|
|
}
|
|
|
|
.align-content-stretch {
|
|
align-content: stretch !important;
|
|
}
|
|
|
|
.align-self-auto {
|
|
align-self: auto !important;
|
|
}
|
|
|
|
.align-self-start {
|
|
align-self: flex-start !important;
|
|
}
|
|
|
|
.align-self-end {
|
|
align-self: flex-end !important;
|
|
}
|
|
|
|
.align-self-center {
|
|
align-self: center !important;
|
|
}
|
|
|
|
.align-self-baseline {
|
|
align-self: baseline !important;
|
|
}
|
|
|
|
.align-self-stretch {
|
|
align-self: stretch !important;
|
|
}
|
|
|
|
.order-first {
|
|
order: -1 !important;
|
|
}
|
|
|
|
.order-0 {
|
|
order: 0 !important;
|
|
}
|
|
|
|
.order-1 {
|
|
order: 1 !important;
|
|
}
|
|
|
|
.order-2 {
|
|
order: 2 !important;
|
|
}
|
|
|
|
.order-3 {
|
|
order: 3 !important;
|
|
}
|
|
|
|
.order-4 {
|
|
order: 4 !important;
|
|
}
|
|
|
|
.order-5 {
|
|
order: 5 !important;
|
|
}
|
|
|
|
.order-last {
|
|
order: 6 !important;
|
|
}
|
|
|
|
.m-0 {
|
|
margin: 0 !important;
|
|
}
|
|
|
|
.m-1 {
|
|
margin: 0.25rem !important;
|
|
}
|
|
|
|
.m-2 {
|
|
margin: 0.5rem !important;
|
|
}
|
|
|
|
.m-3 {
|
|
margin: 1rem !important;
|
|
}
|
|
|
|
.m-4 {
|
|
margin: 1.5rem !important;
|
|
}
|
|
|
|
.m-5 {
|
|
margin: 3rem !important;
|
|
}
|
|
|
|
.m-auto {
|
|
margin: auto !important;
|
|
}
|
|
|
|
.mx-0 {
|
|
margin-right: 0 !important;
|
|
margin-left: 0 !important;
|
|
}
|
|
|
|
.mx-1 {
|
|
margin-right: 0.25rem !important;
|
|
margin-left: 0.25rem !important;
|
|
}
|
|
|
|
.mx-2 {
|
|
margin-right: 0.5rem !important;
|
|
margin-left: 0.5rem !important;
|
|
}
|
|
|
|
.mx-3 {
|
|
margin-right: 1rem !important;
|
|
margin-left: 1rem !important;
|
|
}
|
|
|
|
.mx-4 {
|
|
margin-right: 1.5rem !important;
|
|
margin-left: 1.5rem !important;
|
|
}
|
|
|
|
.mx-5 {
|
|
margin-right: 3rem !important;
|
|
margin-left: 3rem !important;
|
|
}
|
|
|
|
.mx-auto {
|
|
margin-right: auto !important;
|
|
margin-left: auto !important;
|
|
}
|
|
|
|
.my-0 {
|
|
margin-top: 0 !important;
|
|
margin-bottom: 0 !important;
|
|
}
|
|
|
|
.my-1 {
|
|
margin-top: 0.25rem !important;
|
|
margin-bottom: 0.25rem !important;
|
|
}
|
|
|
|
.my-2 {
|
|
margin-top: 0.5rem !important;
|
|
margin-bottom: 0.5rem !important;
|
|
}
|
|
|
|
.my-3 {
|
|
margin-top: 1rem !important;
|
|
margin-bottom: 1rem !important;
|
|
}
|
|
|
|
.my-4 {
|
|
margin-top: 1.5rem !important;
|
|
margin-bottom: 1.5rem !important;
|
|
}
|
|
|
|
.my-5 {
|
|
margin-top: 3rem !important;
|
|
margin-bottom: 3rem !important;
|
|
}
|
|
|
|
.my-auto {
|
|
margin-top: auto !important;
|
|
margin-bottom: auto !important;
|
|
}
|
|
|
|
.mt-0 {
|
|
margin-top: 0 !important;
|
|
}
|
|
|
|
.mt-1 {
|
|
margin-top: 0.25rem !important;
|
|
}
|
|
|
|
.mt-2 {
|
|
margin-top: 0.5rem !important;
|
|
}
|
|
|
|
.mt-3 {
|
|
margin-top: 1rem !important;
|
|
}
|
|
|
|
.mt-4 {
|
|
margin-top: 1.5rem !important;
|
|
}
|
|
|
|
.mt-5 {
|
|
margin-top: 3rem !important;
|
|
}
|
|
|
|
.mt-auto {
|
|
margin-top: auto !important;
|
|
}
|
|
|
|
.me-0 {
|
|
margin-right: 0 !important;
|
|
}
|
|
|
|
.me-1 {
|
|
margin-right: 0.25rem !important;
|
|
}
|
|
|
|
.me-2 {
|
|
margin-right: 0.5rem !important;
|
|
}
|
|
|
|
.me-3 {
|
|
margin-right: 1rem !important;
|
|
}
|
|
|
|
.me-4 {
|
|
margin-right: 1.5rem !important;
|
|
}
|
|
|
|
.me-5 {
|
|
margin-right: 3rem !important;
|
|
}
|
|
|
|
.me-auto {
|
|
margin-right: auto !important;
|
|
}
|
|
|
|
.mb-0 {
|
|
margin-bottom: 0 !important;
|
|
}
|
|
|
|
.mb-1 {
|
|
margin-bottom: 0.25rem !important;
|
|
}
|
|
|
|
.mb-2 {
|
|
margin-bottom: 0.5rem !important;
|
|
}
|
|
|
|
.mb-3 {
|
|
margin-bottom: 1rem !important;
|
|
}
|
|
|
|
.mb-4 {
|
|
margin-bottom: 1.5rem !important;
|
|
}
|
|
|
|
.mb-5 {
|
|
margin-bottom: 3rem !important;
|
|
}
|
|
|
|
.mb-auto {
|
|
margin-bottom: auto !important;
|
|
}
|
|
|
|
.ms-0 {
|
|
margin-left: 0 !important;
|
|
}
|
|
|
|
.ms-1 {
|
|
margin-left: 0.25rem !important;
|
|
}
|
|
|
|
.ms-2 {
|
|
margin-left: 0.5rem !important;
|
|
}
|
|
|
|
.ms-3 {
|
|
margin-left: 1rem !important;
|
|
}
|
|
|
|
.ms-4 {
|
|
margin-left: 1.5rem !important;
|
|
}
|
|
|
|
.ms-5 {
|
|
margin-left: 3rem !important;
|
|
}
|
|
|
|
.ms-auto {
|
|
margin-left: auto !important;
|
|
}
|
|
|
|
.p-0 {
|
|
padding: 0 !important;
|
|
}
|
|
|
|
.p-1 {
|
|
padding: 0.25rem !important;
|
|
}
|
|
|
|
.p-2 {
|
|
padding: 0.5rem !important;
|
|
}
|
|
|
|
.p-3 {
|
|
padding: 1rem !important;
|
|
}
|
|
|
|
.p-4 {
|
|
padding: 1.5rem !important;
|
|
}
|
|
|
|
.p-5 {
|
|
padding: 3rem !important;
|
|
}
|
|
|
|
.px-0 {
|
|
padding-right: 0 !important;
|
|
padding-left: 0 !important;
|
|
}
|
|
|
|
.px-1 {
|
|
padding-right: 0.25rem !important;
|
|
padding-left: 0.25rem !important;
|
|
}
|
|
|
|
.px-2 {
|
|
padding-right: 0.5rem !important;
|
|
padding-left: 0.5rem !important;
|
|
}
|
|
|
|
.px-3 {
|
|
padding-right: 1rem !important;
|
|
padding-left: 1rem !important;
|
|
}
|
|
|
|
.px-4 {
|
|
padding-right: 1.5rem !important;
|
|
padding-left: 1.5rem !important;
|
|
}
|
|
|
|
.px-5 {
|
|
padding-right: 3rem !important;
|
|
padding-left: 3rem !important;
|
|
}
|
|
|
|
.py-0 {
|
|
padding-top: 0 !important;
|
|
padding-bottom: 0 !important;
|
|
}
|
|
|
|
.py-1 {
|
|
padding-top: 0.25rem !important;
|
|
padding-bottom: 0.25rem !important;
|
|
}
|
|
|
|
.py-2 {
|
|
padding-top: 0.5rem !important;
|
|
padding-bottom: 0.5rem !important;
|
|
}
|
|
|
|
.py-3 {
|
|
padding-top: 1rem !important;
|
|
padding-bottom: 1rem !important;
|
|
}
|
|
|
|
.py-4 {
|
|
padding-top: 1.5rem !important;
|
|
padding-bottom: 1.5rem !important;
|
|
}
|
|
|
|
.py-5 {
|
|
padding-top: 3rem !important;
|
|
padding-bottom: 3rem !important;
|
|
}
|
|
|
|
.pt-0 {
|
|
padding-top: 0 !important;
|
|
}
|
|
|
|
.pt-1 {
|
|
padding-top: 0.25rem !important;
|
|
}
|
|
|
|
.pt-2 {
|
|
padding-top: 0.5rem !important;
|
|
}
|
|
|
|
.pt-3 {
|
|
padding-top: 1rem !important;
|
|
}
|
|
|
|
.pt-4 {
|
|
padding-top: 1.5rem !important;
|
|
}
|
|
|
|
.pt-5 {
|
|
padding-top: 3rem !important;
|
|
}
|
|
|
|
.pe-0 {
|
|
padding-right: 0 !important;
|
|
}
|
|
|
|
.pe-1 {
|
|
padding-right: 0.25rem !important;
|
|
}
|
|
|
|
.pe-2 {
|
|
padding-right: 0.5rem !important;
|
|
}
|
|
|
|
.pe-3 {
|
|
padding-right: 1rem !important;
|
|
}
|
|
|
|
.pe-4 {
|
|
padding-right: 1.5rem !important;
|
|
}
|
|
|
|
.pe-5 {
|
|
padding-right: 3rem !important;
|
|
}
|
|
|
|
.pb-0 {
|
|
padding-bottom: 0 !important;
|
|
}
|
|
|
|
.pb-1 {
|
|
padding-bottom: 0.25rem !important;
|
|
}
|
|
|
|
.pb-2 {
|
|
padding-bottom: 0.5rem !important;
|
|
}
|
|
|
|
.pb-3 {
|
|
padding-bottom: 1rem !important;
|
|
}
|
|
|
|
.pb-4 {
|
|
padding-bottom: 1.5rem !important;
|
|
}
|
|
|
|
.pb-5 {
|
|
padding-bottom: 3rem !important;
|
|
}
|
|
|
|
.ps-0 {
|
|
padding-left: 0 !important;
|
|
}
|
|
|
|
.ps-1 {
|
|
padding-left: 0.25rem !important;
|
|
}
|
|
|
|
.ps-2 {
|
|
padding-left: 0.5rem !important;
|
|
}
|
|
|
|
.ps-3 {
|
|
padding-left: 1rem !important;
|
|
}
|
|
|
|
.ps-4 {
|
|
padding-left: 1.5rem !important;
|
|
}
|
|
|
|
.ps-5 {
|
|
padding-left: 3rem !important;
|
|
}
|
|
|
|
.gap-0 {
|
|
gap: 0 !important;
|
|
}
|
|
|
|
.gap-1 {
|
|
gap: 0.25rem !important;
|
|
}
|
|
|
|
.gap-2 {
|
|
gap: 0.5rem !important;
|
|
}
|
|
|
|
.gap-3 {
|
|
gap: 1rem !important;
|
|
}
|
|
|
|
.gap-4 {
|
|
gap: 1.5rem !important;
|
|
}
|
|
|
|
.gap-5 {
|
|
gap: 3rem !important;
|
|
}
|
|
|
|
.row-gap-0 {
|
|
row-gap: 0 !important;
|
|
}
|
|
|
|
.row-gap-1 {
|
|
row-gap: 0.25rem !important;
|
|
}
|
|
|
|
.row-gap-2 {
|
|
row-gap: 0.5rem !important;
|
|
}
|
|
|
|
.row-gap-3 {
|
|
row-gap: 1rem !important;
|
|
}
|
|
|
|
.row-gap-4 {
|
|
row-gap: 1.5rem !important;
|
|
}
|
|
|
|
.row-gap-5 {
|
|
row-gap: 3rem !important;
|
|
}
|
|
|
|
.column-gap-0 {
|
|
column-gap: 0 !important;
|
|
}
|
|
|
|
.column-gap-1 {
|
|
column-gap: 0.25rem !important;
|
|
}
|
|
|
|
.column-gap-2 {
|
|
column-gap: 0.5rem !important;
|
|
}
|
|
|
|
.column-gap-3 {
|
|
column-gap: 1rem !important;
|
|
}
|
|
|
|
.column-gap-4 {
|
|
column-gap: 1.5rem !important;
|
|
}
|
|
|
|
.column-gap-5 {
|
|
column-gap: 3rem !important;
|
|
}
|
|
|
|
.font-monospace {
|
|
font-family: var(--bs-font-monospace) !important;
|
|
}
|
|
|
|
.fs-1 {
|
|
font-size: calc(1.375rem + 1.5vw) !important;
|
|
}
|
|
|
|
.fs-2 {
|
|
font-size: calc(1.325rem + 0.9vw) !important;
|
|
}
|
|
|
|
.fs-3 {
|
|
font-size: calc(1.3rem + 0.6vw) !important;
|
|
}
|
|
|
|
.fs-4 {
|
|
font-size: calc(1.275rem + 0.3vw) !important;
|
|
}
|
|
|
|
.fs-5 {
|
|
font-size: 1.25rem !important;
|
|
}
|
|
|
|
.fs-6 {
|
|
font-size: 1rem !important;
|
|
}
|
|
|
|
.fst-italic {
|
|
font-style: italic !important;
|
|
}
|
|
|
|
.fst-normal {
|
|
font-style: normal !important;
|
|
}
|
|
|
|
.fw-lighter {
|
|
font-weight: lighter !important;
|
|
}
|
|
|
|
.fw-light {
|
|
font-weight: 300 !important;
|
|
}
|
|
|
|
.fw-normal {
|
|
font-weight: 400 !important;
|
|
}
|
|
|
|
.fw-medium {
|
|
font-weight: 500 !important;
|
|
}
|
|
|
|
.fw-semibold {
|
|
font-weight: 600 !important;
|
|
}
|
|
|
|
.fw-bold {
|
|
font-weight: 700 !important;
|
|
}
|
|
|
|
.fw-bolder {
|
|
font-weight: bolder !important;
|
|
}
|
|
|
|
.lh-1 {
|
|
line-height: 1 !important;
|
|
}
|
|
|
|
.lh-sm {
|
|
line-height: 1.25 !important;
|
|
}
|
|
|
|
.lh-base {
|
|
line-height: 1.5 !important;
|
|
}
|
|
|
|
.lh-lg {
|
|
line-height: 2 !important;
|
|
}
|
|
|
|
.text-start {
|
|
text-align: left !important;
|
|
}
|
|
|
|
.text-end {
|
|
text-align: right !important;
|
|
}
|
|
|
|
.text-center {
|
|
text-align: center !important;
|
|
}
|
|
|
|
.text-decoration-none {
|
|
text-decoration: none !important;
|
|
}
|
|
|
|
.text-decoration-underline {
|
|
text-decoration: underline !important;
|
|
}
|
|
|
|
.text-decoration-line-through {
|
|
text-decoration: line-through !important;
|
|
}
|
|
|
|
.text-lowercase {
|
|
text-transform: lowercase !important;
|
|
}
|
|
|
|
.text-uppercase {
|
|
text-transform: uppercase !important;
|
|
}
|
|
|
|
.text-capitalize {
|
|
text-transform: capitalize !important;
|
|
}
|
|
|
|
.text-wrap {
|
|
white-space: normal !important;
|
|
}
|
|
|
|
.text-nowrap {
|
|
white-space: nowrap !important;
|
|
}
|
|
|
|
/* rtl:begin:remove */
|
|
.text-break {
|
|
word-wrap: break-word !important;
|
|
word-break: break-word !important;
|
|
}
|
|
|
|
/* rtl:end:remove */
|
|
.text-primary {
|
|
--bs-text-opacity: 1;
|
|
color: rgba(var(--bs-primary-rgb), var(--bs-text-opacity)) !important;
|
|
}
|
|
|
|
.text-secondary {
|
|
--bs-text-opacity: 1;
|
|
color: rgba(var(--bs-secondary-rgb), var(--bs-text-opacity)) !important;
|
|
}
|
|
|
|
.text-success {
|
|
--bs-text-opacity: 1;
|
|
color: rgba(var(--bs-success-rgb), var(--bs-text-opacity)) !important;
|
|
}
|
|
|
|
.text-info {
|
|
--bs-text-opacity: 1;
|
|
color: rgba(var(--bs-info-rgb), var(--bs-text-opacity)) !important;
|
|
}
|
|
|
|
.text-warning {
|
|
--bs-text-opacity: 1;
|
|
color: rgba(var(--bs-warning-rgb), var(--bs-text-opacity)) !important;
|
|
}
|
|
|
|
.text-danger {
|
|
--bs-text-opacity: 1;
|
|
color: rgba(var(--bs-danger-rgb), var(--bs-text-opacity)) !important;
|
|
}
|
|
|
|
.text-light {
|
|
--bs-text-opacity: 1;
|
|
color: rgba(var(--bs-light-rgb), var(--bs-text-opacity)) !important;
|
|
}
|
|
|
|
.text-dark {
|
|
--bs-text-opacity: 1;
|
|
color: rgba(var(--bs-dark-rgb), var(--bs-text-opacity)) !important;
|
|
}
|
|
|
|
.text-black {
|
|
--bs-text-opacity: 1;
|
|
color: rgba(var(--bs-black-rgb), var(--bs-text-opacity)) !important;
|
|
}
|
|
|
|
.text-white {
|
|
--bs-text-opacity: 1;
|
|
color: rgba(var(--bs-white-rgb), var(--bs-text-opacity)) !important;
|
|
}
|
|
|
|
.text-body {
|
|
--bs-text-opacity: 1;
|
|
color: rgba(var(--bs-body-color-rgb), var(--bs-text-opacity)) !important;
|
|
}
|
|
|
|
.text-muted {
|
|
--bs-text-opacity: 1;
|
|
color: var(--bs-secondary-color) !important;
|
|
}
|
|
|
|
.text-black-50 {
|
|
--bs-text-opacity: 1;
|
|
color: rgba(0, 0, 0, 0.5) !important;
|
|
}
|
|
|
|
.text-white-50 {
|
|
--bs-text-opacity: 1;
|
|
color: rgba(255, 255, 255, 0.5) !important;
|
|
}
|
|
|
|
.text-body-secondary {
|
|
--bs-text-opacity: 1;
|
|
color: var(--bs-secondary-color) !important;
|
|
}
|
|
|
|
.text-body-tertiary {
|
|
--bs-text-opacity: 1;
|
|
color: var(--bs-tertiary-color) !important;
|
|
}
|
|
|
|
.text-body-emphasis {
|
|
--bs-text-opacity: 1;
|
|
color: var(--bs-emphasis-color) !important;
|
|
}
|
|
|
|
.text-reset {
|
|
--bs-text-opacity: 1;
|
|
color: inherit !important;
|
|
}
|
|
|
|
.text-opacity-25 {
|
|
--bs-text-opacity: 0.25;
|
|
}
|
|
|
|
.text-opacity-50 {
|
|
--bs-text-opacity: 0.5;
|
|
}
|
|
|
|
.text-opacity-75 {
|
|
--bs-text-opacity: 0.75;
|
|
}
|
|
|
|
.text-opacity-100 {
|
|
--bs-text-opacity: 1;
|
|
}
|
|
|
|
.text-primary-emphasis {
|
|
color: var(--bs-primary-text-emphasis) !important;
|
|
}
|
|
|
|
.text-secondary-emphasis {
|
|
color: var(--bs-secondary-text-emphasis) !important;
|
|
}
|
|
|
|
.text-success-emphasis {
|
|
color: var(--bs-success-text-emphasis) !important;
|
|
}
|
|
|
|
.text-info-emphasis {
|
|
color: var(--bs-info-text-emphasis) !important;
|
|
}
|
|
|
|
.text-warning-emphasis {
|
|
color: var(--bs-warning-text-emphasis) !important;
|
|
}
|
|
|
|
.text-danger-emphasis {
|
|
color: var(--bs-danger-text-emphasis) !important;
|
|
}
|
|
|
|
.text-light-emphasis {
|
|
color: var(--bs-light-text-emphasis) !important;
|
|
}
|
|
|
|
.text-dark-emphasis {
|
|
color: var(--bs-dark-text-emphasis) !important;
|
|
}
|
|
|
|
.link-opacity-10 {
|
|
--bs-link-opacity: 0.1;
|
|
}
|
|
|
|
.link-opacity-10-hover:hover {
|
|
--bs-link-opacity: 0.1;
|
|
}
|
|
|
|
.link-opacity-25 {
|
|
--bs-link-opacity: 0.25;
|
|
}
|
|
|
|
.link-opacity-25-hover:hover {
|
|
--bs-link-opacity: 0.25;
|
|
}
|
|
|
|
.link-opacity-50 {
|
|
--bs-link-opacity: 0.5;
|
|
}
|
|
|
|
.link-opacity-50-hover:hover {
|
|
--bs-link-opacity: 0.5;
|
|
}
|
|
|
|
.link-opacity-75 {
|
|
--bs-link-opacity: 0.75;
|
|
}
|
|
|
|
.link-opacity-75-hover:hover {
|
|
--bs-link-opacity: 0.75;
|
|
}
|
|
|
|
.link-opacity-100 {
|
|
--bs-link-opacity: 1;
|
|
}
|
|
|
|
.link-opacity-100-hover:hover {
|
|
--bs-link-opacity: 1;
|
|
}
|
|
|
|
.link-offset-1 {
|
|
text-underline-offset: 0.125em !important;
|
|
}
|
|
|
|
.link-offset-1-hover:hover {
|
|
text-underline-offset: 0.125em !important;
|
|
}
|
|
|
|
.link-offset-2 {
|
|
text-underline-offset: 0.25em !important;
|
|
}
|
|
|
|
.link-offset-2-hover:hover {
|
|
text-underline-offset: 0.25em !important;
|
|
}
|
|
|
|
.link-offset-3 {
|
|
text-underline-offset: 0.375em !important;
|
|
}
|
|
|
|
.link-offset-3-hover:hover {
|
|
text-underline-offset: 0.375em !important;
|
|
}
|
|
|
|
.link-underline-primary {
|
|
--bs-link-underline-opacity: 1;
|
|
text-decoration-color: rgba(var(--bs-primary-rgb), var(--bs-link-underline-opacity)) !important;
|
|
}
|
|
|
|
.link-underline-secondary {
|
|
--bs-link-underline-opacity: 1;
|
|
text-decoration-color: rgba(var(--bs-secondary-rgb), var(--bs-link-underline-opacity)) !important;
|
|
}
|
|
|
|
.link-underline-success {
|
|
--bs-link-underline-opacity: 1;
|
|
text-decoration-color: rgba(var(--bs-success-rgb), var(--bs-link-underline-opacity)) !important;
|
|
}
|
|
|
|
.link-underline-info {
|
|
--bs-link-underline-opacity: 1;
|
|
text-decoration-color: rgba(var(--bs-info-rgb), var(--bs-link-underline-opacity)) !important;
|
|
}
|
|
|
|
.link-underline-warning {
|
|
--bs-link-underline-opacity: 1;
|
|
text-decoration-color: rgba(var(--bs-warning-rgb), var(--bs-link-underline-opacity)) !important;
|
|
}
|
|
|
|
.link-underline-danger {
|
|
--bs-link-underline-opacity: 1;
|
|
text-decoration-color: rgba(var(--bs-danger-rgb), var(--bs-link-underline-opacity)) !important;
|
|
}
|
|
|
|
.link-underline-light {
|
|
--bs-link-underline-opacity: 1;
|
|
text-decoration-color: rgba(var(--bs-light-rgb), var(--bs-link-underline-opacity)) !important;
|
|
}
|
|
|
|
.link-underline-dark {
|
|
--bs-link-underline-opacity: 1;
|
|
text-decoration-color: rgba(var(--bs-dark-rgb), var(--bs-link-underline-opacity)) !important;
|
|
}
|
|
|
|
.link-underline {
|
|
--bs-link-underline-opacity: 1;
|
|
text-decoration-color: rgba(var(--bs-link-color-rgb), var(--bs-link-underline-opacity, 1)) !important;
|
|
}
|
|
|
|
.link-underline-opacity-0 {
|
|
--bs-link-underline-opacity: 0;
|
|
}
|
|
|
|
.link-underline-opacity-0-hover:hover {
|
|
--bs-link-underline-opacity: 0;
|
|
}
|
|
|
|
.link-underline-opacity-10 {
|
|
--bs-link-underline-opacity: 0.1;
|
|
}
|
|
|
|
.link-underline-opacity-10-hover:hover {
|
|
--bs-link-underline-opacity: 0.1;
|
|
}
|
|
|
|
.link-underline-opacity-25 {
|
|
--bs-link-underline-opacity: 0.25;
|
|
}
|
|
|
|
.link-underline-opacity-25-hover:hover {
|
|
--bs-link-underline-opacity: 0.25;
|
|
}
|
|
|
|
.link-underline-opacity-50 {
|
|
--bs-link-underline-opacity: 0.5;
|
|
}
|
|
|
|
.link-underline-opacity-50-hover:hover {
|
|
--bs-link-underline-opacity: 0.5;
|
|
}
|
|
|
|
.link-underline-opacity-75 {
|
|
--bs-link-underline-opacity: 0.75;
|
|
}
|
|
|
|
.link-underline-opacity-75-hover:hover {
|
|
--bs-link-underline-opacity: 0.75;
|
|
}
|
|
|
|
.link-underline-opacity-100 {
|
|
--bs-link-underline-opacity: 1;
|
|
}
|
|
|
|
.link-underline-opacity-100-hover:hover {
|
|
--bs-link-underline-opacity: 1;
|
|
}
|
|
|
|
.bg-primary {
|
|
--bs-bg-opacity: 1;
|
|
background-color: rgba(var(--bs-primary-rgb), var(--bs-bg-opacity)) !important;
|
|
}
|
|
|
|
.bg-secondary {
|
|
--bs-bg-opacity: 1;
|
|
background-color: rgba(var(--bs-secondary-rgb), var(--bs-bg-opacity)) !important;
|
|
}
|
|
|
|
.bg-success {
|
|
--bs-bg-opacity: 1;
|
|
background-color: rgba(var(--bs-success-rgb), var(--bs-bg-opacity)) !important;
|
|
}
|
|
|
|
.bg-info {
|
|
--bs-bg-opacity: 1;
|
|
background-color: rgba(var(--bs-info-rgb), var(--bs-bg-opacity)) !important;
|
|
}
|
|
|
|
.bg-warning {
|
|
--bs-bg-opacity: 1;
|
|
background-color: rgba(var(--bs-warning-rgb), var(--bs-bg-opacity)) !important;
|
|
}
|
|
|
|
.bg-danger {
|
|
--bs-bg-opacity: 1;
|
|
background-color: rgba(var(--bs-danger-rgb), var(--bs-bg-opacity)) !important;
|
|
}
|
|
|
|
.bg-light {
|
|
--bs-bg-opacity: 1;
|
|
background-color: rgba(var(--bs-light-rgb), var(--bs-bg-opacity)) !important;
|
|
}
|
|
|
|
.bg-dark {
|
|
--bs-bg-opacity: 1;
|
|
background-color: rgba(var(--bs-dark-rgb), var(--bs-bg-opacity)) !important;
|
|
}
|
|
|
|
.bg-black {
|
|
--bs-bg-opacity: 1;
|
|
background-color: rgba(var(--bs-black-rgb), var(--bs-bg-opacity)) !important;
|
|
}
|
|
|
|
.bg-white {
|
|
--bs-bg-opacity: 1;
|
|
background-color: rgba(var(--bs-white-rgb), var(--bs-bg-opacity)) !important;
|
|
}
|
|
|
|
.bg-body {
|
|
--bs-bg-opacity: 1;
|
|
background-color: rgba(var(--bs-body-bg-rgb), var(--bs-bg-opacity)) !important;
|
|
}
|
|
|
|
.bg-transparent {
|
|
--bs-bg-opacity: 1;
|
|
background-color: transparent !important;
|
|
}
|
|
|
|
.bg-body-secondary {
|
|
--bs-bg-opacity: 1;
|
|
background-color: rgba(var(--bs-secondary-bg-rgb), var(--bs-bg-opacity)) !important;
|
|
}
|
|
|
|
.bg-body-tertiary {
|
|
--bs-bg-opacity: 1;
|
|
background-color: rgba(var(--bs-tertiary-bg-rgb), var(--bs-bg-opacity)) !important;
|
|
}
|
|
|
|
.bg-opacity-10 {
|
|
--bs-bg-opacity: 0.1;
|
|
}
|
|
|
|
.bg-opacity-25 {
|
|
--bs-bg-opacity: 0.25;
|
|
}
|
|
|
|
.bg-opacity-50 {
|
|
--bs-bg-opacity: 0.5;
|
|
}
|
|
|
|
.bg-opacity-75 {
|
|
--bs-bg-opacity: 0.75;
|
|
}
|
|
|
|
.bg-opacity-100 {
|
|
--bs-bg-opacity: 1;
|
|
}
|
|
|
|
.bg-primary-subtle {
|
|
background-color: var(--bs-primary-bg-subtle) !important;
|
|
}
|
|
|
|
.bg-secondary-subtle {
|
|
background-color: var(--bs-secondary-bg-subtle) !important;
|
|
}
|
|
|
|
.bg-success-subtle {
|
|
background-color: var(--bs-success-bg-subtle) !important;
|
|
}
|
|
|
|
.bg-info-subtle {
|
|
background-color: var(--bs-info-bg-subtle) !important;
|
|
}
|
|
|
|
.bg-warning-subtle {
|
|
background-color: var(--bs-warning-bg-subtle) !important;
|
|
}
|
|
|
|
.bg-danger-subtle {
|
|
background-color: var(--bs-danger-bg-subtle) !important;
|
|
}
|
|
|
|
.bg-light-subtle {
|
|
background-color: var(--bs-light-bg-subtle) !important;
|
|
}
|
|
|
|
.bg-dark-subtle {
|
|
background-color: var(--bs-dark-bg-subtle) !important;
|
|
}
|
|
|
|
.bg-gradient {
|
|
background-image: var(--bs-gradient) !important;
|
|
}
|
|
|
|
.user-select-all {
|
|
user-select: all !important;
|
|
}
|
|
|
|
.user-select-auto {
|
|
user-select: auto !important;
|
|
}
|
|
|
|
.user-select-none {
|
|
user-select: none !important;
|
|
}
|
|
|
|
.pe-none {
|
|
pointer-events: none !important;
|
|
}
|
|
|
|
.pe-auto {
|
|
pointer-events: auto !important;
|
|
}
|
|
|
|
.rounded {
|
|
border-radius: var(--bs-border-radius) !important;
|
|
}
|
|
|
|
.rounded-0 {
|
|
border-radius: 0 !important;
|
|
}
|
|
|
|
.rounded-1 {
|
|
border-radius: var(--bs-border-radius-sm) !important;
|
|
}
|
|
|
|
.rounded-2 {
|
|
border-radius: var(--bs-border-radius) !important;
|
|
}
|
|
|
|
.rounded-3 {
|
|
border-radius: var(--bs-border-radius-lg) !important;
|
|
}
|
|
|
|
.rounded-4 {
|
|
border-radius: var(--bs-border-radius-xl) !important;
|
|
}
|
|
|
|
.rounded-5 {
|
|
border-radius: var(--bs-border-radius-xxl) !important;
|
|
}
|
|
|
|
.rounded-circle {
|
|
border-radius: 50% !important;
|
|
}
|
|
|
|
.rounded-pill {
|
|
border-radius: var(--bs-border-radius-pill) !important;
|
|
}
|
|
|
|
.rounded-top {
|
|
border-top-left-radius: var(--bs-border-radius) !important;
|
|
border-top-right-radius: var(--bs-border-radius) !important;
|
|
}
|
|
|
|
.rounded-top-0 {
|
|
border-top-left-radius: 0 !important;
|
|
border-top-right-radius: 0 !important;
|
|
}
|
|
|
|
.rounded-top-1 {
|
|
border-top-left-radius: var(--bs-border-radius-sm) !important;
|
|
border-top-right-radius: var(--bs-border-radius-sm) !important;
|
|
}
|
|
|
|
.rounded-top-2 {
|
|
border-top-left-radius: var(--bs-border-radius) !important;
|
|
border-top-right-radius: var(--bs-border-radius) !important;
|
|
}
|
|
|
|
.rounded-top-3 {
|
|
border-top-left-radius: var(--bs-border-radius-lg) !important;
|
|
border-top-right-radius: var(--bs-border-radius-lg) !important;
|
|
}
|
|
|
|
.rounded-top-4 {
|
|
border-top-left-radius: var(--bs-border-radius-xl) !important;
|
|
border-top-right-radius: var(--bs-border-radius-xl) !important;
|
|
}
|
|
|
|
.rounded-top-5 {
|
|
border-top-left-radius: var(--bs-border-radius-xxl) !important;
|
|
border-top-right-radius: var(--bs-border-radius-xxl) !important;
|
|
}
|
|
|
|
.rounded-top-circle {
|
|
border-top-left-radius: 50% !important;
|
|
border-top-right-radius: 50% !important;
|
|
}
|
|
|
|
.rounded-top-pill {
|
|
border-top-left-radius: var(--bs-border-radius-pill) !important;
|
|
border-top-right-radius: var(--bs-border-radius-pill) !important;
|
|
}
|
|
|
|
.rounded-end {
|
|
border-top-right-radius: var(--bs-border-radius) !important;
|
|
border-bottom-right-radius: var(--bs-border-radius) !important;
|
|
}
|
|
|
|
.rounded-end-0 {
|
|
border-top-right-radius: 0 !important;
|
|
border-bottom-right-radius: 0 !important;
|
|
}
|
|
|
|
.rounded-end-1 {
|
|
border-top-right-radius: var(--bs-border-radius-sm) !important;
|
|
border-bottom-right-radius: var(--bs-border-radius-sm) !important;
|
|
}
|
|
|
|
.rounded-end-2 {
|
|
border-top-right-radius: var(--bs-border-radius) !important;
|
|
border-bottom-right-radius: var(--bs-border-radius) !important;
|
|
}
|
|
|
|
.rounded-end-3 {
|
|
border-top-right-radius: var(--bs-border-radius-lg) !important;
|
|
border-bottom-right-radius: var(--bs-border-radius-lg) !important;
|
|
}
|
|
|
|
.rounded-end-4 {
|
|
border-top-right-radius: var(--bs-border-radius-xl) !important;
|
|
border-bottom-right-radius: var(--bs-border-radius-xl) !important;
|
|
}
|
|
|
|
.rounded-end-5 {
|
|
border-top-right-radius: var(--bs-border-radius-xxl) !important;
|
|
border-bottom-right-radius: var(--bs-border-radius-xxl) !important;
|
|
}
|
|
|
|
.rounded-end-circle {
|
|
border-top-right-radius: 50% !important;
|
|
border-bottom-right-radius: 50% !important;
|
|
}
|
|
|
|
.rounded-end-pill {
|
|
border-top-right-radius: var(--bs-border-radius-pill) !important;
|
|
border-bottom-right-radius: var(--bs-border-radius-pill) !important;
|
|
}
|
|
|
|
.rounded-bottom {
|
|
border-bottom-right-radius: var(--bs-border-radius) !important;
|
|
border-bottom-left-radius: var(--bs-border-radius) !important;
|
|
}
|
|
|
|
.rounded-bottom-0 {
|
|
border-bottom-right-radius: 0 !important;
|
|
border-bottom-left-radius: 0 !important;
|
|
}
|
|
|
|
.rounded-bottom-1 {
|
|
border-bottom-right-radius: var(--bs-border-radius-sm) !important;
|
|
border-bottom-left-radius: var(--bs-border-radius-sm) !important;
|
|
}
|
|
|
|
.rounded-bottom-2 {
|
|
border-bottom-right-radius: var(--bs-border-radius) !important;
|
|
border-bottom-left-radius: var(--bs-border-radius) !important;
|
|
}
|
|
|
|
.rounded-bottom-3 {
|
|
border-bottom-right-radius: var(--bs-border-radius-lg) !important;
|
|
border-bottom-left-radius: var(--bs-border-radius-lg) !important;
|
|
}
|
|
|
|
.rounded-bottom-4 {
|
|
border-bottom-right-radius: var(--bs-border-radius-xl) !important;
|
|
border-bottom-left-radius: var(--bs-border-radius-xl) !important;
|
|
}
|
|
|
|
.rounded-bottom-5 {
|
|
border-bottom-right-radius: var(--bs-border-radius-xxl) !important;
|
|
border-bottom-left-radius: var(--bs-border-radius-xxl) !important;
|
|
}
|
|
|
|
.rounded-bottom-circle {
|
|
border-bottom-right-radius: 50% !important;
|
|
border-bottom-left-radius: 50% !important;
|
|
}
|
|
|
|
.rounded-bottom-pill {
|
|
border-bottom-right-radius: var(--bs-border-radius-pill) !important;
|
|
border-bottom-left-radius: var(--bs-border-radius-pill) !important;
|
|
}
|
|
|
|
.rounded-start {
|
|
border-bottom-left-radius: var(--bs-border-radius) !important;
|
|
border-top-left-radius: var(--bs-border-radius) !important;
|
|
}
|
|
|
|
.rounded-start-0 {
|
|
border-bottom-left-radius: 0 !important;
|
|
border-top-left-radius: 0 !important;
|
|
}
|
|
|
|
.rounded-start-1 {
|
|
border-bottom-left-radius: var(--bs-border-radius-sm) !important;
|
|
border-top-left-radius: var(--bs-border-radius-sm) !important;
|
|
}
|
|
|
|
.rounded-start-2 {
|
|
border-bottom-left-radius: var(--bs-border-radius) !important;
|
|
border-top-left-radius: var(--bs-border-radius) !important;
|
|
}
|
|
|
|
.rounded-start-3 {
|
|
border-bottom-left-radius: var(--bs-border-radius-lg) !important;
|
|
border-top-left-radius: var(--bs-border-radius-lg) !important;
|
|
}
|
|
|
|
.rounded-start-4 {
|
|
border-bottom-left-radius: var(--bs-border-radius-xl) !important;
|
|
border-top-left-radius: var(--bs-border-radius-xl) !important;
|
|
}
|
|
|
|
.rounded-start-5 {
|
|
border-bottom-left-radius: var(--bs-border-radius-xxl) !important;
|
|
border-top-left-radius: var(--bs-border-radius-xxl) !important;
|
|
}
|
|
|
|
.rounded-start-circle {
|
|
border-bottom-left-radius: 50% !important;
|
|
border-top-left-radius: 50% !important;
|
|
}
|
|
|
|
.rounded-start-pill {
|
|
border-bottom-left-radius: var(--bs-border-radius-pill) !important;
|
|
border-top-left-radius: var(--bs-border-radius-pill) !important;
|
|
}
|
|
|
|
.visible {
|
|
visibility: visible !important;
|
|
}
|
|
|
|
.invisible {
|
|
visibility: hidden !important;
|
|
}
|
|
|
|
.z-n1 {
|
|
z-index: -1 !important;
|
|
}
|
|
|
|
.z-0 {
|
|
z-index: 0 !important;
|
|
}
|
|
|
|
.z-1 {
|
|
z-index: 1 !important;
|
|
}
|
|
|
|
.z-2 {
|
|
z-index: 2 !important;
|
|
}
|
|
|
|
.z-3 {
|
|
z-index: 3 !important;
|
|
}
|
|
|
|
@media (min-width: 576px) {
|
|
.float-sm-start {
|
|
float: left !important;
|
|
}
|
|
.float-sm-end {
|
|
float: right !important;
|
|
}
|
|
.float-sm-none {
|
|
float: none !important;
|
|
}
|
|
.object-fit-sm-contain {
|
|
object-fit: contain !important;
|
|
}
|
|
.object-fit-sm-cover {
|
|
object-fit: cover !important;
|
|
}
|
|
.object-fit-sm-fill {
|
|
object-fit: fill !important;
|
|
}
|
|
.object-fit-sm-scale {
|
|
object-fit: scale-down !important;
|
|
}
|
|
.object-fit-sm-none {
|
|
object-fit: none !important;
|
|
}
|
|
.d-sm-inline {
|
|
display: inline !important;
|
|
}
|
|
.d-sm-inline-block {
|
|
display: inline-block !important;
|
|
}
|
|
.d-sm-block {
|
|
display: block !important;
|
|
}
|
|
.d-sm-grid {
|
|
display: grid !important;
|
|
}
|
|
.d-sm-inline-grid {
|
|
display: inline-grid !important;
|
|
}
|
|
.d-sm-table {
|
|
display: table !important;
|
|
}
|
|
.d-sm-table-row {
|
|
display: table-row !important;
|
|
}
|
|
.d-sm-table-cell {
|
|
display: table-cell !important;
|
|
}
|
|
.d-sm-flex {
|
|
display: flex !important;
|
|
}
|
|
.d-sm-inline-flex {
|
|
display: inline-flex !important;
|
|
}
|
|
.d-sm-none {
|
|
display: none !important;
|
|
}
|
|
.flex-sm-fill {
|
|
flex: 1 1 auto !important;
|
|
}
|
|
.flex-sm-row {
|
|
flex-direction: row !important;
|
|
}
|
|
.flex-sm-column {
|
|
flex-direction: column !important;
|
|
}
|
|
.flex-sm-row-reverse {
|
|
flex-direction: row-reverse !important;
|
|
}
|
|
.flex-sm-column-reverse {
|
|
flex-direction: column-reverse !important;
|
|
}
|
|
.flex-sm-grow-0 {
|
|
flex-grow: 0 !important;
|
|
}
|
|
.flex-sm-grow-1 {
|
|
flex-grow: 1 !important;
|
|
}
|
|
.flex-sm-shrink-0 {
|
|
flex-shrink: 0 !important;
|
|
}
|
|
.flex-sm-shrink-1 {
|
|
flex-shrink: 1 !important;
|
|
}
|
|
.flex-sm-wrap {
|
|
flex-wrap: wrap !important;
|
|
}
|
|
.flex-sm-nowrap {
|
|
flex-wrap: nowrap !important;
|
|
}
|
|
.flex-sm-wrap-reverse {
|
|
flex-wrap: wrap-reverse !important;
|
|
}
|
|
.justify-content-sm-start {
|
|
justify-content: flex-start !important;
|
|
}
|
|
.justify-content-sm-end {
|
|
justify-content: flex-end !important;
|
|
}
|
|
.justify-content-sm-center {
|
|
justify-content: center !important;
|
|
}
|
|
.justify-content-sm-between {
|
|
justify-content: space-between !important;
|
|
}
|
|
.justify-content-sm-around {
|
|
justify-content: space-around !important;
|
|
}
|
|
.justify-content-sm-evenly {
|
|
justify-content: space-evenly !important;
|
|
}
|
|
.align-items-sm-start {
|
|
align-items: flex-start !important;
|
|
}
|
|
.align-items-sm-end {
|
|
align-items: flex-end !important;
|
|
}
|
|
.align-items-sm-center {
|
|
align-items: center !important;
|
|
}
|
|
.align-items-sm-baseline {
|
|
align-items: baseline !important;
|
|
}
|
|
.align-items-sm-stretch {
|
|
align-items: stretch !important;
|
|
}
|
|
.align-content-sm-start {
|
|
align-content: flex-start !important;
|
|
}
|
|
.align-content-sm-end {
|
|
align-content: flex-end !important;
|
|
}
|
|
.align-content-sm-center {
|
|
align-content: center !important;
|
|
}
|
|
.align-content-sm-between {
|
|
align-content: space-between !important;
|
|
}
|
|
.align-content-sm-around {
|
|
align-content: space-around !important;
|
|
}
|
|
.align-content-sm-stretch {
|
|
align-content: stretch !important;
|
|
}
|
|
.align-self-sm-auto {
|
|
align-self: auto !important;
|
|
}
|
|
.align-self-sm-start {
|
|
align-self: flex-start !important;
|
|
}
|
|
.align-self-sm-end {
|
|
align-self: flex-end !important;
|
|
}
|
|
.align-self-sm-center {
|
|
align-self: center !important;
|
|
}
|
|
.align-self-sm-baseline {
|
|
align-self: baseline !important;
|
|
}
|
|
.align-self-sm-stretch {
|
|
align-self: stretch !important;
|
|
}
|
|
.order-sm-first {
|
|
order: -1 !important;
|
|
}
|
|
.order-sm-0 {
|
|
order: 0 !important;
|
|
}
|
|
.order-sm-1 {
|
|
order: 1 !important;
|
|
}
|
|
.order-sm-2 {
|
|
order: 2 !important;
|
|
}
|
|
.order-sm-3 {
|
|
order: 3 !important;
|
|
}
|
|
.order-sm-4 {
|
|
order: 4 !important;
|
|
}
|
|
.order-sm-5 {
|
|
order: 5 !important;
|
|
}
|
|
.order-sm-last {
|
|
order: 6 !important;
|
|
}
|
|
.m-sm-0 {
|
|
margin: 0 !important;
|
|
}
|
|
.m-sm-1 {
|
|
margin: 0.25rem !important;
|
|
}
|
|
.m-sm-2 {
|
|
margin: 0.5rem !important;
|
|
}
|
|
.m-sm-3 {
|
|
margin: 1rem !important;
|
|
}
|
|
.m-sm-4 {
|
|
margin: 1.5rem !important;
|
|
}
|
|
.m-sm-5 {
|
|
margin: 3rem !important;
|
|
}
|
|
.m-sm-auto {
|
|
margin: auto !important;
|
|
}
|
|
.mx-sm-0 {
|
|
margin-right: 0 !important;
|
|
margin-left: 0 !important;
|
|
}
|
|
.mx-sm-1 {
|
|
margin-right: 0.25rem !important;
|
|
margin-left: 0.25rem !important;
|
|
}
|
|
.mx-sm-2 {
|
|
margin-right: 0.5rem !important;
|
|
margin-left: 0.5rem !important;
|
|
}
|
|
.mx-sm-3 {
|
|
margin-right: 1rem !important;
|
|
margin-left: 1rem !important;
|
|
}
|
|
.mx-sm-4 {
|
|
margin-right: 1.5rem !important;
|
|
margin-left: 1.5rem !important;
|
|
}
|
|
.mx-sm-5 {
|
|
margin-right: 3rem !important;
|
|
margin-left: 3rem !important;
|
|
}
|
|
.mx-sm-auto {
|
|
margin-right: auto !important;
|
|
margin-left: auto !important;
|
|
}
|
|
.my-sm-0 {
|
|
margin-top: 0 !important;
|
|
margin-bottom: 0 !important;
|
|
}
|
|
.my-sm-1 {
|
|
margin-top: 0.25rem !important;
|
|
margin-bottom: 0.25rem !important;
|
|
}
|
|
.my-sm-2 {
|
|
margin-top: 0.5rem !important;
|
|
margin-bottom: 0.5rem !important;
|
|
}
|
|
.my-sm-3 {
|
|
margin-top: 1rem !important;
|
|
margin-bottom: 1rem !important;
|
|
}
|
|
.my-sm-4 {
|
|
margin-top: 1.5rem !important;
|
|
margin-bottom: 1.5rem !important;
|
|
}
|
|
.my-sm-5 {
|
|
margin-top: 3rem !important;
|
|
margin-bottom: 3rem !important;
|
|
}
|
|
.my-sm-auto {
|
|
margin-top: auto !important;
|
|
margin-bottom: auto !important;
|
|
}
|
|
.mt-sm-0 {
|
|
margin-top: 0 !important;
|
|
}
|
|
.mt-sm-1 {
|
|
margin-top: 0.25rem !important;
|
|
}
|
|
.mt-sm-2 {
|
|
margin-top: 0.5rem !important;
|
|
}
|
|
.mt-sm-3 {
|
|
margin-top: 1rem !important;
|
|
}
|
|
.mt-sm-4 {
|
|
margin-top: 1.5rem !important;
|
|
}
|
|
.mt-sm-5 {
|
|
margin-top: 3rem !important;
|
|
}
|
|
.mt-sm-auto {
|
|
margin-top: auto !important;
|
|
}
|
|
.me-sm-0 {
|
|
margin-right: 0 !important;
|
|
}
|
|
.me-sm-1 {
|
|
margin-right: 0.25rem !important;
|
|
}
|
|
.me-sm-2 {
|
|
margin-right: 0.5rem !important;
|
|
}
|
|
.me-sm-3 {
|
|
margin-right: 1rem !important;
|
|
}
|
|
.me-sm-4 {
|
|
margin-right: 1.5rem !important;
|
|
}
|
|
.me-sm-5 {
|
|
margin-right: 3rem !important;
|
|
}
|
|
.me-sm-auto {
|
|
margin-right: auto !important;
|
|
}
|
|
.mb-sm-0 {
|
|
margin-bottom: 0 !important;
|
|
}
|
|
.mb-sm-1 {
|
|
margin-bottom: 0.25rem !important;
|
|
}
|
|
.mb-sm-2 {
|
|
margin-bottom: 0.5rem !important;
|
|
}
|
|
.mb-sm-3 {
|
|
margin-bottom: 1rem !important;
|
|
}
|
|
.mb-sm-4 {
|
|
margin-bottom: 1.5rem !important;
|
|
}
|
|
.mb-sm-5 {
|
|
margin-bottom: 3rem !important;
|
|
}
|
|
.mb-sm-auto {
|
|
margin-bottom: auto !important;
|
|
}
|
|
.ms-sm-0 {
|
|
margin-left: 0 !important;
|
|
}
|
|
.ms-sm-1 {
|
|
margin-left: 0.25rem !important;
|
|
}
|
|
.ms-sm-2 {
|
|
margin-left: 0.5rem !important;
|
|
}
|
|
.ms-sm-3 {
|
|
margin-left: 1rem !important;
|
|
}
|
|
.ms-sm-4 {
|
|
margin-left: 1.5rem !important;
|
|
}
|
|
.ms-sm-5 {
|
|
margin-left: 3rem !important;
|
|
}
|
|
.ms-sm-auto {
|
|
margin-left: auto !important;
|
|
}
|
|
.p-sm-0 {
|
|
padding: 0 !important;
|
|
}
|
|
.p-sm-1 {
|
|
padding: 0.25rem !important;
|
|
}
|
|
.p-sm-2 {
|
|
padding: 0.5rem !important;
|
|
}
|
|
.p-sm-3 {
|
|
padding: 1rem !important;
|
|
}
|
|
.p-sm-4 {
|
|
padding: 1.5rem !important;
|
|
}
|
|
.p-sm-5 {
|
|
padding: 3rem !important;
|
|
}
|
|
.px-sm-0 {
|
|
padding-right: 0 !important;
|
|
padding-left: 0 !important;
|
|
}
|
|
.px-sm-1 {
|
|
padding-right: 0.25rem !important;
|
|
padding-left: 0.25rem !important;
|
|
}
|
|
.px-sm-2 {
|
|
padding-right: 0.5rem !important;
|
|
padding-left: 0.5rem !important;
|
|
}
|
|
.px-sm-3 {
|
|
padding-right: 1rem !important;
|
|
padding-left: 1rem !important;
|
|
}
|
|
.px-sm-4 {
|
|
padding-right: 1.5rem !important;
|
|
padding-left: 1.5rem !important;
|
|
}
|
|
.px-sm-5 {
|
|
padding-right: 3rem !important;
|
|
padding-left: 3rem !important;
|
|
}
|
|
.py-sm-0 {
|
|
padding-top: 0 !important;
|
|
padding-bottom: 0 !important;
|
|
}
|
|
.py-sm-1 {
|
|
padding-top: 0.25rem !important;
|
|
padding-bottom: 0.25rem !important;
|
|
}
|
|
.py-sm-2 {
|
|
padding-top: 0.5rem !important;
|
|
padding-bottom: 0.5rem !important;
|
|
}
|
|
.py-sm-3 {
|
|
padding-top: 1rem !important;
|
|
padding-bottom: 1rem !important;
|
|
}
|
|
.py-sm-4 {
|
|
padding-top: 1.5rem !important;
|
|
padding-bottom: 1.5rem !important;
|
|
}
|
|
.py-sm-5 {
|
|
padding-top: 3rem !important;
|
|
padding-bottom: 3rem !important;
|
|
}
|
|
.pt-sm-0 {
|
|
padding-top: 0 !important;
|
|
}
|
|
.pt-sm-1 {
|
|
padding-top: 0.25rem !important;
|
|
}
|
|
.pt-sm-2 {
|
|
padding-top: 0.5rem !important;
|
|
}
|
|
.pt-sm-3 {
|
|
padding-top: 1rem !important;
|
|
}
|
|
.pt-sm-4 {
|
|
padding-top: 1.5rem !important;
|
|
}
|
|
.pt-sm-5 {
|
|
padding-top: 3rem !important;
|
|
}
|
|
.pe-sm-0 {
|
|
padding-right: 0 !important;
|
|
}
|
|
.pe-sm-1 {
|
|
padding-right: 0.25rem !important;
|
|
}
|
|
.pe-sm-2 {
|
|
padding-right: 0.5rem !important;
|
|
}
|
|
.pe-sm-3 {
|
|
padding-right: 1rem !important;
|
|
}
|
|
.pe-sm-4 {
|
|
padding-right: 1.5rem !important;
|
|
}
|
|
.pe-sm-5 {
|
|
padding-right: 3rem !important;
|
|
}
|
|
.pb-sm-0 {
|
|
padding-bottom: 0 !important;
|
|
}
|
|
.pb-sm-1 {
|
|
padding-bottom: 0.25rem !important;
|
|
}
|
|
.pb-sm-2 {
|
|
padding-bottom: 0.5rem !important;
|
|
}
|
|
.pb-sm-3 {
|
|
padding-bottom: 1rem !important;
|
|
}
|
|
.pb-sm-4 {
|
|
padding-bottom: 1.5rem !important;
|
|
}
|
|
.pb-sm-5 {
|
|
padding-bottom: 3rem !important;
|
|
}
|
|
.ps-sm-0 {
|
|
padding-left: 0 !important;
|
|
}
|
|
.ps-sm-1 {
|
|
padding-left: 0.25rem !important;
|
|
}
|
|
.ps-sm-2 {
|
|
padding-left: 0.5rem !important;
|
|
}
|
|
.ps-sm-3 {
|
|
padding-left: 1rem !important;
|
|
}
|
|
.ps-sm-4 {
|
|
padding-left: 1.5rem !important;
|
|
}
|
|
.ps-sm-5 {
|
|
padding-left: 3rem !important;
|
|
}
|
|
.gap-sm-0 {
|
|
gap: 0 !important;
|
|
}
|
|
.gap-sm-1 {
|
|
gap: 0.25rem !important;
|
|
}
|
|
.gap-sm-2 {
|
|
gap: 0.5rem !important;
|
|
}
|
|
.gap-sm-3 {
|
|
gap: 1rem !important;
|
|
}
|
|
.gap-sm-4 {
|
|
gap: 1.5rem !important;
|
|
}
|
|
.gap-sm-5 {
|
|
gap: 3rem !important;
|
|
}
|
|
.row-gap-sm-0 {
|
|
row-gap: 0 !important;
|
|
}
|
|
.row-gap-sm-1 {
|
|
row-gap: 0.25rem !important;
|
|
}
|
|
.row-gap-sm-2 {
|
|
row-gap: 0.5rem !important;
|
|
}
|
|
.row-gap-sm-3 {
|
|
row-gap: 1rem !important;
|
|
}
|
|
.row-gap-sm-4 {
|
|
row-gap: 1.5rem !important;
|
|
}
|
|
.row-gap-sm-5 {
|
|
row-gap: 3rem !important;
|
|
}
|
|
.column-gap-sm-0 {
|
|
column-gap: 0 !important;
|
|
}
|
|
.column-gap-sm-1 {
|
|
column-gap: 0.25rem !important;
|
|
}
|
|
.column-gap-sm-2 {
|
|
column-gap: 0.5rem !important;
|
|
}
|
|
.column-gap-sm-3 {
|
|
column-gap: 1rem !important;
|
|
}
|
|
.column-gap-sm-4 {
|
|
column-gap: 1.5rem !important;
|
|
}
|
|
.column-gap-sm-5 {
|
|
column-gap: 3rem !important;
|
|
}
|
|
.text-sm-start {
|
|
text-align: left !important;
|
|
}
|
|
.text-sm-end {
|
|
text-align: right !important;
|
|
}
|
|
.text-sm-center {
|
|
text-align: center !important;
|
|
}
|
|
}
|
|
@media (min-width: 768px) {
|
|
.float-md-start {
|
|
float: left !important;
|
|
}
|
|
.float-md-end {
|
|
float: right !important;
|
|
}
|
|
.float-md-none {
|
|
float: none !important;
|
|
}
|
|
.object-fit-md-contain {
|
|
object-fit: contain !important;
|
|
}
|
|
.object-fit-md-cover {
|
|
object-fit: cover !important;
|
|
}
|
|
.object-fit-md-fill {
|
|
object-fit: fill !important;
|
|
}
|
|
.object-fit-md-scale {
|
|
object-fit: scale-down !important;
|
|
}
|
|
.object-fit-md-none {
|
|
object-fit: none !important;
|
|
}
|
|
.d-md-inline {
|
|
display: inline !important;
|
|
}
|
|
.d-md-inline-block {
|
|
display: inline-block !important;
|
|
}
|
|
.d-md-block {
|
|
display: block !important;
|
|
}
|
|
.d-md-grid {
|
|
display: grid !important;
|
|
}
|
|
.d-md-inline-grid {
|
|
display: inline-grid !important;
|
|
}
|
|
.d-md-table {
|
|
display: table !important;
|
|
}
|
|
.d-md-table-row {
|
|
display: table-row !important;
|
|
}
|
|
.d-md-table-cell {
|
|
display: table-cell !important;
|
|
}
|
|
.d-md-flex {
|
|
display: flex !important;
|
|
}
|
|
.d-md-inline-flex {
|
|
display: inline-flex !important;
|
|
}
|
|
.d-md-none {
|
|
display: none !important;
|
|
}
|
|
.flex-md-fill {
|
|
flex: 1 1 auto !important;
|
|
}
|
|
.flex-md-row {
|
|
flex-direction: row !important;
|
|
}
|
|
.flex-md-column {
|
|
flex-direction: column !important;
|
|
}
|
|
.flex-md-row-reverse {
|
|
flex-direction: row-reverse !important;
|
|
}
|
|
.flex-md-column-reverse {
|
|
flex-direction: column-reverse !important;
|
|
}
|
|
.flex-md-grow-0 {
|
|
flex-grow: 0 !important;
|
|
}
|
|
.flex-md-grow-1 {
|
|
flex-grow: 1 !important;
|
|
}
|
|
.flex-md-shrink-0 {
|
|
flex-shrink: 0 !important;
|
|
}
|
|
.flex-md-shrink-1 {
|
|
flex-shrink: 1 !important;
|
|
}
|
|
.flex-md-wrap {
|
|
flex-wrap: wrap !important;
|
|
}
|
|
.flex-md-nowrap {
|
|
flex-wrap: nowrap !important;
|
|
}
|
|
.flex-md-wrap-reverse {
|
|
flex-wrap: wrap-reverse !important;
|
|
}
|
|
.justify-content-md-start {
|
|
justify-content: flex-start !important;
|
|
}
|
|
.justify-content-md-end {
|
|
justify-content: flex-end !important;
|
|
}
|
|
.justify-content-md-center {
|
|
justify-content: center !important;
|
|
}
|
|
.justify-content-md-between {
|
|
justify-content: space-between !important;
|
|
}
|
|
.justify-content-md-around {
|
|
justify-content: space-around !important;
|
|
}
|
|
.justify-content-md-evenly {
|
|
justify-content: space-evenly !important;
|
|
}
|
|
.align-items-md-start {
|
|
align-items: flex-start !important;
|
|
}
|
|
.align-items-md-end {
|
|
align-items: flex-end !important;
|
|
}
|
|
.align-items-md-center {
|
|
align-items: center !important;
|
|
}
|
|
.align-items-md-baseline {
|
|
align-items: baseline !important;
|
|
}
|
|
.align-items-md-stretch {
|
|
align-items: stretch !important;
|
|
}
|
|
.align-content-md-start {
|
|
align-content: flex-start !important;
|
|
}
|
|
.align-content-md-end {
|
|
align-content: flex-end !important;
|
|
}
|
|
.align-content-md-center {
|
|
align-content: center !important;
|
|
}
|
|
.align-content-md-between {
|
|
align-content: space-between !important;
|
|
}
|
|
.align-content-md-around {
|
|
align-content: space-around !important;
|
|
}
|
|
.align-content-md-stretch {
|
|
align-content: stretch !important;
|
|
}
|
|
.align-self-md-auto {
|
|
align-self: auto !important;
|
|
}
|
|
.align-self-md-start {
|
|
align-self: flex-start !important;
|
|
}
|
|
.align-self-md-end {
|
|
align-self: flex-end !important;
|
|
}
|
|
.align-self-md-center {
|
|
align-self: center !important;
|
|
}
|
|
.align-self-md-baseline {
|
|
align-self: baseline !important;
|
|
}
|
|
.align-self-md-stretch {
|
|
align-self: stretch !important;
|
|
}
|
|
.order-md-first {
|
|
order: -1 !important;
|
|
}
|
|
.order-md-0 {
|
|
order: 0 !important;
|
|
}
|
|
.order-md-1 {
|
|
order: 1 !important;
|
|
}
|
|
.order-md-2 {
|
|
order: 2 !important;
|
|
}
|
|
.order-md-3 {
|
|
order: 3 !important;
|
|
}
|
|
.order-md-4 {
|
|
order: 4 !important;
|
|
}
|
|
.order-md-5 {
|
|
order: 5 !important;
|
|
}
|
|
.order-md-last {
|
|
order: 6 !important;
|
|
}
|
|
.m-md-0 {
|
|
margin: 0 !important;
|
|
}
|
|
.m-md-1 {
|
|
margin: 0.25rem !important;
|
|
}
|
|
.m-md-2 {
|
|
margin: 0.5rem !important;
|
|
}
|
|
.m-md-3 {
|
|
margin: 1rem !important;
|
|
}
|
|
.m-md-4 {
|
|
margin: 1.5rem !important;
|
|
}
|
|
.m-md-5 {
|
|
margin: 3rem !important;
|
|
}
|
|
.m-md-auto {
|
|
margin: auto !important;
|
|
}
|
|
.mx-md-0 {
|
|
margin-right: 0 !important;
|
|
margin-left: 0 !important;
|
|
}
|
|
.mx-md-1 {
|
|
margin-right: 0.25rem !important;
|
|
margin-left: 0.25rem !important;
|
|
}
|
|
.mx-md-2 {
|
|
margin-right: 0.5rem !important;
|
|
margin-left: 0.5rem !important;
|
|
}
|
|
.mx-md-3 {
|
|
margin-right: 1rem !important;
|
|
margin-left: 1rem !important;
|
|
}
|
|
.mx-md-4 {
|
|
margin-right: 1.5rem !important;
|
|
margin-left: 1.5rem !important;
|
|
}
|
|
.mx-md-5 {
|
|
margin-right: 3rem !important;
|
|
margin-left: 3rem !important;
|
|
}
|
|
.mx-md-auto {
|
|
margin-right: auto !important;
|
|
margin-left: auto !important;
|
|
}
|
|
.my-md-0 {
|
|
margin-top: 0 !important;
|
|
margin-bottom: 0 !important;
|
|
}
|
|
.my-md-1 {
|
|
margin-top: 0.25rem !important;
|
|
margin-bottom: 0.25rem !important;
|
|
}
|
|
.my-md-2 {
|
|
margin-top: 0.5rem !important;
|
|
margin-bottom: 0.5rem !important;
|
|
}
|
|
.my-md-3 {
|
|
margin-top: 1rem !important;
|
|
margin-bottom: 1rem !important;
|
|
}
|
|
.my-md-4 {
|
|
margin-top: 1.5rem !important;
|
|
margin-bottom: 1.5rem !important;
|
|
}
|
|
.my-md-5 {
|
|
margin-top: 3rem !important;
|
|
margin-bottom: 3rem !important;
|
|
}
|
|
.my-md-auto {
|
|
margin-top: auto !important;
|
|
margin-bottom: auto !important;
|
|
}
|
|
.mt-md-0 {
|
|
margin-top: 0 !important;
|
|
}
|
|
.mt-md-1 {
|
|
margin-top: 0.25rem !important;
|
|
}
|
|
.mt-md-2 {
|
|
margin-top: 0.5rem !important;
|
|
}
|
|
.mt-md-3 {
|
|
margin-top: 1rem !important;
|
|
}
|
|
.mt-md-4 {
|
|
margin-top: 1.5rem !important;
|
|
}
|
|
.mt-md-5 {
|
|
margin-top: 3rem !important;
|
|
}
|
|
.mt-md-auto {
|
|
margin-top: auto !important;
|
|
}
|
|
.me-md-0 {
|
|
margin-right: 0 !important;
|
|
}
|
|
.me-md-1 {
|
|
margin-right: 0.25rem !important;
|
|
}
|
|
.me-md-2 {
|
|
margin-right: 0.5rem !important;
|
|
}
|
|
.me-md-3 {
|
|
margin-right: 1rem !important;
|
|
}
|
|
.me-md-4 {
|
|
margin-right: 1.5rem !important;
|
|
}
|
|
.me-md-5 {
|
|
margin-right: 3rem !important;
|
|
}
|
|
.me-md-auto {
|
|
margin-right: auto !important;
|
|
}
|
|
.mb-md-0 {
|
|
margin-bottom: 0 !important;
|
|
}
|
|
.mb-md-1 {
|
|
margin-bottom: 0.25rem !important;
|
|
}
|
|
.mb-md-2 {
|
|
margin-bottom: 0.5rem !important;
|
|
}
|
|
.mb-md-3 {
|
|
margin-bottom: 1rem !important;
|
|
}
|
|
.mb-md-4 {
|
|
margin-bottom: 1.5rem !important;
|
|
}
|
|
.mb-md-5 {
|
|
margin-bottom: 3rem !important;
|
|
}
|
|
.mb-md-auto {
|
|
margin-bottom: auto !important;
|
|
}
|
|
.ms-md-0 {
|
|
margin-left: 0 !important;
|
|
}
|
|
.ms-md-1 {
|
|
margin-left: 0.25rem !important;
|
|
}
|
|
.ms-md-2 {
|
|
margin-left: 0.5rem !important;
|
|
}
|
|
.ms-md-3 {
|
|
margin-left: 1rem !important;
|
|
}
|
|
.ms-md-4 {
|
|
margin-left: 1.5rem !important;
|
|
}
|
|
.ms-md-5 {
|
|
margin-left: 3rem !important;
|
|
}
|
|
.ms-md-auto {
|
|
margin-left: auto !important;
|
|
}
|
|
.p-md-0 {
|
|
padding: 0 !important;
|
|
}
|
|
.p-md-1 {
|
|
padding: 0.25rem !important;
|
|
}
|
|
.p-md-2 {
|
|
padding: 0.5rem !important;
|
|
}
|
|
.p-md-3 {
|
|
padding: 1rem !important;
|
|
}
|
|
.p-md-4 {
|
|
padding: 1.5rem !important;
|
|
}
|
|
.p-md-5 {
|
|
padding: 3rem !important;
|
|
}
|
|
.px-md-0 {
|
|
padding-right: 0 !important;
|
|
padding-left: 0 !important;
|
|
}
|
|
.px-md-1 {
|
|
padding-right: 0.25rem !important;
|
|
padding-left: 0.25rem !important;
|
|
}
|
|
.px-md-2 {
|
|
padding-right: 0.5rem !important;
|
|
padding-left: 0.5rem !important;
|
|
}
|
|
.px-md-3 {
|
|
padding-right: 1rem !important;
|
|
padding-left: 1rem !important;
|
|
}
|
|
.px-md-4 {
|
|
padding-right: 1.5rem !important;
|
|
padding-left: 1.5rem !important;
|
|
}
|
|
.px-md-5 {
|
|
padding-right: 3rem !important;
|
|
padding-left: 3rem !important;
|
|
}
|
|
.py-md-0 {
|
|
padding-top: 0 !important;
|
|
padding-bottom: 0 !important;
|
|
}
|
|
.py-md-1 {
|
|
padding-top: 0.25rem !important;
|
|
padding-bottom: 0.25rem !important;
|
|
}
|
|
.py-md-2 {
|
|
padding-top: 0.5rem !important;
|
|
padding-bottom: 0.5rem !important;
|
|
}
|
|
.py-md-3 {
|
|
padding-top: 1rem !important;
|
|
padding-bottom: 1rem !important;
|
|
}
|
|
.py-md-4 {
|
|
padding-top: 1.5rem !important;
|
|
padding-bottom: 1.5rem !important;
|
|
}
|
|
.py-md-5 {
|
|
padding-top: 3rem !important;
|
|
padding-bottom: 3rem !important;
|
|
}
|
|
.pt-md-0 {
|
|
padding-top: 0 !important;
|
|
}
|
|
.pt-md-1 {
|
|
padding-top: 0.25rem !important;
|
|
}
|
|
.pt-md-2 {
|
|
padding-top: 0.5rem !important;
|
|
}
|
|
.pt-md-3 {
|
|
padding-top: 1rem !important;
|
|
}
|
|
.pt-md-4 {
|
|
padding-top: 1.5rem !important;
|
|
}
|
|
.pt-md-5 {
|
|
padding-top: 3rem !important;
|
|
}
|
|
.pe-md-0 {
|
|
padding-right: 0 !important;
|
|
}
|
|
.pe-md-1 {
|
|
padding-right: 0.25rem !important;
|
|
}
|
|
.pe-md-2 {
|
|
padding-right: 0.5rem !important;
|
|
}
|
|
.pe-md-3 {
|
|
padding-right: 1rem !important;
|
|
}
|
|
.pe-md-4 {
|
|
padding-right: 1.5rem !important;
|
|
}
|
|
.pe-md-5 {
|
|
padding-right: 3rem !important;
|
|
}
|
|
.pb-md-0 {
|
|
padding-bottom: 0 !important;
|
|
}
|
|
.pb-md-1 {
|
|
padding-bottom: 0.25rem !important;
|
|
}
|
|
.pb-md-2 {
|
|
padding-bottom: 0.5rem !important;
|
|
}
|
|
.pb-md-3 {
|
|
padding-bottom: 1rem !important;
|
|
}
|
|
.pb-md-4 {
|
|
padding-bottom: 1.5rem !important;
|
|
}
|
|
.pb-md-5 {
|
|
padding-bottom: 3rem !important;
|
|
}
|
|
.ps-md-0 {
|
|
padding-left: 0 !important;
|
|
}
|
|
.ps-md-1 {
|
|
padding-left: 0.25rem !important;
|
|
}
|
|
.ps-md-2 {
|
|
padding-left: 0.5rem !important;
|
|
}
|
|
.ps-md-3 {
|
|
padding-left: 1rem !important;
|
|
}
|
|
.ps-md-4 {
|
|
padding-left: 1.5rem !important;
|
|
}
|
|
.ps-md-5 {
|
|
padding-left: 3rem !important;
|
|
}
|
|
.gap-md-0 {
|
|
gap: 0 !important;
|
|
}
|
|
.gap-md-1 {
|
|
gap: 0.25rem !important;
|
|
}
|
|
.gap-md-2 {
|
|
gap: 0.5rem !important;
|
|
}
|
|
.gap-md-3 {
|
|
gap: 1rem !important;
|
|
}
|
|
.gap-md-4 {
|
|
gap: 1.5rem !important;
|
|
}
|
|
.gap-md-5 {
|
|
gap: 3rem !important;
|
|
}
|
|
.row-gap-md-0 {
|
|
row-gap: 0 !important;
|
|
}
|
|
.row-gap-md-1 {
|
|
row-gap: 0.25rem !important;
|
|
}
|
|
.row-gap-md-2 {
|
|
row-gap: 0.5rem !important;
|
|
}
|
|
.row-gap-md-3 {
|
|
row-gap: 1rem !important;
|
|
}
|
|
.row-gap-md-4 {
|
|
row-gap: 1.5rem !important;
|
|
}
|
|
.row-gap-md-5 {
|
|
row-gap: 3rem !important;
|
|
}
|
|
.column-gap-md-0 {
|
|
column-gap: 0 !important;
|
|
}
|
|
.column-gap-md-1 {
|
|
column-gap: 0.25rem !important;
|
|
}
|
|
.column-gap-md-2 {
|
|
column-gap: 0.5rem !important;
|
|
}
|
|
.column-gap-md-3 {
|
|
column-gap: 1rem !important;
|
|
}
|
|
.column-gap-md-4 {
|
|
column-gap: 1.5rem !important;
|
|
}
|
|
.column-gap-md-5 {
|
|
column-gap: 3rem !important;
|
|
}
|
|
.text-md-start {
|
|
text-align: left !important;
|
|
}
|
|
.text-md-end {
|
|
text-align: right !important;
|
|
}
|
|
.text-md-center {
|
|
text-align: center !important;
|
|
}
|
|
}
|
|
@media (min-width: 992px) {
|
|
.float-lg-start {
|
|
float: left !important;
|
|
}
|
|
.float-lg-end {
|
|
float: right !important;
|
|
}
|
|
.float-lg-none {
|
|
float: none !important;
|
|
}
|
|
.object-fit-lg-contain {
|
|
object-fit: contain !important;
|
|
}
|
|
.object-fit-lg-cover {
|
|
object-fit: cover !important;
|
|
}
|
|
.object-fit-lg-fill {
|
|
object-fit: fill !important;
|
|
}
|
|
.object-fit-lg-scale {
|
|
object-fit: scale-down !important;
|
|
}
|
|
.object-fit-lg-none {
|
|
object-fit: none !important;
|
|
}
|
|
.d-lg-inline {
|
|
display: inline !important;
|
|
}
|
|
.d-lg-inline-block {
|
|
display: inline-block !important;
|
|
}
|
|
.d-lg-block {
|
|
display: block !important;
|
|
}
|
|
.d-lg-grid {
|
|
display: grid !important;
|
|
}
|
|
.d-lg-inline-grid {
|
|
display: inline-grid !important;
|
|
}
|
|
.d-lg-table {
|
|
display: table !important;
|
|
}
|
|
.d-lg-table-row {
|
|
display: table-row !important;
|
|
}
|
|
.d-lg-table-cell {
|
|
display: table-cell !important;
|
|
}
|
|
.d-lg-flex {
|
|
display: flex !important;
|
|
}
|
|
.d-lg-inline-flex {
|
|
display: inline-flex !important;
|
|
}
|
|
.d-lg-none {
|
|
display: none !important;
|
|
}
|
|
.flex-lg-fill {
|
|
flex: 1 1 auto !important;
|
|
}
|
|
.flex-lg-row {
|
|
flex-direction: row !important;
|
|
}
|
|
.flex-lg-column {
|
|
flex-direction: column !important;
|
|
}
|
|
.flex-lg-row-reverse {
|
|
flex-direction: row-reverse !important;
|
|
}
|
|
.flex-lg-column-reverse {
|
|
flex-direction: column-reverse !important;
|
|
}
|
|
.flex-lg-grow-0 {
|
|
flex-grow: 0 !important;
|
|
}
|
|
.flex-lg-grow-1 {
|
|
flex-grow: 1 !important;
|
|
}
|
|
.flex-lg-shrink-0 {
|
|
flex-shrink: 0 !important;
|
|
}
|
|
.flex-lg-shrink-1 {
|
|
flex-shrink: 1 !important;
|
|
}
|
|
.flex-lg-wrap {
|
|
flex-wrap: wrap !important;
|
|
}
|
|
.flex-lg-nowrap {
|
|
flex-wrap: nowrap !important;
|
|
}
|
|
.flex-lg-wrap-reverse {
|
|
flex-wrap: wrap-reverse !important;
|
|
}
|
|
.justify-content-lg-start {
|
|
justify-content: flex-start !important;
|
|
}
|
|
.justify-content-lg-end {
|
|
justify-content: flex-end !important;
|
|
}
|
|
.justify-content-lg-center {
|
|
justify-content: center !important;
|
|
}
|
|
.justify-content-lg-between {
|
|
justify-content: space-between !important;
|
|
}
|
|
.justify-content-lg-around {
|
|
justify-content: space-around !important;
|
|
}
|
|
.justify-content-lg-evenly {
|
|
justify-content: space-evenly !important;
|
|
}
|
|
.align-items-lg-start {
|
|
align-items: flex-start !important;
|
|
}
|
|
.align-items-lg-end {
|
|
align-items: flex-end !important;
|
|
}
|
|
.align-items-lg-center {
|
|
align-items: center !important;
|
|
}
|
|
.align-items-lg-baseline {
|
|
align-items: baseline !important;
|
|
}
|
|
.align-items-lg-stretch {
|
|
align-items: stretch !important;
|
|
}
|
|
.align-content-lg-start {
|
|
align-content: flex-start !important;
|
|
}
|
|
.align-content-lg-end {
|
|
align-content: flex-end !important;
|
|
}
|
|
.align-content-lg-center {
|
|
align-content: center !important;
|
|
}
|
|
.align-content-lg-between {
|
|
align-content: space-between !important;
|
|
}
|
|
.align-content-lg-around {
|
|
align-content: space-around !important;
|
|
}
|
|
.align-content-lg-stretch {
|
|
align-content: stretch !important;
|
|
}
|
|
.align-self-lg-auto {
|
|
align-self: auto !important;
|
|
}
|
|
.align-self-lg-start {
|
|
align-self: flex-start !important;
|
|
}
|
|
.align-self-lg-end {
|
|
align-self: flex-end !important;
|
|
}
|
|
.align-self-lg-center {
|
|
align-self: center !important;
|
|
}
|
|
.align-self-lg-baseline {
|
|
align-self: baseline !important;
|
|
}
|
|
.align-self-lg-stretch {
|
|
align-self: stretch !important;
|
|
}
|
|
.order-lg-first {
|
|
order: -1 !important;
|
|
}
|
|
.order-lg-0 {
|
|
order: 0 !important;
|
|
}
|
|
.order-lg-1 {
|
|
order: 1 !important;
|
|
}
|
|
.order-lg-2 {
|
|
order: 2 !important;
|
|
}
|
|
.order-lg-3 {
|
|
order: 3 !important;
|
|
}
|
|
.order-lg-4 {
|
|
order: 4 !important;
|
|
}
|
|
.order-lg-5 {
|
|
order: 5 !important;
|
|
}
|
|
.order-lg-last {
|
|
order: 6 !important;
|
|
}
|
|
.m-lg-0 {
|
|
margin: 0 !important;
|
|
}
|
|
.m-lg-1 {
|
|
margin: 0.25rem !important;
|
|
}
|
|
.m-lg-2 {
|
|
margin: 0.5rem !important;
|
|
}
|
|
.m-lg-3 {
|
|
margin: 1rem !important;
|
|
}
|
|
.m-lg-4 {
|
|
margin: 1.5rem !important;
|
|
}
|
|
.m-lg-5 {
|
|
margin: 3rem !important;
|
|
}
|
|
.m-lg-auto {
|
|
margin: auto !important;
|
|
}
|
|
.mx-lg-0 {
|
|
margin-right: 0 !important;
|
|
margin-left: 0 !important;
|
|
}
|
|
.mx-lg-1 {
|
|
margin-right: 0.25rem !important;
|
|
margin-left: 0.25rem !important;
|
|
}
|
|
.mx-lg-2 {
|
|
margin-right: 0.5rem !important;
|
|
margin-left: 0.5rem !important;
|
|
}
|
|
.mx-lg-3 {
|
|
margin-right: 1rem !important;
|
|
margin-left: 1rem !important;
|
|
}
|
|
.mx-lg-4 {
|
|
margin-right: 1.5rem !important;
|
|
margin-left: 1.5rem !important;
|
|
}
|
|
.mx-lg-5 {
|
|
margin-right: 3rem !important;
|
|
margin-left: 3rem !important;
|
|
}
|
|
.mx-lg-auto {
|
|
margin-right: auto !important;
|
|
margin-left: auto !important;
|
|
}
|
|
.my-lg-0 {
|
|
margin-top: 0 !important;
|
|
margin-bottom: 0 !important;
|
|
}
|
|
.my-lg-1 {
|
|
margin-top: 0.25rem !important;
|
|
margin-bottom: 0.25rem !important;
|
|
}
|
|
.my-lg-2 {
|
|
margin-top: 0.5rem !important;
|
|
margin-bottom: 0.5rem !important;
|
|
}
|
|
.my-lg-3 {
|
|
margin-top: 1rem !important;
|
|
margin-bottom: 1rem !important;
|
|
}
|
|
.my-lg-4 {
|
|
margin-top: 1.5rem !important;
|
|
margin-bottom: 1.5rem !important;
|
|
}
|
|
.my-lg-5 {
|
|
margin-top: 3rem !important;
|
|
margin-bottom: 3rem !important;
|
|
}
|
|
.my-lg-auto {
|
|
margin-top: auto !important;
|
|
margin-bottom: auto !important;
|
|
}
|
|
.mt-lg-0 {
|
|
margin-top: 0 !important;
|
|
}
|
|
.mt-lg-1 {
|
|
margin-top: 0.25rem !important;
|
|
}
|
|
.mt-lg-2 {
|
|
margin-top: 0.5rem !important;
|
|
}
|
|
.mt-lg-3 {
|
|
margin-top: 1rem !important;
|
|
}
|
|
.mt-lg-4 {
|
|
margin-top: 1.5rem !important;
|
|
}
|
|
.mt-lg-5 {
|
|
margin-top: 3rem !important;
|
|
}
|
|
.mt-lg-auto {
|
|
margin-top: auto !important;
|
|
}
|
|
.me-lg-0 {
|
|
margin-right: 0 !important;
|
|
}
|
|
.me-lg-1 {
|
|
margin-right: 0.25rem !important;
|
|
}
|
|
.me-lg-2 {
|
|
margin-right: 0.5rem !important;
|
|
}
|
|
.me-lg-3 {
|
|
margin-right: 1rem !important;
|
|
}
|
|
.me-lg-4 {
|
|
margin-right: 1.5rem !important;
|
|
}
|
|
.me-lg-5 {
|
|
margin-right: 3rem !important;
|
|
}
|
|
.me-lg-auto {
|
|
margin-right: auto !important;
|
|
}
|
|
.mb-lg-0 {
|
|
margin-bottom: 0 !important;
|
|
}
|
|
.mb-lg-1 {
|
|
margin-bottom: 0.25rem !important;
|
|
}
|
|
.mb-lg-2 {
|
|
margin-bottom: 0.5rem !important;
|
|
}
|
|
.mb-lg-3 {
|
|
margin-bottom: 1rem !important;
|
|
}
|
|
.mb-lg-4 {
|
|
margin-bottom: 1.5rem !important;
|
|
}
|
|
.mb-lg-5 {
|
|
margin-bottom: 3rem !important;
|
|
}
|
|
.mb-lg-auto {
|
|
margin-bottom: auto !important;
|
|
}
|
|
.ms-lg-0 {
|
|
margin-left: 0 !important;
|
|
}
|
|
.ms-lg-1 {
|
|
margin-left: 0.25rem !important;
|
|
}
|
|
.ms-lg-2 {
|
|
margin-left: 0.5rem !important;
|
|
}
|
|
.ms-lg-3 {
|
|
margin-left: 1rem !important;
|
|
}
|
|
.ms-lg-4 {
|
|
margin-left: 1.5rem !important;
|
|
}
|
|
.ms-lg-5 {
|
|
margin-left: 3rem !important;
|
|
}
|
|
.ms-lg-auto {
|
|
margin-left: auto !important;
|
|
}
|
|
.p-lg-0 {
|
|
padding: 0 !important;
|
|
}
|
|
.p-lg-1 {
|
|
padding: 0.25rem !important;
|
|
}
|
|
.p-lg-2 {
|
|
padding: 0.5rem !important;
|
|
}
|
|
.p-lg-3 {
|
|
padding: 1rem !important;
|
|
}
|
|
.p-lg-4 {
|
|
padding: 1.5rem !important;
|
|
}
|
|
.p-lg-5 {
|
|
padding: 3rem !important;
|
|
}
|
|
.px-lg-0 {
|
|
padding-right: 0 !important;
|
|
padding-left: 0 !important;
|
|
}
|
|
.px-lg-1 {
|
|
padding-right: 0.25rem !important;
|
|
padding-left: 0.25rem !important;
|
|
}
|
|
.px-lg-2 {
|
|
padding-right: 0.5rem !important;
|
|
padding-left: 0.5rem !important;
|
|
}
|
|
.px-lg-3 {
|
|
padding-right: 1rem !important;
|
|
padding-left: 1rem !important;
|
|
}
|
|
.px-lg-4 {
|
|
padding-right: 1.5rem !important;
|
|
padding-left: 1.5rem !important;
|
|
}
|
|
.px-lg-5 {
|
|
padding-right: 3rem !important;
|
|
padding-left: 3rem !important;
|
|
}
|
|
.py-lg-0 {
|
|
padding-top: 0 !important;
|
|
padding-bottom: 0 !important;
|
|
}
|
|
.py-lg-1 {
|
|
padding-top: 0.25rem !important;
|
|
padding-bottom: 0.25rem !important;
|
|
}
|
|
.py-lg-2 {
|
|
padding-top: 0.5rem !important;
|
|
padding-bottom: 0.5rem !important;
|
|
}
|
|
.py-lg-3 {
|
|
padding-top: 1rem !important;
|
|
padding-bottom: 1rem !important;
|
|
}
|
|
.py-lg-4 {
|
|
padding-top: 1.5rem !important;
|
|
padding-bottom: 1.5rem !important;
|
|
}
|
|
.py-lg-5 {
|
|
padding-top: 3rem !important;
|
|
padding-bottom: 3rem !important;
|
|
}
|
|
.pt-lg-0 {
|
|
padding-top: 0 !important;
|
|
}
|
|
.pt-lg-1 {
|
|
padding-top: 0.25rem !important;
|
|
}
|
|
.pt-lg-2 {
|
|
padding-top: 0.5rem !important;
|
|
}
|
|
.pt-lg-3 {
|
|
padding-top: 1rem !important;
|
|
}
|
|
.pt-lg-4 {
|
|
padding-top: 1.5rem !important;
|
|
}
|
|
.pt-lg-5 {
|
|
padding-top: 3rem !important;
|
|
}
|
|
.pe-lg-0 {
|
|
padding-right: 0 !important;
|
|
}
|
|
.pe-lg-1 {
|
|
padding-right: 0.25rem !important;
|
|
}
|
|
.pe-lg-2 {
|
|
padding-right: 0.5rem !important;
|
|
}
|
|
.pe-lg-3 {
|
|
padding-right: 1rem !important;
|
|
}
|
|
.pe-lg-4 {
|
|
padding-right: 1.5rem !important;
|
|
}
|
|
.pe-lg-5 {
|
|
padding-right: 3rem !important;
|
|
}
|
|
.pb-lg-0 {
|
|
padding-bottom: 0 !important;
|
|
}
|
|
.pb-lg-1 {
|
|
padding-bottom: 0.25rem !important;
|
|
}
|
|
.pb-lg-2 {
|
|
padding-bottom: 0.5rem !important;
|
|
}
|
|
.pb-lg-3 {
|
|
padding-bottom: 1rem !important;
|
|
}
|
|
.pb-lg-4 {
|
|
padding-bottom: 1.5rem !important;
|
|
}
|
|
.pb-lg-5 {
|
|
padding-bottom: 3rem !important;
|
|
}
|
|
.ps-lg-0 {
|
|
padding-left: 0 !important;
|
|
}
|
|
.ps-lg-1 {
|
|
padding-left: 0.25rem !important;
|
|
}
|
|
.ps-lg-2 {
|
|
padding-left: 0.5rem !important;
|
|
}
|
|
.ps-lg-3 {
|
|
padding-left: 1rem !important;
|
|
}
|
|
.ps-lg-4 {
|
|
padding-left: 1.5rem !important;
|
|
}
|
|
.ps-lg-5 {
|
|
padding-left: 3rem !important;
|
|
}
|
|
.gap-lg-0 {
|
|
gap: 0 !important;
|
|
}
|
|
.gap-lg-1 {
|
|
gap: 0.25rem !important;
|
|
}
|
|
.gap-lg-2 {
|
|
gap: 0.5rem !important;
|
|
}
|
|
.gap-lg-3 {
|
|
gap: 1rem !important;
|
|
}
|
|
.gap-lg-4 {
|
|
gap: 1.5rem !important;
|
|
}
|
|
.gap-lg-5 {
|
|
gap: 3rem !important;
|
|
}
|
|
.row-gap-lg-0 {
|
|
row-gap: 0 !important;
|
|
}
|
|
.row-gap-lg-1 {
|
|
row-gap: 0.25rem !important;
|
|
}
|
|
.row-gap-lg-2 {
|
|
row-gap: 0.5rem !important;
|
|
}
|
|
.row-gap-lg-3 {
|
|
row-gap: 1rem !important;
|
|
}
|
|
.row-gap-lg-4 {
|
|
row-gap: 1.5rem !important;
|
|
}
|
|
.row-gap-lg-5 {
|
|
row-gap: 3rem !important;
|
|
}
|
|
.column-gap-lg-0 {
|
|
column-gap: 0 !important;
|
|
}
|
|
.column-gap-lg-1 {
|
|
column-gap: 0.25rem !important;
|
|
}
|
|
.column-gap-lg-2 {
|
|
column-gap: 0.5rem !important;
|
|
}
|
|
.column-gap-lg-3 {
|
|
column-gap: 1rem !important;
|
|
}
|
|
.column-gap-lg-4 {
|
|
column-gap: 1.5rem !important;
|
|
}
|
|
.column-gap-lg-5 {
|
|
column-gap: 3rem !important;
|
|
}
|
|
.text-lg-start {
|
|
text-align: left !important;
|
|
}
|
|
.text-lg-end {
|
|
text-align: right !important;
|
|
}
|
|
.text-lg-center {
|
|
text-align: center !important;
|
|
}
|
|
}
|
|
@media (min-width: 1200px) {
|
|
.float-xl-start {
|
|
float: left !important;
|
|
}
|
|
.float-xl-end {
|
|
float: right !important;
|
|
}
|
|
.float-xl-none {
|
|
float: none !important;
|
|
}
|
|
.object-fit-xl-contain {
|
|
object-fit: contain !important;
|
|
}
|
|
.object-fit-xl-cover {
|
|
object-fit: cover !important;
|
|
}
|
|
.object-fit-xl-fill {
|
|
object-fit: fill !important;
|
|
}
|
|
.object-fit-xl-scale {
|
|
object-fit: scale-down !important;
|
|
}
|
|
.object-fit-xl-none {
|
|
object-fit: none !important;
|
|
}
|
|
.d-xl-inline {
|
|
display: inline !important;
|
|
}
|
|
.d-xl-inline-block {
|
|
display: inline-block !important;
|
|
}
|
|
.d-xl-block {
|
|
display: block !important;
|
|
}
|
|
.d-xl-grid {
|
|
display: grid !important;
|
|
}
|
|
.d-xl-inline-grid {
|
|
display: inline-grid !important;
|
|
}
|
|
.d-xl-table {
|
|
display: table !important;
|
|
}
|
|
.d-xl-table-row {
|
|
display: table-row !important;
|
|
}
|
|
.d-xl-table-cell {
|
|
display: table-cell !important;
|
|
}
|
|
.d-xl-flex {
|
|
display: flex !important;
|
|
}
|
|
.d-xl-inline-flex {
|
|
display: inline-flex !important;
|
|
}
|
|
.d-xl-none {
|
|
display: none !important;
|
|
}
|
|
.flex-xl-fill {
|
|
flex: 1 1 auto !important;
|
|
}
|
|
.flex-xl-row {
|
|
flex-direction: row !important;
|
|
}
|
|
.flex-xl-column {
|
|
flex-direction: column !important;
|
|
}
|
|
.flex-xl-row-reverse {
|
|
flex-direction: row-reverse !important;
|
|
}
|
|
.flex-xl-column-reverse {
|
|
flex-direction: column-reverse !important;
|
|
}
|
|
.flex-xl-grow-0 {
|
|
flex-grow: 0 !important;
|
|
}
|
|
.flex-xl-grow-1 {
|
|
flex-grow: 1 !important;
|
|
}
|
|
.flex-xl-shrink-0 {
|
|
flex-shrink: 0 !important;
|
|
}
|
|
.flex-xl-shrink-1 {
|
|
flex-shrink: 1 !important;
|
|
}
|
|
.flex-xl-wrap {
|
|
flex-wrap: wrap !important;
|
|
}
|
|
.flex-xl-nowrap {
|
|
flex-wrap: nowrap !important;
|
|
}
|
|
.flex-xl-wrap-reverse {
|
|
flex-wrap: wrap-reverse !important;
|
|
}
|
|
.justify-content-xl-start {
|
|
justify-content: flex-start !important;
|
|
}
|
|
.justify-content-xl-end {
|
|
justify-content: flex-end !important;
|
|
}
|
|
.justify-content-xl-center {
|
|
justify-content: center !important;
|
|
}
|
|
.justify-content-xl-between {
|
|
justify-content: space-between !important;
|
|
}
|
|
.justify-content-xl-around {
|
|
justify-content: space-around !important;
|
|
}
|
|
.justify-content-xl-evenly {
|
|
justify-content: space-evenly !important;
|
|
}
|
|
.align-items-xl-start {
|
|
align-items: flex-start !important;
|
|
}
|
|
.align-items-xl-end {
|
|
align-items: flex-end !important;
|
|
}
|
|
.align-items-xl-center {
|
|
align-items: center !important;
|
|
}
|
|
.align-items-xl-baseline {
|
|
align-items: baseline !important;
|
|
}
|
|
.align-items-xl-stretch {
|
|
align-items: stretch !important;
|
|
}
|
|
.align-content-xl-start {
|
|
align-content: flex-start !important;
|
|
}
|
|
.align-content-xl-end {
|
|
align-content: flex-end !important;
|
|
}
|
|
.align-content-xl-center {
|
|
align-content: center !important;
|
|
}
|
|
.align-content-xl-between {
|
|
align-content: space-between !important;
|
|
}
|
|
.align-content-xl-around {
|
|
align-content: space-around !important;
|
|
}
|
|
.align-content-xl-stretch {
|
|
align-content: stretch !important;
|
|
}
|
|
.align-self-xl-auto {
|
|
align-self: auto !important;
|
|
}
|
|
.align-self-xl-start {
|
|
align-self: flex-start !important;
|
|
}
|
|
.align-self-xl-end {
|
|
align-self: flex-end !important;
|
|
}
|
|
.align-self-xl-center {
|
|
align-self: center !important;
|
|
}
|
|
.align-self-xl-baseline {
|
|
align-self: baseline !important;
|
|
}
|
|
.align-self-xl-stretch {
|
|
align-self: stretch !important;
|
|
}
|
|
.order-xl-first {
|
|
order: -1 !important;
|
|
}
|
|
.order-xl-0 {
|
|
order: 0 !important;
|
|
}
|
|
.order-xl-1 {
|
|
order: 1 !important;
|
|
}
|
|
.order-xl-2 {
|
|
order: 2 !important;
|
|
}
|
|
.order-xl-3 {
|
|
order: 3 !important;
|
|
}
|
|
.order-xl-4 {
|
|
order: 4 !important;
|
|
}
|
|
.order-xl-5 {
|
|
order: 5 !important;
|
|
}
|
|
.order-xl-last {
|
|
order: 6 !important;
|
|
}
|
|
.m-xl-0 {
|
|
margin: 0 !important;
|
|
}
|
|
.m-xl-1 {
|
|
margin: 0.25rem !important;
|
|
}
|
|
.m-xl-2 {
|
|
margin: 0.5rem !important;
|
|
}
|
|
.m-xl-3 {
|
|
margin: 1rem !important;
|
|
}
|
|
.m-xl-4 {
|
|
margin: 1.5rem !important;
|
|
}
|
|
.m-xl-5 {
|
|
margin: 3rem !important;
|
|
}
|
|
.m-xl-auto {
|
|
margin: auto !important;
|
|
}
|
|
.mx-xl-0 {
|
|
margin-right: 0 !important;
|
|
margin-left: 0 !important;
|
|
}
|
|
.mx-xl-1 {
|
|
margin-right: 0.25rem !important;
|
|
margin-left: 0.25rem !important;
|
|
}
|
|
.mx-xl-2 {
|
|
margin-right: 0.5rem !important;
|
|
margin-left: 0.5rem !important;
|
|
}
|
|
.mx-xl-3 {
|
|
margin-right: 1rem !important;
|
|
margin-left: 1rem !important;
|
|
}
|
|
.mx-xl-4 {
|
|
margin-right: 1.5rem !important;
|
|
margin-left: 1.5rem !important;
|
|
}
|
|
.mx-xl-5 {
|
|
margin-right: 3rem !important;
|
|
margin-left: 3rem !important;
|
|
}
|
|
.mx-xl-auto {
|
|
margin-right: auto !important;
|
|
margin-left: auto !important;
|
|
}
|
|
.my-xl-0 {
|
|
margin-top: 0 !important;
|
|
margin-bottom: 0 !important;
|
|
}
|
|
.my-xl-1 {
|
|
margin-top: 0.25rem !important;
|
|
margin-bottom: 0.25rem !important;
|
|
}
|
|
.my-xl-2 {
|
|
margin-top: 0.5rem !important;
|
|
margin-bottom: 0.5rem !important;
|
|
}
|
|
.my-xl-3 {
|
|
margin-top: 1rem !important;
|
|
margin-bottom: 1rem !important;
|
|
}
|
|
.my-xl-4 {
|
|
margin-top: 1.5rem !important;
|
|
margin-bottom: 1.5rem !important;
|
|
}
|
|
.my-xl-5 {
|
|
margin-top: 3rem !important;
|
|
margin-bottom: 3rem !important;
|
|
}
|
|
.my-xl-auto {
|
|
margin-top: auto !important;
|
|
margin-bottom: auto !important;
|
|
}
|
|
.mt-xl-0 {
|
|
margin-top: 0 !important;
|
|
}
|
|
.mt-xl-1 {
|
|
margin-top: 0.25rem !important;
|
|
}
|
|
.mt-xl-2 {
|
|
margin-top: 0.5rem !important;
|
|
}
|
|
.mt-xl-3 {
|
|
margin-top: 1rem !important;
|
|
}
|
|
.mt-xl-4 {
|
|
margin-top: 1.5rem !important;
|
|
}
|
|
.mt-xl-5 {
|
|
margin-top: 3rem !important;
|
|
}
|
|
.mt-xl-auto {
|
|
margin-top: auto !important;
|
|
}
|
|
.me-xl-0 {
|
|
margin-right: 0 !important;
|
|
}
|
|
.me-xl-1 {
|
|
margin-right: 0.25rem !important;
|
|
}
|
|
.me-xl-2 {
|
|
margin-right: 0.5rem !important;
|
|
}
|
|
.me-xl-3 {
|
|
margin-right: 1rem !important;
|
|
}
|
|
.me-xl-4 {
|
|
margin-right: 1.5rem !important;
|
|
}
|
|
.me-xl-5 {
|
|
margin-right: 3rem !important;
|
|
}
|
|
.me-xl-auto {
|
|
margin-right: auto !important;
|
|
}
|
|
.mb-xl-0 {
|
|
margin-bottom: 0 !important;
|
|
}
|
|
.mb-xl-1 {
|
|
margin-bottom: 0.25rem !important;
|
|
}
|
|
.mb-xl-2 {
|
|
margin-bottom: 0.5rem !important;
|
|
}
|
|
.mb-xl-3 {
|
|
margin-bottom: 1rem !important;
|
|
}
|
|
.mb-xl-4 {
|
|
margin-bottom: 1.5rem !important;
|
|
}
|
|
.mb-xl-5 {
|
|
margin-bottom: 3rem !important;
|
|
}
|
|
.mb-xl-auto {
|
|
margin-bottom: auto !important;
|
|
}
|
|
.ms-xl-0 {
|
|
margin-left: 0 !important;
|
|
}
|
|
.ms-xl-1 {
|
|
margin-left: 0.25rem !important;
|
|
}
|
|
.ms-xl-2 {
|
|
margin-left: 0.5rem !important;
|
|
}
|
|
.ms-xl-3 {
|
|
margin-left: 1rem !important;
|
|
}
|
|
.ms-xl-4 {
|
|
margin-left: 1.5rem !important;
|
|
}
|
|
.ms-xl-5 {
|
|
margin-left: 3rem !important;
|
|
}
|
|
.ms-xl-auto {
|
|
margin-left: auto !important;
|
|
}
|
|
.p-xl-0 {
|
|
padding: 0 !important;
|
|
}
|
|
.p-xl-1 {
|
|
padding: 0.25rem !important;
|
|
}
|
|
.p-xl-2 {
|
|
padding: 0.5rem !important;
|
|
}
|
|
.p-xl-3 {
|
|
padding: 1rem !important;
|
|
}
|
|
.p-xl-4 {
|
|
padding: 1.5rem !important;
|
|
}
|
|
.p-xl-5 {
|
|
padding: 3rem !important;
|
|
}
|
|
.px-xl-0 {
|
|
padding-right: 0 !important;
|
|
padding-left: 0 !important;
|
|
}
|
|
.px-xl-1 {
|
|
padding-right: 0.25rem !important;
|
|
padding-left: 0.25rem !important;
|
|
}
|
|
.px-xl-2 {
|
|
padding-right: 0.5rem !important;
|
|
padding-left: 0.5rem !important;
|
|
}
|
|
.px-xl-3 {
|
|
padding-right: 1rem !important;
|
|
padding-left: 1rem !important;
|
|
}
|
|
.px-xl-4 {
|
|
padding-right: 1.5rem !important;
|
|
padding-left: 1.5rem !important;
|
|
}
|
|
.px-xl-5 {
|
|
padding-right: 3rem !important;
|
|
padding-left: 3rem !important;
|
|
}
|
|
.py-xl-0 {
|
|
padding-top: 0 !important;
|
|
padding-bottom: 0 !important;
|
|
}
|
|
.py-xl-1 {
|
|
padding-top: 0.25rem !important;
|
|
padding-bottom: 0.25rem !important;
|
|
}
|
|
.py-xl-2 {
|
|
padding-top: 0.5rem !important;
|
|
padding-bottom: 0.5rem !important;
|
|
}
|
|
.py-xl-3 {
|
|
padding-top: 1rem !important;
|
|
padding-bottom: 1rem !important;
|
|
}
|
|
.py-xl-4 {
|
|
padding-top: 1.5rem !important;
|
|
padding-bottom: 1.5rem !important;
|
|
}
|
|
.py-xl-5 {
|
|
padding-top: 3rem !important;
|
|
padding-bottom: 3rem !important;
|
|
}
|
|
.pt-xl-0 {
|
|
padding-top: 0 !important;
|
|
}
|
|
.pt-xl-1 {
|
|
padding-top: 0.25rem !important;
|
|
}
|
|
.pt-xl-2 {
|
|
padding-top: 0.5rem !important;
|
|
}
|
|
.pt-xl-3 {
|
|
padding-top: 1rem !important;
|
|
}
|
|
.pt-xl-4 {
|
|
padding-top: 1.5rem !important;
|
|
}
|
|
.pt-xl-5 {
|
|
padding-top: 3rem !important;
|
|
}
|
|
.pe-xl-0 {
|
|
padding-right: 0 !important;
|
|
}
|
|
.pe-xl-1 {
|
|
padding-right: 0.25rem !important;
|
|
}
|
|
.pe-xl-2 {
|
|
padding-right: 0.5rem !important;
|
|
}
|
|
.pe-xl-3 {
|
|
padding-right: 1rem !important;
|
|
}
|
|
.pe-xl-4 {
|
|
padding-right: 1.5rem !important;
|
|
}
|
|
.pe-xl-5 {
|
|
padding-right: 3rem !important;
|
|
}
|
|
.pb-xl-0 {
|
|
padding-bottom: 0 !important;
|
|
}
|
|
.pb-xl-1 {
|
|
padding-bottom: 0.25rem !important;
|
|
}
|
|
.pb-xl-2 {
|
|
padding-bottom: 0.5rem !important;
|
|
}
|
|
.pb-xl-3 {
|
|
padding-bottom: 1rem !important;
|
|
}
|
|
.pb-xl-4 {
|
|
padding-bottom: 1.5rem !important;
|
|
}
|
|
.pb-xl-5 {
|
|
padding-bottom: 3rem !important;
|
|
}
|
|
.ps-xl-0 {
|
|
padding-left: 0 !important;
|
|
}
|
|
.ps-xl-1 {
|
|
padding-left: 0.25rem !important;
|
|
}
|
|
.ps-xl-2 {
|
|
padding-left: 0.5rem !important;
|
|
}
|
|
.ps-xl-3 {
|
|
padding-left: 1rem !important;
|
|
}
|
|
.ps-xl-4 {
|
|
padding-left: 1.5rem !important;
|
|
}
|
|
.ps-xl-5 {
|
|
padding-left: 3rem !important;
|
|
}
|
|
.gap-xl-0 {
|
|
gap: 0 !important;
|
|
}
|
|
.gap-xl-1 {
|
|
gap: 0.25rem !important;
|
|
}
|
|
.gap-xl-2 {
|
|
gap: 0.5rem !important;
|
|
}
|
|
.gap-xl-3 {
|
|
gap: 1rem !important;
|
|
}
|
|
.gap-xl-4 {
|
|
gap: 1.5rem !important;
|
|
}
|
|
.gap-xl-5 {
|
|
gap: 3rem !important;
|
|
}
|
|
.row-gap-xl-0 {
|
|
row-gap: 0 !important;
|
|
}
|
|
.row-gap-xl-1 {
|
|
row-gap: 0.25rem !important;
|
|
}
|
|
.row-gap-xl-2 {
|
|
row-gap: 0.5rem !important;
|
|
}
|
|
.row-gap-xl-3 {
|
|
row-gap: 1rem !important;
|
|
}
|
|
.row-gap-xl-4 {
|
|
row-gap: 1.5rem !important;
|
|
}
|
|
.row-gap-xl-5 {
|
|
row-gap: 3rem !important;
|
|
}
|
|
.column-gap-xl-0 {
|
|
column-gap: 0 !important;
|
|
}
|
|
.column-gap-xl-1 {
|
|
column-gap: 0.25rem !important;
|
|
}
|
|
.column-gap-xl-2 {
|
|
column-gap: 0.5rem !important;
|
|
}
|
|
.column-gap-xl-3 {
|
|
column-gap: 1rem !important;
|
|
}
|
|
.column-gap-xl-4 {
|
|
column-gap: 1.5rem !important;
|
|
}
|
|
.column-gap-xl-5 {
|
|
column-gap: 3rem !important;
|
|
}
|
|
.text-xl-start {
|
|
text-align: left !important;
|
|
}
|
|
.text-xl-end {
|
|
text-align: right !important;
|
|
}
|
|
.text-xl-center {
|
|
text-align: center !important;
|
|
}
|
|
}
|
|
@media (min-width: 1400px) {
|
|
.float-xxl-start {
|
|
float: left !important;
|
|
}
|
|
.float-xxl-end {
|
|
float: right !important;
|
|
}
|
|
.float-xxl-none {
|
|
float: none !important;
|
|
}
|
|
.object-fit-xxl-contain {
|
|
object-fit: contain !important;
|
|
}
|
|
.object-fit-xxl-cover {
|
|
object-fit: cover !important;
|
|
}
|
|
.object-fit-xxl-fill {
|
|
object-fit: fill !important;
|
|
}
|
|
.object-fit-xxl-scale {
|
|
object-fit: scale-down !important;
|
|
}
|
|
.object-fit-xxl-none {
|
|
object-fit: none !important;
|
|
}
|
|
.d-xxl-inline {
|
|
display: inline !important;
|
|
}
|
|
.d-xxl-inline-block {
|
|
display: inline-block !important;
|
|
}
|
|
.d-xxl-block {
|
|
display: block !important;
|
|
}
|
|
.d-xxl-grid {
|
|
display: grid !important;
|
|
}
|
|
.d-xxl-inline-grid {
|
|
display: inline-grid !important;
|
|
}
|
|
.d-xxl-table {
|
|
display: table !important;
|
|
}
|
|
.d-xxl-table-row {
|
|
display: table-row !important;
|
|
}
|
|
.d-xxl-table-cell {
|
|
display: table-cell !important;
|
|
}
|
|
.d-xxl-flex {
|
|
display: flex !important;
|
|
}
|
|
.d-xxl-inline-flex {
|
|
display: inline-flex !important;
|
|
}
|
|
.d-xxl-none {
|
|
display: none !important;
|
|
}
|
|
.flex-xxl-fill {
|
|
flex: 1 1 auto !important;
|
|
}
|
|
.flex-xxl-row {
|
|
flex-direction: row !important;
|
|
}
|
|
.flex-xxl-column {
|
|
flex-direction: column !important;
|
|
}
|
|
.flex-xxl-row-reverse {
|
|
flex-direction: row-reverse !important;
|
|
}
|
|
.flex-xxl-column-reverse {
|
|
flex-direction: column-reverse !important;
|
|
}
|
|
.flex-xxl-grow-0 {
|
|
flex-grow: 0 !important;
|
|
}
|
|
.flex-xxl-grow-1 {
|
|
flex-grow: 1 !important;
|
|
}
|
|
.flex-xxl-shrink-0 {
|
|
flex-shrink: 0 !important;
|
|
}
|
|
.flex-xxl-shrink-1 {
|
|
flex-shrink: 1 !important;
|
|
}
|
|
.flex-xxl-wrap {
|
|
flex-wrap: wrap !important;
|
|
}
|
|
.flex-xxl-nowrap {
|
|
flex-wrap: nowrap !important;
|
|
}
|
|
.flex-xxl-wrap-reverse {
|
|
flex-wrap: wrap-reverse !important;
|
|
}
|
|
.justify-content-xxl-start {
|
|
justify-content: flex-start !important;
|
|
}
|
|
.justify-content-xxl-end {
|
|
justify-content: flex-end !important;
|
|
}
|
|
.justify-content-xxl-center {
|
|
justify-content: center !important;
|
|
}
|
|
.justify-content-xxl-between {
|
|
justify-content: space-between !important;
|
|
}
|
|
.justify-content-xxl-around {
|
|
justify-content: space-around !important;
|
|
}
|
|
.justify-content-xxl-evenly {
|
|
justify-content: space-evenly !important;
|
|
}
|
|
.align-items-xxl-start {
|
|
align-items: flex-start !important;
|
|
}
|
|
.align-items-xxl-end {
|
|
align-items: flex-end !important;
|
|
}
|
|
.align-items-xxl-center {
|
|
align-items: center !important;
|
|
}
|
|
.align-items-xxl-baseline {
|
|
align-items: baseline !important;
|
|
}
|
|
.align-items-xxl-stretch {
|
|
align-items: stretch !important;
|
|
}
|
|
.align-content-xxl-start {
|
|
align-content: flex-start !important;
|
|
}
|
|
.align-content-xxl-end {
|
|
align-content: flex-end !important;
|
|
}
|
|
.align-content-xxl-center {
|
|
align-content: center !important;
|
|
}
|
|
.align-content-xxl-between {
|
|
align-content: space-between !important;
|
|
}
|
|
.align-content-xxl-around {
|
|
align-content: space-around !important;
|
|
}
|
|
.align-content-xxl-stretch {
|
|
align-content: stretch !important;
|
|
}
|
|
.align-self-xxl-auto {
|
|
align-self: auto !important;
|
|
}
|
|
.align-self-xxl-start {
|
|
align-self: flex-start !important;
|
|
}
|
|
.align-self-xxl-end {
|
|
align-self: flex-end !important;
|
|
}
|
|
.align-self-xxl-center {
|
|
align-self: center !important;
|
|
}
|
|
.align-self-xxl-baseline {
|
|
align-self: baseline !important;
|
|
}
|
|
.align-self-xxl-stretch {
|
|
align-self: stretch !important;
|
|
}
|
|
.order-xxl-first {
|
|
order: -1 !important;
|
|
}
|
|
.order-xxl-0 {
|
|
order: 0 !important;
|
|
}
|
|
.order-xxl-1 {
|
|
order: 1 !important;
|
|
}
|
|
.order-xxl-2 {
|
|
order: 2 !important;
|
|
}
|
|
.order-xxl-3 {
|
|
order: 3 !important;
|
|
}
|
|
.order-xxl-4 {
|
|
order: 4 !important;
|
|
}
|
|
.order-xxl-5 {
|
|
order: 5 !important;
|
|
}
|
|
.order-xxl-last {
|
|
order: 6 !important;
|
|
}
|
|
.m-xxl-0 {
|
|
margin: 0 !important;
|
|
}
|
|
.m-xxl-1 {
|
|
margin: 0.25rem !important;
|
|
}
|
|
.m-xxl-2 {
|
|
margin: 0.5rem !important;
|
|
}
|
|
.m-xxl-3 {
|
|
margin: 1rem !important;
|
|
}
|
|
.m-xxl-4 {
|
|
margin: 1.5rem !important;
|
|
}
|
|
.m-xxl-5 {
|
|
margin: 3rem !important;
|
|
}
|
|
.m-xxl-auto {
|
|
margin: auto !important;
|
|
}
|
|
.mx-xxl-0 {
|
|
margin-right: 0 !important;
|
|
margin-left: 0 !important;
|
|
}
|
|
.mx-xxl-1 {
|
|
margin-right: 0.25rem !important;
|
|
margin-left: 0.25rem !important;
|
|
}
|
|
.mx-xxl-2 {
|
|
margin-right: 0.5rem !important;
|
|
margin-left: 0.5rem !important;
|
|
}
|
|
.mx-xxl-3 {
|
|
margin-right: 1rem !important;
|
|
margin-left: 1rem !important;
|
|
}
|
|
.mx-xxl-4 {
|
|
margin-right: 1.5rem !important;
|
|
margin-left: 1.5rem !important;
|
|
}
|
|
.mx-xxl-5 {
|
|
margin-right: 3rem !important;
|
|
margin-left: 3rem !important;
|
|
}
|
|
.mx-xxl-auto {
|
|
margin-right: auto !important;
|
|
margin-left: auto !important;
|
|
}
|
|
.my-xxl-0 {
|
|
margin-top: 0 !important;
|
|
margin-bottom: 0 !important;
|
|
}
|
|
.my-xxl-1 {
|
|
margin-top: 0.25rem !important;
|
|
margin-bottom: 0.25rem !important;
|
|
}
|
|
.my-xxl-2 {
|
|
margin-top: 0.5rem !important;
|
|
margin-bottom: 0.5rem !important;
|
|
}
|
|
.my-xxl-3 {
|
|
margin-top: 1rem !important;
|
|
margin-bottom: 1rem !important;
|
|
}
|
|
.my-xxl-4 {
|
|
margin-top: 1.5rem !important;
|
|
margin-bottom: 1.5rem !important;
|
|
}
|
|
.my-xxl-5 {
|
|
margin-top: 3rem !important;
|
|
margin-bottom: 3rem !important;
|
|
}
|
|
.my-xxl-auto {
|
|
margin-top: auto !important;
|
|
margin-bottom: auto !important;
|
|
}
|
|
.mt-xxl-0 {
|
|
margin-top: 0 !important;
|
|
}
|
|
.mt-xxl-1 {
|
|
margin-top: 0.25rem !important;
|
|
}
|
|
.mt-xxl-2 {
|
|
margin-top: 0.5rem !important;
|
|
}
|
|
.mt-xxl-3 {
|
|
margin-top: 1rem !important;
|
|
}
|
|
.mt-xxl-4 {
|
|
margin-top: 1.5rem !important;
|
|
}
|
|
.mt-xxl-5 {
|
|
margin-top: 3rem !important;
|
|
}
|
|
.mt-xxl-auto {
|
|
margin-top: auto !important;
|
|
}
|
|
.me-xxl-0 {
|
|
margin-right: 0 !important;
|
|
}
|
|
.me-xxl-1 {
|
|
margin-right: 0.25rem !important;
|
|
}
|
|
.me-xxl-2 {
|
|
margin-right: 0.5rem !important;
|
|
}
|
|
.me-xxl-3 {
|
|
margin-right: 1rem !important;
|
|
}
|
|
.me-xxl-4 {
|
|
margin-right: 1.5rem !important;
|
|
}
|
|
.me-xxl-5 {
|
|
margin-right: 3rem !important;
|
|
}
|
|
.me-xxl-auto {
|
|
margin-right: auto !important;
|
|
}
|
|
.mb-xxl-0 {
|
|
margin-bottom: 0 !important;
|
|
}
|
|
.mb-xxl-1 {
|
|
margin-bottom: 0.25rem !important;
|
|
}
|
|
.mb-xxl-2 {
|
|
margin-bottom: 0.5rem !important;
|
|
}
|
|
.mb-xxl-3 {
|
|
margin-bottom: 1rem !important;
|
|
}
|
|
.mb-xxl-4 {
|
|
margin-bottom: 1.5rem !important;
|
|
}
|
|
.mb-xxl-5 {
|
|
margin-bottom: 3rem !important;
|
|
}
|
|
.mb-xxl-auto {
|
|
margin-bottom: auto !important;
|
|
}
|
|
.ms-xxl-0 {
|
|
margin-left: 0 !important;
|
|
}
|
|
.ms-xxl-1 {
|
|
margin-left: 0.25rem !important;
|
|
}
|
|
.ms-xxl-2 {
|
|
margin-left: 0.5rem !important;
|
|
}
|
|
.ms-xxl-3 {
|
|
margin-left: 1rem !important;
|
|
}
|
|
.ms-xxl-4 {
|
|
margin-left: 1.5rem !important;
|
|
}
|
|
.ms-xxl-5 {
|
|
margin-left: 3rem !important;
|
|
}
|
|
.ms-xxl-auto {
|
|
margin-left: auto !important;
|
|
}
|
|
.p-xxl-0 {
|
|
padding: 0 !important;
|
|
}
|
|
.p-xxl-1 {
|
|
padding: 0.25rem !important;
|
|
}
|
|
.p-xxl-2 {
|
|
padding: 0.5rem !important;
|
|
}
|
|
.p-xxl-3 {
|
|
padding: 1rem !important;
|
|
}
|
|
.p-xxl-4 {
|
|
padding: 1.5rem !important;
|
|
}
|
|
.p-xxl-5 {
|
|
padding: 3rem !important;
|
|
}
|
|
.px-xxl-0 {
|
|
padding-right: 0 !important;
|
|
padding-left: 0 !important;
|
|
}
|
|
.px-xxl-1 {
|
|
padding-right: 0.25rem !important;
|
|
padding-left: 0.25rem !important;
|
|
}
|
|
.px-xxl-2 {
|
|
padding-right: 0.5rem !important;
|
|
padding-left: 0.5rem !important;
|
|
}
|
|
.px-xxl-3 {
|
|
padding-right: 1rem !important;
|
|
padding-left: 1rem !important;
|
|
}
|
|
.px-xxl-4 {
|
|
padding-right: 1.5rem !important;
|
|
padding-left: 1.5rem !important;
|
|
}
|
|
.px-xxl-5 {
|
|
padding-right: 3rem !important;
|
|
padding-left: 3rem !important;
|
|
}
|
|
.py-xxl-0 {
|
|
padding-top: 0 !important;
|
|
padding-bottom: 0 !important;
|
|
}
|
|
.py-xxl-1 {
|
|
padding-top: 0.25rem !important;
|
|
padding-bottom: 0.25rem !important;
|
|
}
|
|
.py-xxl-2 {
|
|
padding-top: 0.5rem !important;
|
|
padding-bottom: 0.5rem !important;
|
|
}
|
|
.py-xxl-3 {
|
|
padding-top: 1rem !important;
|
|
padding-bottom: 1rem !important;
|
|
}
|
|
.py-xxl-4 {
|
|
padding-top: 1.5rem !important;
|
|
padding-bottom: 1.5rem !important;
|
|
}
|
|
.py-xxl-5 {
|
|
padding-top: 3rem !important;
|
|
padding-bottom: 3rem !important;
|
|
}
|
|
.pt-xxl-0 {
|
|
padding-top: 0 !important;
|
|
}
|
|
.pt-xxl-1 {
|
|
padding-top: 0.25rem !important;
|
|
}
|
|
.pt-xxl-2 {
|
|
padding-top: 0.5rem !important;
|
|
}
|
|
.pt-xxl-3 {
|
|
padding-top: 1rem !important;
|
|
}
|
|
.pt-xxl-4 {
|
|
padding-top: 1.5rem !important;
|
|
}
|
|
.pt-xxl-5 {
|
|
padding-top: 3rem !important;
|
|
}
|
|
.pe-xxl-0 {
|
|
padding-right: 0 !important;
|
|
}
|
|
.pe-xxl-1 {
|
|
padding-right: 0.25rem !important;
|
|
}
|
|
.pe-xxl-2 {
|
|
padding-right: 0.5rem !important;
|
|
}
|
|
.pe-xxl-3 {
|
|
padding-right: 1rem !important;
|
|
}
|
|
.pe-xxl-4 {
|
|
padding-right: 1.5rem !important;
|
|
}
|
|
.pe-xxl-5 {
|
|
padding-right: 3rem !important;
|
|
}
|
|
.pb-xxl-0 {
|
|
padding-bottom: 0 !important;
|
|
}
|
|
.pb-xxl-1 {
|
|
padding-bottom: 0.25rem !important;
|
|
}
|
|
.pb-xxl-2 {
|
|
padding-bottom: 0.5rem !important;
|
|
}
|
|
.pb-xxl-3 {
|
|
padding-bottom: 1rem !important;
|
|
}
|
|
.pb-xxl-4 {
|
|
padding-bottom: 1.5rem !important;
|
|
}
|
|
.pb-xxl-5 {
|
|
padding-bottom: 3rem !important;
|
|
}
|
|
.ps-xxl-0 {
|
|
padding-left: 0 !important;
|
|
}
|
|
.ps-xxl-1 {
|
|
padding-left: 0.25rem !important;
|
|
}
|
|
.ps-xxl-2 {
|
|
padding-left: 0.5rem !important;
|
|
}
|
|
.ps-xxl-3 {
|
|
padding-left: 1rem !important;
|
|
}
|
|
.ps-xxl-4 {
|
|
padding-left: 1.5rem !important;
|
|
}
|
|
.ps-xxl-5 {
|
|
padding-left: 3rem !important;
|
|
}
|
|
.gap-xxl-0 {
|
|
gap: 0 !important;
|
|
}
|
|
.gap-xxl-1 {
|
|
gap: 0.25rem !important;
|
|
}
|
|
.gap-xxl-2 {
|
|
gap: 0.5rem !important;
|
|
}
|
|
.gap-xxl-3 {
|
|
gap: 1rem !important;
|
|
}
|
|
.gap-xxl-4 {
|
|
gap: 1.5rem !important;
|
|
}
|
|
.gap-xxl-5 {
|
|
gap: 3rem !important;
|
|
}
|
|
.row-gap-xxl-0 {
|
|
row-gap: 0 !important;
|
|
}
|
|
.row-gap-xxl-1 {
|
|
row-gap: 0.25rem !important;
|
|
}
|
|
.row-gap-xxl-2 {
|
|
row-gap: 0.5rem !important;
|
|
}
|
|
.row-gap-xxl-3 {
|
|
row-gap: 1rem !important;
|
|
}
|
|
.row-gap-xxl-4 {
|
|
row-gap: 1.5rem !important;
|
|
}
|
|
.row-gap-xxl-5 {
|
|
row-gap: 3rem !important;
|
|
}
|
|
.column-gap-xxl-0 {
|
|
column-gap: 0 !important;
|
|
}
|
|
.column-gap-xxl-1 {
|
|
column-gap: 0.25rem !important;
|
|
}
|
|
.column-gap-xxl-2 {
|
|
column-gap: 0.5rem !important;
|
|
}
|
|
.column-gap-xxl-3 {
|
|
column-gap: 1rem !important;
|
|
}
|
|
.column-gap-xxl-4 {
|
|
column-gap: 1.5rem !important;
|
|
}
|
|
.column-gap-xxl-5 {
|
|
column-gap: 3rem !important;
|
|
}
|
|
.text-xxl-start {
|
|
text-align: left !important;
|
|
}
|
|
.text-xxl-end {
|
|
text-align: right !important;
|
|
}
|
|
.text-xxl-center {
|
|
text-align: center !important;
|
|
}
|
|
}
|
|
@media (min-width: 1200px) {
|
|
.fs-1 {
|
|
font-size: 2.5rem !important;
|
|
}
|
|
.fs-2 {
|
|
font-size: 2rem !important;
|
|
}
|
|
.fs-3 {
|
|
font-size: 1.75rem !important;
|
|
}
|
|
.fs-4 {
|
|
font-size: 1.5rem !important;
|
|
}
|
|
}
|
|
@media print {
|
|
.d-print-inline {
|
|
display: inline !important;
|
|
}
|
|
.d-print-inline-block {
|
|
display: inline-block !important;
|
|
}
|
|
.d-print-block {
|
|
display: block !important;
|
|
}
|
|
.d-print-grid {
|
|
display: grid !important;
|
|
}
|
|
.d-print-inline-grid {
|
|
display: inline-grid !important;
|
|
}
|
|
.d-print-table {
|
|
display: table !important;
|
|
}
|
|
.d-print-table-row {
|
|
display: table-row !important;
|
|
}
|
|
.d-print-table-cell {
|
|
display: table-cell !important;
|
|
}
|
|
.d-print-flex {
|
|
display: flex !important;
|
|
}
|
|
.d-print-inline-flex {
|
|
display: inline-flex !important;
|
|
}
|
|
.d-print-none {
|
|
display: none !important;
|
|
}
|
|
}
|
|
/*------------------------------------------------------------------
|
|
[Table of contents]
|
|
|
|
1. Container / .filemanager-page
|
|
2. Navigation / .filemanager-page > .navigation
|
|
3. Files list / .filemanager-page > .files
|
|
4. File info sidebar / .filemanager-page > .info
|
|
-------------------------------------------------------------------*/
|
|
.filemanager-page {
|
|
display: flex;
|
|
flex-direction: row;
|
|
height: 100%;
|
|
}
|
|
.filemanager-page > .navigation {
|
|
width: 259px;
|
|
min-width: 259px;
|
|
border-right: 1px solid #ccc;
|
|
background: #fff;
|
|
}
|
|
.filemanager-page > .navigation .wrapper {
|
|
display: flex;
|
|
flex-direction: column;
|
|
height: 100%;
|
|
}
|
|
.filemanager-page > .navigation .wrapper > .separator {
|
|
font-size: 11px;
|
|
color: #ccc;
|
|
margin: 25px 30px;
|
|
text-transform: uppercase;
|
|
}
|
|
.filemanager-page > .navigation .wrapper > .tree {
|
|
list-style: none;
|
|
margin: 0;
|
|
padding: 0;
|
|
}
|
|
.filemanager-page > .navigation .wrapper > .tree ul {
|
|
list-style: none;
|
|
margin: 0;
|
|
padding: 0;
|
|
}
|
|
.filemanager-page > .navigation .wrapper > .tree li > a {
|
|
display: block;
|
|
padding: 11px 30px;
|
|
font-size: 13px;
|
|
color: #777;
|
|
position: relative;
|
|
}
|
|
.filemanager-page > .navigation .wrapper > .tree li > a:hover {
|
|
text-decoration: none;
|
|
background-color: #f3f5f9;
|
|
}
|
|
.filemanager-page > .navigation .wrapper > .tree li.active {
|
|
background: #ebeef5;
|
|
color: #777;
|
|
position: relative;
|
|
}
|
|
.filemanager-page > .navigation .wrapper > .tree li.active::before {
|
|
content: "";
|
|
width: 4px;
|
|
height: 100%;
|
|
background: #d7dceb;
|
|
display: block;
|
|
position: absolute;
|
|
top: 0;
|
|
left: 0;
|
|
}
|
|
.filemanager-page > .navigation .wrapper > .tree li.item > a::before {
|
|
content: "\f114";
|
|
font-family: "ionicons";
|
|
font-size: 16px;
|
|
color: #3a529b;
|
|
display: inline-block;
|
|
margin-right: 14px;
|
|
position: relative;
|
|
top: 1px;
|
|
}
|
|
.filemanager-page > .navigation .wrapper > .tree li.item.has-submenu > a::before {
|
|
content: "\f114";
|
|
}
|
|
.filemanager-page > .navigation .wrapper > .tree li.has-submenu > a::after {
|
|
content: "\f107";
|
|
border: none;
|
|
font-family: "ionicons";
|
|
width: auto;
|
|
height: auto;
|
|
float: right;
|
|
display: block;
|
|
padding: 0;
|
|
margin-right: 0;
|
|
font-size: 16px;
|
|
font-weight: normal;
|
|
margin-top: -1px;
|
|
color: #9da9cd;
|
|
}
|
|
.filemanager-page > .navigation .wrapper > .tree li.has-submenu .submenu {
|
|
display: none;
|
|
}
|
|
.filemanager-page > .navigation .wrapper > .tree li.has-submenu .submenu a {
|
|
padding-left: 40px;
|
|
}
|
|
.filemanager-page > .navigation .wrapper > .tree li.has-submenu .submenu .submenu a {
|
|
padding-left: 50px;
|
|
}
|
|
.filemanager-page > .navigation .wrapper > .tree li.has-submenu .submenu .submenu .submenu a {
|
|
padding-left: 60px;
|
|
}
|
|
.filemanager-page > .navigation .wrapper > .tree li.has-submenu .submenu .submenu .submenu .submenu a {
|
|
padding-left: 70px;
|
|
}
|
|
.filemanager-page > .navigation .wrapper > .tree li.has-submenu.open.has-submenu > .submenu {
|
|
display: block;
|
|
}
|
|
.filemanager-page > .navigation .wrapper > .tree li.has-submenu.open.item > a::before {
|
|
content: "\f115";
|
|
}
|
|
.filemanager-page > .navigation .wrapper > .tree li.has-submenu.active a {
|
|
background-color: #f3f5f9;
|
|
}
|
|
.filemanager-page > .navigation .wrapper > .menu {
|
|
list-style: none;
|
|
padding: 0;
|
|
}
|
|
.filemanager-page > .navigation .wrapper > .menu li:last-child {
|
|
margin-bottom: 0;
|
|
}
|
|
.filemanager-page > .navigation .wrapper > .menu li > a {
|
|
display: block;
|
|
padding: 11px 30px;
|
|
font-size: 13px;
|
|
color: #777;
|
|
position: relative;
|
|
}
|
|
.filemanager-page > .navigation .wrapper > .menu li > a > .icon {
|
|
width: 16px;
|
|
font-size: 16px;
|
|
color: blue;
|
|
display: inline-block;
|
|
margin-right: 12px;
|
|
}
|
|
.filemanager-page > .navigation .wrapper > .menu li.active {
|
|
background: #ebeef5;
|
|
color: var(--bs-body-color);
|
|
position: relative;
|
|
}
|
|
.filemanager-page > .navigation .wrapper > .menu li.active::before {
|
|
content: "";
|
|
width: 4px;
|
|
height: 100%;
|
|
background: #d7dceb;
|
|
display: block;
|
|
position: absolute;
|
|
top: 0;
|
|
left: 0;
|
|
}
|
|
.filemanager-page > .files {
|
|
flex-grow: 1;
|
|
}
|
|
.filemanager-page > .files > .header {
|
|
padding: 12px 20px;
|
|
border-bottom: 1px solid #ccc;
|
|
height: 59px;
|
|
display: flex;
|
|
justify-content: space-between;
|
|
align-items: center;
|
|
}
|
|
.filemanager-page > .files > .header > .search {
|
|
width: 330px;
|
|
margin-right: 10px;
|
|
}
|
|
.filemanager-page > .files > .header > .filters {
|
|
display: flex;
|
|
}
|
|
.filemanager-page > .files > .header > .filters > .btn-group + .btn-group {
|
|
margin-left: 10px;
|
|
}
|
|
.filemanager-page > .files > .header > .filters > .view-type > label {
|
|
margin: 0;
|
|
}
|
|
.filemanager-page > .files > .breadcrubms {
|
|
border-bottom: 1px solid #ccc;
|
|
height: 59px;
|
|
display: flex;
|
|
align-items: center;
|
|
padding: 0 20px;
|
|
}
|
|
.filemanager-page > .files > .breadcrubms > .breadcrumb {
|
|
background: transparent;
|
|
margin-bottom: 0;
|
|
padding: 0;
|
|
}
|
|
.filemanager-page > .files > .breadcrubms > .breadcrumb > .active {
|
|
color: #ccc;
|
|
}
|
|
.filemanager-page > .files > .breadcrubms > .breadcrumb a {
|
|
color: blue;
|
|
}
|
|
.filemanager-page > .files > .content {
|
|
padding: 20px;
|
|
}
|
|
.filemanager-page > .files > .content.recent {
|
|
padding: 0;
|
|
}
|
|
.filemanager-page > .files > .content.recent .recent-box {
|
|
border-bottom: 1px solid #ccc;
|
|
padding: 20px;
|
|
}
|
|
.filemanager-page > .files > .content.recent .recent-box:last-child {
|
|
border: none;
|
|
}
|
|
.filemanager-page > .files > .content.recent .recent-box h6, .filemanager-page > .files > .content.recent .recent-box .h6 {
|
|
margin-top: 5px;
|
|
font-weight: normal;
|
|
}
|
|
.filemanager-page > .files > .content.recent .recent-box ul {
|
|
margin-top: -20px;
|
|
padding-left: 0;
|
|
margin-bottom: 0;
|
|
}
|
|
.filemanager-page > .files > .content ul.items {
|
|
padding: 0 20px 20px 20px;
|
|
margin: 0;
|
|
list-style: none;
|
|
display: flex;
|
|
flex-wrap: wrap;
|
|
}
|
|
.filemanager-page > .files > .content ul.items > .item {
|
|
cursor: pointer;
|
|
margin-right: 20px;
|
|
margin-top: 20px;
|
|
position: relative;
|
|
}
|
|
.filemanager-page > .files > .content ul.items > .item > .checkbox {
|
|
display: none;
|
|
position: absolute;
|
|
top: 67px;
|
|
left: 7px;
|
|
width: 12px;
|
|
height: 14px;
|
|
}
|
|
.filemanager-page > .files > .content ul.items > .item:hover > .checkbox {
|
|
display: block;
|
|
}
|
|
.filemanager-page > .files > .content ul.items > .item:hover > .thumb {
|
|
border: solid 1px #777;
|
|
}
|
|
.filemanager-page > .files > .content ul.items > .item.checked > .checkbox {
|
|
display: block;
|
|
}
|
|
.filemanager-page > .files > .content ul.items > .item.checked > .thumb {
|
|
background-color: #f5f6fa;
|
|
border: solid 1px #c4cbe1;
|
|
}
|
|
.filemanager-page > .files > .content ul.items > .item > .thumb {
|
|
width: 90px;
|
|
height: 90px;
|
|
border-radius: 2px;
|
|
background-color: #fff;
|
|
border: solid 1px #ccc;
|
|
margin-bottom: 5px;
|
|
display: flex;
|
|
align-items: center;
|
|
text-align: center;
|
|
font-size: 45px;
|
|
color: blue;
|
|
}
|
|
.filemanager-page > .files > .content ul.items > .item > .thumb::before {
|
|
width: 100%;
|
|
}
|
|
.filemanager-page > .files > .content ul.items > .item > .filename {
|
|
display: block;
|
|
font-size: 12px;
|
|
color: #ccc;
|
|
text-align: center;
|
|
}
|
|
.filemanager-page > .files > .content.compact {
|
|
padding: 0;
|
|
}
|
|
.filemanager-page > .files > .content.compact > .table-header {
|
|
margin-bottom: 0;
|
|
}
|
|
.filemanager-page > .files > .content.compact > .table-content table tr:first-child td {
|
|
border-top: none;
|
|
}
|
|
.filemanager-page > .files > .content.compact > .table-content .recent-box {
|
|
padding: 0;
|
|
}
|
|
.filemanager-page > .files > .content.compact > .table-content .recent-box table tr:first-child td {
|
|
border-top: none;
|
|
}
|
|
.filemanager-page > .files > .content.compact > .table-content .recent-box table tr:last-child td {
|
|
border-bottom: none;
|
|
}
|
|
.filemanager-page > .files > .content.compact > .table-content .recent-box table td.name-column {
|
|
padding-left: 20px;
|
|
}
|
|
.filemanager-page > .files > .content.compact > .table-content .recent-box > .header {
|
|
font-weight: normal;
|
|
margin: 0;
|
|
padding: 14px 20px;
|
|
border-bottom: 1px solid #ccc;
|
|
}
|
|
.filemanager-page > .files > .content.compact.recent table {
|
|
margin-bottom: 0;
|
|
}
|
|
.filemanager-page > .files > .content.compact.recent table thead th.name-column {
|
|
padding-left: 20px;
|
|
}
|
|
.filemanager-page > .files > .content.compact .table tbody td {
|
|
vertical-align: middle;
|
|
border-top-color: #ebeef5;
|
|
}
|
|
.filemanager-page > .files > .content.compact .table tbody td.checkbox-column {
|
|
padding-left: 15px;
|
|
padding-right: 15px;
|
|
}
|
|
.filemanager-page > .files > .content.compact .table tbody td.checkbox-column > .checkbox {
|
|
margin-bottom: 0;
|
|
position: relative;
|
|
top: 1px;
|
|
}
|
|
.filemanager-page > .files > .content.compact .table tbody td.name-column {
|
|
padding-left: 0;
|
|
}
|
|
.filemanager-page > .files > .content.compact .table tbody td.name-column > .icon {
|
|
font-size: 16px;
|
|
display: inline-block;
|
|
margin-right: 7px;
|
|
position: relative;
|
|
top: 1px;
|
|
}
|
|
.filemanager-page > .files > .content.compact .table tbody tr {
|
|
position: relative;
|
|
}
|
|
.filemanager-page > .files > .content.compact .table tbody tr:hover td, .filemanager-page > .files > .content.compact .table tbody tr.checked td {
|
|
background-color: #f5f6fa;
|
|
color: #777;
|
|
cursor: pointer;
|
|
}
|
|
.filemanager-page > .files > .content.compact .table tbody tr.selected td {
|
|
background: #ebeef5;
|
|
color: #777;
|
|
}
|
|
.filemanager-page > .files > .content.compact .table tbody tr.selected td:first-child {
|
|
position: relative;
|
|
}
|
|
.filemanager-page > .files > .content.compact .table tbody tr.selected td:first-child::before {
|
|
content: "";
|
|
width: 4px;
|
|
height: 100%;
|
|
background: #d7dceb;
|
|
display: block;
|
|
position: absolute;
|
|
top: 0;
|
|
left: 0;
|
|
}
|
|
.filemanager-page > .files > .content.compact .table thead th {
|
|
border-top: none;
|
|
border-bottom-color: #ccc;
|
|
}
|
|
.filemanager-page > .files > .content.compact .table thead th.name-column {
|
|
padding-left: 0;
|
|
}
|
|
.filemanager-page > .files > .content.compact .table thead th.checkbox-column {
|
|
padding-left: 15px;
|
|
padding-right: 15px;
|
|
}
|
|
.filemanager-page > .files > .content.compact .table thead th.checkbox-column > .checkbox {
|
|
margin-bottom: 0;
|
|
position: relative;
|
|
top: 1px;
|
|
}
|
|
.filemanager-page > .info {
|
|
width: 312px;
|
|
min-width: 312px;
|
|
border-left: 1px solid #ccc;
|
|
background: #fff;
|
|
}
|
|
.filemanager-page > .info.selected-items > .header {
|
|
justify-content: space-between;
|
|
}
|
|
.filemanager-page > .info.empty {
|
|
display: flex;
|
|
background-color: rgba(57, 81, 155, 0.05);
|
|
align-items: center;
|
|
justify-content: center;
|
|
flex-direction: column;
|
|
}
|
|
.filemanager-page > .info.empty > .icon {
|
|
color: rgba(58, 82, 155, 0.1);
|
|
font-size: 64px;
|
|
margin-bottom: 20px;
|
|
}
|
|
.filemanager-page > .info.empty > .text {
|
|
font-size: 12px;
|
|
color: #ccc;
|
|
}
|
|
.filemanager-page > .info > .header {
|
|
padding: 12px 20px;
|
|
font-size: 14px;
|
|
color: var(--bs-body-color);
|
|
border-bottom: 1px solid #ccc;
|
|
display: flex;
|
|
align-items: center;
|
|
height: 59px;
|
|
}
|
|
.filemanager-page > .info > .header > .icon {
|
|
font-size: 20px;
|
|
color: #3a529b;
|
|
display: inline-block;
|
|
margin-right: 10px;
|
|
position: relative;
|
|
top: 1px;
|
|
}
|
|
.filemanager-page > .info > .controls {
|
|
padding: 10px 30px;
|
|
border-bottom: 1px solid #ccc;
|
|
}
|
|
.filemanager-page > .info > .controls .btn {
|
|
margin-right: 5px;
|
|
}
|
|
.filemanager-page > .info > .controls .btn:last-child {
|
|
margin-right: 0;
|
|
}
|
|
.filemanager-page > .info > .controls > .image-preview {
|
|
margin-bottom: 10px;
|
|
}
|
|
.filemanager-page > .info > .controls > .image-preview > img {
|
|
border-radius: 2px;
|
|
}
|
|
.filemanager-page > .info > .controls > .audio-preview {
|
|
margin-bottom: 10px;
|
|
}
|
|
.filemanager-page > .info > .controls > .audio-preview > .album-name {
|
|
margin-bottom: 2px;
|
|
}
|
|
.filemanager-page > .info > .controls > .audio-preview > .album-name > span:first-child {
|
|
padding-right: 3px;
|
|
}
|
|
.filemanager-page > .info > .controls > .audio-preview > .album-name > span:last-child {
|
|
color: rgba(57, 81, 155, 0.4);
|
|
}
|
|
.filemanager-page > .info > .controls > .audio-preview > .song-name {
|
|
font-weight: 600;
|
|
margin-bottom: 7px;
|
|
}
|
|
.filemanager-page > .info > .controls > .audio-preview > .progress {
|
|
font-size: 10px;
|
|
color: var(--bs-body-color);
|
|
}
|
|
.filemanager-page > .info > .controls > .audio-preview > .progress > .progress {
|
|
margin-bottom: 7px;
|
|
}
|
|
.filemanager-page > .info > .body {
|
|
padding: 30px;
|
|
}
|
|
.filemanager-page > .info > .body > .item {
|
|
margin-bottom: 15px;
|
|
}
|
|
.filemanager-page > .info > .body > .item:last-child {
|
|
margin-bottom: 0;
|
|
}
|
|
.filemanager-page > .info > .body > .item > .header {
|
|
font-size: 12px;
|
|
color: #ccc;
|
|
margin-bottom: 3px;
|
|
}
|
|
.filemanager-page > .info > .body > .item > .text > .icon {
|
|
font-size: 16px;
|
|
color: #3a529b;
|
|
position: relative;
|
|
top: 1px;
|
|
display: inline-block;
|
|
margin-right: 7px;
|
|
}
|
|
|
|
@media screen and (max-width: 1200px) {
|
|
.filemanager-info-block-toggle {
|
|
position: static;
|
|
}
|
|
.filemanager-page > .info {
|
|
position: fixed;
|
|
top: 120px;
|
|
bottom: 0;
|
|
right: -313px;
|
|
z-index: 2;
|
|
height: calc(100% - 120px);
|
|
}
|
|
.filemanager-page > .info.open {
|
|
right: 0;
|
|
transition: right 0.2s ease;
|
|
}
|
|
}
|
|
@media screen and (max-width: 1068px) {
|
|
.filemanager-page > .files > .header > .search {
|
|
width: 100%;
|
|
}
|
|
}
|
|
@media screen and (max-width: 880px) {
|
|
.filemanager-navigation-block-toggle {
|
|
position: static;
|
|
}
|
|
.filemanager-page > .navigation {
|
|
position: fixed;
|
|
top: 120px;
|
|
bottom: 0;
|
|
left: -260px;
|
|
z-index: 2;
|
|
height: calc(100% - 120px);
|
|
}
|
|
.filemanager-page > .navigation.open {
|
|
left: 0;
|
|
transition: left 0.2s ease;
|
|
}
|
|
}
|
|
@media screen and (max-width: 600px) {
|
|
.filemanager-page > .files > .header {
|
|
height: auto;
|
|
flex-direction: column;
|
|
}
|
|
.filemanager-page > .files > .header > .search {
|
|
margin-bottom: 15px;
|
|
}
|
|
}
|
|
/**
|
|
* Vvveb
|
|
*
|
|
* Copyright (C) 2022 Ziadin Givan
|
|
*
|
|
* This program is free software: you can redistribute it and/or modify
|
|
* it under the terms of the GNU Affero General Public License as
|
|
* published by the Free Software Foundation, either version 3 of the
|
|
* License, or (at your option) any later version.
|
|
*
|
|
* This program is distributed in the hope that it will be useful,
|
|
* but WITHOUT ANY WARRANTY; without even the implied warranty of
|
|
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the
|
|
* GNU Affero General Public License for more details.
|
|
*
|
|
* You should have received a copy of the GNU Affero General Public License
|
|
* along with this program. If not, see <https://www.gnu.org/licenses/>.
|
|
*
|
|
*/
|
|
/* CSS Tree menu styles */
|
|
.tree {
|
|
width: 100%;
|
|
padding: 0;
|
|
}
|
|
.tree > ol {
|
|
padding: 0rem 0 0 0rem;
|
|
margin: 0;
|
|
font-size: 12px;
|
|
color: var(--bs-body-color);
|
|
}
|
|
.tree > ol li {
|
|
position: relative;
|
|
margin-bottom: 0.1rem;
|
|
list-style: none;
|
|
color: var(--bs-body-color);
|
|
overflow: hidden;
|
|
}
|
|
.tree > ol li:hover {
|
|
color: #007bff;
|
|
}
|
|
.tree > ol li.file {
|
|
border: 1px solid transparent;
|
|
}
|
|
.tree > ol li.file:hover, .tree > ol li.file.active {
|
|
color: var(--bs-link-hover-color);
|
|
}
|
|
.tree > ol li.file:hover {
|
|
background-color: rgba(var(--bs-link-color-rgb), 0.05);
|
|
}
|
|
.tree > ol li.file:hover .file-actions {
|
|
display: block;
|
|
}
|
|
.tree > ol li.file > label {
|
|
background-image: url(../../../js/vvvebjs/icons/file.svg);
|
|
background-position: 8px 4px;
|
|
background-size: 19px 19px;
|
|
background-repeat: no-repeat;
|
|
cursor: pointer;
|
|
display: block;
|
|
padding-left: 33px;
|
|
margin: 0;
|
|
font-size: 12px;
|
|
line-height: 28px;
|
|
max-height: 2rem;
|
|
}
|
|
.tree > ol li.file .file-actions {
|
|
display: none;
|
|
position: absolute;
|
|
top: 0px;
|
|
right: 2px;
|
|
}
|
|
.tree > ol li.file .file-actions .btn {
|
|
padding: 0rem 0.2rem;
|
|
margin-right: 1px;
|
|
font-size: 0.875rem;
|
|
line-height: 1;
|
|
border-radius: 4px;
|
|
--bs-btn-border-color: rgba(var(--bs-link-color-rgb), 0.25);
|
|
}
|
|
.tree > ol li.page > label {
|
|
background-image: url(../../../js/vvvebjs/icons/post.svg);
|
|
}
|
|
.tree > ol li.product > label {
|
|
background-image: url(../../../js/vvvebjs/icons/product.svg);
|
|
}
|
|
.tree > ol li.url > label {
|
|
background-image: url(../../../js/vvvebjs/icons/panel.svg);
|
|
}
|
|
.tree > ol li.notemplate .duplicate, .tree > ol li.notemplate .rename, .tree > ol li.notemplate .delete {
|
|
display: none;
|
|
}
|
|
.tree > ol li[data-global] .rename, .tree > ol li[data-global] .delete {
|
|
display: none;
|
|
}
|
|
.tree > ol li input {
|
|
position: absolute;
|
|
left: 0;
|
|
margin-left: 0;
|
|
opacity: 0;
|
|
z-index: 2;
|
|
cursor: pointer;
|
|
height: 2em;
|
|
width: 2em;
|
|
top: 0;
|
|
}
|
|
.tree > ol li input + ol {
|
|
background: url(../../../js/vvvebjs/icons/arrow-right.svg) 8px 0.8rem no-repeat;
|
|
background-size: 12px 12px;
|
|
margin: -1.9rem 0 0 0rem;
|
|
padding: 2rem 0 0 2rem;
|
|
height: 0;
|
|
}
|
|
.tree > ol li input + ol > li {
|
|
display: none;
|
|
margin-left: -14px !important;
|
|
padding-left: 1px;
|
|
}
|
|
.tree > ol li label {
|
|
background: url(../../../js/vvvebjs/icons/folder.svg) 24px 1px no-repeat;
|
|
background-size: 20px 20px;
|
|
cursor: pointer;
|
|
display: block;
|
|
padding-left: 50px;
|
|
margin: 0px;
|
|
font-size: 12px;
|
|
line-height: 24px;
|
|
/*
|
|
p {
|
|
margin: 0;
|
|
display:none;
|
|
color: #999;
|
|
margin-left: 1rem;
|
|
}
|
|
|
|
&:hover {
|
|
p {
|
|
display: inline-block;
|
|
}
|
|
}
|
|
*/
|
|
}
|
|
.tree > ol li input:checked + ol {
|
|
background: url(../../../js/vvvebjs/icons/arrow-down.svg) 8px 0.7rem no-repeat;
|
|
background-size: 12px 12px;
|
|
margin: -2.5em 0 0 0rem;
|
|
padding: 2rem 0 0 2.5rem;
|
|
height: auto;
|
|
}
|
|
.tree > ol li input:checked + ol > li {
|
|
display: block;
|
|
margin: 0 0 0.1em; /* 2px */
|
|
}
|
|
.tree > ol li input:checked + ol > li:last-child {
|
|
margin: 0 0 0.3em; /* 1px */
|
|
}
|
|
|
|
[data-bs-theme=dark] .tree > ol li.active label {
|
|
color: var(--bs-primary-border-subtle);
|
|
}
|
|
[data-bs-theme=dark] .tree > ol li label {
|
|
filter: invert(93%) hue-rotate(180deg);
|
|
color: var(--bs-dark);
|
|
}
|
|
[data-bs-theme=dark] .tree > ol li.file .file-actions .btn {
|
|
--bs-btn-color: var(--bs-primary-border-subtle);
|
|
--bs-btn-border-color: var(--bs-link-hover-color);
|
|
}
|
|
|
|
/* autocomplete */
|
|
input.autocomplete-loading {
|
|
background-image: url(../libs/autocomplete/autocomplete.gif);
|
|
background-position: left center;
|
|
background-repeat: no-repeat;
|
|
}
|
|
|
|
ul.autocomplete ~ .btn-close {
|
|
position: absolute;
|
|
right: 1.5rem;
|
|
margin-top: -1.5rem;
|
|
display: none;
|
|
}
|
|
|
|
.autocomplete-open ~ button.btn-close {
|
|
display: block;
|
|
}
|
|
|
|
ul.autocomplete {
|
|
position: absolute;
|
|
overflow: hidden;
|
|
background-color: var(--bs-body-bg);
|
|
border: 1px solid var(--bs-border-color);
|
|
border-top: none;
|
|
margin-top: -1px;
|
|
margin: 0px;
|
|
padding: 0px;
|
|
list-style: none;
|
|
color: var(--bs-body-color);
|
|
display: none;
|
|
z-index: 1000;
|
|
}
|
|
|
|
ul.autocomplete li {
|
|
display: block;
|
|
padding: 0.3em;
|
|
overflow: hidden;
|
|
width: 100%;
|
|
cursor: pointer;
|
|
}
|
|
ul.autocomplete li:hover {
|
|
background-color: var(--bs-primary);
|
|
color: var(--bs-body-bg);
|
|
}
|
|
|
|
ul.autocomplete li.selected {
|
|
background-color: Highlight;
|
|
background-color: var(--bs-primary);
|
|
color: var(--bs-body-bg);
|
|
color: var(--bs-white);
|
|
}
|
|
|
|
input.autocomplete-list {
|
|
border-radius: 5px 5px 0px 0px;
|
|
}
|
|
|
|
div.autocomplete-list {
|
|
border-radius: 0px 0px 5px 5px;
|
|
overflow: auto;
|
|
min-height: 150px;
|
|
height: 150px;
|
|
resize: vertical;
|
|
}
|
|
|
|
.autocomplete-list > div {
|
|
padding: 0.3rem 0.3rem 0.3rem 1rem;
|
|
border-bottom: 1px dashed var(--bs-border-color);
|
|
display: flex;
|
|
justify-content: space-between;
|
|
align-items: center;
|
|
}
|
|
.autocomplete-list > div .btn-close {
|
|
vertical-align: middle;
|
|
margin: 0.5rem;
|
|
}
|
|
|
|
.tags-input .tag {
|
|
display: inline-block;
|
|
font-size: 0.75rem;
|
|
padding: 0 0.3rem;
|
|
border: 1px solid var(--bs-primary-bg-subtle);
|
|
background-color: var(--bs-primary-bg-subtle);
|
|
background-color: rgba(var(--bs-primary-rgb), 0.1);
|
|
color: var(--bs-primary-text-emphasis);
|
|
border-radius: 4px;
|
|
margin: 0.2rem;
|
|
}
|
|
.tags-input .tag .remove-btn {
|
|
color: var(--bs-link-color);
|
|
}
|
|
.tags-input input.form-control {
|
|
box-shadow: none;
|
|
}
|
|
|
|
body {
|
|
--builder-filemanager-height: 250px;
|
|
--builder-canvas-margin: 40px;
|
|
--builder-header-top-height:35px;
|
|
--builder-bottom-panel-height:35px;
|
|
--drag-items-tabs-height:40px;
|
|
scrollbar-width: thin;
|
|
-webkit-font-smoothing: subpixel-antialiased;
|
|
}
|
|
@media (min-width: 576px) {
|
|
body {
|
|
--builder-left-panel-width:25vw;
|
|
--builder-right-panel-width:25vw;
|
|
--builder-component-list-element-width:90%;
|
|
}
|
|
}
|
|
@media (min-width: 768px) {
|
|
body {
|
|
--builder-left-panel-width:25vw;
|
|
--builder-right-panel-width:25vw;
|
|
--builder-component-list-element-width:90%;
|
|
}
|
|
}
|
|
@media (min-width: 992px) {
|
|
body {
|
|
--builder-left-panel-width:250px;
|
|
--builder-right-panel-width:250px;
|
|
--builder-component-list-element-width:44%;
|
|
}
|
|
}
|
|
@media (min-width: 1200px) {
|
|
body {
|
|
--builder-left-panel-width:300px;
|
|
--builder-right-panel-width:300px;
|
|
--builder-component-list-element-width:44%;
|
|
}
|
|
}
|
|
@media (min-width: 1600px) {
|
|
body {
|
|
--builder-left-panel-width: 300px;
|
|
--builder-right-panel-width: 300px;
|
|
--builder-component-list-element-width:44%;
|
|
}
|
|
}
|
|
@media (min-width: 2000px) {
|
|
body {
|
|
--builder-left-panel-width: 300px;
|
|
--builder-right-panel-width: 300px;
|
|
--builder-component-list-element-width:44%;
|
|
}
|
|
}
|
|
|
|
.modal-content {
|
|
font-size: 0.875rem;
|
|
}
|
|
|
|
.modal-footer .btn {
|
|
font-size: 0.875rem;
|
|
}
|
|
|
|
#vvveb-builder {
|
|
display: block;
|
|
height: 100%;
|
|
}
|
|
#vvveb-builder #left-panel, #vvveb-builder #right-panel {
|
|
border-color: var(--bs-border-color);
|
|
border-style: solid;
|
|
border-width: 0px;
|
|
background-color: var(--bs-body-bg);
|
|
height: 100%;
|
|
position: fixed;
|
|
top: 35px;
|
|
z-index: 10;
|
|
}
|
|
#vvveb-builder #left-panel {
|
|
border-right-width: 1px;
|
|
/*
|
|
box-shadow: 1px 0px 2px rgba(var(--bs-body-color-rgb),.1);
|
|
-moz-box-shadow: 1px 0px 2px rgba(var(--bs-body-color-rgb),.1);
|
|
-webkit-box-shadow: 1px 0px 2px rgba(var(--bs-body-color-rgb),.1);
|
|
*/
|
|
/*
|
|
background:-moz-linear-gradient(left, var(--bs-body-bg) 85%, #fafbfc 100%);
|
|
background:-webkit-linear-gradient(left, var(--bs-body-bg) 85%, #fafbfc 100%);
|
|
background:linear-gradient(left, var(--bs-body-bg) 85%, #fafbfc 100%);
|
|
box-shadow: -1px -2px 2px var(--bs-border-color) inset;*/
|
|
width: 15vw;
|
|
width: calc(var(--builder-left-panel-width));
|
|
height: 100%;
|
|
max-height: 100%;
|
|
}
|
|
#vvveb-builder #left-panel > div {
|
|
height: 100%;
|
|
display: flex;
|
|
flex-direction: column;
|
|
flex-wrap: nowrap;
|
|
}
|
|
#vvveb-builder #left-panel #filemanager {
|
|
display: flex;
|
|
flex-direction: column;
|
|
width: 30vw;
|
|
width: calc(var(--builder-left-panel-width));
|
|
border-bottom: 1px solid var(--bs-border-color);
|
|
}
|
|
#vvveb-builder #left-panel #filemanager .header {
|
|
font-size: 11px;
|
|
font-weight: 500;
|
|
height: 2rem;
|
|
margin: 0;
|
|
padding: 0;
|
|
width: 100%;
|
|
line-height: 2rem;
|
|
text-align: left;
|
|
padding-left: 1rem;
|
|
border-bottom: 1px solid var(--bs-border-color);
|
|
margin-bottom: 0rem;
|
|
padding: 0rem 0.5rem;
|
|
padding: 0rem 0rem 0.5rem 1rem;
|
|
}
|
|
#vvveb-builder #left-panel #filemanager .header a {
|
|
color: var(--bs-link-color);
|
|
}
|
|
#vvveb-builder #left-panel #filemanager .btn-add {
|
|
--bs-btn-border-color: rgba(var(--bs-link-color-rgb), 0.3);
|
|
--bs-btn-border-color: rgba(var(--bs-secondary-color-rgb), 0.15);
|
|
padding: 0rem 0.3rem;
|
|
margin: 0.2rem 0.3rem;
|
|
}
|
|
#vvveb-builder #left-panel #filemanager .btn-add span {
|
|
font-size: 12px;
|
|
}
|
|
#vvveb-builder #left-panel #filemanager .btn-add i {
|
|
vertical-align: middle;
|
|
}
|
|
#vvveb-builder #left-panel #filemanager .tree {
|
|
height: 215px;
|
|
height: calc( var(--builder-filemanager-height) - 35px);
|
|
padding: 0.3rem 0.5rem;
|
|
overflow: hidden;
|
|
resize: vertical;
|
|
}
|
|
#vvveb-builder #left-panel #filemanager .tree:hover {
|
|
overflow-y: auto;
|
|
}
|
|
#vvveb-builder #left-panel .components-list, #vvveb-builder #left-panel .blocks-list, #vvveb-builder #left-panel .component-properties, #vvveb-builder #left-panel .sections-list {
|
|
width: var(--builder-left-panel-width);
|
|
}
|
|
#vvveb-builder #left-panel .component-properties {
|
|
width: auto;
|
|
height: calc(100% - 85px);
|
|
}
|
|
#vvveb-builder #right-panel {
|
|
float: right;
|
|
right: 0px;
|
|
overflow: hidden;
|
|
border-left-width: 1px;
|
|
float: right;
|
|
transition: margin-right 0.1s linear;
|
|
-moz-transition: margin-right 0.1s linear;
|
|
-webkit-transition: margin-right 0.1s linear;
|
|
background: -moz-linear-gradient(to right, var(--bs-body-bg) 85%, #fafbfc 100%);
|
|
background: -webkit-linear-gradient(to right, var(--bs-body-bg) 85%, #fafbfc 100%);
|
|
background: linear-gradient(to right, var(--bs-body-bg) 85%, #fafbfc 100%);
|
|
box-shadow: 1px -2px 2px var(--bs-border-color) inset;
|
|
width: 15vw;
|
|
width: var(--builder-right-panel-width);
|
|
}
|
|
#vvveb-builder #right-panel .components-list, #vvveb-builder #right-panel .blocks-list, #vvveb-builder #right-panel .component-properties, #vvveb-builder #right-panel .sections-list {
|
|
width: var(--builder-right-panel-width);
|
|
}
|
|
#vvveb-builder #right-panel label.header .header-arrow {
|
|
right: 0px;
|
|
}
|
|
#vvveb-builder #right-panel .nav-link {
|
|
border-top: none;
|
|
border-bottom: none;
|
|
/*
|
|
border-left:none;
|
|
border-right:none;
|
|
*/
|
|
}
|
|
#vvveb-builder #right-panel .nav-link.active {
|
|
border-bottom-color: var(--bs-border-color);
|
|
font-weight: normal;
|
|
}
|
|
#vvveb-builder #right-panel .nav-link.active i {
|
|
color: var(--bs-link-hover-color);
|
|
}
|
|
#vvveb-builder #top-panel {
|
|
height: 35px;
|
|
padding: 0;
|
|
border-bottom: 1px solid var(--bs-border-color);
|
|
text-align: center;
|
|
display: flex;
|
|
justify-content: space-between;
|
|
width: 100%;
|
|
}
|
|
#vvveb-builder #top-panel .btn-group .btn.btn-light {
|
|
padding: 0.1rem 0.5rem;
|
|
--bs-btn-active-bg: rgba(var(--bs-primary-rgb), 0.1);
|
|
--bs-btn-hover-bg: var(--bs-primary-bg-subtle);
|
|
--bs-btn-active-border-color: transparent;
|
|
--bs-btn-hover-color: var(--bs-body-bg);
|
|
--bs-btn-bg:transparent;
|
|
border-color: transparent;
|
|
color: var(--bs-secondary-color);
|
|
line-height: 1.8;
|
|
}
|
|
#vvveb-builder #top-panel .btn-group .btn.btn-light i {
|
|
font-size: 1.2rem;
|
|
}
|
|
#vvveb-builder #top-panel .btn-group .btn.btn-primary {
|
|
margin-top: 0.2rem;
|
|
margin-bottom: 0.1rem;
|
|
}
|
|
#vvveb-builder #top-panel .btn-group .btn.btn-primary i {
|
|
font-size: 1rem;
|
|
line-height: 21px;
|
|
}
|
|
#vvveb-builder #top-panel .btn-group .btn span {
|
|
font-size: 14px;
|
|
}
|
|
#vvveb-builder #top-panel .btn-group.responsive-btns .btn.btn-light {
|
|
font-size: 1.4rem;
|
|
line-height: 1.3;
|
|
padding: 0rem 0.5rem;
|
|
}
|
|
#vvveb-builder #top-panel .menu-toggle i, #vvveb-builder #top-panel #color-theme-switch i {
|
|
font-size: 15px;
|
|
line-height: 1.4;
|
|
vertical-align: middle;
|
|
}
|
|
html[data-bs-theme=dark] #vvveb-builder #top-panel img {
|
|
filter: invert(93%) hue-rotate(180deg);
|
|
}
|
|
#vvveb-builder #bottom-panel {
|
|
width: auto;
|
|
height: 35px;
|
|
bottom: 0px;
|
|
position: fixed;
|
|
border-top: 1px solid var(--bs-border-color);
|
|
left: 15vw;
|
|
left: calc(15vw + 40px);
|
|
left: calc(var(--builder-left-panel-width) + var(--builder-canvas-margin));
|
|
right: 15vw;
|
|
right: var(--builder-right-panel-width);
|
|
background-color: var(--bs-body-bg);
|
|
}
|
|
#vvveb-builder #bottom-panel > div {
|
|
position: relative;
|
|
}
|
|
#vvveb-builder #bottom-panel > div .btn-group {
|
|
position: absolute;
|
|
right: 0px;
|
|
top: 0px;
|
|
background: var(--bs-body-bg);
|
|
}
|
|
#vvveb-builder #bottom-panel .nav-tabs {
|
|
background-color: rgba(var(--bs-body-color-rgb), 0.1);
|
|
}
|
|
#vvveb-builder #bottom-panel .nav-tabs .nav-item {
|
|
max-width: 300px;
|
|
}
|
|
#vvveb-builder #bottom-panel .nav-tabs .nav-item .nav-link {
|
|
padding: 0.3rem 0;
|
|
}
|
|
#vvveb-builder #bottom-panel #vvveb-code-editor {
|
|
width: 100%;
|
|
height: 100%;
|
|
clear: both;
|
|
}
|
|
#vvveb-builder #bottom-panel #vvveb-code-editor textarea {
|
|
height: 100%;
|
|
width: 100%;
|
|
border: none;
|
|
font-size: 14px;
|
|
margin-bottom: 10px;
|
|
background: rgba(var(--bs-secondary-color-rgb), 0.03);
|
|
}
|
|
#vvveb-builder.bottom-panel-expand #bottom-panel {
|
|
height: 50%;
|
|
}
|
|
#vvveb-builder.bottom-panel-expand #canvas {
|
|
height: 50%;
|
|
position: relative;
|
|
}
|
|
#vvveb-builder .drag-elements {
|
|
flex: 1 1;
|
|
overflow: hidden;
|
|
padding-top: 0rem;
|
|
height: 100%;
|
|
}
|
|
#vvveb-builder .drag-elements > .header {
|
|
height: 100%;
|
|
display: flex;
|
|
flex-direction: column;
|
|
}
|
|
#vvveb-builder .drag-elements .nav-item a.nav-link {
|
|
text-align: center;
|
|
border-top-color: var(--bs-body-bg);
|
|
border-radius: 0px;
|
|
min-width: 4.5rem;
|
|
padding: 0.3rem 0;
|
|
--bs-nav-link-color:var(--bs-secondary-color);
|
|
line-height: 1.4;
|
|
}
|
|
#vvveb-builder .drag-elements .nav-item a.nav-link i {
|
|
font-size: 1.1rem;
|
|
vertical-align: middle;
|
|
}
|
|
#vvveb-builder .drag-elements .nav-item a.nav-link small, #vvveb-builder .drag-elements .nav-item a.nav-link .small {
|
|
font-size: 0.8rem;
|
|
}
|
|
#vvveb-builder .drag-elements#add-section-box .nav-item:first-child .nav-link {
|
|
border-left: none;
|
|
}
|
|
#vvveb-builder .search {
|
|
position: relative;
|
|
}
|
|
#vvveb-builder .search .form-control {
|
|
border-color: var(--bs-body-bg);
|
|
border-bottom-color: var(--bs-border-color);
|
|
border-radius: 0px;
|
|
box-shadow: none;
|
|
}
|
|
#vvveb-builder .search .form-control:focus {
|
|
border-color: #80bdff;
|
|
}
|
|
#vvveb-builder .search .form-control::placeholder {
|
|
/*font-size: $font-size-sm;*/
|
|
font-size: 0.75rem;
|
|
}
|
|
#vvveb-builder .search .clear-backspace {
|
|
border: none;
|
|
background: none;
|
|
position: absolute;
|
|
top: 0.3rem;
|
|
right: 12px;
|
|
opacity: 0.5;
|
|
}
|
|
#vvveb-builder .search .clear-backspace:hover {
|
|
opacity: 1;
|
|
background: var(--bs-border-color);
|
|
}
|
|
#vvveb-builder .search i {
|
|
font-size: 13px;
|
|
}
|
|
#vvveb-builder .search input:focus + .clear-backspace,
|
|
#vvveb-builder .search input:hover + .clear-backspace {
|
|
opacity: 1;
|
|
background: var(--bs-border-color);
|
|
}
|
|
#vvveb-builder .search .expand {
|
|
position: absolute;
|
|
top: 4px;
|
|
right: 5px;
|
|
}
|
|
#vvveb-builder .search .expand button {
|
|
padding: 0.1rem 0.25rem;
|
|
background: transparent;
|
|
border: none;
|
|
color: var(--bs-body-color);
|
|
}
|
|
#vvveb-builder .search .expand button:hover {
|
|
background: var(--bs-border-color);
|
|
}
|
|
#vvveb-builder .search .expand ~ .clear-backspace {
|
|
right: 56px;
|
|
}
|
|
#vvveb-builder .components-list, #vvveb-builder .blocks-list, #vvveb-builder .component-properties, #vvveb-builder .sections-list {
|
|
list-style: none;
|
|
background: rgba(var(--bs-secondary-color-rgb), 0.015);
|
|
}
|
|
#vvveb-builder #add-section-box {
|
|
animation: popup-animation 0.1s cubic-bezier(0, 0, 0.2, 1) 0s;
|
|
animation-fill-mode: forwards;
|
|
}
|
|
#vvveb-builder #add-section-box .header > div.section-box-actions {
|
|
position: absolute;
|
|
top: 0.5rem;
|
|
right: 0.5rem;
|
|
}
|
|
#vvveb-builder #add-section-box .components-list, #vvveb-builder #add-section-box .blocks-list, #vvveb-builder #add-section-box .component-properties, #vvveb-builder #add-section-box .sections-list {
|
|
width: auto;
|
|
height: auto;
|
|
padding: 0px;
|
|
margin: 0;
|
|
}
|
|
#vvveb-builder #add-section-box .components-list ol, #vvveb-builder #add-section-box .blocks-list ol, #vvveb-builder #add-section-box .component-properties ol, #vvveb-builder #add-section-box .sections-list ol {
|
|
padding: 0rem 0rem 0rem 1rem;
|
|
list-style: none;
|
|
}
|
|
#vvveb-builder #add-section-box .components-list ol li, #vvveb-builder #add-section-box .blocks-list ol li, #vvveb-builder #add-section-box .component-properties ol li, #vvveb-builder #add-section-box .sections-list ol li {
|
|
width: 10%;
|
|
min-width: 100px;
|
|
float: left;
|
|
margin: 0% 1% 2% 1%;
|
|
}
|
|
#vvveb-builder #add-section-box .components-list ol li a, #vvveb-builder #add-section-box .blocks-list ol li a, #vvveb-builder #add-section-box .component-properties ol li a, #vvveb-builder #add-section-box .sections-list ol li a {
|
|
display: block;
|
|
color: var(--bs-gray-900);
|
|
text-decoration: none;
|
|
text-shadow: none;
|
|
margin-top: 5px;
|
|
}
|
|
#vvveb-builder #add-section-box .blocks-list ol, #vvveb-builder #add-section-box .sections-list ol {
|
|
list-style: none;
|
|
display: grid;
|
|
grid-template-columns: repeat(auto-fill, minmax(300px, 1fr));
|
|
margin: 0rem 2rem 2rem 1rem;
|
|
grid-gap: 2rem;
|
|
grid-auto-rows: 250px;
|
|
grid-template-rows: masonry;
|
|
display: flex;
|
|
flex-wrap: wrap;
|
|
}
|
|
#vvveb-builder #add-section-box .blocks-list ol li, #vvveb-builder #add-section-box .sections-list ol li {
|
|
display: flex;
|
|
position: relative;
|
|
padding: 0;
|
|
margin: 0;
|
|
height: auto;
|
|
width: auto;
|
|
border: none;
|
|
box-shadow: none;
|
|
width: 300px;
|
|
}
|
|
#vvveb-builder #add-section-box .blocks-list ol li span, #vvveb-builder #add-section-box .sections-list ol li span {
|
|
position: absolute;
|
|
bottom: 0;
|
|
text-align: center;
|
|
visibility: hidden;
|
|
width: 100%;
|
|
padding: 0.2rem;
|
|
background-color: rgba(var(--bs-body-bg-rgb), 0.8);
|
|
}
|
|
#vvveb-builder #add-section-box .blocks-list ol li .add-section-btn, #vvveb-builder #add-section-box .sections-list ol li .add-section-btn {
|
|
position: absolute;
|
|
bottom: 0;
|
|
right: 0;
|
|
top: 50%;
|
|
left: 50%;
|
|
visibility: hidden;
|
|
}
|
|
#vvveb-builder #add-section-box .blocks-list ol li img, #vvveb-builder #add-section-box .sections-list ol li img {
|
|
border: 1px solid rgba(var(--bs-body-color-rgb), 0.15);
|
|
box-shadow: 0px 1px 4px 0px rgba(var(--bs-body-color-rgb), 0.2);
|
|
border-radius: 5px;
|
|
}
|
|
#vvveb-builder #add-section-box .blocks-list ol li:hover span, #vvveb-builder #add-section-box .blocks-list ol li:hover .add-section-btn, #vvveb-builder #add-section-box .sections-list ol li:hover span, #vvveb-builder #add-section-box .sections-list ol li:hover .add-section-btn {
|
|
visibility: visible;
|
|
}
|
|
#vvveb-builder #add-section-box.only-sections {
|
|
max-width: 100% !important;
|
|
max-height: 100%;
|
|
display: block;
|
|
top: 20px !important;
|
|
left: 20px !important;
|
|
width: calc(100% - 40px);
|
|
height: calc(100% - 40px);
|
|
}
|
|
#vvveb-builder #add-section-box.only-sections .nav-tabs .nav-item, #vvveb-builder #add-section-box.only-sections .section-box-actions .form-check {
|
|
visibility: hidden;
|
|
}
|
|
#vvveb-builder .component-properties-sidepane {
|
|
z-index: 0;
|
|
margin: 0;
|
|
-webkit-touch-callout: none;
|
|
-webkit-user-select: none;
|
|
-khtml-user-select: none;
|
|
-moz-user-select: none;
|
|
-ms-user-select: none;
|
|
user-select: none;
|
|
/*
|
|
height: auto;
|
|
width: 100%;
|
|
overflow-y: auto;
|
|
*/
|
|
display: flex;
|
|
flex-direction: column;
|
|
flex-wrap: wrap;
|
|
height: 100%;
|
|
}
|
|
#vvveb-builder .component-properties-sidepane > div {
|
|
flex: 1 1;
|
|
height: 100%;
|
|
}
|
|
#vvveb-builder .component-properties {
|
|
background: var(--bs-body-bg);
|
|
display: flex;
|
|
flex-direction: column;
|
|
height: 100%;
|
|
height: calc(100% - 45px);
|
|
/*
|
|
.form-control, .form-select
|
|
{
|
|
padding:.275rem 0.25rem;
|
|
}*/
|
|
}
|
|
#vvveb-builder .component-properties .tab-content {
|
|
padding: 0.5rem 0;
|
|
overflow-x: hidden;
|
|
overflow-y: auto;
|
|
flex: 1 1;
|
|
}
|
|
#vvveb-builder .component-properties .tab-content > .active {
|
|
display: flex;
|
|
flex-direction: column;
|
|
height: 100%;
|
|
margin-bottom: 2rem;
|
|
}
|
|
#vvveb-builder .component-properties #right-panel {
|
|
color: #777;
|
|
}
|
|
#vvveb-builder .component-properties, #vvveb-builder .component-properties select, #vvveb-builder .component-properties input[type=text] {
|
|
font-size: 12px;
|
|
}
|
|
#vvveb-builder .component-properties .btn-sm, #vvveb-builder .component-properties .btn-group-sm > .btn {
|
|
font-size: 0.8rem;
|
|
}
|
|
#vvveb-builder .component-properties .form-select {
|
|
height: auto;
|
|
}
|
|
#vvveb-builder .component-properties .mb-2 {
|
|
vertical-align: middle;
|
|
align-items: center;
|
|
}
|
|
#vvveb-builder .component-properties .mb-2.row {
|
|
margin: 0;
|
|
}
|
|
#vvveb-builder .component-properties .mb-2 > label {
|
|
font-size: 11px;
|
|
font-weight: 500;
|
|
margin-bottom: 5px;
|
|
color: var(--bs-secondary-color);
|
|
flex-grow: 1;
|
|
}
|
|
#vvveb-builder .component-properties .mb-2 > label i {
|
|
font-size: 14px;
|
|
}
|
|
#vvveb-builder .component-properties .mb-2 .input .input-range {
|
|
position: relative;
|
|
padding-top: 0.4rem;
|
|
}
|
|
#vvveb-builder .component-properties .mb-2 .input .input-range input[type=number] {
|
|
position: absolute;
|
|
right: 0;
|
|
top: -0.8rem;
|
|
width: 5em;
|
|
padding: 0.2rem 0.2rem;
|
|
text-align: center;
|
|
line-height: 12px;
|
|
font-size: 12px;
|
|
}
|
|
#vvveb-builder .component-properties .mb-2 .input [type=color], #vvveb-builder .component-properties .mb-2 .input .form-check-input {
|
|
float: right;
|
|
}
|
|
#vvveb-builder .component-properties .mb-2 .custom-control {
|
|
min-height: 1.1rem;
|
|
}
|
|
#vvveb-builder .component-properties .mb-2.inline {
|
|
display: flex;
|
|
align-items: center;
|
|
}
|
|
#vvveb-builder .component-properties .mb-2.inline .control-label {
|
|
flex-grow: 1;
|
|
}
|
|
#vvveb-builder .component-properties .mb-2.inline .input {
|
|
flex: 1 1 auto;
|
|
width: auto;
|
|
}
|
|
#vvveb-builder #canvas {
|
|
margin-right: 15vw;
|
|
margin-left: 15vw;
|
|
margin-right: var(--builder-right-panel-width);
|
|
margin-left: var(--builder-left-panel-width);
|
|
width: 100%;
|
|
height: 100%;
|
|
width: calc( 100vw - 640px);
|
|
height: calc( 100vh - 70px);
|
|
top: 35px;
|
|
width: calc(100vw - (var(--builder-left-panel-width) + var(--builder-right-panel-width) + var(--builder-canvas-margin)));
|
|
height: calc(100vh - (var(--builder-header-top-height) + var(--builder-bottom-panel-height)));
|
|
top: var(--builder-header-top-height);
|
|
position: fixed;
|
|
background-color: var(--bs-secondary-bg);
|
|
overflow: hidden;
|
|
}
|
|
#vvveb-builder #canvas #iframe-wrapper {
|
|
transition: transform 1s ease 0s, width 1s ease 0s, width 1s ease 0s, left 1s ease 0s, height 1s ease 0s;
|
|
transform-origin: top center;
|
|
}
|
|
#vvveb-builder #canvas #iframe-wrapper, #vvveb-builder #canvas iframe, #vvveb-builder #canvas iframe body {
|
|
width: 100%;
|
|
height: 100%;
|
|
border: none;
|
|
}
|
|
#vvveb-builder #canvas.tablet {
|
|
background: var(--bs-border-color);
|
|
}
|
|
#vvveb-builder #canvas.tablet #iframe-wrapper {
|
|
width: 768px;
|
|
margin: auto;
|
|
position: relative;
|
|
}
|
|
#vvveb-builder #canvas.tablet #iframe-wrapper iframe {
|
|
resize: both;
|
|
}
|
|
#vvveb-builder #canvas.mobile {
|
|
background: var(--bs-border-color);
|
|
}
|
|
#vvveb-builder #canvas.mobile #iframe-wrapper {
|
|
width: 320px;
|
|
margin: auto;
|
|
position: relative;
|
|
}
|
|
#vvveb-builder #canvas.mobile #iframe-wrapper iframe {
|
|
resize: both;
|
|
}
|
|
#vvveb-builder.preview #canvas {
|
|
width: 100%;
|
|
margin-left: 0px;
|
|
margin-right: 0px;
|
|
}
|
|
#vvveb-builder.preview #left-panel, #vvveb-builder.preview #right-panel {
|
|
display: none;
|
|
}
|
|
#vvveb-builder.no-right-panel {
|
|
--builder-right-panel-width:0px;
|
|
}
|
|
#vvveb-builder.no-right-panel #right-panel {
|
|
display: none;
|
|
}
|
|
#vvveb-builder #iframe-layer {
|
|
overflow: hidden;
|
|
pointer-events: none;
|
|
white-space: nowrap;
|
|
}
|
|
#vvveb-builder #iframe-layer .loading-message {
|
|
width: 100%;
|
|
height: 100%;
|
|
position: absolute;
|
|
display: none;
|
|
}
|
|
#vvveb-builder #iframe-layer .loading-message.active {
|
|
display: block;
|
|
}
|
|
#vvveb-builder #highlight-box {
|
|
position: absolute;
|
|
border: 1px solid var(--bs-primary);
|
|
color: var(--bs-white);
|
|
width: 0px;
|
|
height: 0px;
|
|
top: 0px;
|
|
left: 0px;
|
|
display: none;
|
|
transition: all 0.05s;
|
|
}
|
|
#vvveb-builder #drop-highlight-box {
|
|
position: absolute;
|
|
border: 2px solid var(--bs-primary);
|
|
color: var(--bs-white);
|
|
width: 0px;
|
|
height: 0px;
|
|
top: 0px;
|
|
left: 0px;
|
|
transition: all 0.3s;
|
|
border-radius: 4px;
|
|
display: none;
|
|
}
|
|
#vvveb-builder .text-edit#select-box {
|
|
border-style: dashed;
|
|
/*border-width:1px;*/
|
|
border: 1px solid rgba(var(--bs-body-color-rgb), 0.2);
|
|
box-shadow: 1px 1px 3px 0px rgba(var(--bs-body-color-rgb), 0.1) inset, 0px 0px 2px 1px rgba(var(--bs-body-bg-rgb), 0.8) inset;
|
|
background: transparent;
|
|
border-radius: 0 0 3px 3px;
|
|
}
|
|
#vvveb-builder #select-box {
|
|
position: absolute;
|
|
border: 1px solid var(--bs-primary);
|
|
color: var(--bs-white);
|
|
background: rgba(var(--bs-primary), 0.1);
|
|
width: 0px;
|
|
height: 0px;
|
|
top: 0px;
|
|
left: 0px;
|
|
display: none;
|
|
}
|
|
#vvveb-builder #select-box.resizable .resize {
|
|
position: absolute;
|
|
left: 0;
|
|
top: 0;
|
|
width: 100%;
|
|
height: 100%;
|
|
z-index: 10;
|
|
}
|
|
#vvveb-builder #select-box.resizable .resize > div {
|
|
position: absolute;
|
|
pointer-events: all;
|
|
border: 2px solid var(--bs-primary);
|
|
width: 10px;
|
|
height: 10px;
|
|
background-color: rgba(var(--bs-primary), 0.1);
|
|
margin: -5px;
|
|
}
|
|
#vvveb-builder #select-box.resizable .resize .top-left {
|
|
top: 0;
|
|
left: 0;
|
|
cursor: nwse-resize;
|
|
}
|
|
#vvveb-builder #select-box.resizable .resize .top-center {
|
|
top: 0;
|
|
left: 0;
|
|
right: 0;
|
|
margin: -5px auto;
|
|
cursor: ns-resize;
|
|
}
|
|
#vvveb-builder #select-box.resizable .resize .top-right {
|
|
top: 0;
|
|
right: 0;
|
|
cursor: nesw-resize;
|
|
}
|
|
#vvveb-builder #select-box.resizable .resize .center-left {
|
|
left: 0;
|
|
margin: auto -5px;
|
|
top: 0;
|
|
bottom: 0;
|
|
cursor: ew-resize;
|
|
}
|
|
#vvveb-builder #select-box.resizable .resize .center-right {
|
|
top: 0;
|
|
bottom: 0;
|
|
right: 0;
|
|
margin: auto -5px;
|
|
cursor: ew-resize;
|
|
}
|
|
#vvveb-builder #select-box.resizable .resize .bottom-left {
|
|
bottom: 0;
|
|
left: 0;
|
|
cursor: nesw-resize;
|
|
}
|
|
#vvveb-builder #select-box.resizable .resize .bottom-center {
|
|
bottom: 0;
|
|
left: 0;
|
|
right: 0;
|
|
margin: -5px auto;
|
|
cursor: ns-resize;
|
|
}
|
|
#vvveb-builder #select-box.resizable .resize .bottom-right {
|
|
bottom: 0;
|
|
right: 0;
|
|
cursor: nwse-resize;
|
|
}
|
|
#vvveb-builder #select-actions, #vvveb-builder #wysiwyg-editor {
|
|
position: absolute;
|
|
z-index: 1;
|
|
right: -1px;
|
|
top: -25px;
|
|
background: var(--bs-primary);
|
|
color: var(--bs-light);
|
|
padding: 0px 0px;
|
|
border-radius: 3px 3px 0px 0px;
|
|
}
|
|
#vvveb-builder #select-actions a, #vvveb-builder #wysiwyg-editor.default-editor a, #vvveb-builder #section-actions a#add-section-btn {
|
|
pointer-events: auto;
|
|
color: inherit;
|
|
text-decoration: none;
|
|
font-size: 16px;
|
|
padding-right: 2px;
|
|
padding: 2px 5px;
|
|
}
|
|
#vvveb-builder #select-actions a:hover, #vvveb-builder #wysiwyg-editor.default-editor a:hover, #vvveb-builder #section-actions a#add-section-btn:hover {
|
|
background-color: rgba(var(--bs-body-color-rgb), 0.3);
|
|
}
|
|
#vvveb-builder #section-actions a#add-section-btn:hover {
|
|
background-color: rgba(var(--bs-primary-rgb), 0.9);
|
|
}
|
|
#vvveb-builder #wysiwyg-editor {
|
|
top: auto;
|
|
bottom: 100%;
|
|
height: -44px;
|
|
right: auto;
|
|
left: -1px;
|
|
display: none;
|
|
color: var(--bs-body-color);
|
|
background: var(--bs-body-bg);
|
|
border: 1px solid rgba(var(--bs-body-color-rgb), 0.07);
|
|
box-shadow: 0 0 2px 0 rgba(var(--bs-body-color-rgb), 0.07), 0 4px 8px 0 rgba(var(--bs-body-color-rgb), 0.05);
|
|
pointer-events: auto;
|
|
}
|
|
#vvveb-builder #wysiwyg-editor.default-editor a {
|
|
display: inline-block;
|
|
padding: 8px;
|
|
line-height: 1;
|
|
color: var(--bs-body-color);
|
|
font-size: 18px;
|
|
}
|
|
#vvveb-builder #wysiwyg-editor.default-editor a:last-child {
|
|
border-right: none;
|
|
}
|
|
#vvveb-builder #wysiwyg-editor.default-editor a:hover {
|
|
background: var(--bs-border-color);
|
|
}
|
|
#vvveb-builder #wysiwyg-editor.default-editor a i {
|
|
font-size: 16px;
|
|
}
|
|
#vvveb-builder #wysiwyg-editor.default-editor div.separator {
|
|
display: inline-block;
|
|
background: var(--bs-border-color);
|
|
width: 1px;
|
|
height: 18px;
|
|
vertical-align: text-bottom;
|
|
top: 0;
|
|
padding: 0;
|
|
margin: 0;
|
|
}
|
|
#vvveb-builder #wysiwyg-editor.default-editor > div.dropdown, #vvveb-builder #wysiwyg-editor.default-editor > select, #vvveb-builder #wysiwyg-editor.default-editor > input {
|
|
display: inline-block;
|
|
width: auto;
|
|
vertical-align: top;
|
|
border: none;
|
|
pointer-events: all;
|
|
line-height: 2.2rem;
|
|
height: 34px;
|
|
font-size: 14px;
|
|
padding: 0;
|
|
box-shadow: none;
|
|
}
|
|
#vvveb-builder #wysiwyg-editor.default-editor > input[type=color] {
|
|
padding: 4px;
|
|
height: 30px;
|
|
width: 32px;
|
|
box-shadow: none;
|
|
border: 1px dashed var(--bs-border-color);
|
|
margin: 0;
|
|
margin: 3px;
|
|
border-radius: 3px;
|
|
}
|
|
#vvveb-builder #wysiwyg-editor.default-editor > input[type=color].form-control-color::-moz-color-swatch {
|
|
border-radius: 3px;
|
|
box-shadow: 1px 1px 5px 0px rgba(var(--bs-body-color-rgb), 0.25);
|
|
border: none;
|
|
}
|
|
#vvveb-builder #wysiwyg-editor.default-editor > input[type=color].form-control-color::-webkit-color-swatch {
|
|
padding: 0;
|
|
border-radius: 3px;
|
|
box-shadow: 1px 1px 5px 0px rgba(var(--bs-body-color-rgb), 0.25);
|
|
border: none;
|
|
}
|
|
#vvveb-builder #wysiwyg-editor.default-editor > div.dropdown button {
|
|
padding: 5px 8px;
|
|
margin: 0;
|
|
font-size: 18px;
|
|
vertical-align: middle;
|
|
color: var(--bs-body-color);
|
|
}
|
|
#vvveb-builder #wysiwyg-editor.default-editor > div.dropdown .dropdown-toggle::after {
|
|
font-size: 50%;
|
|
vertical-align: unset;
|
|
}
|
|
#vvveb-builder #wysiwyg-editor.default-editor > select {
|
|
padding: 0rem 2.5rem 0 1rem;
|
|
margin-top: 2px;
|
|
background-size: 12px 10px;
|
|
}
|
|
#vvveb-builder #wysiwyg-editor.default-editor div.dropdown a:after {
|
|
vertical-align: middle !important;
|
|
font-size: 14px;
|
|
margin-bottom: 0.2rem;
|
|
}
|
|
#vvveb-builder #wysiwyg-editor.default-editor div.dropdown a.dropdown-item {
|
|
display: block;
|
|
font-size: 1rem;
|
|
}
|
|
#vvveb-builder #wysiwyg-editor.default-editor div.dropdown a.dropdown-item i {
|
|
margin-right: 0;
|
|
}
|
|
#vvveb-builder #section-actions {
|
|
bottom: 0px;
|
|
position: absolute;
|
|
border-radius: 3px 3px 0px 0px;
|
|
bottom: -10px;
|
|
left: 50%;
|
|
left: calc(50% - 12px);
|
|
}
|
|
#vvveb-builder #section-actions.outside {
|
|
bottom: -30px;
|
|
}
|
|
#vvveb-builder #section-actions a#add-section-btn {
|
|
position: relative;
|
|
bottom: 0px;
|
|
background: var(--bs-primary);
|
|
color: var(--bs-white);
|
|
font-size: 18px;
|
|
border-radius: 24px;
|
|
width: 32px;
|
|
height: 32px;
|
|
padding: 3px 7px;
|
|
cursor: pointer;
|
|
display: block;
|
|
box-shadow: 0px 0px 1px 2px rgba(18, 83, 205, 0.05);
|
|
box-shadow: 0px 3px 7px 1px rgba(var(--bs-body-color-rgb), 0.1), 1px 2px 7px 1px rgba(255, 255, 255, 0.1) inset;
|
|
}
|
|
#vvveb-builder #section-actions a#add-section-btn i {
|
|
font-weight: 600;
|
|
}
|
|
#vvveb-builder #section-actions a#add-section-btn:hover {
|
|
text-decoration: none;
|
|
filter: brightness(1.2);
|
|
}
|
|
#vvveb-builder #add-section-box {
|
|
width: 50%;
|
|
min-height: 300px;
|
|
max-height: 480px;
|
|
position: absolute;
|
|
background: var(--bs-body-bg);
|
|
top: 100px;
|
|
left: 100px;
|
|
box-shadow: 0px 5px 50px 15px rgba(var(--bs-body-color-rgb), 0.08);
|
|
border: 1px solid var(--bs-border-color);
|
|
border-radius: 4px;
|
|
min-width: 500px;
|
|
max-width: 720px;
|
|
pointer-events: auto;
|
|
display: none;
|
|
z-index: 101;
|
|
background: var(--bs-body-bg);
|
|
}
|
|
#vvveb-builder #highlight-name {
|
|
background: var(--bs-primary);
|
|
color: var(--bs-white);
|
|
font-size: 12px;
|
|
position: relative;
|
|
top: -22px;
|
|
left: -1px;
|
|
width: auto;
|
|
padding: 2px 5px;
|
|
display: inline-block;
|
|
border-radius: 3px 3px 0px 0px;
|
|
}
|
|
#vvveb-builder #highlight-name .type {
|
|
font-size: 10px;
|
|
opacity: 0.7;
|
|
}
|
|
#vvveb-builder #elements-tabs .nav-item {
|
|
background: var(--bs-body-bg);
|
|
overflow: hidden;
|
|
}
|
|
#vvveb-builder #elements-tabs a {
|
|
font-size: 1.4rem;
|
|
outline: none;
|
|
border: none;
|
|
padding: 0.3rem 0.2rem 0.4rem;
|
|
}
|
|
#vvveb-builder #elements-tabs a i {
|
|
padding: 0.3rem 0rem;
|
|
font-size: 1.1rem;
|
|
border-radius: 3px;
|
|
display: block;
|
|
border: 1px solid transparent;
|
|
}
|
|
#vvveb-builder #elements-tabs a:hover i {
|
|
border: 1px solid rgba(var(--bs-link-color-rgb), 0.2);
|
|
}
|
|
#vvveb-builder #elements-tabs a.active {
|
|
border-top: none;
|
|
border-left: none;
|
|
border-right: none;
|
|
border-top-color: rgba(var(--bs-link-color-rgb), 0.7);
|
|
color: var(--bs-link-color);
|
|
box-shadow: none;
|
|
}
|
|
#vvveb-builder #elements-tabs a.active i {
|
|
background: rgba(var(--bs-link-color-rgb), 0.03);
|
|
border: 1px solid rgba(var(--bs-link-color-rgb), 0.3);
|
|
color: var(--bs-link-hover-color);
|
|
}
|
|
#vvveb-builder .nav-tabs .nav-item:first-child .nav-link {
|
|
border-left: none;
|
|
}
|
|
#vvveb-builder .nav-tabs .nav-link {
|
|
/*
|
|
border-top:none;
|
|
border-left:none;
|
|
border-right:none;
|
|
border-bottom-width: 1px;
|
|
*/
|
|
text-align: center;
|
|
--bs-nav-link-color:var(--bs-secondary-color);
|
|
}
|
|
#vvveb-builder .nav-tabs .nav-link i {
|
|
font-size: 1.2rem;
|
|
line-height: 1;
|
|
vertical-align: bottom;
|
|
margin-right: 0.5rem;
|
|
}
|
|
#vvveb-builder .nav-tabs .nav-link.active,
|
|
#vvveb-builder .nav-tabs .nav-item.show .nav-link {
|
|
border-radius: 0px;
|
|
font-weight: normal;
|
|
}
|
|
#vvveb-builder .nav-tabs .nav-link.active i,
|
|
#vvveb-builder .nav-tabs .nav-item.show .nav-link i {
|
|
color: var(--bs-link-hover-color);
|
|
}
|
|
#vvveb-builder .nav-fill .nav-item {
|
|
background-color: rgba(var(--bs-body-color-rgb), 0.03);
|
|
}
|
|
#vvveb-builder .nav-fill .nav-item .nav-link {
|
|
padding: 0.5rem 0;
|
|
}
|
|
#vvveb-builder .sections-tabs .nav-link i, #vvveb-builder .sections-tabs .nav-link div {
|
|
display: inline-block;
|
|
vertical-align: bottom;
|
|
}
|
|
#vvveb-builder .sections-tabs .nav-link i {
|
|
margin-right: 0.3rem;
|
|
}
|
|
/* style for drag element */
|
|
li[data-type] {
|
|
width: var(--builder-component-list-element-width);
|
|
min-width: 80px;
|
|
height: 80px;
|
|
margin: 0% 1% 3% 3%;
|
|
text-align: center;
|
|
font-weight: normal;
|
|
font-size: 11px;
|
|
color: #000;
|
|
background-repeat: no-repeat;
|
|
padding-top: 60px;
|
|
padding-bottom: 7px;
|
|
padding: 50px 5px 7px 5px;
|
|
border-style: solid;
|
|
border-width: 1px;
|
|
border-radius: 3px;
|
|
/*
|
|
border-left-width:1px;
|
|
border-top-width:1px;
|
|
*/
|
|
background-color: var(--bs-white);
|
|
border-color: var(--bs-border-color);
|
|
border-color: rgba(var(--bs-secondary-rgb), 0.25);
|
|
background-position: 50% 20%;
|
|
background-size: auto 42px;
|
|
z-index: 100;
|
|
cursor: move;
|
|
cursor: grab;
|
|
box-shadow: 0px 1px 4px 0px rgba(var(--bs-body-color-rgb), 0.05);
|
|
box-shadow: none;
|
|
/*border-width:1px;*/
|
|
}
|
|
li[data-type] a, li[data-type] span {
|
|
min-height: 20px;
|
|
white-space: break-spaces;
|
|
padding: 0 3px;
|
|
}
|
|
html[data-bs-theme=dark] li[data-type][data-drag-type=component] {
|
|
border-color: var(--bs-gray-500);
|
|
filter: invert(93%) hue-rotate(180deg);
|
|
background-color: transparent;
|
|
}
|
|
html[data-bs-theme=dark] li[data-type][data-drag-type=component] a {
|
|
color: var(--bs-gray-900);
|
|
}
|
|
.drag-elements-sidepane {
|
|
z-index: 0;
|
|
margin: 0;
|
|
-webkit-touch-callout: none;
|
|
-webkit-user-select: none;
|
|
-khtml-user-select: none;
|
|
-moz-user-select: none;
|
|
-ms-user-select: none;
|
|
user-select: none;
|
|
width: 100%;
|
|
height: 100%;
|
|
display: flex;
|
|
flex-direction: column;
|
|
overflow: hidden;
|
|
}
|
|
.drag-elements-sidepane > div {
|
|
overflow: hidden;
|
|
margin-bottom: 5rem;
|
|
}
|
|
.drag-elements-sidepane > div:hover {
|
|
overflow-y: auto;
|
|
}
|
|
.drag-elements-sidepane .block-preview, .drag-elements-sidepane .style-preview {
|
|
margin: 0;
|
|
}
|
|
.drag-elements-sidepane ul {
|
|
z-index: 1;
|
|
margin: 0;
|
|
padding: 0;
|
|
padding-bottom: 2rem;
|
|
white-space: nowrap;
|
|
text-align: center;
|
|
}
|
|
.drag-elements-sidepane ul > li {
|
|
float: none;
|
|
clear: both;
|
|
}
|
|
.drag-elements-sidepane ul > li.header {
|
|
height: auto;
|
|
margin: 0;
|
|
padding: 0;
|
|
width: 100%;
|
|
position: relative;
|
|
}
|
|
.drag-elements-sidepane ul > li.header label {
|
|
font-size: 11px;
|
|
font-weight: 500;
|
|
line-height: 28px;
|
|
text-align: left;
|
|
padding: 0.3rem 1rem;
|
|
padding: 0.5rem 1.8rem;
|
|
}
|
|
.drag-elements-sidepane ul > li.header label > a {
|
|
padding-left: 1rem;
|
|
color: var(--bs-link-color);
|
|
}
|
|
.drag-elements-sidepane ul > li.header:first-child {
|
|
margin-top: 0rem;
|
|
}
|
|
.drag-elements-sidepane ul > li ol {
|
|
margin: 0px;
|
|
padding: 0rem;
|
|
padding-bottom: 0rem;
|
|
list-style: none;
|
|
}
|
|
.drag-elements-sidepane ul > li ol li {
|
|
float: left;
|
|
}
|
|
.drag-elements-sidepane ul > li ol li a {
|
|
color: var(--bs-body-color);
|
|
text-decoration: none;
|
|
text-shadow: none;
|
|
}
|
|
.drag-elements-sidepane ul > li ol li[data-type] {
|
|
border: none;
|
|
}
|
|
.drag-elements-sidepane ul > li ol li[data-type]:hover {
|
|
cursor: grab;
|
|
cursor: -moz-grab;
|
|
cursor: -webkit-grab;
|
|
background-color: var(--bs-body-bg);
|
|
opacity: 1;
|
|
text-align: center;
|
|
}
|
|
.drag-elements-sidepane ul > li ol li[data-type]:hover .add-section-btn {
|
|
visibility: visible;
|
|
}
|
|
|
|
.sections-container {
|
|
width: 100%;
|
|
background: var(--bs-body-bg);
|
|
padding: 1rem;
|
|
}
|
|
.sections-container > div.section-item {
|
|
box-shadow: 0px 0px 1px 0px var(--bs-primary);
|
|
box-shadow: 0px 0px 1px 0px rgba(18, 83, 205, 0.7), 0px 0px 5px 0px rgba(18, 83, 205, 0.1);
|
|
box-shadow: 0px 0px 1px 2px rgba(18, 83, 205, 0.03);
|
|
border: 1px solid var(--bs-border-color);
|
|
background: var(--bs-body-bg);
|
|
margin: 0rem 0rem 1rem;
|
|
padding: 0.3rem 0.5rem 0.3rem 1.4rem;
|
|
position: relative;
|
|
border-radius: 3px;
|
|
}
|
|
.sections-container > div.section-item .controls {
|
|
cursor: pointer;
|
|
display: flex;
|
|
justify-content: space-between;
|
|
}
|
|
.sections-container > div.section-item .controls .handle {
|
|
width: 20px;
|
|
height: 10px;
|
|
position: absolute;
|
|
left: 0px;
|
|
top: 0px;
|
|
height: 100%;
|
|
cursor: grab;
|
|
}
|
|
.sections-container > div.section-item .controls .handle::after {
|
|
content: "...";
|
|
color: #bbb;
|
|
width: 5px;
|
|
font-size: 28px;
|
|
word-wrap: break-word;
|
|
line-height: 7px;
|
|
vertical-align: middle;
|
|
display: inline-block;
|
|
margin-left: 5px;
|
|
margin-top: 3px;
|
|
}
|
|
.sections-container > div.section-item .controls .name {
|
|
text-transform: capitalize;
|
|
font-weight: 400;
|
|
}
|
|
.sections-container > div.section-item .controls .type {
|
|
color: #777;
|
|
}
|
|
.sections-container > div.section-item .controls .info {
|
|
margin-left: 0.2rem;
|
|
}
|
|
.sections-container > div.section-item .controls .info .name {
|
|
font-size: 12px;
|
|
}
|
|
.sections-container > div.section-item .controls .info .type {
|
|
font-size: 11px;
|
|
}
|
|
.sections-container > div.section-item .controls .buttons {
|
|
margin-right: 2rem;
|
|
margin-top: 0.2rem;
|
|
}
|
|
.sections-container > div.section-item .controls .buttons a {
|
|
padding: 0.3rem 0.5rem 0.3rem;
|
|
display: inline-block;
|
|
}
|
|
.sections-container > div.section-item .controls .buttons a:hover {
|
|
background-color: rgba(18, 83, 205, 0.1);
|
|
text-decoration: none;
|
|
}
|
|
.sections-container > div.section-item .controls .buttons .delete-btn,
|
|
.sections-container > div.section-item .controls .buttons .up-btn,
|
|
.sections-container > div.section-item .controls .buttons .down-btn {
|
|
visibility: hidden;
|
|
}
|
|
.sections-container > div.section-item .controls .buttons:hover .delete-btn,
|
|
.sections-container > div.section-item .controls .buttons:hover .up-btn,
|
|
.sections-container > div.section-item .controls .buttons:hover .down-btn {
|
|
visibility: visible;
|
|
}
|
|
.sections-container > div.section-item.drag-over {
|
|
border: 2px dashed var(--bs-link-color);
|
|
border-radius: 5px;
|
|
}
|
|
.sections-container > div.section-item .header_check ~ label {
|
|
color: var(--bs-link-color);
|
|
display: block;
|
|
}
|
|
.sections-container > div.section-item .header_check ~ label .header-arrow {
|
|
right: 0.5rem;
|
|
top: 0.7rem;
|
|
padding: 0.1rem 0.5rem;
|
|
}
|
|
.sections-container > div.section-item .header_check ~ label .header-arrow:hover {
|
|
background: rgba(18, 83, 205, 0.1);
|
|
}
|
|
.sections-container > div.section-item .header_check ~ label .header-arrow:before {
|
|
content: "\f105";
|
|
}
|
|
.sections-container > div.section-item .header_check:checked ~ label .header-arrow:before {
|
|
content: "\f107";
|
|
}
|
|
.sections-container > div.section-item .header_check:checked ~ .tree {
|
|
display: block;
|
|
}
|
|
.sections-container > div.section-item .tree {
|
|
display: none;
|
|
border-top: 1px solid var(--bs-border-color);
|
|
padding: 0.5rem 0rem 0rem;
|
|
margin: 0.5rem 0rem 0rem;
|
|
}
|
|
.blocks .block-preview, .sections .block-preview {
|
|
position: absolute;
|
|
left: 100%;
|
|
height: auto;
|
|
z-index: 1000;
|
|
border: 1px solid var(--bs-border-color);
|
|
box-shadow: 0px 0px 1px 2px rgba(18, 83, 205, 0.05);
|
|
}
|
|
.blocks .drag-elements-sidepane li[data-type], .sections .drag-elements-sidepane li[data-type] {
|
|
width: 95%;
|
|
height: auto;
|
|
min-height: 100px;
|
|
position: relative;
|
|
text-align: center;
|
|
font-weight: normal;
|
|
font-size: 11px;
|
|
color: #000;
|
|
background-repeat: no-repeat;
|
|
padding: 0px;
|
|
margin: 1rem auto;
|
|
display: flex;
|
|
border-color: var(--bs-border-color);
|
|
border-style: solid;
|
|
border-width: 1px;
|
|
border-radius: 0px;
|
|
background-position: center;
|
|
box-shadow: 0px 1px 5px 0px rgba(var(--bs-body-color-rgb), 0.25);
|
|
box-shadow: none;
|
|
/*
|
|
border-left-width:1px;
|
|
border-top-width:1px;
|
|
*/
|
|
background-size: 100%;
|
|
z-index: 100;
|
|
background-color: var(--bs-body-bg);
|
|
cursor: grab;
|
|
opacity: 1;
|
|
margin: 0.5rem;
|
|
}
|
|
.blocks .drag-elements-sidepane li[data-type] .name, .sections .drag-elements-sidepane li[data-type] .name {
|
|
background: rgba(var(--bs-body-bg-rgb), 0.9);
|
|
background: rgba(var(--bs-body-color-rgb), 0.7);
|
|
background: rgba(var(--bs-link-color-rgb), 0.7);
|
|
background: rgba(var(--bs-body-bg-rgb), 0.9);
|
|
color: var(--bs-body-color);
|
|
padding: 0.5rem 0;
|
|
position: absolute;
|
|
bottom: 0px;
|
|
width: 100%;
|
|
left: 0;
|
|
font-size: 12px;
|
|
border-top: 1px solid rgba(var(--bs-body-color-rgb), 0.1);
|
|
}
|
|
.blocks .drag-elements-sidepane li[data-type]:hover, .sections .drag-elements-sidepane li[data-type]:hover {
|
|
border-color: var(--bs-link-color);
|
|
box-shadow: 0px 1px 5px 2px rgba(var(--bs-link-color-rgb), 0.25);
|
|
-webkit-box-shadow: 0px 1px 5px 2px rgba(var(--bs-link-color-rgb), 0.25);
|
|
}
|
|
.blocks .drag-elements-sidepane li[data-type]:hover:before, .sections .drag-elements-sidepane li[data-type]:hover:before {
|
|
opacity: 0.1;
|
|
}
|
|
.blocks .drag-elements-sidepane li[data-type]:hover .name, .sections .drag-elements-sidepane li[data-type]:hover .name {
|
|
visibility: visible;
|
|
}
|
|
.blocks .drag-elements-sidepane li[data-type][data-section=Reusable] .name, .sections .drag-elements-sidepane li[data-type][data-section=Reusable] .name {
|
|
visibility: visible;
|
|
}
|
|
.blocks .drag-elements-sidepane li[data-type]:before, .sections .drag-elements-sidepane li[data-type]:before {
|
|
content: " ";
|
|
background: var(--bs-body-bg);
|
|
background: var(--bs-primary);
|
|
width: 100%;
|
|
height: 100%;
|
|
position: absolute;
|
|
top: 0;
|
|
left: 0;
|
|
opacity: 0;
|
|
transition: opacity 0.5s;
|
|
}
|
|
.blocks .drag-elements-sidepane li[data-type] img.preview, .sections .drag-elements-sidepane li[data-type] img.preview {
|
|
max-width: 100%;
|
|
}
|
|
.blocks .drag-elements-sidepane li[data-type] .name, .sections .drag-elements-sidepane li[data-type] .name {
|
|
visibility: hidden;
|
|
}
|
|
|
|
.blocks .drag-elements-sidepane li[data-type] {
|
|
width: 44%;
|
|
box-shadow: 0px 1px 4px 0px rgba(var(--bs-body-color-rgb), 0.05);
|
|
-webkit-box-shadow: 0px 1px 4px 0px rgba(var(--bs-body-color-rgb), 0.05);
|
|
}
|
|
|
|
.components .drag-elements-sidepane li[data-type],
|
|
#add-section-box li[data-type] {
|
|
width: var(--builder-component-list-element-width);
|
|
min-width: 80px;
|
|
height: 80px;
|
|
margin: 0% 1% 3% 3%;
|
|
text-align: center;
|
|
font-weight: normal;
|
|
font-size: 11px;
|
|
color: #000;
|
|
background-repeat: no-repeat;
|
|
padding-top: 60px;
|
|
padding-bottom: 7px;
|
|
padding: 50px 5px 7px 5px;
|
|
border-style: solid;
|
|
border-width: 1px;
|
|
border-radius: 3px;
|
|
/*
|
|
border-left-width:1px;
|
|
border-top-width:1px;
|
|
*/
|
|
background-color: var(--bs-white);
|
|
border-color: var(--bs-border-color);
|
|
border-color: rgba(var(--bs-secondary-rgb), 0.25);
|
|
background-position: 50% 20%;
|
|
background-size: auto 42px;
|
|
z-index: 100;
|
|
cursor: move;
|
|
cursor: grab;
|
|
box-shadow: 0px 1px 4px 0px rgba(var(--bs-body-color-rgb), 0.05);
|
|
box-shadow: none;
|
|
}
|
|
.components .drag-elements-sidepane li[data-type] a, .components .drag-elements-sidepane li[data-type] span,
|
|
#add-section-box li[data-type] a,
|
|
#add-section-box li[data-type] span {
|
|
min-height: 20px;
|
|
white-space: break-spaces;
|
|
padding: 0 3px;
|
|
}
|
|
html[data-bs-theme=dark] .components .drag-elements-sidepane li[data-type][data-drag-type=component],
|
|
html[data-bs-theme=dark] #add-section-box li[data-type][data-drag-type=component] {
|
|
border-color: var(--bs-gray-500);
|
|
filter: invert(93%) hue-rotate(180deg);
|
|
background-color: transparent;
|
|
}
|
|
html[data-bs-theme=dark] .components .drag-elements-sidepane li[data-type][data-drag-type=component] a,
|
|
html[data-bs-theme=dark] #add-section-box li[data-type][data-drag-type=component] a {
|
|
color: var(--bs-gray-900);
|
|
}
|
|
.components .drag-elements-sidepane li[data-type]:hover,
|
|
#add-section-box li[data-type]:hover {
|
|
box-shadow: 0px 0px 1px 0px var(--bs-primary);
|
|
background-color: rgba(var(--bs-primary-rgb), 0.05) !important;
|
|
border-color: rgba(var(--bs-primary-rgb), 0.5) !important;
|
|
}
|
|
.components .drag-elements-sidepane li[data-type]:hover a,
|
|
#add-section-box li[data-type]:hover a {
|
|
color: var(--bs-primary);
|
|
}
|
|
|
|
/*
|
|
#right-panel
|
|
{
|
|
*/
|
|
.header-arrow {
|
|
padding: 0.3rem 0.7rem;
|
|
cursor: pointer;
|
|
position: absolute;
|
|
right: 15px;
|
|
top: 0.5rem;
|
|
}
|
|
label.header {
|
|
font-size: 11px;
|
|
font-weight: 500;
|
|
height: auto;
|
|
margin: 0;
|
|
padding: 0;
|
|
width: 100%;
|
|
line-height: 32px;
|
|
text-align: left;
|
|
padding: 0.3rem 0.8rem;
|
|
border-top: 1px solid var(--bs-border-color);
|
|
color: var(--bs-body-color);
|
|
cursor: pointer;
|
|
position: relative;
|
|
}
|
|
.component-properties .tab-pane div:first-child > label.header {
|
|
margin-top: 0rem !important;
|
|
border-top: none;
|
|
}
|
|
label.header :checked {
|
|
color: red;
|
|
}
|
|
|
|
input.header_check {
|
|
position: absolute;
|
|
left: 0;
|
|
margin-left: 0;
|
|
opacity: 0;
|
|
z-index: 2;
|
|
cursor: pointer;
|
|
height: 1em;
|
|
width: 1em;
|
|
top: 0;
|
|
}
|
|
|
|
input.header_check:checked + div.section,
|
|
li.header > input.header_check:checked + ol {
|
|
opacity: 1;
|
|
padding: 0 1rem;
|
|
height: auto;
|
|
}
|
|
|
|
div.section, .header > ol {
|
|
height: 0;
|
|
overflow: hidden;
|
|
opacity: 0;
|
|
transition: height, opacity 0.5s;
|
|
}
|
|
|
|
#right-panel label.header .header-arrow {
|
|
right: 0px;
|
|
}
|
|
|
|
.toggle {
|
|
position: relative;
|
|
width: 65px;
|
|
-webkit-user-select: none;
|
|
-moz-user-select: none;
|
|
-ms-user-select: none;
|
|
}
|
|
|
|
.toggle-checkbox {
|
|
display: none;
|
|
}
|
|
|
|
.toggle-label {
|
|
display: block;
|
|
overflow: hidden;
|
|
cursor: pointer;
|
|
border: 2px solid var(--bs-body-bg);
|
|
border-radius: 30px;
|
|
}
|
|
|
|
.toggle-inner {
|
|
display: block;
|
|
width: 200%;
|
|
margin-left: -100%;
|
|
transition: margin 0.3s ease-in 0s;
|
|
}
|
|
|
|
.toggle-inner:before, .toggle-inner:after {
|
|
display: block;
|
|
float: left;
|
|
width: 50%;
|
|
height: 20px;
|
|
padding: 0;
|
|
line-height: 20px;
|
|
font-size: 12px;
|
|
color: white;
|
|
font-family: Trebuchet, Arial, sans-serif;
|
|
font-weight: bold;
|
|
box-sizing: border-box;
|
|
}
|
|
|
|
.toggle-inner:before {
|
|
content: "ON";
|
|
padding-left: 14px;
|
|
background-color: var(--bs-link-color);
|
|
}
|
|
|
|
.toggle-inner:after {
|
|
content: "OFF";
|
|
padding-right: 14px;
|
|
background-color: #999999;
|
|
color: var(--bs-body-color);
|
|
text-align: right;
|
|
}
|
|
|
|
.toggle-switch {
|
|
display: block;
|
|
width: 18px;
|
|
margin: 4px;
|
|
background: var(--bs-body-bg);
|
|
position: absolute;
|
|
top: 0;
|
|
bottom: 0;
|
|
right: 39px;
|
|
border: 2px solid var(--bs-body-bg);
|
|
border-radius: 30px;
|
|
transition: all 0.3s ease-in 0s;
|
|
}
|
|
|
|
.toggle-checkbox:checked + .toggle-label .toggle-inner {
|
|
margin-left: 0;
|
|
}
|
|
|
|
.toggle-checkbox:checked + .toggle-label .toggle-switch {
|
|
right: 0px;
|
|
}
|
|
|
|
.form-select {
|
|
-webkit-appearance: none;
|
|
-moz-appearance: none;
|
|
box-shadow: rgba(var(--bs-body-color-rgb), 0.08) 0px 1px 2px 0px;
|
|
}
|
|
|
|
/*
|
|
input[type="number"] {
|
|
-moz-appearance: textfield;
|
|
-webkit-appearance: textfield;
|
|
appearance: textfield;
|
|
padding-right: 0.5rem;
|
|
padding-left: 0.5rem;
|
|
}
|
|
|
|
input[type="number"]:hover,
|
|
input[type="number"]:focus {
|
|
-moz-appearance: auto;
|
|
-webkit-appearance: auto;
|
|
appearance: auto;
|
|
}
|
|
*/
|
|
.form-select.small-arrow {
|
|
background-position: right 0.5rem center;
|
|
background-size: 10px 8px;
|
|
}
|
|
|
|
.input-group.css-unit input[type=number] {
|
|
flex-grow: 5;
|
|
}
|
|
.input-group.css-unit .form-select.small-arrow {
|
|
padding-left: 0.5rem;
|
|
padding-right: 1.2em;
|
|
min-width: 3rem;
|
|
}
|
|
|
|
.input-group.auto input[type=number] {
|
|
display: none;
|
|
}
|
|
|
|
.input-group.auto .input-group-append {
|
|
width: 100%;
|
|
}
|
|
.input-group.auto .input-group-append .form-select.small-arrow {
|
|
max-width: 100%;
|
|
}
|
|
|
|
.btn-group.btn-group-fullwidth {
|
|
display: flex;
|
|
width: 100%;
|
|
}
|
|
|
|
.btn-group.btn-group-fullwidth .btn {
|
|
flex: 1 1 auto;
|
|
}
|
|
|
|
.btn-group-sm > .btn {
|
|
font-size: 12px;
|
|
}
|
|
|
|
.btn-group .btn.btn-gray.active {
|
|
background-color: var(--bs-border-color);
|
|
}
|
|
|
|
.form-control::placeholder {
|
|
opacity: 0.7;
|
|
}
|
|
|
|
.btn-link:hover {
|
|
text-decoration: none;
|
|
}
|
|
|
|
/*
|
|
.btn-light:not(:disabled):not(.disabled):active, .btn-light:not(:disabled):not(.disabled).active, .show > .btn-light.dropdown-toggle {
|
|
box-shadow: 0px 0px 1px 0px rgba( 255,255,255, 0.1);
|
|
background-color:rgba($builder-background-color, 0.07);
|
|
border-radius:0px;
|
|
border-color: transparent;
|
|
&:focus {
|
|
box-shadow: 0px 0px 1px 0px rgba($builder-background-color, 0.2);
|
|
}
|
|
}
|
|
*/
|
|
.input-list-select .elements {
|
|
max-height: 300px;
|
|
overflow-y: auto;
|
|
box-shadow: 1px 1px 3px 0px rgba(var(--bs-body-color-rgb), 0.05) inset;
|
|
border: 1px solid #ced4da;
|
|
padding: 0.3rem;
|
|
}
|
|
.input-list-select .elements .row {
|
|
--bs-gutter-y:0.5rem;
|
|
--bs-gutter-x:0.5rem;
|
|
}
|
|
.input-list-select .elements .element {
|
|
border: 1px solid #ced4da;
|
|
box-shadow: 1px 1px 3px 0px rgba(var(--bs-body-color-rgb), 0.05) inset;
|
|
padding: 0.2rem;
|
|
height: 100%;
|
|
text-align: center;
|
|
}
|
|
.input-list-select .elements .element:hover {
|
|
border-color: var(--bs-link-color);
|
|
color: var(--bs-link-color);
|
|
}
|
|
.input-list-select .elements .element label {
|
|
display: block;
|
|
font-size: 11px;
|
|
}
|
|
|
|
#accordionSections .card {
|
|
border-color: rgba(18, 83, 205, 0.1);
|
|
}
|
|
#accordionSections .card .card-header {
|
|
background: rgba(18, 83, 205, 0.05);
|
|
border: none;
|
|
padding: 0rem;
|
|
}
|
|
#accordionSections .card .card-header button {
|
|
font-size: 13px;
|
|
text-align: left;
|
|
padding: 0.5rem;
|
|
border-bottom: 1px solid rgba(18, 83, 205, 0.2);
|
|
}
|
|
#accordionSections .card .card-header button:focus {
|
|
text-decoration: none;
|
|
}
|
|
#accordionSections .card .card-header button .header-arrow {
|
|
padding: 0.2rem;
|
|
}
|
|
|
|
#sections-list {
|
|
background: var(--bs-body-bg);
|
|
}
|
|
|
|
.sections-tabs .nav-link span, .component-properties .nav-link span {
|
|
font-size: 12px;
|
|
}
|
|
|
|
.add-section-btn {
|
|
position: relative;
|
|
bottom: 0px;
|
|
background: var(--bs-primary);
|
|
color: var(--bs-white);
|
|
font-size: 18px;
|
|
border-radius: 24px;
|
|
width: 32px;
|
|
height: 32px;
|
|
padding: 3px 7px;
|
|
cursor: pointer;
|
|
display: block;
|
|
box-shadow: 0px 0px 1px 2px rgba(18, 83, 205, 0.05);
|
|
box-shadow: 0px 3px 7px 1px rgba(var(--bs-body-color-rgb), 0.1), 1px 2px 7px 1px rgba(255, 255, 255, 0.1) inset;
|
|
margin: auto;
|
|
position: absolute;
|
|
font-size: 21px;
|
|
width: 36px;
|
|
height: 36px;
|
|
line-height: 36px;
|
|
visibility: hidden;
|
|
top: 50%;
|
|
left: 50%;
|
|
margin-top: -18px;
|
|
margin-left: -18px;
|
|
border-color: var(--bs-link-color);
|
|
}
|
|
.add-section-btn i {
|
|
font-weight: 600;
|
|
}
|
|
.add-section-btn:hover {
|
|
text-decoration: none;
|
|
filter: brightness(1.2);
|
|
}
|
|
.add-section-btn i {
|
|
color: var(--bs-body-bg);
|
|
}
|
|
|
|
.animation-container {
|
|
width: 200px;
|
|
height: 200px;
|
|
position: absolute;
|
|
top: 50%;
|
|
left: 50%;
|
|
transform: translate(-50%, -50%);
|
|
margin: auto;
|
|
filter: url("#goo");
|
|
animation: rotate-move 2s ease-in-out infinite;
|
|
}
|
|
|
|
.dot {
|
|
width: 50px;
|
|
height: 50px;
|
|
border-radius: 50%;
|
|
background-color: rgba(var(--bs-body-bg-rgb), 0.7);
|
|
position: absolute;
|
|
top: 0;
|
|
bottom: 0;
|
|
left: 0;
|
|
right: 0;
|
|
margin: auto;
|
|
line-height: 49px;
|
|
text-align: center;
|
|
}
|
|
|
|
.dot-3 {
|
|
background-color: var(--bs-link-color);
|
|
animation: dot-3-move 2s ease infinite, index 6s ease infinite;
|
|
}
|
|
|
|
.dot-2 {
|
|
background-color: #198754;
|
|
animation: dot-2-move 2s ease infinite, index 6s -4s ease infinite;
|
|
}
|
|
|
|
.dot-1 {
|
|
background-color: #dc3545;
|
|
animation: dot-1-move 2s ease infinite, index 6s -2s ease infinite;
|
|
}
|
|
|
|
@keyframes dot-3-move {
|
|
20% {
|
|
transform: scale(1);
|
|
}
|
|
45% {
|
|
transform: translateY(-18px) scale(0.45);
|
|
}
|
|
60% {
|
|
transform: translateY(-90px) scale(0.45);
|
|
}
|
|
80% {
|
|
transform: translateY(-90px) scale(0.45);
|
|
}
|
|
100% {
|
|
transform: translateY(0px) scale(1);
|
|
}
|
|
}
|
|
@keyframes dot-2-move {
|
|
20% {
|
|
transform: scale(1);
|
|
}
|
|
45% {
|
|
transform: translate(-16px, 12px) scale(0.45);
|
|
}
|
|
60% {
|
|
transform: translate(-80px, 80px) scale(0.45);
|
|
}
|
|
80% {
|
|
transform: translate(-80px, 80px) scale(0.45);
|
|
}
|
|
100% {
|
|
transform: translateY(0px) scale(1);
|
|
}
|
|
}
|
|
@keyframes dot-1-move {
|
|
20% {
|
|
transform: scale(1);
|
|
}
|
|
45% {
|
|
transform: translate(16px, 12px) scale(0.45);
|
|
}
|
|
60% {
|
|
transform: translate(80px, 70px) scale(0.45);
|
|
}
|
|
80% {
|
|
transform: translate(80px, 60px) scale(0.45);
|
|
}
|
|
100% {
|
|
transform: translateY(0px) scale(1);
|
|
}
|
|
}
|
|
@keyframes rotate-move {
|
|
55% {
|
|
transform: translate(-50%, -50%) rotate(0deg);
|
|
}
|
|
80% {
|
|
transform: translate(-50%, -50%) rotate(360deg);
|
|
}
|
|
100% {
|
|
transform: translate(-50%, -50%) rotate(360deg);
|
|
}
|
|
}
|
|
@keyframes index {
|
|
0%, 100% {
|
|
z-index: 3;
|
|
}
|
|
33.3% {
|
|
z-index: 2;
|
|
}
|
|
66.6% {
|
|
z-index: 1;
|
|
}
|
|
}
|
|
input[type=color] {
|
|
width: 24px;
|
|
height: 24px;
|
|
border-radius: 3px;
|
|
padding: 2px;
|
|
box-shadow: none;
|
|
}
|
|
input[type=color].form-control-color::-moz-color-swatch {
|
|
min-width: 17px;
|
|
min-height: 17px;
|
|
border-radius: 3px;
|
|
box-shadow: 1px 1px 5px 0px rgba(var(--bs-body-color-rgb), 0.25);
|
|
border: none;
|
|
}
|
|
input[type=color].form-control-color::-webkit-color-swatch {
|
|
min-width: 17px;
|
|
min-height: 17px;
|
|
border-radius: 3px;
|
|
box-shadow: 1px 1px 5px 0px rgba(var(--bs-body-color-rgb), 0.25);
|
|
border: none;
|
|
}
|
|
|
|
.breadcrumb-navigator {
|
|
min-height: 30px;
|
|
font-size: 12px;
|
|
}
|
|
.breadcrumb-navigator .breadcrumb {
|
|
padding: 0.5rem 0.7rem;
|
|
margin: 0;
|
|
}
|
|
.breadcrumb-navigator .breadcrumb .breadcrumb-item a {
|
|
color: var(--bs-body-color);
|
|
background: rgba(var(--bs-secondary-color-rgb), 0.03);
|
|
padding: 0.2rem 0.4rem;
|
|
border-radius: 4px;
|
|
border: 1px solid var(--bs-border-color);
|
|
text-decoration: none;
|
|
}
|
|
.breadcrumb-navigator .breadcrumb .breadcrumb-item a:hover {
|
|
background: rgba(var(--bs-link-color-rgb), 0.05);
|
|
border: 1px solid rgba(var(--bs-link-color-rgb), 0.2);
|
|
text-decoration: none;
|
|
}
|
|
.breadcrumb-navigator .breadcrumb .breadcrumb-item a.el-component {
|
|
border-color: var(--bs-primary-bg-subtle);
|
|
background-color: rgba(var(--bs-primary-rgb), 0.07);
|
|
}
|
|
.breadcrumb-navigator .breadcrumb .breadcrumb-item a.el-attribute {
|
|
border-color: var(--bs-success-bg-subtle);
|
|
background-color: rgba(var(--bs-success-rgb), 0.07);
|
|
}
|
|
|
|
#dragElement-clone {
|
|
background: rgba(var(--bs-body-bg-rgb), 0.5);
|
|
border: 1px solid rgba(var(--bs-body-color-rgb), 0.15);
|
|
border-radius: 4px;
|
|
pointer-events: none;
|
|
}
|
|
|
|
@keyframes popup-animation {
|
|
0% {
|
|
transform: translateY(-3rem) scaleY(0) scaleX(0);
|
|
}
|
|
to {
|
|
transform: translateY(0) scaleY(1) scaleX(1);
|
|
}
|
|
}
|
|
/* input-html-list-select */
|
|
.input-html-list-select .elements {
|
|
margin-top: 5px;
|
|
max-height: 300px;
|
|
overflow-y: auto;
|
|
overflow-x: hidden;
|
|
border: 1px solid var(--bs-border-color);
|
|
}
|
|
.input-html-list-select .elements li {
|
|
cursor: pointer;
|
|
}
|
|
|
|
.tab-content {
|
|
height: 100%;
|
|
display: flex;
|
|
flex-direction: column;
|
|
}
|
|
.tab-content > .active {
|
|
display: flex;
|
|
flex-direction: column;
|
|
height: 100%;
|
|
}
|
|
|
|
img.preview {
|
|
max-width: 100%;
|
|
margin: auto;
|
|
}
|
|
|
|
.hint {
|
|
position: relative;
|
|
/*
|
|
input:hover + &,
|
|
select:focus + &, */
|
|
}
|
|
.hint:before {
|
|
position: absolute;
|
|
bottom: 100%;
|
|
margin-bottom: -11px;
|
|
left: calc(50% - 6px);
|
|
content: "";
|
|
z-index: 1000001;
|
|
transform: translateY(-18px);
|
|
visibility: hidden;
|
|
opacity: 0;
|
|
z-index: 1000000;
|
|
pointer-events: none;
|
|
transition: 0.3s ease;
|
|
transition-delay: 0s;
|
|
border: 6px solid transparent;
|
|
border-top-color: rgba(var(--bs-body-color-rgb), 0.9);
|
|
}
|
|
.hint:after {
|
|
content: attr(aria-label);
|
|
bottom: 100%;
|
|
left: 50%;
|
|
background: rgba(var(--bs-body-color-rgb), 0.9);
|
|
color: var(--bs-body-bg);
|
|
padding: 8px 10px;
|
|
font-size: 12px;
|
|
font-family: "Helvetica Neue", Helvetica, Arial, sans-serif;
|
|
line-height: 12px;
|
|
white-space: nowrap;
|
|
text-shadow: 0 -1px 0 #000;
|
|
box-shadow: rgba(var(--bs-body-color-rgb), 0.3);
|
|
position: absolute;
|
|
transform: translateX(-50%);
|
|
visibility: hidden;
|
|
opacity: 0;
|
|
z-index: 1000000;
|
|
pointer-events: none;
|
|
transition: 0.3s ease;
|
|
transition-delay: 0s;
|
|
}
|
|
.hint:hover:before, .hint:hover:after {
|
|
visibility: visible;
|
|
opacity: 1;
|
|
transition-delay: 0.1s;
|
|
transform: translateX(-50%) translateY(-8px);
|
|
}
|
|
.hint:hover:before {
|
|
transform: translateY(-8px);
|
|
}
|
|
|
|
/*
|
|
.btn-light {
|
|
--bs-btn-bg:transparent;
|
|
border-color:transparent;
|
|
color:var(--bs-body-bg);
|
|
&:hover {
|
|
//background-color:var(--bs-border-color);
|
|
}
|
|
}
|
|
*/
|
|
.btn-outline-primary {
|
|
--bs-btn-color: var(--bs-link-color);
|
|
}
|
|
|
|
.form-switch-lg {
|
|
font-size: 1rem;
|
|
min-height: 1rem;
|
|
}
|
|
|
|
#tree-list {
|
|
position: absolute;
|
|
top: 10%;
|
|
left: 80%;
|
|
left: calc(100% - 300px);
|
|
border-radius: 2px;
|
|
z-index: 100;
|
|
width: 250px;
|
|
min-width: 250px;
|
|
min-height: 250px;
|
|
height: 500px;
|
|
resize: both;
|
|
overflow: hidden;
|
|
border: 1px solid rgba(var(--bs-body-color-rgb), 0.1);
|
|
box-shadow: 0px 1px 5px 0px rgba(var(--bs-body-color-rgb), 0.05);
|
|
background: var(--bs-body-bg);
|
|
}
|
|
#tree-list .header {
|
|
display: flex;
|
|
justify-content: space-between;
|
|
height: 30px;
|
|
font-size: 12px;
|
|
color: rgba(var(--bs-body-color-rgb), 0.7);
|
|
border-bottom: 1px solid var(--bs-border-color);
|
|
cursor: grabbing;
|
|
}
|
|
#tree-list .header > div {
|
|
padding: 0.4rem 1rem;
|
|
}
|
|
#tree-list .header > div:before {
|
|
content: "....";
|
|
opacity: 0.5;
|
|
width: 15px;
|
|
top: 0;
|
|
font-size: 28px;
|
|
word-wrap: break-word;
|
|
line-height: 7px;
|
|
vertical-align: middle;
|
|
display: inline-block;
|
|
margin-right: 10px;
|
|
margin-top: -1rem;
|
|
}
|
|
#tree-list .tree {
|
|
padding: 1rem;
|
|
overflow: auto;
|
|
width: 100%;
|
|
height: 100%;
|
|
height: calc(100% - 30px);
|
|
}
|
|
#tree-list .tree label.active {
|
|
border: 1px solid rgba(var(--bs-primary-rgb), 0.15);
|
|
background-color: rgba(var(--bs-primary-rgb), 0.05);
|
|
}
|
|
#tree-list .tree > ol li input {
|
|
height: 2.4em;
|
|
width: 4em;
|
|
}
|
|
#tree-list .tree > ol li input:checked + ol {
|
|
padding: 2rem 0 0 1.5rem;
|
|
}
|
|
#tree-list .tree > ol li.file > label {
|
|
margin-left: 18px;
|
|
}
|
|
|
|
.percent {
|
|
display: inline-block;
|
|
position: relative;
|
|
}
|
|
|
|
.percent input {
|
|
width: 50px;
|
|
height: 29px;
|
|
width: 65px;
|
|
margin-top: 2px;
|
|
font-size: 14px;
|
|
text-align: right;
|
|
/*
|
|
-moz-appearance: textfield;
|
|
-webkit-appearance: textfield;
|
|
appearance: textfield;
|
|
*/
|
|
}
|
|
|
|
.percent:hover::after,
|
|
.percent:focus-within::after {
|
|
display: none;
|
|
}
|
|
|
|
/*
|
|
.percent input[type="number"]:hover,
|
|
.percent input[type="number"]:focus {
|
|
-moz-appearance: auto;
|
|
-webkit-appearance: auto;
|
|
appearance: auto;
|
|
}
|
|
*/
|
|
.percent::after {
|
|
font-size: 12px;
|
|
position: absolute;
|
|
top: 0.5rem;
|
|
right: 0.9em;
|
|
transition: all 0.05s ease-in-out;
|
|
content: "%";
|
|
}
|
|
|
|
/* Variable fonts usage: */
|
|
:root {
|
|
font-family: "Inter", sans-serif;
|
|
}
|
|
|
|
@supports (font-variation-settings: normal) {
|
|
:root {
|
|
--bs-font-sans-serif: "InterVariable", system-ui, -apple-system, "Segoe UI", Roboto, "Helvetica Neue", Arial, "Noto Sans", "Liberation Sans", sans-serif, "Apple Color Emoji", "Segoe UI Emoji", "Segoe UI Symbol", "Noto Color Emoji";
|
|
font-optical-sizing: auto;
|
|
}
|
|
}
|
|
@font-face {
|
|
font-family: InterVariable;
|
|
font-style: normal;
|
|
font-weight: 100 900;
|
|
font-display: swap;
|
|
src: url("../../../fonts/inter/InterVariable.woff2") format("woff2");
|
|
}
|
|
@font-face {
|
|
font-family: InterVariable;
|
|
font-style: italic;
|
|
font-weight: 100 900;
|
|
font-display: swap;
|
|
src: url("../../../fonts/inter/InterVariable-Italic.woff2") format("woff2");
|
|
}
|
|
/* static fonts */
|
|
@font-face {
|
|
font-family: "Inter";
|
|
font-style: normal;
|
|
font-weight: 100;
|
|
font-display: swap;
|
|
src: url("../../../fonts/inter/Inter-Thin.woff2") format("woff2");
|
|
}
|
|
@font-face {
|
|
font-family: "Inter";
|
|
font-style: italic;
|
|
font-weight: 100;
|
|
font-display: swap;
|
|
src: url("../../../fonts/inter/Inter-ThinItalic.woff2") format("woff2");
|
|
}
|
|
@font-face {
|
|
font-family: "Inter";
|
|
font-style: normal;
|
|
font-weight: 200;
|
|
font-display: swap;
|
|
src: url("../../../fonts/inter/Inter-ExtraLight.woff2") format("woff2");
|
|
}
|
|
@font-face {
|
|
font-family: "Inter";
|
|
font-style: italic;
|
|
font-weight: 200;
|
|
font-display: swap;
|
|
src: url("../../../fonts/inter/Inter-ExtraLightItalic.woff2") format("woff2");
|
|
}
|
|
@font-face {
|
|
font-family: "Inter";
|
|
font-style: normal;
|
|
font-weight: 300;
|
|
font-display: swap;
|
|
src: url("../../../fonts/inter/Inter-Light.woff2") format("woff2");
|
|
}
|
|
@font-face {
|
|
font-family: "Inter";
|
|
font-style: italic;
|
|
font-weight: 300;
|
|
font-display: swap;
|
|
src: url("../../../fonts/inter/Inter-LightItalic.woff2") format("woff2");
|
|
}
|
|
@font-face {
|
|
font-family: "Inter";
|
|
font-style: normal;
|
|
font-weight: 400;
|
|
font-display: swap;
|
|
src: url("../../../fonts/inter/Inter-Regular.woff2") format("woff2");
|
|
}
|
|
@font-face {
|
|
font-family: "Inter";
|
|
font-style: italic;
|
|
font-weight: 400;
|
|
font-display: swap;
|
|
src: url("../../../fonts/inter/Inter-Italic.woff2") format("woff2");
|
|
}
|
|
@font-face {
|
|
font-family: "Inter";
|
|
font-style: normal;
|
|
font-weight: 500;
|
|
font-display: swap;
|
|
src: url("../../../fonts/inter/Inter-Medium.woff2") format("woff2");
|
|
}
|
|
@font-face {
|
|
font-family: "Inter";
|
|
font-style: italic;
|
|
font-weight: 500;
|
|
font-display: swap;
|
|
src: url("../../../fonts/inter/Inter-MediumItalic.woff2") format("woff2");
|
|
}
|
|
@font-face {
|
|
font-family: "Inter";
|
|
font-style: normal;
|
|
font-weight: 600;
|
|
font-display: swap;
|
|
src: url("../../../fonts/inter/Inter-SemiBold.woff2") format("woff2");
|
|
}
|
|
@font-face {
|
|
font-family: "Inter";
|
|
font-style: italic;
|
|
font-weight: 600;
|
|
font-display: swap;
|
|
src: url("../../../fonts/inter/Inter-SemiBoldItalic.woff2") format("woff2");
|
|
}
|
|
@font-face {
|
|
font-family: "Inter";
|
|
font-style: normal;
|
|
font-weight: 700;
|
|
font-display: swap;
|
|
src: url("../../../fonts/inter/Inter-Bold.woff2") format("woff2");
|
|
}
|
|
@font-face {
|
|
font-family: "Inter";
|
|
font-style: italic;
|
|
font-weight: 700;
|
|
font-display: swap;
|
|
src: url("../../../fonts/inter/Inter-BoldItalic.woff2") format("woff2");
|
|
}
|
|
@font-face {
|
|
font-family: "Inter";
|
|
font-style: normal;
|
|
font-weight: 800;
|
|
font-display: swap;
|
|
src: url("../../../fonts/inter/Inter-ExtraBold.woff2") format("woff2");
|
|
}
|
|
@font-face {
|
|
font-family: "Inter";
|
|
font-style: italic;
|
|
font-weight: 800;
|
|
font-display: swap;
|
|
src: url("../../../fonts/inter/Inter-ExtraBoldItalic.woff2") format("woff2");
|
|
}
|
|
@font-face {
|
|
font-family: "Inter";
|
|
font-style: normal;
|
|
font-weight: 900;
|
|
font-display: swap;
|
|
src: url("../../../fonts/inter/Inter-Black.woff2") format("woff2");
|
|
}
|
|
@font-face {
|
|
font-family: "Inter";
|
|
font-style: italic;
|
|
font-weight: 900;
|
|
font-display: swap;
|
|
src: url("../../../fonts/inter/Inter-BlackItalic.woff2") format("woff2");
|
|
}
|
|
@font-face {
|
|
font-family: "InterDisplay";
|
|
font-style: normal;
|
|
font-weight: 100;
|
|
font-display: swap;
|
|
src: url("../../../fonts/inter/InterDisplay-Thin.woff2") format("woff2");
|
|
}
|
|
@font-face {
|
|
font-family: "InterDisplay";
|
|
font-style: italic;
|
|
font-weight: 100;
|
|
font-display: swap;
|
|
src: url("../../../fonts/inter/InterDisplay-ThinItalic.woff2") format("woff2");
|
|
}
|
|
@font-face {
|
|
font-family: "InterDisplay";
|
|
font-style: normal;
|
|
font-weight: 200;
|
|
font-display: swap;
|
|
src: url("../../../fonts/inter/InterDisplay-ExtraLight.woff2") format("woff2");
|
|
}
|
|
@font-face {
|
|
font-family: "InterDisplay";
|
|
font-style: italic;
|
|
font-weight: 200;
|
|
font-display: swap;
|
|
src: url("../../../fonts/inter/InterDisplay-ExtraLightItalic.woff2") format("woff2");
|
|
}
|
|
@font-face {
|
|
font-family: "InterDisplay";
|
|
font-style: normal;
|
|
font-weight: 300;
|
|
font-display: swap;
|
|
src: url("../../../fonts/inter/InterDisplay-Light.woff2") format("woff2");
|
|
}
|
|
@font-face {
|
|
font-family: "InterDisplay";
|
|
font-style: italic;
|
|
font-weight: 300;
|
|
font-display: swap;
|
|
src: url("../../../fonts/inter/InterDisplay-LightItalic.woff2") format("woff2");
|
|
}
|
|
@font-face {
|
|
font-family: "InterDisplay";
|
|
font-style: normal;
|
|
font-weight: 400;
|
|
font-display: swap;
|
|
src: url("../../../fonts/inter/InterDisplay-Regular.woff2") format("woff2");
|
|
}
|
|
@font-face {
|
|
font-family: "InterDisplay";
|
|
font-style: italic;
|
|
font-weight: 400;
|
|
font-display: swap;
|
|
src: url("../../../fonts/inter/InterDisplay-Italic.woff2") format("woff2");
|
|
}
|
|
@font-face {
|
|
font-family: "InterDisplay";
|
|
font-style: normal;
|
|
font-weight: 500;
|
|
font-display: swap;
|
|
src: url("../../../fonts/inter/InterDisplay-Medium.woff2") format("woff2");
|
|
}
|
|
@font-face {
|
|
font-family: "InterDisplay";
|
|
font-style: italic;
|
|
font-weight: 500;
|
|
font-display: swap;
|
|
src: url("../../../fonts/inter/InterDisplay-MediumItalic.woff2") format("woff2");
|
|
}
|
|
@font-face {
|
|
font-family: "InterDisplay";
|
|
font-style: normal;
|
|
font-weight: 600;
|
|
font-display: swap;
|
|
src: url("../../../fonts/inter/InterDisplay-SemiBold.woff2") format("woff2");
|
|
}
|
|
@font-face {
|
|
font-family: "InterDisplay";
|
|
font-style: italic;
|
|
font-weight: 600;
|
|
font-display: swap;
|
|
src: url("../../../fonts/inter/InterDisplay-SemiBoldItalic.woff2") format("woff2");
|
|
}
|
|
@font-face {
|
|
font-family: "InterDisplay";
|
|
font-style: normal;
|
|
font-weight: 700;
|
|
font-display: swap;
|
|
src: url("../../../fonts/inter/InterDisplay-Bold.woff2") format("woff2");
|
|
}
|
|
@font-face {
|
|
font-family: "InterDisplay";
|
|
font-style: italic;
|
|
font-weight: 700;
|
|
font-display: swap;
|
|
src: url("../../../fonts/inter/InterDisplay-BoldItalic.woff2") format("woff2");
|
|
}
|
|
@font-face {
|
|
font-family: "InterDisplay";
|
|
font-style: normal;
|
|
font-weight: 800;
|
|
font-display: swap;
|
|
src: url("../../../fonts/inter/InterDisplay-ExtraBold.woff2") format("woff2");
|
|
}
|
|
@font-face {
|
|
font-family: "InterDisplay";
|
|
font-style: italic;
|
|
font-weight: 800;
|
|
font-display: swap;
|
|
src: url("../../../fonts/inter/InterDisplay-ExtraBoldItalic.woff2") format("woff2");
|
|
}
|
|
@font-face {
|
|
font-family: "InterDisplay";
|
|
font-style: normal;
|
|
font-weight: 900;
|
|
font-display: swap;
|
|
src: url("../../../fonts/inter/InterDisplay-Black.woff2") format("woff2");
|
|
}
|
|
@font-face {
|
|
font-family: "InterDisplay";
|
|
font-style: italic;
|
|
font-weight: 900;
|
|
font-display: swap;
|
|
src: url("../../../fonts/inter/InterDisplay-BlackItalic.woff2") format("woff2");
|
|
}
|
|
@font-feature-values InterVariable {
|
|
@character-variant {
|
|
cv01: 1;
|
|
cv02: 2;
|
|
cv03: 3;
|
|
cv04: 4;
|
|
cv05: 5;
|
|
cv06: 6;
|
|
cv07: 7;
|
|
cv08: 8;
|
|
cv09: 9;
|
|
cv10: 10;
|
|
cv11: 11;
|
|
cv12: 12;
|
|
cv13: 13;
|
|
alt-1: 1; /* Alternate one */
|
|
alt-3: 9; /* Flat-top three */
|
|
open-4: 2; /* Open four */
|
|
open-6: 3; /* Open six */
|
|
open-9: 4; /* Open nine */
|
|
lc-l-with-tail: 5; /* Lower-case L with tail */
|
|
simplified-u: 6; /* Simplified u */
|
|
alt-double-s: 7; /* Alternate German double s */
|
|
uc-i-with-serif: 8; /* Upper-case i with serif */
|
|
uc-g-with-spur: 10; /* Capital G with spur */
|
|
single-story-a: 11; /* Single-story a */
|
|
compact-lc-f: 12; /* Compact f */
|
|
compact-lc-t: 13; /* Compact t */
|
|
}
|
|
@styleset {
|
|
ss01: 1;
|
|
ss02: 2;
|
|
ss03: 3;
|
|
ss04: 4;
|
|
ss05: 5;
|
|
ss06: 6;
|
|
ss07: 7;
|
|
ss08: 8;
|
|
open-digits: 1; /* Open digits */
|
|
disambiguation: 2; /* Disambiguation (with zero) */
|
|
disambiguation-except-zero: 4; /* Disambiguation (no zero) */
|
|
round-quotes-and-commas: 3; /* Round quotes & commas */
|
|
square-punctuation: 7; /* Square punctuation */
|
|
square-quotes: 8; /* Square quotes */
|
|
circled-characters: 5; /* Circled characters */
|
|
squared-characters: 6; /* Squared characters */
|
|
}
|
|
}
|
|
@font-feature-values Inter {
|
|
@character-variant {
|
|
cv01: 1;
|
|
cv02: 2;
|
|
cv03: 3;
|
|
cv04: 4;
|
|
cv05: 5;
|
|
cv06: 6;
|
|
cv07: 7;
|
|
cv08: 8;
|
|
cv09: 9;
|
|
cv10: 10;
|
|
cv11: 11;
|
|
cv12: 12;
|
|
cv13: 13;
|
|
alt-1: 1; /* Alternate one */
|
|
alt-3: 9; /* Flat-top three */
|
|
open-4: 2; /* Open four */
|
|
open-6: 3; /* Open six */
|
|
open-9: 4; /* Open nine */
|
|
lc-l-with-tail: 5; /* Lower-case L with tail */
|
|
simplified-u: 6; /* Simplified u */
|
|
alt-double-s: 7; /* Alternate German double s */
|
|
uc-i-with-serif: 8; /* Upper-case i with serif */
|
|
uc-g-with-spur: 10; /* Capital G with spur */
|
|
single-story-a: 11; /* Single-story a */
|
|
compact-lc-f: 12; /* Compact f */
|
|
compact-lc-t: 13; /* Compact t */
|
|
}
|
|
@styleset {
|
|
ss01: 1;
|
|
ss02: 2;
|
|
ss03: 3;
|
|
ss04: 4;
|
|
ss05: 5;
|
|
ss06: 6;
|
|
ss07: 7;
|
|
ss08: 8;
|
|
open-digits: 1; /* Open digits */
|
|
disambiguation: 2; /* Disambiguation (with zero) */
|
|
disambiguation-except-zero: 4; /* Disambiguation (no zero) */
|
|
round-quotes-and-commas: 3; /* Round quotes & commas */
|
|
square-punctuation: 7; /* Square punctuation */
|
|
square-quotes: 8; /* Square quotes */
|
|
circled-characters: 5; /* Circled characters */
|
|
squared-characters: 6; /* Squared characters */
|
|
}
|
|
}
|
|
@font-feature-values InterDisplay {
|
|
@character-variant {
|
|
cv01: 1;
|
|
cv02: 2;
|
|
cv03: 3;
|
|
cv04: 4;
|
|
cv05: 5;
|
|
cv06: 6;
|
|
cv07: 7;
|
|
cv08: 8;
|
|
cv09: 9;
|
|
cv10: 10;
|
|
cv11: 11;
|
|
cv12: 12;
|
|
cv13: 13;
|
|
alt-1: 1; /* Alternate one */
|
|
alt-3: 9; /* Flat-top three */
|
|
open-4: 2; /* Open four */
|
|
open-6: 3; /* Open six */
|
|
open-9: 4; /* Open nine */
|
|
lc-l-with-tail: 5; /* Lower-case L with tail */
|
|
simplified-u: 6; /* Simplified u */
|
|
alt-double-s: 7; /* Alternate German double s */
|
|
uc-i-with-serif: 8; /* Upper-case i with serif */
|
|
uc-g-with-spur: 10; /* Capital G with spur */
|
|
single-story-a: 11; /* Single-story a */
|
|
compact-lc-f: 12; /* Compact f */
|
|
compact-lc-t: 13; /* Compact t */
|
|
}
|
|
@styleset {
|
|
ss01: 1;
|
|
ss02: 2;
|
|
ss03: 3;
|
|
ss04: 4;
|
|
ss05: 5;
|
|
ss06: 6;
|
|
ss07: 7;
|
|
ss08: 8;
|
|
open-digits: 1; /* Open digits */
|
|
disambiguation: 2; /* Disambiguation (with zero) */
|
|
disambiguation-except-zero: 4; /* Disambiguation (no zero) */
|
|
round-quotes-and-commas: 3; /* Round quotes & commas */
|
|
square-punctuation: 7; /* Square punctuation */
|
|
square-quotes: 8; /* Square quotes */
|
|
circled-characters: 5; /* Circled characters */
|
|
squared-characters: 6; /* Squared characters */
|
|
}
|
|
}
|
|
@font-face {
|
|
font-family: "ionicons";
|
|
src: url("../../../fonts/ionicons/ionicons.ttf?76q473") format("truetype"), url("../../../fonts/ionicons/ionicons.woff?76q473") format("woff"), url("../../../fonts/ionicons/ionicons.svg?76q473#ionicons") format("svg");
|
|
font-weight: normal;
|
|
font-style: normal;
|
|
font-display: block;
|
|
}
|
|
i[class^=icon-] {
|
|
/* use !important to prevent issues with browser extensions that change fonts */
|
|
font-family: "ionicons" !important;
|
|
speak: never;
|
|
font-style: normal;
|
|
font-weight: normal;
|
|
font-variant: normal;
|
|
text-transform: none;
|
|
line-height: 1.5;
|
|
/* Better Font Rendering =========== */
|
|
-webkit-font-smoothing: antialiased;
|
|
-moz-osx-font-smoothing: grayscale;
|
|
}
|
|
|
|
.icon-accessibility:before {
|
|
content: "\e900";
|
|
}
|
|
|
|
.icon-accessibility-outline:before {
|
|
content: "\e901";
|
|
}
|
|
|
|
.icon-accessibility-sharp:before {
|
|
content: "\e902";
|
|
}
|
|
|
|
.icon-add:before {
|
|
content: "\e903";
|
|
}
|
|
|
|
.icon-add-circle:before {
|
|
content: "\e904";
|
|
}
|
|
|
|
.icon-add-circle-outline:before {
|
|
content: "\e905";
|
|
}
|
|
|
|
.icon-add-circle-sharp:before {
|
|
content: "\e906";
|
|
}
|
|
|
|
.icon-add-outline:before {
|
|
content: "\e907";
|
|
}
|
|
|
|
.icon-add-sharp:before {
|
|
content: "\e908";
|
|
}
|
|
|
|
.icon-airplane:before {
|
|
content: "\e909";
|
|
}
|
|
|
|
.icon-airplane-outline:before {
|
|
content: "\e90a";
|
|
}
|
|
|
|
.icon-airplane-sharp:before {
|
|
content: "\e90b";
|
|
}
|
|
|
|
.icon-alarm:before {
|
|
content: "\e90c";
|
|
}
|
|
|
|
.icon-alarm-outline:before {
|
|
content: "\e90d";
|
|
}
|
|
|
|
.icon-alarm-sharp:before {
|
|
content: "\e90e";
|
|
}
|
|
|
|
.icon-albums:before {
|
|
content: "\e90f";
|
|
}
|
|
|
|
.icon-albums-outline:before {
|
|
content: "\e910";
|
|
}
|
|
|
|
.icon-albums-sharp:before {
|
|
content: "\e911";
|
|
}
|
|
|
|
.icon-alert:before {
|
|
content: "\e912";
|
|
}
|
|
|
|
.icon-alert-circle:before {
|
|
content: "\e913";
|
|
}
|
|
|
|
.icon-alert-circle-outline:before {
|
|
content: "\e914";
|
|
}
|
|
|
|
.icon-alert-circle-sharp:before {
|
|
content: "\e915";
|
|
}
|
|
|
|
.icon-alert-outline:before {
|
|
content: "\e916";
|
|
}
|
|
|
|
.icon-alert-sharp:before {
|
|
content: "\e917";
|
|
}
|
|
|
|
.icon-american-football:before {
|
|
content: "\e918";
|
|
}
|
|
|
|
.icon-american-football-outline:before {
|
|
content: "\e919";
|
|
}
|
|
|
|
.icon-american-football-sharp:before {
|
|
content: "\e91a";
|
|
}
|
|
|
|
.icon-analytics:before {
|
|
content: "\e91b";
|
|
}
|
|
|
|
.icon-analytics-outline:before {
|
|
content: "\e91c";
|
|
}
|
|
|
|
.icon-analytics-sharp:before {
|
|
content: "\e91d";
|
|
}
|
|
|
|
.icon-aperture:before {
|
|
content: "\e91e";
|
|
}
|
|
|
|
.icon-aperture-outline:before {
|
|
content: "\e91f";
|
|
}
|
|
|
|
.icon-aperture-sharp:before {
|
|
content: "\e920";
|
|
}
|
|
|
|
.icon-apps:before {
|
|
content: "\e921";
|
|
}
|
|
|
|
.icon-apps-outline:before {
|
|
content: "\e922";
|
|
}
|
|
|
|
.icon-apps-sharp:before {
|
|
content: "\e923";
|
|
}
|
|
|
|
.icon-archive:before {
|
|
content: "\e924";
|
|
}
|
|
|
|
.icon-archive-outline:before {
|
|
content: "\e925";
|
|
}
|
|
|
|
.icon-archive-sharp:before {
|
|
content: "\e926";
|
|
}
|
|
|
|
.icon-arrow-back:before {
|
|
content: "\e927";
|
|
}
|
|
|
|
.icon-arrow-back-circle:before {
|
|
content: "\e928";
|
|
}
|
|
|
|
.icon-arrow-back-circle-outline:before {
|
|
content: "\e929";
|
|
}
|
|
|
|
.icon-arrow-back-circle-sharp:before {
|
|
content: "\e92a";
|
|
}
|
|
|
|
.icon-arrow-back-outline:before {
|
|
content: "\e92b";
|
|
}
|
|
|
|
.icon-arrow-back-sharp:before {
|
|
content: "\e92c";
|
|
}
|
|
|
|
.icon-arrow-down:before {
|
|
content: "\e92d";
|
|
}
|
|
|
|
.icon-arrow-down-circle:before {
|
|
content: "\e92e";
|
|
}
|
|
|
|
.icon-arrow-down-circle-outline:before {
|
|
content: "\e92f";
|
|
}
|
|
|
|
.icon-arrow-down-circle-sharp:before {
|
|
content: "\e930";
|
|
}
|
|
|
|
.icon-arrow-down-outline:before {
|
|
content: "\e931";
|
|
}
|
|
|
|
.icon-arrow-down-sharp:before {
|
|
content: "\e932";
|
|
}
|
|
|
|
.icon-arrow-forward:before {
|
|
content: "\e933";
|
|
}
|
|
|
|
.icon-arrow-forward-circle:before {
|
|
content: "\e934";
|
|
}
|
|
|
|
.icon-arrow-forward-circle-outline:before {
|
|
content: "\e935";
|
|
}
|
|
|
|
.icon-arrow-forward-circle-sharp:before {
|
|
content: "\e936";
|
|
}
|
|
|
|
.icon-arrow-forward-outline:before {
|
|
content: "\e937";
|
|
}
|
|
|
|
.icon-arrow-forward-sharp:before {
|
|
content: "\e938";
|
|
}
|
|
|
|
.icon-arrow-redo:before {
|
|
content: "\e939";
|
|
}
|
|
|
|
.icon-arrow-redo-circle:before {
|
|
content: "\e93a";
|
|
}
|
|
|
|
.icon-arrow-redo-circle-outline:before {
|
|
content: "\e93b";
|
|
}
|
|
|
|
.icon-arrow-redo-circle-sharp:before {
|
|
content: "\e93c";
|
|
}
|
|
|
|
.icon-arrow-redo-outline:before {
|
|
content: "\e93d";
|
|
}
|
|
|
|
.icon-arrow-redo-sharp:before {
|
|
content: "\e93e";
|
|
}
|
|
|
|
.icon-arrow-undo:before {
|
|
content: "\e93f";
|
|
}
|
|
|
|
.icon-arrow-undo-circle:before {
|
|
content: "\e940";
|
|
}
|
|
|
|
.icon-arrow-undo-circle-outline:before {
|
|
content: "\e941";
|
|
}
|
|
|
|
.icon-arrow-undo-circle-sharp:before {
|
|
content: "\e942";
|
|
}
|
|
|
|
.icon-arrow-undo-outline:before {
|
|
content: "\e943";
|
|
}
|
|
|
|
.icon-arrow-undo-sharp:before {
|
|
content: "\e944";
|
|
}
|
|
|
|
.icon-arrow-up:before {
|
|
content: "\e945";
|
|
}
|
|
|
|
.icon-arrow-up-circle:before {
|
|
content: "\e946";
|
|
}
|
|
|
|
.icon-arrow-up-circle-outline:before {
|
|
content: "\e947";
|
|
}
|
|
|
|
.icon-arrow-up-circle-sharp:before {
|
|
content: "\e948";
|
|
}
|
|
|
|
.icon-arrow-up-outline:before {
|
|
content: "\e949";
|
|
}
|
|
|
|
.icon-arrow-up-sharp:before {
|
|
content: "\e94a";
|
|
}
|
|
|
|
.icon-at:before {
|
|
content: "\e94b";
|
|
}
|
|
|
|
.icon-at-circle:before {
|
|
content: "\e94c";
|
|
}
|
|
|
|
.icon-at-circle-outline:before {
|
|
content: "\e94d";
|
|
}
|
|
|
|
.icon-at-circle-sharp:before {
|
|
content: "\e94e";
|
|
}
|
|
|
|
.icon-at-outline:before {
|
|
content: "\e94f";
|
|
}
|
|
|
|
.icon-at-sharp:before {
|
|
content: "\e950";
|
|
}
|
|
|
|
.icon-attach:before {
|
|
content: "\e951";
|
|
}
|
|
|
|
.icon-attach-outline:before {
|
|
content: "\e952";
|
|
}
|
|
|
|
.icon-attach-sharp:before {
|
|
content: "\e953";
|
|
}
|
|
|
|
.icon-backspace:before {
|
|
content: "\e954";
|
|
}
|
|
|
|
.icon-backspace-outline:before {
|
|
content: "\e955";
|
|
}
|
|
|
|
.icon-backspace-sharp:before {
|
|
content: "\e956";
|
|
}
|
|
|
|
.icon-bag:before {
|
|
content: "\e957";
|
|
}
|
|
|
|
.icon-bag-add:before {
|
|
content: "\e958";
|
|
}
|
|
|
|
.icon-bag-add-outline:before {
|
|
content: "\e959";
|
|
}
|
|
|
|
.icon-bag-add-sharp:before {
|
|
content: "\e95a";
|
|
}
|
|
|
|
.icon-bag-check:before {
|
|
content: "\e95b";
|
|
}
|
|
|
|
.icon-bag-check-outline:before {
|
|
content: "\e95c";
|
|
}
|
|
|
|
.icon-bag-check-sharp:before {
|
|
content: "\e95d";
|
|
}
|
|
|
|
.icon-bag-handle:before {
|
|
content: "\e95e";
|
|
}
|
|
|
|
.icon-bag-handle-outline:before {
|
|
content: "\e95f";
|
|
}
|
|
|
|
.icon-bag-handle-sharp:before {
|
|
content: "\e960";
|
|
}
|
|
|
|
.icon-bag-outline:before {
|
|
content: "\e961";
|
|
}
|
|
|
|
.icon-bag-remove:before {
|
|
content: "\e962";
|
|
}
|
|
|
|
.icon-bag-remove-outline:before {
|
|
content: "\e963";
|
|
}
|
|
|
|
.icon-bag-remove-sharp:before {
|
|
content: "\e964";
|
|
}
|
|
|
|
.icon-bag-sharp:before {
|
|
content: "\e965";
|
|
}
|
|
|
|
.icon-balloon:before {
|
|
content: "\e966";
|
|
}
|
|
|
|
.icon-balloon-outline:before {
|
|
content: "\e967";
|
|
}
|
|
|
|
.icon-balloon-sharp:before {
|
|
content: "\e968";
|
|
}
|
|
|
|
.icon-ban:before {
|
|
content: "\e969";
|
|
}
|
|
|
|
.icon-bandage:before {
|
|
content: "\e96a";
|
|
}
|
|
|
|
.icon-bandage-outline:before {
|
|
content: "\e96b";
|
|
}
|
|
|
|
.icon-bandage-sharp:before {
|
|
content: "\e96c";
|
|
}
|
|
|
|
.icon-ban-outline:before {
|
|
content: "\e96d";
|
|
}
|
|
|
|
.icon-ban-sharp:before {
|
|
content: "\e96e";
|
|
}
|
|
|
|
.icon-barbell:before {
|
|
content: "\e96f";
|
|
}
|
|
|
|
.icon-barbell-outline:before {
|
|
content: "\e970";
|
|
}
|
|
|
|
.icon-barbell-sharp:before {
|
|
content: "\e971";
|
|
}
|
|
|
|
.icon-bar-chart:before {
|
|
content: "\e972";
|
|
}
|
|
|
|
.icon-bar-chart-outline:before {
|
|
content: "\e973";
|
|
}
|
|
|
|
.icon-bar-chart-sharp:before {
|
|
content: "\e974";
|
|
}
|
|
|
|
.icon-barcode:before {
|
|
content: "\e975";
|
|
}
|
|
|
|
.icon-barcode-outline:before {
|
|
content: "\e976";
|
|
}
|
|
|
|
.icon-barcode-sharp:before {
|
|
content: "\e977";
|
|
}
|
|
|
|
.icon-baseball:before {
|
|
content: "\e978";
|
|
}
|
|
|
|
.icon-baseball-outline:before {
|
|
content: "\e979";
|
|
}
|
|
|
|
.icon-baseball-sharp:before {
|
|
content: "\e97a";
|
|
}
|
|
|
|
.icon-basket:before {
|
|
content: "\e97b";
|
|
}
|
|
|
|
.icon-basketball:before {
|
|
content: "\e97c";
|
|
}
|
|
|
|
.icon-basketball-outline:before {
|
|
content: "\e97d";
|
|
}
|
|
|
|
.icon-basketball-sharp:before {
|
|
content: "\e97e";
|
|
}
|
|
|
|
.icon-basket-outline:before {
|
|
content: "\e97f";
|
|
}
|
|
|
|
.icon-basket-sharp:before {
|
|
content: "\e980";
|
|
}
|
|
|
|
.icon-battery-charging:before {
|
|
content: "\e981";
|
|
}
|
|
|
|
.icon-battery-charging-outline:before {
|
|
content: "\e982";
|
|
}
|
|
|
|
.icon-battery-charging-sharp:before {
|
|
content: "\e983";
|
|
}
|
|
|
|
.icon-battery-dead:before {
|
|
content: "\e984";
|
|
}
|
|
|
|
.icon-battery-dead-outline:before {
|
|
content: "\e985";
|
|
}
|
|
|
|
.icon-battery-dead-sharp:before {
|
|
content: "\e986";
|
|
}
|
|
|
|
.icon-battery-full:before {
|
|
content: "\e987";
|
|
}
|
|
|
|
.icon-battery-full-outline:before {
|
|
content: "\e988";
|
|
}
|
|
|
|
.icon-battery-full-sharp:before {
|
|
content: "\e989";
|
|
}
|
|
|
|
.icon-battery-half:before {
|
|
content: "\e98a";
|
|
}
|
|
|
|
.icon-battery-half-outline:before {
|
|
content: "\e98b";
|
|
}
|
|
|
|
.icon-battery-half-sharp:before {
|
|
content: "\e98c";
|
|
}
|
|
|
|
.icon-beaker:before {
|
|
content: "\e98d";
|
|
}
|
|
|
|
.icon-beaker-outline:before {
|
|
content: "\e98e";
|
|
}
|
|
|
|
.icon-beaker-sharp:before {
|
|
content: "\e98f";
|
|
}
|
|
|
|
.icon-bed:before {
|
|
content: "\e990";
|
|
}
|
|
|
|
.icon-bed-outline:before {
|
|
content: "\e991";
|
|
}
|
|
|
|
.icon-bed-sharp:before {
|
|
content: "\e992";
|
|
}
|
|
|
|
.icon-beer:before {
|
|
content: "\e993";
|
|
}
|
|
|
|
.icon-beer-outline:before {
|
|
content: "\e994";
|
|
}
|
|
|
|
.icon-beer-sharp:before {
|
|
content: "\e995";
|
|
}
|
|
|
|
.icon-bicycle:before {
|
|
content: "\e996";
|
|
}
|
|
|
|
.icon-bicycle-outline:before {
|
|
content: "\e997";
|
|
}
|
|
|
|
.icon-bicycle-sharp:before {
|
|
content: "\e998";
|
|
}
|
|
|
|
.icon-bluetooth:before {
|
|
content: "\e999";
|
|
}
|
|
|
|
.icon-bluetooth-outline:before {
|
|
content: "\e99a";
|
|
}
|
|
|
|
.icon-bluetooth-sharp:before {
|
|
content: "\e99b";
|
|
}
|
|
|
|
.icon-boat:before {
|
|
content: "\e99c";
|
|
}
|
|
|
|
.icon-boat-outline:before {
|
|
content: "\e99d";
|
|
}
|
|
|
|
.icon-boat-sharp:before {
|
|
content: "\e99e";
|
|
}
|
|
|
|
.icon-body:before {
|
|
content: "\e99f";
|
|
}
|
|
|
|
.icon-body-outline:before {
|
|
content: "\e9a0";
|
|
}
|
|
|
|
.icon-body-sharp:before {
|
|
content: "\e9a1";
|
|
}
|
|
|
|
.icon-bonfire:before {
|
|
content: "\e9a2";
|
|
}
|
|
|
|
.icon-bonfire-outline:before {
|
|
content: "\e9a3";
|
|
}
|
|
|
|
.icon-bonfire-sharp:before {
|
|
content: "\e9a4";
|
|
}
|
|
|
|
.icon-book:before {
|
|
content: "\e9a5";
|
|
}
|
|
|
|
.icon-bookmark:before {
|
|
content: "\e9a6";
|
|
}
|
|
|
|
.icon-bookmark-outline:before {
|
|
content: "\e9a7";
|
|
}
|
|
|
|
.icon-bookmarks:before {
|
|
content: "\e9a8";
|
|
}
|
|
|
|
.icon-bookmark-sharp:before {
|
|
content: "\e9a9";
|
|
}
|
|
|
|
.icon-bookmarks-outline:before {
|
|
content: "\e9aa";
|
|
}
|
|
|
|
.icon-bookmarks-sharp:before {
|
|
content: "\e9ab";
|
|
}
|
|
|
|
.icon-book-outline:before {
|
|
content: "\e9ac";
|
|
}
|
|
|
|
.icon-book-sharp:before {
|
|
content: "\e9ad";
|
|
}
|
|
|
|
.icon-bowling-ball:before {
|
|
content: "\e9ae";
|
|
}
|
|
|
|
.icon-bowling-ball-outline:before {
|
|
content: "\e9af";
|
|
}
|
|
|
|
.icon-bowling-ball-sharp:before {
|
|
content: "\e9b0";
|
|
}
|
|
|
|
.icon-briefcase:before {
|
|
content: "\e9b1";
|
|
}
|
|
|
|
.icon-briefcase-outline:before {
|
|
content: "\e9b2";
|
|
}
|
|
|
|
.icon-briefcase-sharp:before {
|
|
content: "\e9b3";
|
|
}
|
|
|
|
.icon-browsers:before {
|
|
content: "\e9b4";
|
|
}
|
|
|
|
.icon-browsers-outline:before {
|
|
content: "\e9b5";
|
|
}
|
|
|
|
.icon-browsers-sharp:before {
|
|
content: "\e9b6";
|
|
}
|
|
|
|
.icon-brush:before {
|
|
content: "\e9b7";
|
|
}
|
|
|
|
.icon-brush-outline:before {
|
|
content: "\e9b8";
|
|
}
|
|
|
|
.icon-brush-sharp:before {
|
|
content: "\e9b9";
|
|
}
|
|
|
|
.icon-bug:before {
|
|
content: "\e9ba";
|
|
}
|
|
|
|
.icon-bug-outline:before {
|
|
content: "\e9bb";
|
|
}
|
|
|
|
.icon-bug-sharp:before {
|
|
content: "\e9bc";
|
|
}
|
|
|
|
.icon-build:before {
|
|
content: "\e9bd";
|
|
}
|
|
|
|
.icon-build-outline:before {
|
|
content: "\e9be";
|
|
}
|
|
|
|
.icon-build-sharp:before {
|
|
content: "\e9bf";
|
|
}
|
|
|
|
.icon-bulb:before {
|
|
content: "\e9c0";
|
|
}
|
|
|
|
.icon-bulb-outline:before {
|
|
content: "\e9c1";
|
|
}
|
|
|
|
.icon-bulb-sharp:before {
|
|
content: "\e9c2";
|
|
}
|
|
|
|
.icon-bus:before {
|
|
content: "\e9c3";
|
|
}
|
|
|
|
.icon-business:before {
|
|
content: "\e9c4";
|
|
}
|
|
|
|
.icon-business-outline:before {
|
|
content: "\e9c5";
|
|
}
|
|
|
|
.icon-business-sharp:before {
|
|
content: "\e9c6";
|
|
}
|
|
|
|
.icon-bus-outline:before {
|
|
content: "\e9c7";
|
|
}
|
|
|
|
.icon-bus-sharp:before {
|
|
content: "\e9c8";
|
|
}
|
|
|
|
.icon-cafe:before {
|
|
content: "\e9c9";
|
|
}
|
|
|
|
.icon-cafe-outline:before {
|
|
content: "\e9ca";
|
|
}
|
|
|
|
.icon-cafe-sharp:before {
|
|
content: "\e9cb";
|
|
}
|
|
|
|
.icon-calculator:before {
|
|
content: "\e9cc";
|
|
}
|
|
|
|
.icon-calculator-outline:before {
|
|
content: "\e9cd";
|
|
}
|
|
|
|
.icon-calculator-sharp:before {
|
|
content: "\e9ce";
|
|
}
|
|
|
|
.icon-calendar:before {
|
|
content: "\e9cf";
|
|
}
|
|
|
|
.icon-calendar-clear:before {
|
|
content: "\e9d0";
|
|
}
|
|
|
|
.icon-calendar-clear-outline:before {
|
|
content: "\e9d1";
|
|
}
|
|
|
|
.icon-calendar-clear-sharp:before {
|
|
content: "\e9d2";
|
|
}
|
|
|
|
.icon-calendar-number:before {
|
|
content: "\e9d3";
|
|
}
|
|
|
|
.icon-calendar-number-outline:before {
|
|
content: "\e9d4";
|
|
}
|
|
|
|
.icon-calendar-number-sharp:before {
|
|
content: "\e9d5";
|
|
}
|
|
|
|
.icon-calendar-outline:before {
|
|
content: "\e9d6";
|
|
}
|
|
|
|
.icon-calendar-sharp:before {
|
|
content: "\e9d7";
|
|
}
|
|
|
|
.icon-call:before {
|
|
content: "\e9d8";
|
|
}
|
|
|
|
.icon-call-outline:before {
|
|
content: "\e9d9";
|
|
}
|
|
|
|
.icon-call-sharp:before {
|
|
content: "\e9da";
|
|
}
|
|
|
|
.icon-camera:before {
|
|
content: "\e9db";
|
|
}
|
|
|
|
.icon-camera-outline:before {
|
|
content: "\e9dc";
|
|
}
|
|
|
|
.icon-camera-reverse:before {
|
|
content: "\e9dd";
|
|
}
|
|
|
|
.icon-camera-reverse-outline:before {
|
|
content: "\e9de";
|
|
}
|
|
|
|
.icon-camera-reverse-sharp:before {
|
|
content: "\e9df";
|
|
}
|
|
|
|
.icon-camera-sharp:before {
|
|
content: "\e9e0";
|
|
}
|
|
|
|
.icon-car:before {
|
|
content: "\e9e1";
|
|
}
|
|
|
|
.icon-card:before {
|
|
content: "\e9e2";
|
|
}
|
|
|
|
.icon-card-outline:before {
|
|
content: "\e9e3";
|
|
}
|
|
|
|
.icon-card-sharp:before {
|
|
content: "\e9e4";
|
|
}
|
|
|
|
.icon-caret-back:before {
|
|
content: "\e9e5";
|
|
}
|
|
|
|
.icon-caret-back-circle:before {
|
|
content: "\e9e6";
|
|
}
|
|
|
|
.icon-caret-back-circle-outline:before {
|
|
content: "\e9e7";
|
|
}
|
|
|
|
.icon-caret-back-circle-sharp:before {
|
|
content: "\e9e8";
|
|
}
|
|
|
|
.icon-caret-back-outline:before {
|
|
content: "\e9e9";
|
|
}
|
|
|
|
.icon-caret-back-sharp:before {
|
|
content: "\e9ea";
|
|
}
|
|
|
|
.icon-caret-down:before {
|
|
content: "\e9eb";
|
|
}
|
|
|
|
.icon-caret-down-circle:before {
|
|
content: "\e9ec";
|
|
}
|
|
|
|
.icon-caret-down-circle-outline:before {
|
|
content: "\e9ed";
|
|
}
|
|
|
|
.icon-caret-down-circle-sharp:before {
|
|
content: "\e9ee";
|
|
}
|
|
|
|
.icon-caret-down-outline:before {
|
|
content: "\e9ef";
|
|
}
|
|
|
|
.icon-caret-down-sharp:before {
|
|
content: "\e9f0";
|
|
}
|
|
|
|
.icon-caret-forward:before {
|
|
content: "\e9f1";
|
|
}
|
|
|
|
.icon-caret-forward-circle:before {
|
|
content: "\e9f2";
|
|
}
|
|
|
|
.icon-caret-forward-circle-outline:before {
|
|
content: "\e9f3";
|
|
}
|
|
|
|
.icon-caret-forward-circle-sharp:before {
|
|
content: "\e9f4";
|
|
}
|
|
|
|
.icon-caret-forward-outline:before {
|
|
content: "\e9f5";
|
|
}
|
|
|
|
.icon-caret-forward-sharp:before {
|
|
content: "\e9f6";
|
|
}
|
|
|
|
.icon-caret-up:before {
|
|
content: "\e9f7";
|
|
}
|
|
|
|
.icon-caret-up-circle:before {
|
|
content: "\e9f8";
|
|
}
|
|
|
|
.icon-caret-up-circle-outline:before {
|
|
content: "\e9f9";
|
|
}
|
|
|
|
.icon-caret-up-circle-sharp:before {
|
|
content: "\e9fa";
|
|
}
|
|
|
|
.icon-caret-up-outline:before {
|
|
content: "\e9fb";
|
|
}
|
|
|
|
.icon-caret-up-sharp:before {
|
|
content: "\e9fc";
|
|
}
|
|
|
|
.icon-car-outline:before {
|
|
content: "\e9fd";
|
|
}
|
|
|
|
.icon-car-sharp:before {
|
|
content: "\e9fe";
|
|
}
|
|
|
|
.icon-car-sport:before {
|
|
content: "\e9ff";
|
|
}
|
|
|
|
.icon-car-sport-outline:before {
|
|
content: "\ea00";
|
|
}
|
|
|
|
.icon-car-sport-sharp:before {
|
|
content: "\ea01";
|
|
}
|
|
|
|
.icon-cart:before {
|
|
content: "\ea02";
|
|
}
|
|
|
|
.icon-cart-outline:before {
|
|
content: "\ea03";
|
|
}
|
|
|
|
.icon-cart-sharp:before {
|
|
content: "\ea04";
|
|
}
|
|
|
|
.icon-cash:before {
|
|
content: "\ea05";
|
|
}
|
|
|
|
.icon-cash-outline:before {
|
|
content: "\ea06";
|
|
}
|
|
|
|
.icon-cash-sharp:before {
|
|
content: "\ea07";
|
|
}
|
|
|
|
.icon-cellular:before {
|
|
content: "\ea08";
|
|
}
|
|
|
|
.icon-cellular-outline:before {
|
|
content: "\ea09";
|
|
}
|
|
|
|
.icon-cellular-sharp:before {
|
|
content: "\ea0a";
|
|
}
|
|
|
|
.icon-chatbox:before {
|
|
content: "\ea0b";
|
|
}
|
|
|
|
.icon-chatbox-ellipses:before {
|
|
content: "\ea0c";
|
|
}
|
|
|
|
.icon-chatbox-ellipses-outline:before {
|
|
content: "\ea0d";
|
|
}
|
|
|
|
.icon-chatbox-ellipses-sharp:before {
|
|
content: "\ea0e";
|
|
}
|
|
|
|
.icon-chatbox-outline:before {
|
|
content: "\ea0f";
|
|
}
|
|
|
|
.icon-chatbox-sharp:before {
|
|
content: "\ea10";
|
|
}
|
|
|
|
.icon-chatbubble:before {
|
|
content: "\ea11";
|
|
}
|
|
|
|
.icon-chatbubble-ellipses:before {
|
|
content: "\ea12";
|
|
}
|
|
|
|
.icon-chatbubble-ellipses-outline:before {
|
|
content: "\ea13";
|
|
}
|
|
|
|
.icon-chatbubble-ellipses-sharp:before {
|
|
content: "\ea14";
|
|
}
|
|
|
|
.icon-chatbubble-outline:before {
|
|
content: "\ea15";
|
|
}
|
|
|
|
.icon-chatbubbles:before {
|
|
content: "\ea16";
|
|
}
|
|
|
|
.icon-chatbubble-sharp:before {
|
|
content: "\ea17";
|
|
}
|
|
|
|
.icon-chatbubbles-outline:before {
|
|
content: "\ea18";
|
|
}
|
|
|
|
.icon-chatbubbles-sharp:before {
|
|
content: "\ea19";
|
|
}
|
|
|
|
.icon-checkbox:before {
|
|
content: "\ea1a";
|
|
}
|
|
|
|
.icon-checkbox-outline:before {
|
|
content: "\ea1b";
|
|
}
|
|
|
|
.icon-checkbox-sharp:before {
|
|
content: "\ea1c";
|
|
}
|
|
|
|
.icon-checkmark:before {
|
|
content: "\ea1d";
|
|
}
|
|
|
|
.icon-checkmark-circle:before {
|
|
content: "\ea1e";
|
|
}
|
|
|
|
.icon-checkmark-circle-outline:before {
|
|
content: "\ea1f";
|
|
}
|
|
|
|
.icon-checkmark-circle-sharp:before {
|
|
content: "\ea20";
|
|
}
|
|
|
|
.icon-checkmark-done:before {
|
|
content: "\ea21";
|
|
}
|
|
|
|
.icon-checkmark-done-circle:before {
|
|
content: "\ea22";
|
|
}
|
|
|
|
.icon-checkmark-done-circle-outline:before {
|
|
content: "\ea23";
|
|
}
|
|
|
|
.icon-checkmark-done-circle-sharp:before {
|
|
content: "\ea24";
|
|
}
|
|
|
|
.icon-checkmark-done-outline:before {
|
|
content: "\ea25";
|
|
}
|
|
|
|
.icon-checkmark-done-sharp:before {
|
|
content: "\ea26";
|
|
}
|
|
|
|
.icon-checkmark-outline:before {
|
|
content: "\ea27";
|
|
}
|
|
|
|
.icon-checkmark-sharp:before {
|
|
content: "\ea28";
|
|
}
|
|
|
|
.icon-chevron-back:before {
|
|
content: "\ea29";
|
|
}
|
|
|
|
.icon-chevron-back-circle:before {
|
|
content: "\ea2a";
|
|
}
|
|
|
|
.icon-chevron-back-circle-outline:before {
|
|
content: "\ea2b";
|
|
}
|
|
|
|
.icon-chevron-back-circle-sharp:before {
|
|
content: "\ea2c";
|
|
}
|
|
|
|
.icon-chevron-back-outline:before {
|
|
content: "\ea2d";
|
|
}
|
|
|
|
.icon-chevron-back-sharp:before {
|
|
content: "\ea2e";
|
|
}
|
|
|
|
.icon-chevron-down:before {
|
|
content: "\ea2f";
|
|
}
|
|
|
|
.icon-chevron-down-circle:before {
|
|
content: "\ea30";
|
|
}
|
|
|
|
.icon-chevron-down-circle-outline:before {
|
|
content: "\ea31";
|
|
}
|
|
|
|
.icon-chevron-down-circle-sharp:before {
|
|
content: "\ea32";
|
|
}
|
|
|
|
.icon-chevron-down-outline:before {
|
|
content: "\ea33";
|
|
}
|
|
|
|
.icon-chevron-down-sharp:before {
|
|
content: "\ea34";
|
|
}
|
|
|
|
.icon-chevron-forward:before {
|
|
content: "\ea35";
|
|
}
|
|
|
|
.icon-chevron-forward-circle:before {
|
|
content: "\ea36";
|
|
}
|
|
|
|
.icon-chevron-forward-circle-outline:before {
|
|
content: "\ea37";
|
|
}
|
|
|
|
.icon-chevron-forward-circle-sharp:before {
|
|
content: "\ea38";
|
|
}
|
|
|
|
.icon-chevron-forward-outline:before {
|
|
content: "\ea39";
|
|
}
|
|
|
|
.icon-chevron-forward-sharp:before {
|
|
content: "\ea3a";
|
|
}
|
|
|
|
.icon-chevron-up:before {
|
|
content: "\ea3b";
|
|
}
|
|
|
|
.icon-chevron-up-circle:before {
|
|
content: "\ea3c";
|
|
}
|
|
|
|
.icon-chevron-up-circle-outline:before {
|
|
content: "\ea3d";
|
|
}
|
|
|
|
.icon-chevron-up-circle-sharp:before {
|
|
content: "\ea3e";
|
|
}
|
|
|
|
.icon-chevron-up-outline:before {
|
|
content: "\ea3f";
|
|
}
|
|
|
|
.icon-chevron-up-sharp:before {
|
|
content: "\ea40";
|
|
}
|
|
|
|
.icon-clipboard:before {
|
|
content: "\ea41";
|
|
}
|
|
|
|
.icon-clipboard-outline:before {
|
|
content: "\ea42";
|
|
}
|
|
|
|
.icon-clipboard-sharp:before {
|
|
content: "\ea43";
|
|
}
|
|
|
|
.icon-close:before {
|
|
content: "\ea44";
|
|
}
|
|
|
|
.icon-close-circle:before {
|
|
content: "\ea45";
|
|
}
|
|
|
|
.icon-close-circle-outline:before {
|
|
content: "\ea46";
|
|
}
|
|
|
|
.icon-close-circle-sharp:before {
|
|
content: "\ea47";
|
|
}
|
|
|
|
.icon-close-outline:before {
|
|
content: "\ea48";
|
|
}
|
|
|
|
.icon-close-sharp:before {
|
|
content: "\ea49";
|
|
}
|
|
|
|
.icon-cloud:before {
|
|
content: "\ea4a";
|
|
}
|
|
|
|
.icon-cloud-circle:before {
|
|
content: "\ea4b";
|
|
}
|
|
|
|
.icon-cloud-circle-outline:before {
|
|
content: "\ea4c";
|
|
}
|
|
|
|
.icon-cloud-circle-sharp:before {
|
|
content: "\ea4d";
|
|
}
|
|
|
|
.icon-cloud-done:before {
|
|
content: "\ea4e";
|
|
}
|
|
|
|
.icon-cloud-done-outline:before {
|
|
content: "\ea4f";
|
|
}
|
|
|
|
.icon-cloud-done-sharp:before {
|
|
content: "\ea50";
|
|
}
|
|
|
|
.icon-cloud-download:before {
|
|
content: "\ea51";
|
|
}
|
|
|
|
.icon-cloud-download-outline:before {
|
|
content: "\ea52";
|
|
}
|
|
|
|
.icon-cloud-download-sharp:before {
|
|
content: "\ea53";
|
|
}
|
|
|
|
.icon-cloud-offline:before {
|
|
content: "\ea54";
|
|
}
|
|
|
|
.icon-cloud-offline-outline:before {
|
|
content: "\ea55";
|
|
}
|
|
|
|
.icon-cloud-offline-sharp:before {
|
|
content: "\ea56";
|
|
}
|
|
|
|
.icon-cloud-outline:before {
|
|
content: "\ea57";
|
|
}
|
|
|
|
.icon-cloud-sharp:before {
|
|
content: "\ea58";
|
|
}
|
|
|
|
.icon-cloud-upload:before {
|
|
content: "\ea59";
|
|
}
|
|
|
|
.icon-cloud-upload-outline:before {
|
|
content: "\ea5a";
|
|
}
|
|
|
|
.icon-cloud-upload-sharp:before {
|
|
content: "\ea5b";
|
|
}
|
|
|
|
.icon-cloudy:before {
|
|
content: "\ea5c";
|
|
}
|
|
|
|
.icon-cloudy-night:before {
|
|
content: "\ea5d";
|
|
}
|
|
|
|
.icon-cloudy-night-outline:before {
|
|
content: "\ea5e";
|
|
}
|
|
|
|
.icon-cloudy-night-sharp:before {
|
|
content: "\ea5f";
|
|
}
|
|
|
|
.icon-cloudy-outline:before {
|
|
content: "\ea60";
|
|
}
|
|
|
|
.icon-cloudy-sharp:before {
|
|
content: "\ea61";
|
|
}
|
|
|
|
.icon-code:before {
|
|
content: "\ea62";
|
|
}
|
|
|
|
.icon-code-download:before {
|
|
content: "\ea63";
|
|
}
|
|
|
|
.icon-code-download-outline:before {
|
|
content: "\ea64";
|
|
}
|
|
|
|
.icon-code-download-sharp:before {
|
|
content: "\ea65";
|
|
}
|
|
|
|
.icon-code-outline:before {
|
|
content: "\ea66";
|
|
}
|
|
|
|
.icon-code-sharp:before {
|
|
content: "\ea67";
|
|
}
|
|
|
|
.icon-code-slash:before {
|
|
content: "\ea68";
|
|
}
|
|
|
|
.icon-code-slash-outline:before {
|
|
content: "\ea69";
|
|
}
|
|
|
|
.icon-code-slash-sharp:before {
|
|
content: "\ea6a";
|
|
}
|
|
|
|
.icon-code-working:before {
|
|
content: "\ea6b";
|
|
}
|
|
|
|
.icon-code-working-outline:before {
|
|
content: "\ea6c";
|
|
}
|
|
|
|
.icon-code-working-sharp:before {
|
|
content: "\ea6d";
|
|
}
|
|
|
|
.icon-cog:before {
|
|
content: "\ea6e";
|
|
}
|
|
|
|
.icon-cog-outline:before {
|
|
content: "\ea6f";
|
|
}
|
|
|
|
.icon-cog-sharp:before {
|
|
content: "\ea70";
|
|
}
|
|
|
|
.icon-color-fill:before {
|
|
content: "\ea71";
|
|
}
|
|
|
|
.icon-color-fill-outline:before {
|
|
content: "\ea72";
|
|
}
|
|
|
|
.icon-color-fill-sharp:before {
|
|
content: "\ea73";
|
|
}
|
|
|
|
.icon-color-filter:before {
|
|
content: "\ea74";
|
|
}
|
|
|
|
.icon-color-filter-outline:before {
|
|
content: "\ea75";
|
|
}
|
|
|
|
.icon-color-filter-sharp:before {
|
|
content: "\ea76";
|
|
}
|
|
|
|
.icon-color-palette:before {
|
|
content: "\ea77";
|
|
}
|
|
|
|
.icon-color-palette-outline:before {
|
|
content: "\ea78";
|
|
}
|
|
|
|
.icon-color-palette-sharp:before {
|
|
content: "\ea79";
|
|
}
|
|
|
|
.icon-color-wand:before {
|
|
content: "\ea7a";
|
|
}
|
|
|
|
.icon-color-wand-outline:before {
|
|
content: "\ea7b";
|
|
}
|
|
|
|
.icon-color-wand-sharp:before {
|
|
content: "\ea7c";
|
|
}
|
|
|
|
.icon-compass:before {
|
|
content: "\ea7d";
|
|
}
|
|
|
|
.icon-compass-outline:before {
|
|
content: "\ea7e";
|
|
}
|
|
|
|
.icon-compass-sharp:before {
|
|
content: "\ea7f";
|
|
}
|
|
|
|
.icon-construct:before {
|
|
content: "\ea80";
|
|
}
|
|
|
|
.icon-construct-outline:before {
|
|
content: "\ea81";
|
|
}
|
|
|
|
.icon-construct-sharp:before {
|
|
content: "\ea82";
|
|
}
|
|
|
|
.icon-contract:before {
|
|
content: "\ea83";
|
|
}
|
|
|
|
.icon-contract-outline:before {
|
|
content: "\ea84";
|
|
}
|
|
|
|
.icon-contract-sharp:before {
|
|
content: "\ea85";
|
|
}
|
|
|
|
.icon-contrast:before {
|
|
content: "\ea86";
|
|
}
|
|
|
|
.icon-contrast-outline:before {
|
|
content: "\ea87";
|
|
}
|
|
|
|
.icon-contrast-sharp:before {
|
|
content: "\ea88";
|
|
}
|
|
|
|
.icon-copy:before {
|
|
content: "\ea89";
|
|
}
|
|
|
|
.icon-copy-outline:before {
|
|
content: "\ea8a";
|
|
}
|
|
|
|
.icon-copy-sharp:before {
|
|
content: "\ea8b";
|
|
}
|
|
|
|
.icon-create:before {
|
|
content: "\ea8c";
|
|
}
|
|
|
|
.icon-create-outline:before {
|
|
content: "\ea8d";
|
|
}
|
|
|
|
.icon-create-sharp:before {
|
|
content: "\ea8e";
|
|
}
|
|
|
|
.icon-crop:before {
|
|
content: "\ea8f";
|
|
}
|
|
|
|
.icon-crop-outline:before {
|
|
content: "\ea90";
|
|
}
|
|
|
|
.icon-crop-sharp:before {
|
|
content: "\ea91";
|
|
}
|
|
|
|
.icon-cube:before {
|
|
content: "\ea92";
|
|
}
|
|
|
|
.icon-cube-outline:before {
|
|
content: "\ea93";
|
|
}
|
|
|
|
.icon-cube-sharp:before {
|
|
content: "\ea94";
|
|
}
|
|
|
|
.icon-cut:before {
|
|
content: "\ea95";
|
|
}
|
|
|
|
.icon-cut-outline:before {
|
|
content: "\ea96";
|
|
}
|
|
|
|
.icon-cut-sharp:before {
|
|
content: "\ea97";
|
|
}
|
|
|
|
.icon-desktop:before {
|
|
content: "\ea98";
|
|
}
|
|
|
|
.icon-desktop-outline:before {
|
|
content: "\ea99";
|
|
}
|
|
|
|
.icon-desktop-sharp:before {
|
|
content: "\ea9a";
|
|
}
|
|
|
|
.icon-diamond:before {
|
|
content: "\ea9b";
|
|
}
|
|
|
|
.icon-diamond-outline:before {
|
|
content: "\ea9c";
|
|
}
|
|
|
|
.icon-diamond-sharp:before {
|
|
content: "\ea9d";
|
|
}
|
|
|
|
.icon-dice:before {
|
|
content: "\ea9e";
|
|
}
|
|
|
|
.icon-dice-outline:before {
|
|
content: "\ea9f";
|
|
}
|
|
|
|
.icon-dice-sharp:before {
|
|
content: "\eaa0";
|
|
}
|
|
|
|
.icon-disc:before {
|
|
content: "\eaa1";
|
|
}
|
|
|
|
.icon-disc-outline:before {
|
|
content: "\eaa2";
|
|
}
|
|
|
|
.icon-disc-sharp:before {
|
|
content: "\eaa3";
|
|
}
|
|
|
|
.icon-document:before {
|
|
content: "\eaa4";
|
|
}
|
|
|
|
.icon-document-attach:before {
|
|
content: "\eaa5";
|
|
}
|
|
|
|
.icon-document-attach-outline:before {
|
|
content: "\eaa6";
|
|
}
|
|
|
|
.icon-document-attach-sharp:before {
|
|
content: "\eaa7";
|
|
}
|
|
|
|
.icon-document-lock:before {
|
|
content: "\eaa8";
|
|
}
|
|
|
|
.icon-document-lock-outline:before {
|
|
content: "\eaa9";
|
|
}
|
|
|
|
.icon-document-lock-sharp:before {
|
|
content: "\eaaa";
|
|
}
|
|
|
|
.icon-document-outline:before {
|
|
content: "\eaab";
|
|
}
|
|
|
|
.icon-documents:before {
|
|
content: "\eaac";
|
|
}
|
|
|
|
.icon-document-sharp:before {
|
|
content: "\eaad";
|
|
}
|
|
|
|
.icon-documents-outline:before {
|
|
content: "\eaae";
|
|
}
|
|
|
|
.icon-documents-sharp:before {
|
|
content: "\eaaf";
|
|
}
|
|
|
|
.icon-document-text:before {
|
|
content: "\eab0";
|
|
}
|
|
|
|
.icon-document-text-outline:before {
|
|
content: "\eab1";
|
|
}
|
|
|
|
.icon-document-text-sharp:before {
|
|
content: "\eab2";
|
|
}
|
|
|
|
.icon-download:before {
|
|
content: "\eab3";
|
|
}
|
|
|
|
.icon-download-outline:before {
|
|
content: "\eab4";
|
|
}
|
|
|
|
.icon-download-sharp:before {
|
|
content: "\eab5";
|
|
}
|
|
|
|
.icon-duplicate:before {
|
|
content: "\eab6";
|
|
}
|
|
|
|
.icon-duplicate-outline:before {
|
|
content: "\eab7";
|
|
}
|
|
|
|
.icon-duplicate-sharp:before {
|
|
content: "\eab8";
|
|
}
|
|
|
|
.icon-ear:before {
|
|
content: "\eab9";
|
|
}
|
|
|
|
.icon-ear-outline:before {
|
|
content: "\eaba";
|
|
}
|
|
|
|
.icon-ear-sharp:before {
|
|
content: "\eabb";
|
|
}
|
|
|
|
.icon-earth:before {
|
|
content: "\eabc";
|
|
}
|
|
|
|
.icon-earth-outline:before {
|
|
content: "\eabd";
|
|
}
|
|
|
|
.icon-earth-sharp:before {
|
|
content: "\eabe";
|
|
}
|
|
|
|
.icon-easel:before {
|
|
content: "\eabf";
|
|
}
|
|
|
|
.icon-easel-outline:before {
|
|
content: "\eac0";
|
|
}
|
|
|
|
.icon-easel-sharp:before {
|
|
content: "\eac1";
|
|
}
|
|
|
|
.icon-egg:before {
|
|
content: "\eac2";
|
|
}
|
|
|
|
.icon-egg-outline:before {
|
|
content: "\eac3";
|
|
}
|
|
|
|
.icon-egg-sharp:before {
|
|
content: "\eac4";
|
|
}
|
|
|
|
.icon-ellipse:before {
|
|
content: "\eac5";
|
|
}
|
|
|
|
.icon-ellipse-outline:before {
|
|
content: "\eac6";
|
|
}
|
|
|
|
.icon-ellipse-sharp:before {
|
|
content: "\eac7";
|
|
}
|
|
|
|
.icon-ellipsis-horizontal:before {
|
|
content: "\eac8";
|
|
}
|
|
|
|
.icon-ellipsis-horizontal-circle:before {
|
|
content: "\eac9";
|
|
}
|
|
|
|
.icon-ellipsis-horizontal-circle-outline:before {
|
|
content: "\eaca";
|
|
}
|
|
|
|
.icon-ellipsis-horizontal-circle-sharp:before {
|
|
content: "\eacb";
|
|
}
|
|
|
|
.icon-ellipsis-horizontal-outline:before {
|
|
content: "\eacc";
|
|
}
|
|
|
|
.icon-ellipsis-horizontal-sharp:before {
|
|
content: "\eacd";
|
|
}
|
|
|
|
.icon-ellipsis-vertical:before {
|
|
content: "\eace";
|
|
}
|
|
|
|
.icon-ellipsis-vertical-circle:before {
|
|
content: "\eacf";
|
|
}
|
|
|
|
.icon-ellipsis-vertical-circle-outline:before {
|
|
content: "\ead0";
|
|
}
|
|
|
|
.icon-ellipsis-vertical-circle-sharp:before {
|
|
content: "\ead1";
|
|
}
|
|
|
|
.icon-ellipsis-vertical-outline:before {
|
|
content: "\ead2";
|
|
}
|
|
|
|
.icon-ellipsis-vertical-sharp:before {
|
|
content: "\ead3";
|
|
}
|
|
|
|
.icon-enter:before {
|
|
content: "\ead4";
|
|
}
|
|
|
|
.icon-enter-outline:before {
|
|
content: "\ead5";
|
|
}
|
|
|
|
.icon-enter-sharp:before {
|
|
content: "\ead6";
|
|
}
|
|
|
|
.icon-exit:before {
|
|
content: "\ead7";
|
|
}
|
|
|
|
.icon-exit-outline:before {
|
|
content: "\ead8";
|
|
}
|
|
|
|
.icon-exit-sharp:before {
|
|
content: "\ead9";
|
|
}
|
|
|
|
.icon-expand:before {
|
|
content: "\eada";
|
|
}
|
|
|
|
.icon-expand-outline:before {
|
|
content: "\eadb";
|
|
}
|
|
|
|
.icon-expand-sharp:before {
|
|
content: "\eadc";
|
|
}
|
|
|
|
.icon-extension-puzzle:before {
|
|
content: "\eadd";
|
|
}
|
|
|
|
.icon-extension-puzzle-outline:before {
|
|
content: "\eade";
|
|
}
|
|
|
|
.icon-extension-puzzle-sharp:before {
|
|
content: "\eadf";
|
|
}
|
|
|
|
.icon-eye:before {
|
|
content: "\eae0";
|
|
}
|
|
|
|
.icon-eyedrop:before {
|
|
content: "\eae1";
|
|
}
|
|
|
|
.icon-eyedrop-outline:before {
|
|
content: "\eae2";
|
|
}
|
|
|
|
.icon-eyedrop-sharp:before {
|
|
content: "\eae3";
|
|
}
|
|
|
|
.icon-eye-off:before {
|
|
content: "\eae4";
|
|
}
|
|
|
|
.icon-eye-off-outline:before {
|
|
content: "\eae5";
|
|
}
|
|
|
|
.icon-eye-off-sharp:before {
|
|
content: "\eae6";
|
|
}
|
|
|
|
.icon-eye-outline:before {
|
|
content: "\eae7";
|
|
}
|
|
|
|
.icon-eye-sharp:before {
|
|
content: "\eae8";
|
|
}
|
|
|
|
.icon-fast-food:before {
|
|
content: "\eae9";
|
|
}
|
|
|
|
.icon-fast-food-outline:before {
|
|
content: "\eaea";
|
|
}
|
|
|
|
.icon-fast-food-sharp:before {
|
|
content: "\eaeb";
|
|
}
|
|
|
|
.icon-female:before {
|
|
content: "\eaec";
|
|
}
|
|
|
|
.icon-female-outline:before {
|
|
content: "\eaed";
|
|
}
|
|
|
|
.icon-female-sharp:before {
|
|
content: "\eaee";
|
|
}
|
|
|
|
.icon-file-tray:before {
|
|
content: "\eaef";
|
|
}
|
|
|
|
.icon-file-tray-full:before {
|
|
content: "\eaf0";
|
|
}
|
|
|
|
.icon-file-tray-full-outline:before {
|
|
content: "\eaf1";
|
|
}
|
|
|
|
.icon-file-tray-full-sharp:before {
|
|
content: "\eaf2";
|
|
}
|
|
|
|
.icon-file-tray-outline:before {
|
|
content: "\eaf3";
|
|
}
|
|
|
|
.icon-file-tray-sharp:before {
|
|
content: "\eaf4";
|
|
}
|
|
|
|
.icon-file-tray-stacked:before {
|
|
content: "\eaf5";
|
|
}
|
|
|
|
.icon-file-tray-stacked-outline:before {
|
|
content: "\eaf6";
|
|
}
|
|
|
|
.icon-file-tray-stacked-sharp:before {
|
|
content: "\eaf7";
|
|
}
|
|
|
|
.icon-film:before {
|
|
content: "\eaf8";
|
|
}
|
|
|
|
.icon-film-outline:before {
|
|
content: "\eaf9";
|
|
}
|
|
|
|
.icon-film-sharp:before {
|
|
content: "\eafa";
|
|
}
|
|
|
|
.icon-filter:before {
|
|
content: "\eafb";
|
|
}
|
|
|
|
.icon-filter-circle:before {
|
|
content: "\eafc";
|
|
}
|
|
|
|
.icon-filter-circle-outline:before {
|
|
content: "\eafd";
|
|
}
|
|
|
|
.icon-filter-circle-sharp:before {
|
|
content: "\eafe";
|
|
}
|
|
|
|
.icon-filter-outline:before {
|
|
content: "\eaff";
|
|
}
|
|
|
|
.icon-filter-sharp:before {
|
|
content: "\eb00";
|
|
}
|
|
|
|
.icon-finger-print:before {
|
|
content: "\eb01";
|
|
}
|
|
|
|
.icon-finger-print-outline:before {
|
|
content: "\eb02";
|
|
}
|
|
|
|
.icon-finger-print-sharp:before {
|
|
content: "\eb03";
|
|
}
|
|
|
|
.icon-fish:before {
|
|
content: "\eb04";
|
|
}
|
|
|
|
.icon-fish-outline:before {
|
|
content: "\eb05";
|
|
}
|
|
|
|
.icon-fish-sharp:before {
|
|
content: "\eb06";
|
|
}
|
|
|
|
.icon-fitness:before {
|
|
content: "\eb07";
|
|
}
|
|
|
|
.icon-fitness-outline:before {
|
|
content: "\eb08";
|
|
}
|
|
|
|
.icon-fitness-sharp:before {
|
|
content: "\eb09";
|
|
}
|
|
|
|
.icon-flag:before {
|
|
content: "\eb0a";
|
|
}
|
|
|
|
.icon-flag-outline:before {
|
|
content: "\eb0b";
|
|
}
|
|
|
|
.icon-flag-sharp:before {
|
|
content: "\eb0c";
|
|
}
|
|
|
|
.icon-flame:before {
|
|
content: "\eb0d";
|
|
}
|
|
|
|
.icon-flame-outline:before {
|
|
content: "\eb0e";
|
|
}
|
|
|
|
.icon-flame-sharp:before {
|
|
content: "\eb0f";
|
|
}
|
|
|
|
.icon-flash:before {
|
|
content: "\eb10";
|
|
}
|
|
|
|
.icon-flashlight:before {
|
|
content: "\eb11";
|
|
}
|
|
|
|
.icon-flashlight-outline:before {
|
|
content: "\eb12";
|
|
}
|
|
|
|
.icon-flashlight-sharp:before {
|
|
content: "\eb13";
|
|
}
|
|
|
|
.icon-flash-off:before {
|
|
content: "\eb14";
|
|
}
|
|
|
|
.icon-flash-off-outline:before {
|
|
content: "\eb15";
|
|
}
|
|
|
|
.icon-flash-off-sharp:before {
|
|
content: "\eb16";
|
|
}
|
|
|
|
.icon-flash-outline:before {
|
|
content: "\eb17";
|
|
}
|
|
|
|
.icon-flash-sharp:before {
|
|
content: "\eb18";
|
|
}
|
|
|
|
.icon-flask:before {
|
|
content: "\eb19";
|
|
}
|
|
|
|
.icon-flask-outline:before {
|
|
content: "\eb1a";
|
|
}
|
|
|
|
.icon-flask-sharp:before {
|
|
content: "\eb1b";
|
|
}
|
|
|
|
.icon-flower:before {
|
|
content: "\eb1c";
|
|
}
|
|
|
|
.icon-flower-outline:before {
|
|
content: "\eb1d";
|
|
}
|
|
|
|
.icon-flower-sharp:before {
|
|
content: "\eb1e";
|
|
}
|
|
|
|
.icon-folder:before {
|
|
content: "\eb1f";
|
|
}
|
|
|
|
.icon-folder-open:before {
|
|
content: "\eb20";
|
|
}
|
|
|
|
.icon-folder-open-outline:before {
|
|
content: "\eb21";
|
|
}
|
|
|
|
.icon-folder-open-sharp:before {
|
|
content: "\eb22";
|
|
}
|
|
|
|
.icon-folder-outline:before {
|
|
content: "\eb23";
|
|
}
|
|
|
|
.icon-folder-sharp:before {
|
|
content: "\eb24";
|
|
}
|
|
|
|
.icon-football:before {
|
|
content: "\eb25";
|
|
}
|
|
|
|
.icon-football-outline:before {
|
|
content: "\eb26";
|
|
}
|
|
|
|
.icon-football-sharp:before {
|
|
content: "\eb27";
|
|
}
|
|
|
|
.icon-footsteps:before {
|
|
content: "\eb28";
|
|
}
|
|
|
|
.icon-footsteps-outline:before {
|
|
content: "\eb29";
|
|
}
|
|
|
|
.icon-footsteps-sharp:before {
|
|
content: "\eb2a";
|
|
}
|
|
|
|
.icon-funnel:before {
|
|
content: "\eb2b";
|
|
}
|
|
|
|
.icon-funnel-outline:before {
|
|
content: "\eb2c";
|
|
}
|
|
|
|
.icon-funnel-sharp:before {
|
|
content: "\eb2d";
|
|
}
|
|
|
|
.icon-game-controller:before {
|
|
content: "\eb2e";
|
|
}
|
|
|
|
.icon-game-controller-outline:before {
|
|
content: "\eb2f";
|
|
}
|
|
|
|
.icon-game-controller-sharp:before {
|
|
content: "\eb30";
|
|
}
|
|
|
|
.icon-gift:before {
|
|
content: "\eb31";
|
|
}
|
|
|
|
.icon-gift-outline:before {
|
|
content: "\eb32";
|
|
}
|
|
|
|
.icon-gift-sharp:before {
|
|
content: "\eb33";
|
|
}
|
|
|
|
.icon-git-branch:before {
|
|
content: "\eb34";
|
|
}
|
|
|
|
.icon-git-branch-outline:before {
|
|
content: "\eb35";
|
|
}
|
|
|
|
.icon-git-branch-sharp:before {
|
|
content: "\eb36";
|
|
}
|
|
|
|
.icon-git-commit:before {
|
|
content: "\eb37";
|
|
}
|
|
|
|
.icon-git-commit-outline:before {
|
|
content: "\eb38";
|
|
}
|
|
|
|
.icon-git-commit-sharp:before {
|
|
content: "\eb39";
|
|
}
|
|
|
|
.icon-git-compare:before {
|
|
content: "\eb3a";
|
|
}
|
|
|
|
.icon-git-compare-outline:before {
|
|
content: "\eb3b";
|
|
}
|
|
|
|
.icon-git-compare-sharp:before {
|
|
content: "\eb3c";
|
|
}
|
|
|
|
.icon-git-merge:before {
|
|
content: "\eb3d";
|
|
}
|
|
|
|
.icon-git-merge-outline:before {
|
|
content: "\eb3e";
|
|
}
|
|
|
|
.icon-git-merge-sharp:before {
|
|
content: "\eb3f";
|
|
}
|
|
|
|
.icon-git-network:before {
|
|
content: "\eb40";
|
|
}
|
|
|
|
.icon-git-network-outline:before {
|
|
content: "\eb41";
|
|
}
|
|
|
|
.icon-git-network-sharp:before {
|
|
content: "\eb42";
|
|
}
|
|
|
|
.icon-git-pull-request:before {
|
|
content: "\eb43";
|
|
}
|
|
|
|
.icon-git-pull-request-outline:before {
|
|
content: "\eb44";
|
|
}
|
|
|
|
.icon-git-pull-request-sharp:before {
|
|
content: "\eb45";
|
|
}
|
|
|
|
.icon-glasses:before {
|
|
content: "\eb46";
|
|
}
|
|
|
|
.icon-glasses-outline:before {
|
|
content: "\eb47";
|
|
}
|
|
|
|
.icon-glasses-sharp:before {
|
|
content: "\eb48";
|
|
}
|
|
|
|
.icon-globe:before {
|
|
content: "\eb49";
|
|
}
|
|
|
|
.icon-globe-outline:before {
|
|
content: "\eb4a";
|
|
}
|
|
|
|
.icon-globe-sharp:before {
|
|
content: "\eb4b";
|
|
}
|
|
|
|
.icon-golf:before {
|
|
content: "\eb4c";
|
|
}
|
|
|
|
.icon-golf-outline:before {
|
|
content: "\eb4d";
|
|
}
|
|
|
|
.icon-golf-sharp:before {
|
|
content: "\eb4e";
|
|
}
|
|
|
|
.icon-grid:before {
|
|
content: "\eb4f";
|
|
}
|
|
|
|
.icon-grid-outline:before {
|
|
content: "\eb50";
|
|
}
|
|
|
|
.icon-grid-sharp:before {
|
|
content: "\eb51";
|
|
}
|
|
|
|
.icon-hammer:before {
|
|
content: "\eb52";
|
|
}
|
|
|
|
.icon-hammer-outline:before {
|
|
content: "\eb53";
|
|
}
|
|
|
|
.icon-hammer-sharp:before {
|
|
content: "\eb54";
|
|
}
|
|
|
|
.icon-hand-left:before {
|
|
content: "\eb55";
|
|
}
|
|
|
|
.icon-hand-left-outline:before {
|
|
content: "\eb56";
|
|
}
|
|
|
|
.icon-hand-left-sharp:before {
|
|
content: "\eb57";
|
|
}
|
|
|
|
.icon-hand-right:before {
|
|
content: "\eb58";
|
|
}
|
|
|
|
.icon-hand-right-outline:before {
|
|
content: "\eb59";
|
|
}
|
|
|
|
.icon-hand-right-sharp:before {
|
|
content: "\eb5a";
|
|
}
|
|
|
|
.icon-happy:before {
|
|
content: "\eb5b";
|
|
}
|
|
|
|
.icon-happy-outline:before {
|
|
content: "\eb5c";
|
|
}
|
|
|
|
.icon-happy-sharp:before {
|
|
content: "\eb5d";
|
|
}
|
|
|
|
.icon-hardware-chip:before {
|
|
content: "\eb5e";
|
|
}
|
|
|
|
.icon-hardware-chip-outline:before {
|
|
content: "\eb5f";
|
|
}
|
|
|
|
.icon-hardware-chip-sharp:before {
|
|
content: "\eb60";
|
|
}
|
|
|
|
.icon-headset:before {
|
|
content: "\eb61";
|
|
}
|
|
|
|
.icon-headset-outline:before {
|
|
content: "\eb62";
|
|
}
|
|
|
|
.icon-headset-sharp:before {
|
|
content: "\eb63";
|
|
}
|
|
|
|
.icon-heart:before {
|
|
content: "\eb64";
|
|
}
|
|
|
|
.icon-heart-circle:before {
|
|
content: "\eb65";
|
|
}
|
|
|
|
.icon-heart-circle-outline:before {
|
|
content: "\eb66";
|
|
}
|
|
|
|
.icon-heart-circle-sharp:before {
|
|
content: "\eb67";
|
|
}
|
|
|
|
.icon-heart-dislike:before {
|
|
content: "\eb68";
|
|
}
|
|
|
|
.icon-heart-dislike-circle:before {
|
|
content: "\eb69";
|
|
}
|
|
|
|
.icon-heart-dislike-circle-outline:before {
|
|
content: "\eb6a";
|
|
}
|
|
|
|
.icon-heart-dislike-circle-sharp:before {
|
|
content: "\eb6b";
|
|
}
|
|
|
|
.icon-heart-dislike-outline:before {
|
|
content: "\eb6c";
|
|
}
|
|
|
|
.icon-heart-dislike-sharp:before {
|
|
content: "\eb6d";
|
|
}
|
|
|
|
.icon-heart-half:before {
|
|
content: "\eb6e";
|
|
}
|
|
|
|
.icon-heart-half-outline:before {
|
|
content: "\eb6f";
|
|
}
|
|
|
|
.icon-heart-half-sharp:before {
|
|
content: "\eb70";
|
|
}
|
|
|
|
.icon-heart-outline:before {
|
|
content: "\eb71";
|
|
}
|
|
|
|
.icon-heart-sharp:before {
|
|
content: "\eb72";
|
|
}
|
|
|
|
.icon-help:before {
|
|
content: "\eb73";
|
|
}
|
|
|
|
.icon-help-buoy:before {
|
|
content: "\eb74";
|
|
}
|
|
|
|
.icon-help-buoy-outline:before {
|
|
content: "\eb75";
|
|
}
|
|
|
|
.icon-help-buoy-sharp:before {
|
|
content: "\eb76";
|
|
}
|
|
|
|
.icon-help-circle:before {
|
|
content: "\eb77";
|
|
}
|
|
|
|
.icon-help-circle-outline:before {
|
|
content: "\eb78";
|
|
}
|
|
|
|
.icon-help-circle-sharp:before {
|
|
content: "\eb79";
|
|
}
|
|
|
|
.icon-help-outline:before {
|
|
content: "\eb7a";
|
|
}
|
|
|
|
.icon-help-sharp:before {
|
|
content: "\eb7b";
|
|
}
|
|
|
|
.icon-home:before {
|
|
content: "\eb7c";
|
|
}
|
|
|
|
.icon-home-outline:before {
|
|
content: "\eb7d";
|
|
}
|
|
|
|
.icon-home-sharp:before {
|
|
content: "\eb7e";
|
|
}
|
|
|
|
.icon-hourglass:before {
|
|
content: "\eb7f";
|
|
}
|
|
|
|
.icon-hourglass-outline:before {
|
|
content: "\eb80";
|
|
}
|
|
|
|
.icon-hourglass-sharp:before {
|
|
content: "\eb81";
|
|
}
|
|
|
|
.icon-ice-cream:before {
|
|
content: "\eb82";
|
|
}
|
|
|
|
.icon-ice-cream-outline:before {
|
|
content: "\eb83";
|
|
}
|
|
|
|
.icon-ice-cream-sharp:before {
|
|
content: "\eb84";
|
|
}
|
|
|
|
.icon-id-card:before {
|
|
content: "\eb85";
|
|
}
|
|
|
|
.icon-id-card-outline:before {
|
|
content: "\eb86";
|
|
}
|
|
|
|
.icon-id-card-sharp:before {
|
|
content: "\eb87";
|
|
}
|
|
|
|
.icon-image:before {
|
|
content: "\eb88";
|
|
}
|
|
|
|
.icon-image-outline:before {
|
|
content: "\eb89";
|
|
}
|
|
|
|
.icon-images:before {
|
|
content: "\eb8a";
|
|
}
|
|
|
|
.icon-image-sharp:before {
|
|
content: "\eb8b";
|
|
}
|
|
|
|
.icon-images-outline:before {
|
|
content: "\eb8c";
|
|
}
|
|
|
|
.icon-images-sharp:before {
|
|
content: "\eb8d";
|
|
}
|
|
|
|
.icon-infinite:before {
|
|
content: "\eb8e";
|
|
}
|
|
|
|
.icon-infinite-outline:before {
|
|
content: "\eb8f";
|
|
}
|
|
|
|
.icon-infinite-sharp:before {
|
|
content: "\eb90";
|
|
}
|
|
|
|
.icon-information:before {
|
|
content: "\eb91";
|
|
}
|
|
|
|
.icon-information-circle:before {
|
|
content: "\eb92";
|
|
}
|
|
|
|
.icon-information-circle-outline:before {
|
|
content: "\eb93";
|
|
}
|
|
|
|
.icon-information-circle-sharp:before {
|
|
content: "\eb94";
|
|
}
|
|
|
|
.icon-information-outline:before {
|
|
content: "\eb95";
|
|
}
|
|
|
|
.icon-information-sharp:before {
|
|
content: "\eb96";
|
|
}
|
|
|
|
.icon-invert-mode:before {
|
|
content: "\eb97";
|
|
}
|
|
|
|
.icon-invert-mode-outline:before {
|
|
content: "\eb98";
|
|
}
|
|
|
|
.icon-invert-mode-sharp:before {
|
|
content: "\eb99";
|
|
}
|
|
|
|
.icon-journal:before {
|
|
content: "\eb9a";
|
|
}
|
|
|
|
.icon-journal-outline:before {
|
|
content: "\eb9b";
|
|
}
|
|
|
|
.icon-journal-sharp:before {
|
|
content: "\eb9c";
|
|
}
|
|
|
|
.icon-key:before {
|
|
content: "\eb9d";
|
|
}
|
|
|
|
.icon-key-outline:before {
|
|
content: "\eb9e";
|
|
}
|
|
|
|
.icon-keypad:before {
|
|
content: "\eb9f";
|
|
}
|
|
|
|
.icon-keypad-outline:before {
|
|
content: "\eba0";
|
|
}
|
|
|
|
.icon-keypad-sharp:before {
|
|
content: "\eba1";
|
|
}
|
|
|
|
.icon-key-sharp:before {
|
|
content: "\eba2";
|
|
}
|
|
|
|
.icon-language:before {
|
|
content: "\eba3";
|
|
}
|
|
|
|
.icon-language-outline:before {
|
|
content: "\eba4";
|
|
}
|
|
|
|
.icon-language-sharp:before {
|
|
content: "\eba5";
|
|
}
|
|
|
|
.icon-laptop:before {
|
|
content: "\eba6";
|
|
}
|
|
|
|
.icon-laptop-outline:before {
|
|
content: "\eba7";
|
|
}
|
|
|
|
.icon-laptop-sharp:before {
|
|
content: "\eba8";
|
|
}
|
|
|
|
.icon-layers:before {
|
|
content: "\eba9";
|
|
}
|
|
|
|
.icon-layers-outline:before {
|
|
content: "\ebaa";
|
|
}
|
|
|
|
.icon-layers-sharp:before {
|
|
content: "\ebab";
|
|
}
|
|
|
|
.icon-leaf:before {
|
|
content: "\ebac";
|
|
}
|
|
|
|
.icon-leaf-outline:before {
|
|
content: "\ebad";
|
|
}
|
|
|
|
.icon-leaf-sharp:before {
|
|
content: "\ebae";
|
|
}
|
|
|
|
.icon-library:before {
|
|
content: "\ebaf";
|
|
}
|
|
|
|
.icon-library-outline:before {
|
|
content: "\ebb0";
|
|
}
|
|
|
|
.icon-library-sharp:before {
|
|
content: "\ebb1";
|
|
}
|
|
|
|
.icon-link:before {
|
|
content: "\ebb2";
|
|
}
|
|
|
|
.icon-link-outline:before {
|
|
content: "\ebb3";
|
|
}
|
|
|
|
.icon-link-sharp:before {
|
|
content: "\ebb4";
|
|
}
|
|
|
|
.icon-list:before {
|
|
content: "\ebb5";
|
|
}
|
|
|
|
.icon-list-circle:before {
|
|
content: "\ebb6";
|
|
}
|
|
|
|
.icon-list-circle-outline:before {
|
|
content: "\ebb7";
|
|
}
|
|
|
|
.icon-list-circle-sharp:before {
|
|
content: "\ebb8";
|
|
}
|
|
|
|
.icon-list-outline:before {
|
|
content: "\ebb9";
|
|
}
|
|
|
|
.icon-list-sharp:before {
|
|
content: "\ebba";
|
|
}
|
|
|
|
.icon-locate:before {
|
|
content: "\ebbb";
|
|
}
|
|
|
|
.icon-locate-outline:before {
|
|
content: "\ebbc";
|
|
}
|
|
|
|
.icon-locate-sharp:before {
|
|
content: "\ebbd";
|
|
}
|
|
|
|
.icon-location:before {
|
|
content: "\ebbe";
|
|
}
|
|
|
|
.icon-location-outline:before {
|
|
content: "\ebbf";
|
|
}
|
|
|
|
.icon-location-sharp:before {
|
|
content: "\ebc0";
|
|
}
|
|
|
|
.icon-lock-closed:before {
|
|
content: "\ebc1";
|
|
}
|
|
|
|
.icon-lock-closed-outline:before {
|
|
content: "\ebc2";
|
|
}
|
|
|
|
.icon-lock-closed-sharp:before {
|
|
content: "\ebc3";
|
|
}
|
|
|
|
.icon-lock-open:before {
|
|
content: "\ebc4";
|
|
}
|
|
|
|
.icon-lock-open-outline:before {
|
|
content: "\ebc5";
|
|
}
|
|
|
|
.icon-lock-open-sharp:before {
|
|
content: "\ebc6";
|
|
}
|
|
|
|
.icon-log-in:before {
|
|
content: "\ebc7";
|
|
}
|
|
|
|
.icon-log-in-outline:before {
|
|
content: "\ebc8";
|
|
}
|
|
|
|
.icon-log-in-sharp:before {
|
|
content: "\ebc9";
|
|
}
|
|
|
|
.icon-logo-alipay:before {
|
|
content: "\ebca";
|
|
}
|
|
|
|
.icon-logo-amazon:before {
|
|
content: "\ebcb";
|
|
}
|
|
|
|
.icon-logo-amplify:before {
|
|
content: "\ebcc";
|
|
}
|
|
|
|
.icon-logo-android:before {
|
|
content: "\ebcd";
|
|
}
|
|
|
|
.icon-logo-angular:before {
|
|
content: "\ebce";
|
|
}
|
|
|
|
.icon-logo-apple:before {
|
|
content: "\ebcf";
|
|
}
|
|
|
|
.icon-logo-apple-appstore:before {
|
|
content: "\ebd0";
|
|
}
|
|
|
|
.icon-logo-apple-ar:before {
|
|
content: "\ebd1";
|
|
}
|
|
|
|
.icon-logo-behance:before {
|
|
content: "\ebd2";
|
|
}
|
|
|
|
.icon-logo-bitbucket:before {
|
|
content: "\ebd3";
|
|
}
|
|
|
|
.icon-logo-bitcoin:before {
|
|
content: "\ebd4";
|
|
}
|
|
|
|
.icon-logo-buffer:before {
|
|
content: "\ebd5";
|
|
}
|
|
|
|
.icon-logo-capacitor:before {
|
|
content: "\ebd6";
|
|
}
|
|
|
|
.icon-logo-chrome:before {
|
|
content: "\ebd7";
|
|
}
|
|
|
|
.icon-logo-closed-captioning:before {
|
|
content: "\ebd8";
|
|
}
|
|
|
|
.icon-logo-codepen:before {
|
|
content: "\ebd9";
|
|
}
|
|
|
|
.icon-logo-css3:before {
|
|
content: "\ebda";
|
|
}
|
|
|
|
.icon-logo-designernews:before {
|
|
content: "\ebdb";
|
|
}
|
|
|
|
.icon-logo-deviantart:before {
|
|
content: "\ebdc";
|
|
}
|
|
|
|
.icon-logo-discord:before {
|
|
content: "\ebdd";
|
|
}
|
|
|
|
.icon-logo-docker:before {
|
|
content: "\ebde";
|
|
}
|
|
|
|
.icon-logo-dribbble:before {
|
|
content: "\ebdf";
|
|
}
|
|
|
|
.icon-logo-dropbox:before {
|
|
content: "\ebe0";
|
|
}
|
|
|
|
.icon-logo-edge:before {
|
|
content: "\ebe1";
|
|
}
|
|
|
|
.icon-logo-electron:before {
|
|
content: "\ebe2";
|
|
}
|
|
|
|
.icon-logo-euro:before {
|
|
content: "\ebe3";
|
|
}
|
|
|
|
.icon-logo-facebook:before {
|
|
content: "\ebe4";
|
|
}
|
|
|
|
.icon-logo-figma:before {
|
|
content: "\ebe5";
|
|
}
|
|
|
|
.icon-logo-firebase:before {
|
|
content: "\ebe6";
|
|
}
|
|
|
|
.icon-logo-firefox:before {
|
|
content: "\ebe7";
|
|
}
|
|
|
|
.icon-logo-flickr:before {
|
|
content: "\ebe8";
|
|
}
|
|
|
|
.icon-logo-foursquare:before {
|
|
content: "\ebe9";
|
|
}
|
|
|
|
.icon-logo-github:before {
|
|
content: "\ebea";
|
|
}
|
|
|
|
.icon-logo-gitlab:before {
|
|
content: "\ebeb";
|
|
}
|
|
|
|
.icon-logo-google:before {
|
|
content: "\ebec";
|
|
}
|
|
|
|
.icon-logo-google-playstore:before {
|
|
content: "\ebed";
|
|
}
|
|
|
|
.icon-logo-hackernews:before {
|
|
content: "\ebee";
|
|
}
|
|
|
|
.icon-logo-html5:before {
|
|
content: "\ebef";
|
|
}
|
|
|
|
.icon-logo-instagram:before {
|
|
content: "\ebf0";
|
|
}
|
|
|
|
.icon-logo-ionic:before {
|
|
content: "\ebf1";
|
|
}
|
|
|
|
.icon-logo-ionitron:before {
|
|
content: "\ebf2";
|
|
}
|
|
|
|
.icon-logo-javascript:before {
|
|
content: "\ebf3";
|
|
}
|
|
|
|
.icon-logo-laravel:before {
|
|
content: "\ebf4";
|
|
}
|
|
|
|
.icon-logo-linkedin:before {
|
|
content: "\ebf5";
|
|
}
|
|
|
|
.icon-logo-markdown:before {
|
|
content: "\ebf6";
|
|
}
|
|
|
|
.icon-logo-mastodon:before {
|
|
content: "\ebf7";
|
|
}
|
|
|
|
.icon-logo-medium:before {
|
|
content: "\ebf8";
|
|
}
|
|
|
|
.icon-logo-microsoft:before {
|
|
content: "\ebf9";
|
|
}
|
|
|
|
.icon-logo-nodejs:before {
|
|
content: "\ebfa";
|
|
}
|
|
|
|
.icon-logo-no-smoking:before {
|
|
content: "\ebfb";
|
|
}
|
|
|
|
.icon-logo-npm:before {
|
|
content: "\ebfc";
|
|
}
|
|
|
|
.icon-logo-octocat:before {
|
|
content: "\ebfd";
|
|
}
|
|
|
|
.icon-logo-paypal:before {
|
|
content: "\ebfe";
|
|
}
|
|
|
|
.icon-logo-pinterest:before {
|
|
content: "\ebff";
|
|
}
|
|
|
|
.icon-logo-playstation:before {
|
|
content: "\ec00";
|
|
}
|
|
|
|
.icon-logo-pwa:before {
|
|
content: "\ec01";
|
|
}
|
|
|
|
.icon-logo-python:before {
|
|
content: "\ec02";
|
|
}
|
|
|
|
.icon-logo-react:before {
|
|
content: "\ec03";
|
|
}
|
|
|
|
.icon-logo-reddit:before {
|
|
content: "\ec04";
|
|
}
|
|
|
|
.icon-logo-rss:before {
|
|
content: "\ec05";
|
|
}
|
|
|
|
.icon-logo-sass:before {
|
|
content: "\ec06";
|
|
}
|
|
|
|
.icon-logo-skype:before {
|
|
content: "\ec07";
|
|
}
|
|
|
|
.icon-logo-slack:before {
|
|
content: "\ec08";
|
|
}
|
|
|
|
.icon-logo-snapchat:before {
|
|
content: "\ec09";
|
|
}
|
|
|
|
.icon-logo-soundcloud:before {
|
|
content: "\ec0a";
|
|
}
|
|
|
|
.icon-logo-stackoverflow:before {
|
|
content: "\ec0b";
|
|
}
|
|
|
|
.icon-logo-steam:before {
|
|
content: "\ec0c";
|
|
}
|
|
|
|
.icon-logo-stencil:before {
|
|
content: "\ec0d";
|
|
}
|
|
|
|
.icon-logo-tableau:before {
|
|
content: "\ec0e";
|
|
}
|
|
|
|
.icon-logo-tiktok:before {
|
|
content: "\ec0f";
|
|
}
|
|
|
|
.icon-logo-tumblr:before {
|
|
content: "\ec10";
|
|
}
|
|
|
|
.icon-logo-tux:before {
|
|
content: "\ec11";
|
|
}
|
|
|
|
.icon-logo-twitch:before {
|
|
content: "\ec12";
|
|
}
|
|
|
|
.icon-logo-twitter:before {
|
|
content: "\ec13";
|
|
}
|
|
|
|
.icon-logo-usd:before {
|
|
content: "\ec14";
|
|
}
|
|
|
|
.icon-log-out:before {
|
|
content: "\ec15";
|
|
}
|
|
|
|
.icon-log-out-outline:before {
|
|
content: "\ec16";
|
|
}
|
|
|
|
.icon-log-out-sharp:before {
|
|
content: "\ec17";
|
|
}
|
|
|
|
.icon-logo-venmo:before {
|
|
content: "\ec18";
|
|
}
|
|
|
|
.icon-logo-vercel:before {
|
|
content: "\ec19";
|
|
}
|
|
|
|
.icon-logo-vimeo:before {
|
|
content: "\ec1a";
|
|
}
|
|
|
|
.icon-logo-vk:before {
|
|
content: "\ec1b";
|
|
}
|
|
|
|
.icon-logo-vue:before {
|
|
content: "\ec1c";
|
|
}
|
|
|
|
.icon-logo-web-component:before {
|
|
content: "\ec1d";
|
|
}
|
|
|
|
.icon-logo-wechat:before {
|
|
content: "\ec1e";
|
|
}
|
|
|
|
.icon-logo-whatsapp:before {
|
|
content: "\ec1f";
|
|
}
|
|
|
|
.icon-logo-windows:before {
|
|
content: "\ec20";
|
|
}
|
|
|
|
.icon-logo-wordpress:before {
|
|
content: "\ec21";
|
|
}
|
|
|
|
.icon-logo-xbox:before {
|
|
content: "\ec22";
|
|
}
|
|
|
|
.icon-logo-xing:before {
|
|
content: "\ec23";
|
|
}
|
|
|
|
.icon-logo-yahoo:before {
|
|
content: "\ec24";
|
|
}
|
|
|
|
.icon-logo-yen:before {
|
|
content: "\ec25";
|
|
}
|
|
|
|
.icon-logo-youtube:before {
|
|
content: "\ec26";
|
|
}
|
|
|
|
.icon-magnet:before {
|
|
content: "\ec27";
|
|
}
|
|
|
|
.icon-magnet-outline:before {
|
|
content: "\ec28";
|
|
}
|
|
|
|
.icon-magnet-sharp:before {
|
|
content: "\ec29";
|
|
}
|
|
|
|
.icon-mail:before {
|
|
content: "\ec2a";
|
|
}
|
|
|
|
.icon-mail-open:before {
|
|
content: "\ec2b";
|
|
}
|
|
|
|
.icon-mail-open-outline:before {
|
|
content: "\ec2c";
|
|
}
|
|
|
|
.icon-mail-open-sharp:before {
|
|
content: "\ec2d";
|
|
}
|
|
|
|
.icon-mail-outline:before {
|
|
content: "\ec2e";
|
|
}
|
|
|
|
.icon-mail-sharp:before {
|
|
content: "\ec2f";
|
|
}
|
|
|
|
.icon-mail-unread:before {
|
|
content: "\ec30";
|
|
}
|
|
|
|
.icon-mail-unread-outline:before {
|
|
content: "\ec31";
|
|
}
|
|
|
|
.icon-mail-unread-sharp:before {
|
|
content: "\ec32";
|
|
}
|
|
|
|
.icon-male:before {
|
|
content: "\ec33";
|
|
}
|
|
|
|
.icon-male-female:before {
|
|
content: "\ec34";
|
|
}
|
|
|
|
.icon-male-female-outline:before {
|
|
content: "\ec35";
|
|
}
|
|
|
|
.icon-male-female-sharp:before {
|
|
content: "\ec36";
|
|
}
|
|
|
|
.icon-male-outline:before {
|
|
content: "\ec37";
|
|
}
|
|
|
|
.icon-male-sharp:before {
|
|
content: "\ec38";
|
|
}
|
|
|
|
.icon-man:before {
|
|
content: "\ec39";
|
|
}
|
|
|
|
.icon-man-outline:before {
|
|
content: "\ec3a";
|
|
}
|
|
|
|
.icon-man-sharp:before {
|
|
content: "\ec3b";
|
|
}
|
|
|
|
.icon-map:before {
|
|
content: "\ec3c";
|
|
}
|
|
|
|
.icon-map-outline:before {
|
|
content: "\ec3d";
|
|
}
|
|
|
|
.icon-map-sharp:before {
|
|
content: "\ec3e";
|
|
}
|
|
|
|
.icon-medal:before {
|
|
content: "\ec3f";
|
|
}
|
|
|
|
.icon-medal-outline:before {
|
|
content: "\ec40";
|
|
}
|
|
|
|
.icon-medal-sharp:before {
|
|
content: "\ec41";
|
|
}
|
|
|
|
.icon-medical:before {
|
|
content: "\ec42";
|
|
}
|
|
|
|
.icon-medical-outline:before {
|
|
content: "\ec43";
|
|
}
|
|
|
|
.icon-medical-sharp:before {
|
|
content: "\ec44";
|
|
}
|
|
|
|
.icon-medkit:before {
|
|
content: "\ec45";
|
|
}
|
|
|
|
.icon-medkit-outline:before {
|
|
content: "\ec46";
|
|
}
|
|
|
|
.icon-medkit-sharp:before {
|
|
content: "\ec47";
|
|
}
|
|
|
|
.icon-megaphone:before {
|
|
content: "\ec48";
|
|
}
|
|
|
|
.icon-megaphone-outline:before {
|
|
content: "\ec49";
|
|
}
|
|
|
|
.icon-megaphone-sharp:before {
|
|
content: "\ec4a";
|
|
}
|
|
|
|
.icon-menu:before {
|
|
content: "\ec4b";
|
|
}
|
|
|
|
.icon-menu-outline:before {
|
|
content: "\ec4c";
|
|
}
|
|
|
|
.icon-menu-sharp:before {
|
|
content: "\ec4d";
|
|
}
|
|
|
|
.icon-mic:before {
|
|
content: "\ec4e";
|
|
}
|
|
|
|
.icon-mic-circle:before {
|
|
content: "\ec4f";
|
|
}
|
|
|
|
.icon-mic-circle-outline:before {
|
|
content: "\ec50";
|
|
}
|
|
|
|
.icon-mic-circle-sharp:before {
|
|
content: "\ec51";
|
|
}
|
|
|
|
.icon-mic-off:before {
|
|
content: "\ec52";
|
|
}
|
|
|
|
.icon-mic-off-circle:before {
|
|
content: "\ec53";
|
|
}
|
|
|
|
.icon-mic-off-circle-outline:before {
|
|
content: "\ec54";
|
|
}
|
|
|
|
.icon-mic-off-circle-sharp:before {
|
|
content: "\ec55";
|
|
}
|
|
|
|
.icon-mic-off-outline:before {
|
|
content: "\ec56";
|
|
}
|
|
|
|
.icon-mic-off-sharp:before {
|
|
content: "\ec57";
|
|
}
|
|
|
|
.icon-mic-outline:before {
|
|
content: "\ec58";
|
|
}
|
|
|
|
.icon-mic-sharp:before {
|
|
content: "\ec59";
|
|
}
|
|
|
|
.icon-moon:before {
|
|
content: "\ec5a";
|
|
}
|
|
|
|
.icon-moon-outline:before {
|
|
content: "\ec5b";
|
|
}
|
|
|
|
.icon-moon-sharp:before {
|
|
content: "\ec5c";
|
|
}
|
|
|
|
.icon-move:before {
|
|
content: "\ec5d";
|
|
}
|
|
|
|
.icon-move-outline:before {
|
|
content: "\ec5e";
|
|
}
|
|
|
|
.icon-move-sharp:before {
|
|
content: "\ec5f";
|
|
}
|
|
|
|
.icon-musical-note:before {
|
|
content: "\ec60";
|
|
}
|
|
|
|
.icon-musical-note-outline:before {
|
|
content: "\ec61";
|
|
}
|
|
|
|
.icon-musical-notes:before {
|
|
content: "\ec62";
|
|
}
|
|
|
|
.icon-musical-note-sharp:before {
|
|
content: "\ec63";
|
|
}
|
|
|
|
.icon-musical-notes-outline:before {
|
|
content: "\ec64";
|
|
}
|
|
|
|
.icon-musical-notes-sharp:before {
|
|
content: "\ec65";
|
|
}
|
|
|
|
.icon-navigate:before {
|
|
content: "\ec66";
|
|
}
|
|
|
|
.icon-navigate-circle:before {
|
|
content: "\ec67";
|
|
}
|
|
|
|
.icon-navigate-circle-outline:before {
|
|
content: "\ec68";
|
|
}
|
|
|
|
.icon-navigate-circle-sharp:before {
|
|
content: "\ec69";
|
|
}
|
|
|
|
.icon-navigate-outline:before {
|
|
content: "\ec6a";
|
|
}
|
|
|
|
.icon-navigate-sharp:before {
|
|
content: "\ec6b";
|
|
}
|
|
|
|
.icon-newspaper:before {
|
|
content: "\ec6c";
|
|
}
|
|
|
|
.icon-newspaper-outline:before {
|
|
content: "\ec6d";
|
|
}
|
|
|
|
.icon-newspaper-sharp:before {
|
|
content: "\ec6e";
|
|
}
|
|
|
|
.icon-notifications:before {
|
|
content: "\ec6f";
|
|
}
|
|
|
|
.icon-notifications-circle:before {
|
|
content: "\ec70";
|
|
}
|
|
|
|
.icon-notifications-circle-outline:before {
|
|
content: "\ec71";
|
|
}
|
|
|
|
.icon-notifications-circle-sharp:before {
|
|
content: "\ec72";
|
|
}
|
|
|
|
.icon-notifications-off:before {
|
|
content: "\ec73";
|
|
}
|
|
|
|
.icon-notifications-off-circle:before {
|
|
content: "\ec74";
|
|
}
|
|
|
|
.icon-notifications-off-circle-outline:before {
|
|
content: "\ec75";
|
|
}
|
|
|
|
.icon-notifications-off-circle-sharp:before {
|
|
content: "\ec76";
|
|
}
|
|
|
|
.icon-notifications-off-outline:before {
|
|
content: "\ec77";
|
|
}
|
|
|
|
.icon-notifications-off-sharp:before {
|
|
content: "\ec78";
|
|
}
|
|
|
|
.icon-notifications-outline:before {
|
|
content: "\ec79";
|
|
}
|
|
|
|
.icon-notifications-sharp:before {
|
|
content: "\ec7a";
|
|
}
|
|
|
|
.icon-nuclear:before {
|
|
content: "\ec7b";
|
|
}
|
|
|
|
.icon-nuclear-outline:before {
|
|
content: "\ec7c";
|
|
}
|
|
|
|
.icon-nuclear-sharp:before {
|
|
content: "\ec7d";
|
|
}
|
|
|
|
.icon-nutrition:before {
|
|
content: "\ec7e";
|
|
}
|
|
|
|
.icon-nutrition-outline:before {
|
|
content: "\ec7f";
|
|
}
|
|
|
|
.icon-nutrition-sharp:before {
|
|
content: "\ec80";
|
|
}
|
|
|
|
.icon-open:before {
|
|
content: "\ec81";
|
|
}
|
|
|
|
.icon-open-outline:before {
|
|
content: "\ec82";
|
|
}
|
|
|
|
.icon-open-sharp:before {
|
|
content: "\ec83";
|
|
}
|
|
|
|
.icon-options:before {
|
|
content: "\ec84";
|
|
}
|
|
|
|
.icon-options-outline:before {
|
|
content: "\ec85";
|
|
}
|
|
|
|
.icon-options-sharp:before {
|
|
content: "\ec86";
|
|
}
|
|
|
|
.icon-paper-plane:before {
|
|
content: "\ec87";
|
|
}
|
|
|
|
.icon-paper-plane-outline:before {
|
|
content: "\ec88";
|
|
}
|
|
|
|
.icon-paper-plane-sharp:before {
|
|
content: "\ec89";
|
|
}
|
|
|
|
.icon-partly-sunny:before {
|
|
content: "\ec8a";
|
|
}
|
|
|
|
.icon-partly-sunny-outline:before {
|
|
content: "\ec8b";
|
|
}
|
|
|
|
.icon-partly-sunny-sharp:before {
|
|
content: "\ec8c";
|
|
}
|
|
|
|
.icon-pause:before {
|
|
content: "\ec8d";
|
|
}
|
|
|
|
.icon-pause-circle:before {
|
|
content: "\ec8e";
|
|
}
|
|
|
|
.icon-pause-circle-outline:before {
|
|
content: "\ec8f";
|
|
}
|
|
|
|
.icon-pause-circle-sharp:before {
|
|
content: "\ec90";
|
|
}
|
|
|
|
.icon-pause-outline:before {
|
|
content: "\ec91";
|
|
}
|
|
|
|
.icon-pause-sharp:before {
|
|
content: "\ec92";
|
|
}
|
|
|
|
.icon-paw:before {
|
|
content: "\ec93";
|
|
}
|
|
|
|
.icon-paw-outline:before {
|
|
content: "\ec94";
|
|
}
|
|
|
|
.icon-paw-sharp:before {
|
|
content: "\ec95";
|
|
}
|
|
|
|
.icon-pencil:before {
|
|
content: "\ec96";
|
|
}
|
|
|
|
.icon-pencil-outline:before {
|
|
content: "\ec97";
|
|
}
|
|
|
|
.icon-pencil-sharp:before {
|
|
content: "\ec98";
|
|
}
|
|
|
|
.icon-people:before {
|
|
content: "\ec99";
|
|
}
|
|
|
|
.icon-people-circle:before {
|
|
content: "\ec9a";
|
|
}
|
|
|
|
.icon-people-circle-outline:before {
|
|
content: "\ec9b";
|
|
}
|
|
|
|
.icon-people-circle-sharp:before {
|
|
content: "\ec9c";
|
|
}
|
|
|
|
.icon-people-outline:before {
|
|
content: "\ec9d";
|
|
}
|
|
|
|
.icon-people-sharp:before {
|
|
content: "\ec9e";
|
|
}
|
|
|
|
.icon-person:before {
|
|
content: "\ec9f";
|
|
}
|
|
|
|
.icon-person-add:before {
|
|
content: "\eca0";
|
|
}
|
|
|
|
.icon-person-add-outline:before {
|
|
content: "\eca1";
|
|
}
|
|
|
|
.icon-person-add-sharp:before {
|
|
content: "\eca2";
|
|
}
|
|
|
|
.icon-person-circle:before {
|
|
content: "\eca3";
|
|
}
|
|
|
|
.icon-person-circle-outline:before {
|
|
content: "\eca4";
|
|
}
|
|
|
|
.icon-person-circle-sharp:before {
|
|
content: "\eca5";
|
|
}
|
|
|
|
.icon-person-outline:before {
|
|
content: "\eca6";
|
|
}
|
|
|
|
.icon-person-remove:before {
|
|
content: "\eca7";
|
|
}
|
|
|
|
.icon-person-remove-outline:before {
|
|
content: "\eca8";
|
|
}
|
|
|
|
.icon-person-remove-sharp:before {
|
|
content: "\eca9";
|
|
}
|
|
|
|
.icon-person-sharp:before {
|
|
content: "\ecaa";
|
|
}
|
|
|
|
.icon-phone-landscape:before {
|
|
content: "\ecab";
|
|
}
|
|
|
|
.icon-phone-landscape-outline:before {
|
|
content: "\ecac";
|
|
}
|
|
|
|
.icon-phone-landscape-sharp:before {
|
|
content: "\ecad";
|
|
}
|
|
|
|
.icon-phone-portrait:before {
|
|
content: "\ecae";
|
|
}
|
|
|
|
.icon-phone-portrait-outline:before {
|
|
content: "\ecaf";
|
|
}
|
|
|
|
.icon-phone-portrait-sharp:before {
|
|
content: "\ecb0";
|
|
}
|
|
|
|
.icon-pie-chart:before {
|
|
content: "\ecb1";
|
|
}
|
|
|
|
.icon-pie-chart-outline:before {
|
|
content: "\ecb2";
|
|
}
|
|
|
|
.icon-pie-chart-sharp:before {
|
|
content: "\ecb3";
|
|
}
|
|
|
|
.icon-pin:before {
|
|
content: "\ecb4";
|
|
}
|
|
|
|
.icon-pin-outline:before {
|
|
content: "\ecb5";
|
|
}
|
|
|
|
.icon-pin-sharp:before {
|
|
content: "\ecb6";
|
|
}
|
|
|
|
.icon-pint:before {
|
|
content: "\ecb7";
|
|
}
|
|
|
|
.icon-pint-outline:before {
|
|
content: "\ecb8";
|
|
}
|
|
|
|
.icon-pint-sharp:before {
|
|
content: "\ecb9";
|
|
}
|
|
|
|
.icon-pizza:before {
|
|
content: "\ecba";
|
|
}
|
|
|
|
.icon-pizza-outline:before {
|
|
content: "\ecbb";
|
|
}
|
|
|
|
.icon-pizza-sharp:before {
|
|
content: "\ecbc";
|
|
}
|
|
|
|
.icon-planet:before {
|
|
content: "\ecbd";
|
|
}
|
|
|
|
.icon-planet-outline:before {
|
|
content: "\ecbe";
|
|
}
|
|
|
|
.icon-planet-sharp:before {
|
|
content: "\ecbf";
|
|
}
|
|
|
|
.icon-play:before {
|
|
content: "\ecc0";
|
|
}
|
|
|
|
.icon-play-back:before {
|
|
content: "\ecc1";
|
|
}
|
|
|
|
.icon-play-back-circle:before {
|
|
content: "\ecc2";
|
|
}
|
|
|
|
.icon-play-back-circle-outline:before {
|
|
content: "\ecc3";
|
|
}
|
|
|
|
.icon-play-back-circle-sharp:before {
|
|
content: "\ecc4";
|
|
}
|
|
|
|
.icon-play-back-outline:before {
|
|
content: "\ecc5";
|
|
}
|
|
|
|
.icon-play-back-sharp:before {
|
|
content: "\ecc6";
|
|
}
|
|
|
|
.icon-play-circle:before {
|
|
content: "\ecc7";
|
|
}
|
|
|
|
.icon-play-circle-outline:before {
|
|
content: "\ecc8";
|
|
}
|
|
|
|
.icon-play-circle-sharp:before {
|
|
content: "\ecc9";
|
|
}
|
|
|
|
.icon-play-forward:before {
|
|
content: "\ecca";
|
|
}
|
|
|
|
.icon-play-forward-circle:before {
|
|
content: "\eccb";
|
|
}
|
|
|
|
.icon-play-forward-circle-outline:before {
|
|
content: "\eccc";
|
|
}
|
|
|
|
.icon-play-forward-circle-sharp:before {
|
|
content: "\eccd";
|
|
}
|
|
|
|
.icon-play-forward-outline:before {
|
|
content: "\ecce";
|
|
}
|
|
|
|
.icon-play-forward-sharp:before {
|
|
content: "\eccf";
|
|
}
|
|
|
|
.icon-play-outline:before {
|
|
content: "\ecd0";
|
|
}
|
|
|
|
.icon-play-sharp:before {
|
|
content: "\ecd1";
|
|
}
|
|
|
|
.icon-play-skip-back:before {
|
|
content: "\ecd2";
|
|
}
|
|
|
|
.icon-play-skip-back-circle:before {
|
|
content: "\ecd3";
|
|
}
|
|
|
|
.icon-play-skip-back-circle-outline:before {
|
|
content: "\ecd4";
|
|
}
|
|
|
|
.icon-play-skip-back-circle-sharp:before {
|
|
content: "\ecd5";
|
|
}
|
|
|
|
.icon-play-skip-back-outline:before {
|
|
content: "\ecd6";
|
|
}
|
|
|
|
.icon-play-skip-back-sharp:before {
|
|
content: "\ecd7";
|
|
}
|
|
|
|
.icon-play-skip-forward:before {
|
|
content: "\ecd8";
|
|
}
|
|
|
|
.icon-play-skip-forward-circle:before {
|
|
content: "\ecd9";
|
|
}
|
|
|
|
.icon-play-skip-forward-circle-outline:before {
|
|
content: "\ecda";
|
|
}
|
|
|
|
.icon-play-skip-forward-circle-sharp:before {
|
|
content: "\ecdb";
|
|
}
|
|
|
|
.icon-play-skip-forward-outline:before {
|
|
content: "\ecdc";
|
|
}
|
|
|
|
.icon-play-skip-forward-sharp:before {
|
|
content: "\ecdd";
|
|
}
|
|
|
|
.icon-podium:before {
|
|
content: "\ecde";
|
|
}
|
|
|
|
.icon-podium-outline:before {
|
|
content: "\ecdf";
|
|
}
|
|
|
|
.icon-podium-sharp:before {
|
|
content: "\ece0";
|
|
}
|
|
|
|
.icon-power:before {
|
|
content: "\ece1";
|
|
}
|
|
|
|
.icon-power-outline:before {
|
|
content: "\ece2";
|
|
}
|
|
|
|
.icon-power-sharp:before {
|
|
content: "\ece3";
|
|
}
|
|
|
|
.icon-pricetag:before {
|
|
content: "\ece4";
|
|
}
|
|
|
|
.icon-pricetag-outline:before {
|
|
content: "\ece5";
|
|
}
|
|
|
|
.icon-pricetags:before {
|
|
content: "\ece6";
|
|
}
|
|
|
|
.icon-pricetag-sharp:before {
|
|
content: "\ece7";
|
|
}
|
|
|
|
.icon-pricetags-outline:before {
|
|
content: "\ece8";
|
|
}
|
|
|
|
.icon-pricetags-sharp:before {
|
|
content: "\ece9";
|
|
}
|
|
|
|
.icon-print:before {
|
|
content: "\ecea";
|
|
}
|
|
|
|
.icon-print-outline:before {
|
|
content: "\eceb";
|
|
}
|
|
|
|
.icon-print-sharp:before {
|
|
content: "\ecec";
|
|
}
|
|
|
|
.icon-prism:before {
|
|
content: "\eced";
|
|
}
|
|
|
|
.icon-prism-outline:before {
|
|
content: "\ecee";
|
|
}
|
|
|
|
.icon-prism-sharp:before {
|
|
content: "\ecef";
|
|
}
|
|
|
|
.icon-pulse:before {
|
|
content: "\ecf0";
|
|
}
|
|
|
|
.icon-pulse-outline:before {
|
|
content: "\ecf1";
|
|
}
|
|
|
|
.icon-pulse-sharp:before {
|
|
content: "\ecf2";
|
|
}
|
|
|
|
.icon-push:before {
|
|
content: "\ecf3";
|
|
}
|
|
|
|
.icon-push-outline:before {
|
|
content: "\ecf4";
|
|
}
|
|
|
|
.icon-push-sharp:before {
|
|
content: "\ecf5";
|
|
}
|
|
|
|
.icon-qr-code:before {
|
|
content: "\ecf6";
|
|
}
|
|
|
|
.icon-qr-code-outline:before {
|
|
content: "\ecf7";
|
|
}
|
|
|
|
.icon-qr-code-sharp:before {
|
|
content: "\ecf8";
|
|
}
|
|
|
|
.icon-radio:before {
|
|
content: "\ecf9";
|
|
}
|
|
|
|
.icon-radio-button-off:before {
|
|
content: "\ecfa";
|
|
}
|
|
|
|
.icon-radio-button-off-outline:before {
|
|
content: "\ecfb";
|
|
}
|
|
|
|
.icon-radio-button-off-sharp:before {
|
|
content: "\ecfc";
|
|
}
|
|
|
|
.icon-radio-button-on:before {
|
|
content: "\ecfd";
|
|
}
|
|
|
|
.icon-radio-button-on-outline:before {
|
|
content: "\ecfe";
|
|
}
|
|
|
|
.icon-radio-button-on-sharp:before {
|
|
content: "\ecff";
|
|
}
|
|
|
|
.icon-radio-outline:before {
|
|
content: "\ed00";
|
|
}
|
|
|
|
.icon-radio-sharp:before {
|
|
content: "\ed01";
|
|
}
|
|
|
|
.icon-rainy:before {
|
|
content: "\ed02";
|
|
}
|
|
|
|
.icon-rainy-outline:before {
|
|
content: "\ed03";
|
|
}
|
|
|
|
.icon-rainy-sharp:before {
|
|
content: "\ed04";
|
|
}
|
|
|
|
.icon-reader:before {
|
|
content: "\ed05";
|
|
}
|
|
|
|
.icon-reader-outline:before {
|
|
content: "\ed06";
|
|
}
|
|
|
|
.icon-reader-sharp:before {
|
|
content: "\ed07";
|
|
}
|
|
|
|
.icon-receipt:before {
|
|
content: "\ed08";
|
|
}
|
|
|
|
.icon-receipt-outline:before {
|
|
content: "\ed09";
|
|
}
|
|
|
|
.icon-receipt-sharp:before {
|
|
content: "\ed0a";
|
|
}
|
|
|
|
.icon-recording:before {
|
|
content: "\ed0b";
|
|
}
|
|
|
|
.icon-recording-outline:before {
|
|
content: "\ed0c";
|
|
}
|
|
|
|
.icon-recording-sharp:before {
|
|
content: "\ed0d";
|
|
}
|
|
|
|
.icon-refresh:before {
|
|
content: "\ed0e";
|
|
}
|
|
|
|
.icon-refresh-circle:before {
|
|
content: "\ed0f";
|
|
}
|
|
|
|
.icon-refresh-circle-outline:before {
|
|
content: "\ed10";
|
|
}
|
|
|
|
.icon-refresh-circle-sharp:before {
|
|
content: "\ed11";
|
|
}
|
|
|
|
.icon-refresh-outline:before {
|
|
content: "\ed12";
|
|
}
|
|
|
|
.icon-refresh-sharp:before {
|
|
content: "\ed13";
|
|
}
|
|
|
|
.icon-reload:before {
|
|
content: "\ed14";
|
|
}
|
|
|
|
.icon-reload-circle:before {
|
|
content: "\ed15";
|
|
}
|
|
|
|
.icon-reload-circle-outline:before {
|
|
content: "\ed16";
|
|
}
|
|
|
|
.icon-reload-circle-sharp:before {
|
|
content: "\ed17";
|
|
}
|
|
|
|
.icon-reload-outline:before {
|
|
content: "\ed18";
|
|
}
|
|
|
|
.icon-reload-sharp:before {
|
|
content: "\ed19";
|
|
}
|
|
|
|
.icon-remove:before {
|
|
content: "\ed1a";
|
|
}
|
|
|
|
.icon-remove-circle:before {
|
|
content: "\ed1b";
|
|
}
|
|
|
|
.icon-remove-circle-outline:before {
|
|
content: "\ed1c";
|
|
}
|
|
|
|
.icon-remove-circle-sharp:before {
|
|
content: "\ed1d";
|
|
}
|
|
|
|
.icon-remove-outline:before {
|
|
content: "\ed1e";
|
|
}
|
|
|
|
.icon-remove-sharp:before {
|
|
content: "\ed1f";
|
|
}
|
|
|
|
.icon-reorder-four:before {
|
|
content: "\ed20";
|
|
}
|
|
|
|
.icon-reorder-four-outline:before {
|
|
content: "\ed21";
|
|
}
|
|
|
|
.icon-reorder-four-sharp:before {
|
|
content: "\ed22";
|
|
}
|
|
|
|
.icon-reorder-three:before {
|
|
content: "\ed23";
|
|
}
|
|
|
|
.icon-reorder-three-outline:before {
|
|
content: "\ed24";
|
|
}
|
|
|
|
.icon-reorder-three-sharp:before {
|
|
content: "\ed25";
|
|
}
|
|
|
|
.icon-reorder-two:before {
|
|
content: "\ed26";
|
|
}
|
|
|
|
.icon-reorder-two-outline:before {
|
|
content: "\ed27";
|
|
}
|
|
|
|
.icon-reorder-two-sharp:before {
|
|
content: "\ed28";
|
|
}
|
|
|
|
.icon-repeat:before {
|
|
content: "\ed29";
|
|
}
|
|
|
|
.icon-repeat-outline:before {
|
|
content: "\ed2a";
|
|
}
|
|
|
|
.icon-repeat-sharp:before {
|
|
content: "\ed2b";
|
|
}
|
|
|
|
.icon-resize:before {
|
|
content: "\ed2c";
|
|
}
|
|
|
|
.icon-resize-outline:before {
|
|
content: "\ed2d";
|
|
}
|
|
|
|
.icon-resize-sharp:before {
|
|
content: "\ed2e";
|
|
}
|
|
|
|
.icon-restaurant:before {
|
|
content: "\ed2f";
|
|
}
|
|
|
|
.icon-restaurant-outline:before {
|
|
content: "\ed30";
|
|
}
|
|
|
|
.icon-restaurant-sharp:before {
|
|
content: "\ed31";
|
|
}
|
|
|
|
.icon-return-down-back:before {
|
|
content: "\ed32";
|
|
}
|
|
|
|
.icon-return-down-back-outline:before {
|
|
content: "\ed33";
|
|
}
|
|
|
|
.icon-return-down-back-sharp:before {
|
|
content: "\ed34";
|
|
}
|
|
|
|
.icon-return-down-forward:before {
|
|
content: "\ed35";
|
|
}
|
|
|
|
.icon-return-down-forward-outline:before {
|
|
content: "\ed36";
|
|
}
|
|
|
|
.icon-return-down-forward-sharp:before {
|
|
content: "\ed37";
|
|
}
|
|
|
|
.icon-return-up-back:before {
|
|
content: "\ed38";
|
|
}
|
|
|
|
.icon-return-up-back-outline:before {
|
|
content: "\ed39";
|
|
}
|
|
|
|
.icon-return-up-back-sharp:before {
|
|
content: "\ed3a";
|
|
}
|
|
|
|
.icon-return-up-forward:before {
|
|
content: "\ed3b";
|
|
}
|
|
|
|
.icon-return-up-forward-outline:before {
|
|
content: "\ed3c";
|
|
}
|
|
|
|
.icon-return-up-forward-sharp:before {
|
|
content: "\ed3d";
|
|
}
|
|
|
|
.icon-ribbon:before {
|
|
content: "\ed3e";
|
|
}
|
|
|
|
.icon-ribbon-outline:before {
|
|
content: "\ed3f";
|
|
}
|
|
|
|
.icon-ribbon-sharp:before {
|
|
content: "\ed40";
|
|
}
|
|
|
|
.icon-rocket:before {
|
|
content: "\ed41";
|
|
}
|
|
|
|
.icon-rocket-outline:before {
|
|
content: "\ed42";
|
|
}
|
|
|
|
.icon-rocket-sharp:before {
|
|
content: "\ed43";
|
|
}
|
|
|
|
.icon-rose:before {
|
|
content: "\ed44";
|
|
}
|
|
|
|
.icon-rose-outline:before {
|
|
content: "\ed45";
|
|
}
|
|
|
|
.icon-rose-sharp:before {
|
|
content: "\ed46";
|
|
}
|
|
|
|
.icon-sad:before {
|
|
content: "\ed47";
|
|
}
|
|
|
|
.icon-sad-outline:before {
|
|
content: "\ed48";
|
|
}
|
|
|
|
.icon-sad-sharp:before {
|
|
content: "\ed49";
|
|
}
|
|
|
|
.icon-save:before {
|
|
content: "\ed4a";
|
|
}
|
|
|
|
.icon-save-outline:before {
|
|
content: "\ed4b";
|
|
}
|
|
|
|
.icon-save-sharp:before {
|
|
content: "\ed4c";
|
|
}
|
|
|
|
.icon-scale:before {
|
|
content: "\ed4d";
|
|
}
|
|
|
|
.icon-scale-outline:before {
|
|
content: "\ed4e";
|
|
}
|
|
|
|
.icon-scale-sharp:before {
|
|
content: "\ed4f";
|
|
}
|
|
|
|
.icon-scan:before {
|
|
content: "\ed50";
|
|
}
|
|
|
|
.icon-scan-circle:before {
|
|
content: "\ed51";
|
|
}
|
|
|
|
.icon-scan-circle-outline:before {
|
|
content: "\ed52";
|
|
}
|
|
|
|
.icon-scan-circle-sharp:before {
|
|
content: "\ed53";
|
|
}
|
|
|
|
.icon-scan-outline:before {
|
|
content: "\ed54";
|
|
}
|
|
|
|
.icon-scan-sharp:before {
|
|
content: "\ed55";
|
|
}
|
|
|
|
.icon-school:before {
|
|
content: "\ed56";
|
|
}
|
|
|
|
.icon-school-outline:before {
|
|
content: "\ed57";
|
|
}
|
|
|
|
.icon-school-sharp:before {
|
|
content: "\ed58";
|
|
}
|
|
|
|
.icon-search:before {
|
|
content: "\ed59";
|
|
}
|
|
|
|
.icon-search-circle:before {
|
|
content: "\ed5a";
|
|
}
|
|
|
|
.icon-search-circle-outline:before {
|
|
content: "\ed5b";
|
|
}
|
|
|
|
.icon-search-circle-sharp:before {
|
|
content: "\ed5c";
|
|
}
|
|
|
|
.icon-search-outline:before {
|
|
content: "\ed5d";
|
|
}
|
|
|
|
.icon-search-sharp:before {
|
|
content: "\ed5e";
|
|
}
|
|
|
|
.icon-send:before {
|
|
content: "\ed5f";
|
|
}
|
|
|
|
.icon-send-outline:before {
|
|
content: "\ed60";
|
|
}
|
|
|
|
.icon-send-sharp:before {
|
|
content: "\ed61";
|
|
}
|
|
|
|
.icon-server:before {
|
|
content: "\ed62";
|
|
}
|
|
|
|
.icon-server-outline:before {
|
|
content: "\ed63";
|
|
}
|
|
|
|
.icon-server-sharp:before {
|
|
content: "\ed64";
|
|
}
|
|
|
|
.icon-settings:before {
|
|
content: "\ed65";
|
|
}
|
|
|
|
.icon-settings-outline:before {
|
|
content: "\ed66";
|
|
}
|
|
|
|
.icon-settings-sharp:before {
|
|
content: "\ed67";
|
|
}
|
|
|
|
.icon-shapes:before {
|
|
content: "\ed68";
|
|
}
|
|
|
|
.icon-shapes-outline:before {
|
|
content: "\ed69";
|
|
}
|
|
|
|
.icon-shapes-sharp:before {
|
|
content: "\ed6a";
|
|
}
|
|
|
|
.icon-share:before {
|
|
content: "\ed6b";
|
|
}
|
|
|
|
.icon-share-outline:before {
|
|
content: "\ed6c";
|
|
}
|
|
|
|
.icon-share-sharp:before {
|
|
content: "\ed6d";
|
|
}
|
|
|
|
.icon-share-social:before {
|
|
content: "\ed6e";
|
|
}
|
|
|
|
.icon-share-social-outline:before {
|
|
content: "\ed6f";
|
|
}
|
|
|
|
.icon-share-social-sharp:before {
|
|
content: "\ed70";
|
|
}
|
|
|
|
.icon-shield:before {
|
|
content: "\ed71";
|
|
}
|
|
|
|
.icon-shield-checkmark:before {
|
|
content: "\ed72";
|
|
}
|
|
|
|
.icon-shield-checkmark-outline:before {
|
|
content: "\ed73";
|
|
}
|
|
|
|
.icon-shield-checkmark-sharp:before {
|
|
content: "\ed74";
|
|
}
|
|
|
|
.icon-shield-half:before {
|
|
content: "\ed75";
|
|
}
|
|
|
|
.icon-shield-half-outline:before {
|
|
content: "\ed76";
|
|
}
|
|
|
|
.icon-shield-half-sharp:before {
|
|
content: "\ed77";
|
|
}
|
|
|
|
.icon-shield-outline:before {
|
|
content: "\ed78";
|
|
}
|
|
|
|
.icon-shield-sharp:before {
|
|
content: "\ed79";
|
|
}
|
|
|
|
.icon-shirt:before {
|
|
content: "\ed7a";
|
|
}
|
|
|
|
.icon-shirt-outline:before {
|
|
content: "\ed7b";
|
|
}
|
|
|
|
.icon-shirt-sharp:before {
|
|
content: "\ed7c";
|
|
}
|
|
|
|
.icon-shuffle:before {
|
|
content: "\ed7d";
|
|
}
|
|
|
|
.icon-shuffle-outline:before {
|
|
content: "\ed7e";
|
|
}
|
|
|
|
.icon-shuffle-sharp:before {
|
|
content: "\ed7f";
|
|
}
|
|
|
|
.icon-skull:before {
|
|
content: "\ed80";
|
|
}
|
|
|
|
.icon-skull-outline:before {
|
|
content: "\ed81";
|
|
}
|
|
|
|
.icon-skull-sharp:before {
|
|
content: "\ed82";
|
|
}
|
|
|
|
.icon-snow:before {
|
|
content: "\ed83";
|
|
}
|
|
|
|
.icon-snow-outline:before {
|
|
content: "\ed84";
|
|
}
|
|
|
|
.icon-snow-sharp:before {
|
|
content: "\ed85";
|
|
}
|
|
|
|
.icon-sparkles:before {
|
|
content: "\ed86";
|
|
}
|
|
|
|
.icon-sparkles-outline:before {
|
|
content: "\ed87";
|
|
}
|
|
|
|
.icon-sparkles-sharp:before {
|
|
content: "\ed88";
|
|
}
|
|
|
|
.icon-speedometer:before {
|
|
content: "\ed89";
|
|
}
|
|
|
|
.icon-speedometer-outline:before {
|
|
content: "\ed8a";
|
|
}
|
|
|
|
.icon-speedometer-sharp:before {
|
|
content: "\ed8b";
|
|
}
|
|
|
|
.icon-square:before {
|
|
content: "\ed8c";
|
|
}
|
|
|
|
.icon-square-outline:before {
|
|
content: "\ed8d";
|
|
}
|
|
|
|
.icon-square-sharp:before {
|
|
content: "\ed8e";
|
|
}
|
|
|
|
.icon-star:before {
|
|
content: "\ed8f";
|
|
}
|
|
|
|
.icon-star-half:before {
|
|
content: "\ed90";
|
|
}
|
|
|
|
.icon-star-half-outline:before {
|
|
content: "\ed91";
|
|
}
|
|
|
|
.icon-star-half-sharp:before {
|
|
content: "\ed92";
|
|
}
|
|
|
|
.icon-star-outline:before {
|
|
content: "\ed93";
|
|
}
|
|
|
|
.icon-star-sharp:before {
|
|
content: "\ed94";
|
|
}
|
|
|
|
.icon-stats-chart:before {
|
|
content: "\ed95";
|
|
}
|
|
|
|
.icon-stats-chart-outline:before {
|
|
content: "\ed96";
|
|
}
|
|
|
|
.icon-stats-chart-sharp:before {
|
|
content: "\ed97";
|
|
}
|
|
|
|
.icon-stop:before {
|
|
content: "\ed98";
|
|
}
|
|
|
|
.icon-stop-circle:before {
|
|
content: "\ed99";
|
|
}
|
|
|
|
.icon-stop-circle-outline:before {
|
|
content: "\ed9a";
|
|
}
|
|
|
|
.icon-stop-circle-sharp:before {
|
|
content: "\ed9b";
|
|
}
|
|
|
|
.icon-stop-outline:before {
|
|
content: "\ed9c";
|
|
}
|
|
|
|
.icon-stop-sharp:before {
|
|
content: "\ed9d";
|
|
}
|
|
|
|
.icon-stopwatch:before {
|
|
content: "\ed9e";
|
|
}
|
|
|
|
.icon-stopwatch-outline:before {
|
|
content: "\ed9f";
|
|
}
|
|
|
|
.icon-stopwatch-sharp:before {
|
|
content: "\eda0";
|
|
}
|
|
|
|
.icon-storefront:before {
|
|
content: "\eda1";
|
|
}
|
|
|
|
.icon-storefront-outline:before {
|
|
content: "\eda2";
|
|
}
|
|
|
|
.icon-storefront-sharp:before {
|
|
content: "\eda3";
|
|
}
|
|
|
|
.icon-subway:before {
|
|
content: "\eda4";
|
|
}
|
|
|
|
.icon-subway-outline:before {
|
|
content: "\eda5";
|
|
}
|
|
|
|
.icon-subway-sharp:before {
|
|
content: "\eda6";
|
|
}
|
|
|
|
.icon-sunny:before {
|
|
content: "\eda7";
|
|
}
|
|
|
|
.icon-sunny-outline:before {
|
|
content: "\eda8";
|
|
}
|
|
|
|
.icon-sunny-sharp:before {
|
|
content: "\eda9";
|
|
}
|
|
|
|
.icon-swap-horizontal:before {
|
|
content: "\edaa";
|
|
}
|
|
|
|
.icon-swap-horizontal-outline:before {
|
|
content: "\edab";
|
|
}
|
|
|
|
.icon-swap-horizontal-sharp:before {
|
|
content: "\edac";
|
|
}
|
|
|
|
.icon-swap-vertical:before {
|
|
content: "\edad";
|
|
}
|
|
|
|
.icon-swap-vertical-outline:before {
|
|
content: "\edae";
|
|
}
|
|
|
|
.icon-swap-vertical-sharp:before {
|
|
content: "\edaf";
|
|
}
|
|
|
|
.icon-sync:before {
|
|
content: "\edb0";
|
|
}
|
|
|
|
.icon-sync-circle:before {
|
|
content: "\edb1";
|
|
}
|
|
|
|
.icon-sync-circle-outline:before {
|
|
content: "\edb2";
|
|
}
|
|
|
|
.icon-sync-circle-sharp:before {
|
|
content: "\edb3";
|
|
}
|
|
|
|
.icon-sync-outline:before {
|
|
content: "\edb4";
|
|
}
|
|
|
|
.icon-sync-sharp:before {
|
|
content: "\edb5";
|
|
}
|
|
|
|
.icon-tablet-landscape:before {
|
|
content: "\edb6";
|
|
}
|
|
|
|
.icon-tablet-landscape-outline:before {
|
|
content: "\edb7";
|
|
}
|
|
|
|
.icon-tablet-landscape-sharp:before {
|
|
content: "\edb8";
|
|
}
|
|
|
|
.icon-tablet-portrait:before {
|
|
content: "\edb9";
|
|
}
|
|
|
|
.icon-tablet-portrait-outline:before {
|
|
content: "\edba";
|
|
}
|
|
|
|
.icon-tablet-portrait-sharp:before {
|
|
content: "\edbb";
|
|
}
|
|
|
|
.icon-telescope:before {
|
|
content: "\edbc";
|
|
}
|
|
|
|
.icon-telescope-outline:before {
|
|
content: "\edbd";
|
|
}
|
|
|
|
.icon-telescope-sharp:before {
|
|
content: "\edbe";
|
|
}
|
|
|
|
.icon-tennisball:before {
|
|
content: "\edbf";
|
|
}
|
|
|
|
.icon-tennisball-outline:before {
|
|
content: "\edc0";
|
|
}
|
|
|
|
.icon-tennisball-sharp:before {
|
|
content: "\edc1";
|
|
}
|
|
|
|
.icon-terminal:before {
|
|
content: "\edc2";
|
|
}
|
|
|
|
.icon-terminal-outline:before {
|
|
content: "\edc3";
|
|
}
|
|
|
|
.icon-terminal-sharp:before {
|
|
content: "\edc4";
|
|
}
|
|
|
|
.icon-text:before {
|
|
content: "\edc5";
|
|
}
|
|
|
|
.icon-text-outline:before {
|
|
content: "\edc6";
|
|
}
|
|
|
|
.icon-text-sharp:before {
|
|
content: "\edc7";
|
|
}
|
|
|
|
.icon-thermometer:before {
|
|
content: "\edc8";
|
|
}
|
|
|
|
.icon-thermometer-outline:before {
|
|
content: "\edc9";
|
|
}
|
|
|
|
.icon-thermometer-sharp:before {
|
|
content: "\edca";
|
|
}
|
|
|
|
.icon-thumbs-down:before {
|
|
content: "\edcb";
|
|
}
|
|
|
|
.icon-thumbs-down-outline:before {
|
|
content: "\edcc";
|
|
}
|
|
|
|
.icon-thumbs-down-sharp:before {
|
|
content: "\edcd";
|
|
}
|
|
|
|
.icon-thumbs-up:before {
|
|
content: "\edce";
|
|
}
|
|
|
|
.icon-thumbs-up-outline:before {
|
|
content: "\edcf";
|
|
}
|
|
|
|
.icon-thumbs-up-sharp:before {
|
|
content: "\edd0";
|
|
}
|
|
|
|
.icon-thunderstorm:before {
|
|
content: "\edd1";
|
|
}
|
|
|
|
.icon-thunderstorm-outline:before {
|
|
content: "\edd2";
|
|
}
|
|
|
|
.icon-thunderstorm-sharp:before {
|
|
content: "\edd3";
|
|
}
|
|
|
|
.icon-ticket:before {
|
|
content: "\edd4";
|
|
}
|
|
|
|
.icon-ticket-outline:before {
|
|
content: "\edd5";
|
|
}
|
|
|
|
.icon-ticket-sharp:before {
|
|
content: "\edd6";
|
|
}
|
|
|
|
.icon-time:before {
|
|
content: "\edd7";
|
|
}
|
|
|
|
.icon-time-outline:before {
|
|
content: "\edd8";
|
|
}
|
|
|
|
.icon-timer:before {
|
|
content: "\edd9";
|
|
}
|
|
|
|
.icon-timer-outline:before {
|
|
content: "\edda";
|
|
}
|
|
|
|
.icon-timer-sharp:before {
|
|
content: "\eddb";
|
|
}
|
|
|
|
.icon-time-sharp:before {
|
|
content: "\eddc";
|
|
}
|
|
|
|
.icon-today:before {
|
|
content: "\eddd";
|
|
}
|
|
|
|
.icon-today-outline:before {
|
|
content: "\edde";
|
|
}
|
|
|
|
.icon-today-sharp:before {
|
|
content: "\eddf";
|
|
}
|
|
|
|
.icon-toggle:before {
|
|
content: "\ede0";
|
|
}
|
|
|
|
.icon-toggle-outline:before {
|
|
content: "\ede1";
|
|
}
|
|
|
|
.icon-toggle-sharp:before {
|
|
content: "\ede2";
|
|
}
|
|
|
|
.icon-trail-sign:before {
|
|
content: "\ede3";
|
|
}
|
|
|
|
.icon-trail-sign-outline:before {
|
|
content: "\ede4";
|
|
}
|
|
|
|
.icon-trail-sign-sharp:before {
|
|
content: "\ede5";
|
|
}
|
|
|
|
.icon-train:before {
|
|
content: "\ede6";
|
|
}
|
|
|
|
.icon-train-outline:before {
|
|
content: "\ede7";
|
|
}
|
|
|
|
.icon-train-sharp:before {
|
|
content: "\ede8";
|
|
}
|
|
|
|
.icon-transgender:before {
|
|
content: "\ede9";
|
|
}
|
|
|
|
.icon-transgender-outline:before {
|
|
content: "\edea";
|
|
}
|
|
|
|
.icon-transgender-sharp:before {
|
|
content: "\edeb";
|
|
}
|
|
|
|
.icon-trash:before {
|
|
content: "\edec";
|
|
}
|
|
|
|
.icon-trash-bin:before {
|
|
content: "\eded";
|
|
}
|
|
|
|
.icon-trash-bin-outline:before {
|
|
content: "\edee";
|
|
}
|
|
|
|
.icon-trash-bin-sharp:before {
|
|
content: "\edef";
|
|
}
|
|
|
|
.icon-trash-outline:before {
|
|
content: "\edf0";
|
|
}
|
|
|
|
.icon-trash-sharp:before {
|
|
content: "\edf1";
|
|
}
|
|
|
|
.icon-trending-down:before {
|
|
content: "\edf2";
|
|
}
|
|
|
|
.icon-trending-down-outline:before {
|
|
content: "\edf3";
|
|
}
|
|
|
|
.icon-trending-down-sharp:before {
|
|
content: "\edf4";
|
|
}
|
|
|
|
.icon-trending-up:before {
|
|
content: "\edf5";
|
|
}
|
|
|
|
.icon-trending-up-outline:before {
|
|
content: "\edf6";
|
|
}
|
|
|
|
.icon-trending-up-sharp:before {
|
|
content: "\edf7";
|
|
}
|
|
|
|
.icon-triangle:before {
|
|
content: "\edf8";
|
|
}
|
|
|
|
.icon-triangle-outline:before {
|
|
content: "\edf9";
|
|
}
|
|
|
|
.icon-triangle-sharp:before {
|
|
content: "\edfa";
|
|
}
|
|
|
|
.icon-trophy:before {
|
|
content: "\edfb";
|
|
}
|
|
|
|
.icon-trophy-outline:before {
|
|
content: "\edfc";
|
|
}
|
|
|
|
.icon-trophy-sharp:before {
|
|
content: "\edfd";
|
|
}
|
|
|
|
.icon-tv:before {
|
|
content: "\edfe";
|
|
}
|
|
|
|
.icon-tv-outline:before {
|
|
content: "\edff";
|
|
}
|
|
|
|
.icon-tv-sharp:before {
|
|
content: "\ee00";
|
|
}
|
|
|
|
.icon-umbrella:before {
|
|
content: "\ee01";
|
|
}
|
|
|
|
.icon-umbrella-outline:before {
|
|
content: "\ee02";
|
|
}
|
|
|
|
.icon-umbrella-sharp:before {
|
|
content: "\ee03";
|
|
}
|
|
|
|
.icon-unlink:before {
|
|
content: "\ee04";
|
|
}
|
|
|
|
.icon-unlink-outline:before {
|
|
content: "\ee05";
|
|
}
|
|
|
|
.icon-unlink-sharp:before {
|
|
content: "\ee06";
|
|
}
|
|
|
|
.icon-videocam:before {
|
|
content: "\ee07";
|
|
}
|
|
|
|
.icon-videocam-off:before {
|
|
content: "\ee08";
|
|
}
|
|
|
|
.icon-videocam-off-outline:before {
|
|
content: "\ee09";
|
|
}
|
|
|
|
.icon-videocam-off-sharp:before {
|
|
content: "\ee0a";
|
|
}
|
|
|
|
.icon-videocam-outline:before {
|
|
content: "\ee0b";
|
|
}
|
|
|
|
.icon-videocam-sharp:before {
|
|
content: "\ee0c";
|
|
}
|
|
|
|
.icon-volume-high:before {
|
|
content: "\ee0d";
|
|
}
|
|
|
|
.icon-volume-high-outline:before {
|
|
content: "\ee0e";
|
|
}
|
|
|
|
.icon-volume-high-sharp:before {
|
|
content: "\ee0f";
|
|
}
|
|
|
|
.icon-volume-low:before {
|
|
content: "\ee10";
|
|
}
|
|
|
|
.icon-volume-low-outline:before {
|
|
content: "\ee11";
|
|
}
|
|
|
|
.icon-volume-low-sharp:before {
|
|
content: "\ee12";
|
|
}
|
|
|
|
.icon-volume-medium:before {
|
|
content: "\ee13";
|
|
}
|
|
|
|
.icon-volume-medium-outline:before {
|
|
content: "\ee14";
|
|
}
|
|
|
|
.icon-volume-medium-sharp:before {
|
|
content: "\ee15";
|
|
}
|
|
|
|
.icon-volume-mute:before {
|
|
content: "\ee16";
|
|
}
|
|
|
|
.icon-volume-mute-outline:before {
|
|
content: "\ee17";
|
|
}
|
|
|
|
.icon-volume-mute-sharp:before {
|
|
content: "\ee18";
|
|
}
|
|
|
|
.icon-volume-off:before {
|
|
content: "\ee19";
|
|
}
|
|
|
|
.icon-volume-off-outline:before {
|
|
content: "\ee1a";
|
|
}
|
|
|
|
.icon-volume-off-sharp:before {
|
|
content: "\ee1b";
|
|
}
|
|
|
|
.icon-walk:before {
|
|
content: "\ee1c";
|
|
}
|
|
|
|
.icon-walk-outline:before {
|
|
content: "\ee1d";
|
|
}
|
|
|
|
.icon-walk-sharp:before {
|
|
content: "\ee1e";
|
|
}
|
|
|
|
.icon-wallet:before {
|
|
content: "\ee1f";
|
|
}
|
|
|
|
.icon-wallet-outline:before {
|
|
content: "\ee20";
|
|
}
|
|
|
|
.icon-wallet-sharp:before {
|
|
content: "\ee21";
|
|
}
|
|
|
|
.icon-warning:before {
|
|
content: "\ee22";
|
|
}
|
|
|
|
.icon-warning-outline:before {
|
|
content: "\ee23";
|
|
}
|
|
|
|
.icon-warning-sharp:before {
|
|
content: "\ee24";
|
|
}
|
|
|
|
.icon-watch:before {
|
|
content: "\ee25";
|
|
}
|
|
|
|
.icon-watch-outline:before {
|
|
content: "\ee26";
|
|
}
|
|
|
|
.icon-watch-sharp:before {
|
|
content: "\ee27";
|
|
}
|
|
|
|
.icon-water:before {
|
|
content: "\ee28";
|
|
}
|
|
|
|
.icon-water-outline:before {
|
|
content: "\ee29";
|
|
}
|
|
|
|
.icon-water-sharp:before {
|
|
content: "\ee2a";
|
|
}
|
|
|
|
.icon-wifi:before {
|
|
content: "\ee2b";
|
|
}
|
|
|
|
.icon-wifi-outline:before {
|
|
content: "\ee2c";
|
|
}
|
|
|
|
.icon-wifi-sharp:before {
|
|
content: "\ee2d";
|
|
}
|
|
|
|
.icon-wine:before {
|
|
content: "\ee2e";
|
|
}
|
|
|
|
.icon-wine-outline:before {
|
|
content: "\ee2f";
|
|
}
|
|
|
|
.icon-wine-sharp:before {
|
|
content: "\ee30";
|
|
}
|
|
|
|
.icon-woman:before {
|
|
content: "\ee31";
|
|
}
|
|
|
|
.icon-woman-outline:before {
|
|
content: "\ee32";
|
|
}
|
|
|
|
.icon-woman-sharp:before {
|
|
content: "\ee33";
|
|
}
|
|
|
|
.la, .header-arrow,
|
|
.lar,
|
|
.las,
|
|
.lab {
|
|
-moz-osx-font-smoothing: grayscale;
|
|
-webkit-font-smoothing: antialiased;
|
|
display: inline-block;
|
|
font-style: normal;
|
|
font-variant: normal;
|
|
text-rendering: auto;
|
|
}
|
|
|
|
@font-face {
|
|
font-family: Line Awesome Brands;
|
|
font-style: normal;
|
|
font-weight: normal;
|
|
font-display: swap;
|
|
src: url("../../../fonts/line-awesome/la-brands-400.eot");
|
|
src: url("../../../fonts/line-awesome/la-brands-400.eot?#iefix") format("embedded-opentype"), url("../../../fonts/line-awesome/la-brands-400.woff2") format("woff2"), url("../../../fonts/line-awesome/la-brands-400.woff") format("woff"), url("../../../fonts/line-awesome/la-brands-400.ttf") format("truetype"), url("../../../fonts/line-awesome/la-brands-400.svg#lineawesome") format("svg");
|
|
}
|
|
.lab {
|
|
font-family: Line Awesome Brands, monospace;
|
|
font-weight: 400;
|
|
line-height: var(--bs-body-line-height);
|
|
}
|
|
|
|
@font-face {
|
|
font-family: Line Awesome Free;
|
|
font-style: normal;
|
|
font-weight: 400;
|
|
font-display: swap;
|
|
src: url("../../../fonts/line-awesome/la-regular-400.eot");
|
|
src: url("../../../fonts/line-awesome/la-regular-400.eot?#iefix") format("embedded-opentype"), url("../../../fonts/line-awesome/la-regular-400.woff2") format("woff2"), url("../../../fonts/line-awesome/la-regular-400.woff") format("woff"), url("../../../fonts/line-awesome/la-regular-400.ttf") format("truetype"), url("../../../fonts/line-awesome/la-regular-400.svg#lineawesome") format("svg");
|
|
}
|
|
.la, .header-arrow {
|
|
font-family: Line Awesome Free, monospace;
|
|
font-weight: 400;
|
|
line-height: var(--bs-body-line-height);
|
|
}
|
|
|
|
@font-face {
|
|
font-family: Line Awesome Free;
|
|
font-style: normal;
|
|
font-weight: 410;
|
|
font-display: swap;
|
|
src: url("../../../fonts/line-awesome/la-solid-900.eot");
|
|
src: url("../../../fonts/line-awesome/la-solid-900.eot?#iefix") format("embedded-opentype"), url("../../../fonts/line-awesome/la-solid-900.woff2") format("woff2"), url("../../../fonts/line-awesome/la-solid-900.woff") format("woff"), url("../../../fonts/line-awesome/la-solid-900.ttf") format("truetype"), url("../../../fonts/line-awesome/la-solid-900.svg#lineawesome") format("svg");
|
|
}
|
|
.la, .header-arrow {
|
|
font-family: Line Awesome Free, monospace;
|
|
font-weight: 410;
|
|
line-height: var(--bs-body-line-height);
|
|
}
|
|
|
|
.la.la-lg, .la-lg.header-arrow {
|
|
font-size: 1.33333em;
|
|
line-height: 1.2em;
|
|
vertical-align: -0.0667em;
|
|
}
|
|
|
|
.la-xs {
|
|
font-size: 0.75em;
|
|
}
|
|
|
|
.la-2x {
|
|
font-size: 1em;
|
|
}
|
|
|
|
.la-2x {
|
|
font-size: 2em;
|
|
}
|
|
|
|
.la-3x {
|
|
font-size: 3em;
|
|
}
|
|
|
|
.la-4x {
|
|
font-size: 4em;
|
|
}
|
|
|
|
.la-5x {
|
|
font-size: 5em;
|
|
}
|
|
|
|
.la-6x {
|
|
font-size: 6em;
|
|
}
|
|
|
|
.la-7x {
|
|
font-size: 7em;
|
|
}
|
|
|
|
.la-8x {
|
|
font-size: 8em;
|
|
}
|
|
|
|
.la-9x {
|
|
font-size: 9em;
|
|
}
|
|
|
|
.la-10x {
|
|
font-size: 10em;
|
|
}
|
|
|
|
.la-fw {
|
|
text-align: center;
|
|
width: 1.25em;
|
|
}
|
|
|
|
.la-fw {
|
|
width: 1.25em;
|
|
text-align: center;
|
|
}
|
|
|
|
.la-ul {
|
|
padding-left: 0;
|
|
margin-left: 1.4285714286em;
|
|
list-style-type: none;
|
|
}
|
|
.la-ul > li {
|
|
position: relative;
|
|
}
|
|
|
|
.la-li {
|
|
position: absolute;
|
|
left: -2em;
|
|
text-align: center;
|
|
width: 1.4285714286em;
|
|
line-height: inherit;
|
|
}
|
|
.la-li.la-lg {
|
|
left: -1.1428571429em;
|
|
}
|
|
|
|
.la-border {
|
|
border: solid 0.08em var(--bs-border-color);
|
|
border-radius: 0.1em;
|
|
padding: 0.2em 0.25em 0.15em;
|
|
}
|
|
|
|
.la-pull-left {
|
|
float: left;
|
|
}
|
|
|
|
.la-pull-right {
|
|
float: right;
|
|
}
|
|
|
|
.la.la-pull-left, .la-pull-left.header-arrow {
|
|
margin-right: 0.3em;
|
|
}
|
|
.la.la-pull-right, .la-pull-right.header-arrow {
|
|
margin-left: 0.3em;
|
|
}
|
|
|
|
.la.pull-left, .pull-left.header-arrow {
|
|
margin-right: 0.3em;
|
|
}
|
|
.la.pull-right, .pull-right.header-arrow {
|
|
margin-left: 0.3em;
|
|
}
|
|
|
|
.la-pull-left {
|
|
float: left;
|
|
}
|
|
|
|
.la-pull-right {
|
|
float: right;
|
|
}
|
|
|
|
.la.la-pull-left, .la-pull-left.header-arrow,
|
|
.las.la-pull-left,
|
|
.lar.la-pull-left,
|
|
.lal.la-pull-left,
|
|
.lab.la-pull-left {
|
|
margin-right: 0.3em;
|
|
}
|
|
|
|
.la.la-pull-right, .la-pull-right.header-arrow,
|
|
.las.la-pull-right,
|
|
.lar.la-pull-right,
|
|
.lal.la-pull-right,
|
|
.lab.la-pull-right {
|
|
margin-left: 0.3em;
|
|
}
|
|
|
|
.la-spin {
|
|
-webkit-animation: la-spin 2s infinite linear;
|
|
animation: la-spin 2s infinite linear;
|
|
}
|
|
|
|
.la-pulse {
|
|
-webkit-animation: la-spin 1s infinite steps(8);
|
|
animation: la-spin 1s infinite steps(8);
|
|
}
|
|
|
|
@-webkit-keyframes la-spin {
|
|
0% {
|
|
-webkit-transform: rotate(0deg);
|
|
transform: rotate(0deg);
|
|
}
|
|
100% {
|
|
-webkit-transform: rotate(360deg);
|
|
transform: rotate(360deg);
|
|
}
|
|
}
|
|
@keyframes la-spin {
|
|
0% {
|
|
-webkit-transform: rotate(0deg);
|
|
transform: rotate(0deg);
|
|
}
|
|
100% {
|
|
-webkit-transform: rotate(360deg);
|
|
transform: rotate(360deg);
|
|
}
|
|
}
|
|
.la-rotate-90 {
|
|
-ms-filter: "progid:DXImageTransform.Microsoft.BasicImage(rotation=1)";
|
|
-webkit-transform: rotate(90deg);
|
|
transform: rotate(90deg);
|
|
}
|
|
|
|
.la-rotate-180 {
|
|
-ms-filter: "progid:DXImageTransform.Microsoft.BasicImage(rotation=2)";
|
|
-webkit-transform: rotate(180deg);
|
|
transform: rotate(180deg);
|
|
}
|
|
|
|
.la-rotate-270 {
|
|
-ms-filter: "progid:DXImageTransform.Microsoft.BasicImage(rotation=3)";
|
|
-webkit-transform: rotate(270deg);
|
|
transform: rotate(270deg);
|
|
}
|
|
|
|
.la-flip-horizontal {
|
|
-ms-filter: "progid:DXImageTransform.Microsoft.BasicImage(rotation=0, mirror=1)";
|
|
-webkit-transform: scale(-1, 1);
|
|
transform: scale(-1, 1);
|
|
}
|
|
|
|
.la-flip-vertical {
|
|
-ms-filter: "progid:DXImageTransform.Microsoft.BasicImage(rotation=2, mirror=1)";
|
|
-webkit-transform: scale(1, -1);
|
|
transform: scale(1, -1);
|
|
}
|
|
|
|
.la-flip-both, .la-flip-horizontal.la-flip-vertical {
|
|
-ms-filter: "progid:DXImageTransform.Microsoft.BasicImage(rotation=2, mirror=1)";
|
|
-webkit-transform: scale(-1, -1);
|
|
transform: scale(-1, -1);
|
|
}
|
|
|
|
:root .la-rotate-90,
|
|
:root .la-rotate-180,
|
|
:root .la-rotate-270,
|
|
:root .la-flip-horizontal,
|
|
:root .la-flip-vertical,
|
|
:root .la-flip-both {
|
|
-webkit-filter: none;
|
|
filter: none;
|
|
}
|
|
|
|
.la-stack {
|
|
display: inline-block;
|
|
height: 2em;
|
|
line-height: 2em;
|
|
position: relative;
|
|
vertical-align: middle;
|
|
width: 2.5em;
|
|
}
|
|
|
|
.la-stack-1x,
|
|
.la-stack-2x {
|
|
left: 0;
|
|
position: absolute;
|
|
text-align: center;
|
|
width: 100%;
|
|
}
|
|
|
|
.la-stack-1x {
|
|
line-height: inherit;
|
|
}
|
|
|
|
.la-stack-2x {
|
|
font-size: 2em;
|
|
}
|
|
|
|
.la-inverse {
|
|
color: #fff;
|
|
}
|
|
|
|
.la-500px:before {
|
|
content: "\f26e";
|
|
}
|
|
|
|
.la-accessible-icon:before {
|
|
content: "\f368";
|
|
}
|
|
|
|
.la-accusoft:before {
|
|
content: "\f369";
|
|
}
|
|
|
|
.la-acquisitions-incorporated:before {
|
|
content: "\f6af";
|
|
}
|
|
|
|
.la-ad:before {
|
|
content: "\f641";
|
|
}
|
|
|
|
.la-address-book:before {
|
|
content: "\f2b9";
|
|
}
|
|
|
|
.la-address-card:before {
|
|
content: "\f2bb";
|
|
}
|
|
|
|
.la-adjust:before {
|
|
content: "\f042";
|
|
}
|
|
|
|
.la-adn:before {
|
|
content: "\f170";
|
|
}
|
|
|
|
.la-adobe:before {
|
|
content: "\f778";
|
|
}
|
|
|
|
.la-adversal:before {
|
|
content: "\f36a";
|
|
}
|
|
|
|
.la-affiliatetheme:before {
|
|
content: "\f36b";
|
|
}
|
|
|
|
.la-air-freshener:before {
|
|
content: "\f5d0";
|
|
}
|
|
|
|
.la-airbnb:before {
|
|
content: "\f834";
|
|
}
|
|
|
|
.la-algolia:before {
|
|
content: "\f36c";
|
|
}
|
|
|
|
.la-align-center:before {
|
|
content: "\f037";
|
|
}
|
|
|
|
.la-align-justify:before {
|
|
content: "\f039";
|
|
}
|
|
|
|
.la-align-left:before {
|
|
content: "\f036";
|
|
}
|
|
|
|
.la-align-right:before {
|
|
content: "\f038";
|
|
}
|
|
|
|
.la-alipay:before {
|
|
content: "\f642";
|
|
}
|
|
|
|
.la-allergies:before {
|
|
content: "\f461";
|
|
}
|
|
|
|
.la-amazon:before {
|
|
content: "\f270";
|
|
}
|
|
|
|
.la-amazon-pay:before {
|
|
content: "\f42c";
|
|
}
|
|
|
|
.la-ambulance:before {
|
|
content: "\f0f9";
|
|
}
|
|
|
|
.la-american-sign-language-interpreting:before {
|
|
content: "\f2a3";
|
|
}
|
|
|
|
.la-amilia:before {
|
|
content: "\f36d";
|
|
}
|
|
|
|
.la-anchor:before {
|
|
content: "\f13d";
|
|
}
|
|
|
|
.la-android:before {
|
|
content: "\f17b";
|
|
}
|
|
|
|
.la-angellist:before {
|
|
content: "\f209";
|
|
}
|
|
|
|
.la-angle-double-down:before {
|
|
content: "\f103";
|
|
}
|
|
|
|
.la-angle-double-left:before {
|
|
content: "\f100";
|
|
}
|
|
|
|
.la-angle-double-right:before {
|
|
content: "\f101";
|
|
}
|
|
|
|
.la-angle-double-up:before {
|
|
content: "\f102";
|
|
}
|
|
|
|
.la-angle-down:before, .header-arrow:before {
|
|
content: "\f107";
|
|
}
|
|
|
|
.la-angle-left:before {
|
|
content: "\f104";
|
|
}
|
|
|
|
.la-angle-right:before, .header-arrow.expanded:before {
|
|
content: "\f105";
|
|
}
|
|
|
|
.la-angle-up:before {
|
|
content: "\f106";
|
|
}
|
|
|
|
.la-angry:before {
|
|
content: "\f556";
|
|
}
|
|
|
|
.la-angrycreative:before {
|
|
content: "\f36e";
|
|
}
|
|
|
|
.la-angular:before {
|
|
content: "\f420";
|
|
}
|
|
|
|
.la-ankh:before {
|
|
content: "\f644";
|
|
}
|
|
|
|
.la-app-store:before {
|
|
content: "\f36f";
|
|
}
|
|
|
|
.la-app-store-ios:before {
|
|
content: "\f370";
|
|
}
|
|
|
|
.la-apper:before {
|
|
content: "\f371";
|
|
}
|
|
|
|
.la-apple:before {
|
|
content: "\f179";
|
|
}
|
|
|
|
.la-apple-alt:before {
|
|
content: "\f5d1";
|
|
}
|
|
|
|
.la-apple-pay:before {
|
|
content: "\f415";
|
|
}
|
|
|
|
.la-archive:before {
|
|
content: "\f187";
|
|
}
|
|
|
|
.la-archway:before {
|
|
content: "\f557";
|
|
}
|
|
|
|
.la-arrow-alt-circle-down:before {
|
|
content: "\f358";
|
|
}
|
|
|
|
.la-arrow-alt-circle-left:before {
|
|
content: "\f359";
|
|
}
|
|
|
|
.la-arrow-alt-circle-right:before {
|
|
content: "\f35a";
|
|
}
|
|
|
|
.la-arrow-alt-circle-up:before {
|
|
content: "\f35b";
|
|
}
|
|
|
|
.la-arrow-circle-down:before {
|
|
content: "\f0ab";
|
|
}
|
|
|
|
.la-arrow-circle-left:before {
|
|
content: "\f0a8";
|
|
}
|
|
|
|
.la-arrow-circle-right:before {
|
|
content: "\f0a9";
|
|
}
|
|
|
|
.la-arrow-circle-up:before {
|
|
content: "\f0aa";
|
|
}
|
|
|
|
.la-arrow-down:before {
|
|
content: "\f063";
|
|
}
|
|
|
|
.la-arrow-left:before {
|
|
content: "\f060";
|
|
}
|
|
|
|
.la-arrow-right:before {
|
|
content: "\f061";
|
|
}
|
|
|
|
.la-arrow-up:before {
|
|
content: "\f062";
|
|
}
|
|
|
|
.la-arrows-alt:before {
|
|
content: "\f0b2";
|
|
}
|
|
|
|
.la-arrows-alt-h:before {
|
|
content: "\f337";
|
|
}
|
|
|
|
.la-arrows-alt-v:before {
|
|
content: "\f338";
|
|
}
|
|
|
|
.la-artstation:before {
|
|
content: "\f77a";
|
|
}
|
|
|
|
.la-assistive-listening-systems:before {
|
|
content: "\f2a2";
|
|
}
|
|
|
|
.la-asterisk:before {
|
|
content: "\f069";
|
|
}
|
|
|
|
.la-asymmetrik:before {
|
|
content: "\f372";
|
|
}
|
|
|
|
.la-at:before {
|
|
content: "\f1fa";
|
|
}
|
|
|
|
.la-atlas:before {
|
|
content: "\f558";
|
|
}
|
|
|
|
.la-atlassian:before {
|
|
content: "\f77b";
|
|
}
|
|
|
|
.la-atom:before {
|
|
content: "\f5d2";
|
|
}
|
|
|
|
.la-audible:before {
|
|
content: "\f373";
|
|
}
|
|
|
|
.la-audio-description:before {
|
|
content: "\f29e";
|
|
}
|
|
|
|
.la-autoprefixer:before {
|
|
content: "\f41c";
|
|
}
|
|
|
|
.la-avianex:before {
|
|
content: "\f374";
|
|
}
|
|
|
|
.la-aviato:before {
|
|
content: "\f421";
|
|
}
|
|
|
|
.la-award:before {
|
|
content: "\f559";
|
|
}
|
|
|
|
.la-aws:before {
|
|
content: "\f375";
|
|
}
|
|
|
|
.la-baby:before {
|
|
content: "\f77c";
|
|
}
|
|
|
|
.la-baby-carriage:before {
|
|
content: "\f77d";
|
|
}
|
|
|
|
.la-backspace:before {
|
|
content: "\f55a";
|
|
}
|
|
|
|
.la-backward:before {
|
|
content: "\f04a";
|
|
}
|
|
|
|
.la-bacon:before {
|
|
content: "\f7e5";
|
|
}
|
|
|
|
.la-balance-scale:before {
|
|
content: "\f24e";
|
|
}
|
|
|
|
.la-balance-scale-left:before {
|
|
content: "\f515";
|
|
}
|
|
|
|
.la-balance-scale-right:before {
|
|
content: "\f516";
|
|
}
|
|
|
|
.la-ban:before {
|
|
content: "\f05e";
|
|
}
|
|
|
|
.la-band-aid:before {
|
|
content: "\f462";
|
|
}
|
|
|
|
.la-bandcamp:before {
|
|
content: "\f2d5";
|
|
}
|
|
|
|
.la-barcode:before {
|
|
content: "\f02a";
|
|
}
|
|
|
|
.la-bars:before {
|
|
content: "\f0c9";
|
|
}
|
|
|
|
.la-baseball-ball:before {
|
|
content: "\f433";
|
|
}
|
|
|
|
.la-basketball-ball:before {
|
|
content: "\f434";
|
|
}
|
|
|
|
.la-bath:before {
|
|
content: "\f2cd";
|
|
}
|
|
|
|
.la-battery-empty:before {
|
|
content: "\f244";
|
|
}
|
|
|
|
.la-battery-full:before {
|
|
content: "\f240";
|
|
}
|
|
|
|
.la-battery-half:before {
|
|
content: "\f242";
|
|
}
|
|
|
|
.la-battery-quarter:before {
|
|
content: "\f243";
|
|
}
|
|
|
|
.la-battery-three-quarters:before {
|
|
content: "\f241";
|
|
}
|
|
|
|
.la-battle-net:before {
|
|
content: "\f835";
|
|
}
|
|
|
|
.la-bed:before {
|
|
content: "\f236";
|
|
}
|
|
|
|
.la-beer:before {
|
|
content: "\f0fc";
|
|
}
|
|
|
|
.la-behance:before {
|
|
content: "\f1b4";
|
|
}
|
|
|
|
.la-behance-square:before {
|
|
content: "\f1b5";
|
|
}
|
|
|
|
.la-bell:before {
|
|
content: "\f0f3";
|
|
}
|
|
|
|
.la-bell-slash:before {
|
|
content: "\f1f6";
|
|
}
|
|
|
|
.la-bezier-curve:before {
|
|
content: "\f55b";
|
|
}
|
|
|
|
.la-bible:before {
|
|
content: "\f647";
|
|
}
|
|
|
|
.la-bicycle:before {
|
|
content: "\f206";
|
|
}
|
|
|
|
.la-biking:before {
|
|
content: "\f84a";
|
|
}
|
|
|
|
.la-bimobject:before {
|
|
content: "\f378";
|
|
}
|
|
|
|
.la-binoculars:before {
|
|
content: "\f1e5";
|
|
}
|
|
|
|
.la-biohazard:before {
|
|
content: "\f780";
|
|
}
|
|
|
|
.la-birthday-cake:before {
|
|
content: "\f1fd";
|
|
}
|
|
|
|
.la-bitbucket:before {
|
|
content: "\f171";
|
|
}
|
|
|
|
.la-bitcoin:before {
|
|
content: "\f379";
|
|
}
|
|
|
|
.la-bity:before {
|
|
content: "\f37a";
|
|
}
|
|
|
|
.la-black-tie:before {
|
|
content: "\f27e";
|
|
}
|
|
|
|
.la-blackberry:before {
|
|
content: "\f37b";
|
|
}
|
|
|
|
.la-blender:before {
|
|
content: "\f517";
|
|
}
|
|
|
|
.la-blender-phone:before {
|
|
content: "\f6b6";
|
|
}
|
|
|
|
.la-blind:before {
|
|
content: "\f29d";
|
|
}
|
|
|
|
.la-blog:before {
|
|
content: "\f781";
|
|
}
|
|
|
|
.la-blogger:before {
|
|
content: "\f37c";
|
|
}
|
|
|
|
.la-blogger-b:before {
|
|
content: "\f37d";
|
|
}
|
|
|
|
.la-bluetooth:before {
|
|
content: "\f293";
|
|
}
|
|
|
|
.la-bluetooth-b:before {
|
|
content: "\f294";
|
|
}
|
|
|
|
.la-bold:before {
|
|
content: "\f032";
|
|
}
|
|
|
|
.la-bolt:before {
|
|
content: "\f0e7";
|
|
}
|
|
|
|
.la-bomb:before {
|
|
content: "\f1e2";
|
|
}
|
|
|
|
.la-bone:before {
|
|
content: "\f5d7";
|
|
}
|
|
|
|
.la-bong:before {
|
|
content: "\f55c";
|
|
}
|
|
|
|
.la-book:before {
|
|
content: "\f02d";
|
|
}
|
|
|
|
.la-book-dead:before {
|
|
content: "\f6b7";
|
|
}
|
|
|
|
.la-book-medical:before {
|
|
content: "\f7e6";
|
|
}
|
|
|
|
.la-book-open:before {
|
|
content: "\f518";
|
|
}
|
|
|
|
.la-book-reader:before {
|
|
content: "\f5da";
|
|
}
|
|
|
|
.la-bookmark:before {
|
|
content: "\f02e";
|
|
}
|
|
|
|
.la-bootstrap:before {
|
|
content: "\f836";
|
|
}
|
|
|
|
.la-border-all:before {
|
|
content: "\f84c";
|
|
}
|
|
|
|
.la-border-none:before {
|
|
content: "\f850";
|
|
}
|
|
|
|
.la-border-style:before {
|
|
content: "\f853";
|
|
}
|
|
|
|
.la-bowling-ball:before {
|
|
content: "\f436";
|
|
}
|
|
|
|
.la-box:before {
|
|
content: "\f466";
|
|
}
|
|
|
|
.la-box-open:before {
|
|
content: "\f49e";
|
|
}
|
|
|
|
.la-boxes:before {
|
|
content: "\f468";
|
|
}
|
|
|
|
.la-braille:before {
|
|
content: "\f2a1";
|
|
}
|
|
|
|
.la-brain:before {
|
|
content: "\f5dc";
|
|
}
|
|
|
|
.la-bread-slice:before {
|
|
content: "\f7ec";
|
|
}
|
|
|
|
.la-briefcase:before {
|
|
content: "\f0b1";
|
|
}
|
|
|
|
.la-briefcase-medical:before {
|
|
content: "\f469";
|
|
}
|
|
|
|
.la-broadcast-tower:before {
|
|
content: "\f519";
|
|
}
|
|
|
|
.la-broom:before {
|
|
content: "\f51a";
|
|
}
|
|
|
|
.la-brush:before {
|
|
content: "\f55d";
|
|
}
|
|
|
|
.la-btc:before {
|
|
content: "\f15a";
|
|
}
|
|
|
|
.la-buffer:before {
|
|
content: "\f837";
|
|
}
|
|
|
|
.la-bug:before {
|
|
content: "\f188";
|
|
}
|
|
|
|
.la-building:before {
|
|
content: "\f1ad";
|
|
}
|
|
|
|
.la-bullhorn:before {
|
|
content: "\f0a1";
|
|
}
|
|
|
|
.la-bullseye:before {
|
|
content: "\f140";
|
|
}
|
|
|
|
.la-burn:before {
|
|
content: "\f46a";
|
|
}
|
|
|
|
.la-buromobelexperte:before {
|
|
content: "\f37f";
|
|
}
|
|
|
|
.la-bus:before {
|
|
content: "\f207";
|
|
}
|
|
|
|
.la-bus-alt:before {
|
|
content: "\f55e";
|
|
}
|
|
|
|
.la-business-time:before {
|
|
content: "\f64a";
|
|
}
|
|
|
|
.la-buysellads:before {
|
|
content: "\f20d";
|
|
}
|
|
|
|
.la-calculator:before {
|
|
content: "\f1ec";
|
|
}
|
|
|
|
.la-calendar:before {
|
|
content: "\f133";
|
|
}
|
|
|
|
.la-calendar-alt:before {
|
|
content: "\f073";
|
|
}
|
|
|
|
.la-calendar-check:before {
|
|
content: "\f274";
|
|
}
|
|
|
|
.la-calendar-day:before {
|
|
content: "\f783";
|
|
}
|
|
|
|
.la-calendar-minus:before {
|
|
content: "\f272";
|
|
}
|
|
|
|
.la-calendar-plus:before {
|
|
content: "\f271";
|
|
}
|
|
|
|
.la-calendar-times:before {
|
|
content: "\f273";
|
|
}
|
|
|
|
.la-calendar-week:before {
|
|
content: "\f784";
|
|
}
|
|
|
|
.la-camera:before {
|
|
content: "\f030";
|
|
}
|
|
|
|
.la-camera-retro:before {
|
|
content: "\f083";
|
|
}
|
|
|
|
.la-campground:before {
|
|
content: "\f6bb";
|
|
}
|
|
|
|
.la-canadian-maple-leaf:before {
|
|
content: "\f785";
|
|
}
|
|
|
|
.la-candy-cane:before {
|
|
content: "\f786";
|
|
}
|
|
|
|
.la-cannabis:before {
|
|
content: "\f55f";
|
|
}
|
|
|
|
.la-capsules:before {
|
|
content: "\f46b";
|
|
}
|
|
|
|
.la-car:before {
|
|
content: "\f1b9";
|
|
}
|
|
|
|
.la-car-alt:before {
|
|
content: "\f5de";
|
|
}
|
|
|
|
.la-car-battery:before {
|
|
content: "\f5df";
|
|
}
|
|
|
|
.la-car-crash:before {
|
|
content: "\f5e1";
|
|
}
|
|
|
|
.la-car-side:before {
|
|
content: "\f5e4";
|
|
}
|
|
|
|
.la-caret-down:before {
|
|
content: "\f0d7";
|
|
}
|
|
|
|
.la-caret-left:before {
|
|
content: "\f0d9";
|
|
}
|
|
|
|
.la-caret-right:before {
|
|
content: "\f0da";
|
|
}
|
|
|
|
.la-caret-square-down:before {
|
|
content: "\f150";
|
|
}
|
|
|
|
.la-caret-square-left:before {
|
|
content: "\f191";
|
|
}
|
|
|
|
.la-caret-square-right:before {
|
|
content: "\f152";
|
|
}
|
|
|
|
.la-caret-square-up:before {
|
|
content: "\f151";
|
|
}
|
|
|
|
.la-caret-up:before {
|
|
content: "\f0d8";
|
|
}
|
|
|
|
.la-carrot:before {
|
|
content: "\f787";
|
|
}
|
|
|
|
.la-cart-arrow-down:before {
|
|
content: "\f218";
|
|
}
|
|
|
|
.la-cart-plus:before {
|
|
content: "\f217";
|
|
}
|
|
|
|
.la-cash-register:before {
|
|
content: "\f788";
|
|
}
|
|
|
|
.la-cat:before {
|
|
content: "\f6be";
|
|
}
|
|
|
|
.la-cc-amazon-pay:before {
|
|
content: "\f42d";
|
|
}
|
|
|
|
.la-cc-amex:before {
|
|
content: "\f1f3";
|
|
}
|
|
|
|
.la-cc-apple-pay:before {
|
|
content: "\f416";
|
|
}
|
|
|
|
.la-cc-diners-club:before {
|
|
content: "\f24c";
|
|
}
|
|
|
|
.la-cc-discover:before {
|
|
content: "\f1f2";
|
|
}
|
|
|
|
.la-cc-jcb:before {
|
|
content: "\f24b";
|
|
}
|
|
|
|
.la-cc-mastercard:before {
|
|
content: "\f1f1";
|
|
}
|
|
|
|
.la-cc-paypal:before {
|
|
content: "\f1f4";
|
|
}
|
|
|
|
.la-cc-stripe:before {
|
|
content: "\f1f5";
|
|
}
|
|
|
|
.la-cc-visa:before {
|
|
content: "\f1f0";
|
|
}
|
|
|
|
.la-centercode:before {
|
|
content: "\f380";
|
|
}
|
|
|
|
.la-centos:before {
|
|
content: "\f789";
|
|
}
|
|
|
|
.la-certificate:before {
|
|
content: "\f0a3";
|
|
}
|
|
|
|
.la-chair:before {
|
|
content: "\f6c0";
|
|
}
|
|
|
|
.la-chalkboard:before {
|
|
content: "\f51b";
|
|
}
|
|
|
|
.la-chalkboard-teacher:before {
|
|
content: "\f51c";
|
|
}
|
|
|
|
.la-charging-station:before {
|
|
content: "\f5e7";
|
|
}
|
|
|
|
.la-chart-area:before {
|
|
content: "\f1fe";
|
|
}
|
|
|
|
.la-chart-bar:before {
|
|
content: "\f080";
|
|
}
|
|
|
|
.la-chart-line:before {
|
|
content: "\f201";
|
|
}
|
|
|
|
.la-chart-pie:before {
|
|
content: "\f200";
|
|
}
|
|
|
|
.la-check:before {
|
|
content: "\f00c";
|
|
}
|
|
|
|
.la-check-circle:before {
|
|
content: "\f058";
|
|
}
|
|
|
|
.la-check-double:before {
|
|
content: "\f560";
|
|
}
|
|
|
|
.la-check-square:before {
|
|
content: "\f14a";
|
|
}
|
|
|
|
.la-cheese:before {
|
|
content: "\f7ef";
|
|
}
|
|
|
|
.la-chess:before {
|
|
content: "\f439";
|
|
}
|
|
|
|
.la-chess-bishop:before {
|
|
content: "\f43a";
|
|
}
|
|
|
|
.la-chess-board:before {
|
|
content: "\f43c";
|
|
}
|
|
|
|
.la-chess-king:before {
|
|
content: "\f43f";
|
|
}
|
|
|
|
.la-chess-knight:before {
|
|
content: "\f441";
|
|
}
|
|
|
|
.la-chess-pawn:before {
|
|
content: "\f443";
|
|
}
|
|
|
|
.la-chess-queen:before {
|
|
content: "\f445";
|
|
}
|
|
|
|
.la-chess-rook:before {
|
|
content: "\f447";
|
|
}
|
|
|
|
.la-chevron-circle-down:before {
|
|
content: "\f13a";
|
|
}
|
|
|
|
.la-chevron-circle-left:before {
|
|
content: "\f137";
|
|
}
|
|
|
|
.la-chevron-circle-right:before {
|
|
content: "\f138";
|
|
}
|
|
|
|
.la-chevron-circle-up:before {
|
|
content: "\f139";
|
|
}
|
|
|
|
.la-chevron-down:before {
|
|
content: "\f078";
|
|
}
|
|
|
|
.la-chevron-left:before {
|
|
content: "\f053";
|
|
}
|
|
|
|
.la-chevron-right:before {
|
|
content: "\f054";
|
|
}
|
|
|
|
.la-chevron-up:before {
|
|
content: "\f077";
|
|
}
|
|
|
|
.la-child:before {
|
|
content: "\f1ae";
|
|
}
|
|
|
|
.la-chrome:before {
|
|
content: "\f268";
|
|
}
|
|
|
|
.la-chromecast:before {
|
|
content: "\f838";
|
|
}
|
|
|
|
.la-church:before {
|
|
content: "\f51d";
|
|
}
|
|
|
|
.la-circle:before {
|
|
content: "\f111";
|
|
}
|
|
|
|
.la-circle-notch:before {
|
|
content: "\f1ce";
|
|
}
|
|
|
|
.la-city:before {
|
|
content: "\f64f";
|
|
}
|
|
|
|
.la-clinic-medical:before {
|
|
content: "\f7f2";
|
|
}
|
|
|
|
.la-clipboard:before {
|
|
content: "\f328";
|
|
}
|
|
|
|
.la-clipboard-check:before {
|
|
content: "\f46c";
|
|
}
|
|
|
|
.la-clipboard-list:before {
|
|
content: "\f46d";
|
|
}
|
|
|
|
.la-clock:before {
|
|
content: "\f017";
|
|
}
|
|
|
|
.la-clone:before {
|
|
content: "\f24d";
|
|
}
|
|
|
|
.la-closed-captioning:before {
|
|
content: "\f20a";
|
|
}
|
|
|
|
.la-cloud:before {
|
|
content: "\f0c2";
|
|
}
|
|
|
|
.la-cloud-download-alt:before {
|
|
content: "\f381";
|
|
}
|
|
|
|
.la-cloud-meatball:before {
|
|
content: "\f73b";
|
|
}
|
|
|
|
.la-cloud-moon:before {
|
|
content: "\f6c3";
|
|
}
|
|
|
|
.la-cloud-moon-rain:before {
|
|
content: "\f73c";
|
|
}
|
|
|
|
.la-cloud-rain:before {
|
|
content: "\f73d";
|
|
}
|
|
|
|
.la-cloud-showers-heavy:before {
|
|
content: "\f740";
|
|
}
|
|
|
|
.la-cloud-sun:before {
|
|
content: "\f6c4";
|
|
}
|
|
|
|
.la-cloud-sun-rain:before {
|
|
content: "\f743";
|
|
}
|
|
|
|
.la-cloud-upload-alt:before {
|
|
content: "\f382";
|
|
}
|
|
|
|
.la-cloudscale:before {
|
|
content: "\f383";
|
|
}
|
|
|
|
.la-cloudsmith:before {
|
|
content: "\f384";
|
|
}
|
|
|
|
.la-cloudversify:before {
|
|
content: "\f385";
|
|
}
|
|
|
|
.la-cocktail:before {
|
|
content: "\f561";
|
|
}
|
|
|
|
.la-code:before {
|
|
content: "\f121";
|
|
}
|
|
|
|
.la-code-branch:before {
|
|
content: "\f126";
|
|
}
|
|
|
|
.la-codepen:before {
|
|
content: "\f1cb";
|
|
}
|
|
|
|
.la-codiepie:before {
|
|
content: "\f284";
|
|
}
|
|
|
|
.la-coffee:before {
|
|
content: "\f0f4";
|
|
}
|
|
|
|
.la-cog:before {
|
|
content: "\f013";
|
|
}
|
|
|
|
.la-cogs:before {
|
|
content: "\f085";
|
|
}
|
|
|
|
.la-coins:before {
|
|
content: "\f51e";
|
|
}
|
|
|
|
.la-columns:before {
|
|
content: "\f0db";
|
|
}
|
|
|
|
.la-comment:before {
|
|
content: "\f075";
|
|
}
|
|
|
|
.la-comment-alt:before {
|
|
content: "\f27a";
|
|
}
|
|
|
|
.la-comment-dollar:before {
|
|
content: "\f651";
|
|
}
|
|
|
|
.la-comment-dots:before {
|
|
content: "\f4ad";
|
|
}
|
|
|
|
.la-comment-medical:before {
|
|
content: "\f7f5";
|
|
}
|
|
|
|
.la-comment-slash:before {
|
|
content: "\f4b3";
|
|
}
|
|
|
|
.la-comments:before {
|
|
content: "\f086";
|
|
}
|
|
|
|
.la-comments-dollar:before {
|
|
content: "\f653";
|
|
}
|
|
|
|
.la-compact-disc:before {
|
|
content: "\f51f";
|
|
}
|
|
|
|
.la-compass:before {
|
|
content: "\f14e";
|
|
}
|
|
|
|
.la-compress:before {
|
|
content: "\f066";
|
|
}
|
|
|
|
.la-compress-arrows-alt:before {
|
|
content: "\f78c";
|
|
}
|
|
|
|
.la-concierge-bell:before {
|
|
content: "\f562";
|
|
}
|
|
|
|
.la-confluence:before {
|
|
content: "\f78d";
|
|
}
|
|
|
|
.la-connectdevelop:before {
|
|
content: "\f20e";
|
|
}
|
|
|
|
.la-contao:before {
|
|
content: "\f26d";
|
|
}
|
|
|
|
.la-cookie:before {
|
|
content: "\f563";
|
|
}
|
|
|
|
.la-cookie-bite:before {
|
|
content: "\f564";
|
|
}
|
|
|
|
.la-copy:before {
|
|
content: "\f0c5";
|
|
}
|
|
|
|
.la-copyright:before {
|
|
content: "\f1f9";
|
|
}
|
|
|
|
.la-cotton-bureau:before {
|
|
content: "\f89e";
|
|
}
|
|
|
|
.la-couch:before {
|
|
content: "\f4b8";
|
|
}
|
|
|
|
.la-cpanel:before {
|
|
content: "\f388";
|
|
}
|
|
|
|
.la-creative-commons:before {
|
|
content: "\f25e";
|
|
}
|
|
|
|
.la-creative-commons-by:before {
|
|
content: "\f4e7";
|
|
}
|
|
|
|
.la-creative-commons-nc:before {
|
|
content: "\f4e8";
|
|
}
|
|
|
|
.la-creative-commons-nc-eu:before {
|
|
content: "\f4e9";
|
|
}
|
|
|
|
.la-creative-commons-nc-jp:before {
|
|
content: "\f4ea";
|
|
}
|
|
|
|
.la-creative-commons-nd:before {
|
|
content: "\f4eb";
|
|
}
|
|
|
|
.la-creative-commons-pd:before {
|
|
content: "\f4ec";
|
|
}
|
|
|
|
.la-creative-commons-pd-alt:before {
|
|
content: "\f4ed";
|
|
}
|
|
|
|
.la-creative-commons-remix:before {
|
|
content: "\f4ee";
|
|
}
|
|
|
|
.la-creative-commons-sa:before {
|
|
content: "\f4ef";
|
|
}
|
|
|
|
.la-creative-commons-sampling:before {
|
|
content: "\f4f0";
|
|
}
|
|
|
|
.la-creative-commons-sampling-plus:before {
|
|
content: "\f4f1";
|
|
}
|
|
|
|
.la-creative-commons-share:before {
|
|
content: "\f4f2";
|
|
}
|
|
|
|
.la-creative-commons-zero:before {
|
|
content: "\f4f3";
|
|
}
|
|
|
|
.la-credit-card:before {
|
|
content: "\f09d";
|
|
}
|
|
|
|
.la-critical-role:before {
|
|
content: "\f6c9";
|
|
}
|
|
|
|
.la-crop:before {
|
|
content: "\f125";
|
|
}
|
|
|
|
.la-crop-alt:before {
|
|
content: "\f565";
|
|
}
|
|
|
|
.la-cross:before {
|
|
content: "\f654";
|
|
}
|
|
|
|
.la-crosshairs:before {
|
|
content: "\f05b";
|
|
}
|
|
|
|
.la-crow:before {
|
|
content: "\f520";
|
|
}
|
|
|
|
.la-crown:before {
|
|
content: "\f521";
|
|
}
|
|
|
|
.la-crutch:before {
|
|
content: "\f7f7";
|
|
}
|
|
|
|
.la-css3:before {
|
|
content: "\f13c";
|
|
}
|
|
|
|
.la-css3-alt:before {
|
|
content: "\f38b";
|
|
}
|
|
|
|
.la-cube:before {
|
|
content: "\f1b2";
|
|
}
|
|
|
|
.la-cubes:before {
|
|
content: "\f1b3";
|
|
}
|
|
|
|
.la-cut:before {
|
|
content: "\f0c4";
|
|
}
|
|
|
|
.la-cuttlefish:before {
|
|
content: "\f38c";
|
|
}
|
|
|
|
.la-d-and-d:before {
|
|
content: "\f38d";
|
|
}
|
|
|
|
.la-d-and-d-beyond:before {
|
|
content: "\f6ca";
|
|
}
|
|
|
|
.la-dashcube:before {
|
|
content: "\f210";
|
|
}
|
|
|
|
.la-database:before {
|
|
content: "\f1c0";
|
|
}
|
|
|
|
.la-deaf:before {
|
|
content: "\f2a4";
|
|
}
|
|
|
|
.la-delicious:before {
|
|
content: "\f1a5";
|
|
}
|
|
|
|
.la-democrat:before {
|
|
content: "\f747";
|
|
}
|
|
|
|
.la-deploydog:before {
|
|
content: "\f38e";
|
|
}
|
|
|
|
.la-deskpro:before {
|
|
content: "\f38f";
|
|
}
|
|
|
|
.la-desktop:before {
|
|
content: "\f108";
|
|
}
|
|
|
|
.la-dev:before {
|
|
content: "\f6cc";
|
|
}
|
|
|
|
.la-deviantart:before {
|
|
content: "\f1bd";
|
|
}
|
|
|
|
.la-dharmachakra:before {
|
|
content: "\f655";
|
|
}
|
|
|
|
.la-dhl:before {
|
|
content: "\f790";
|
|
}
|
|
|
|
.la-diagnoses:before {
|
|
content: "\f470";
|
|
}
|
|
|
|
.la-diaspora:before {
|
|
content: "\f791";
|
|
}
|
|
|
|
.la-dice:before {
|
|
content: "\f522";
|
|
}
|
|
|
|
.la-dice-d20:before {
|
|
content: "\f6cf";
|
|
}
|
|
|
|
.la-dice-d6:before {
|
|
content: "\f6d1";
|
|
}
|
|
|
|
.la-dice-five:before {
|
|
content: "\f523";
|
|
}
|
|
|
|
.la-dice-four:before {
|
|
content: "\f524";
|
|
}
|
|
|
|
.la-dice-one:before {
|
|
content: "\f525";
|
|
}
|
|
|
|
.la-dice-six:before {
|
|
content: "\f526";
|
|
}
|
|
|
|
.la-dice-three:before {
|
|
content: "\f527";
|
|
}
|
|
|
|
.la-dice-two:before {
|
|
content: "\f528";
|
|
}
|
|
|
|
.la-digg:before {
|
|
content: "\f1a6";
|
|
}
|
|
|
|
.la-digital-ocean:before {
|
|
content: "\f391";
|
|
}
|
|
|
|
.la-digital-tachograph:before {
|
|
content: "\f566";
|
|
}
|
|
|
|
.la-directions:before {
|
|
content: "\f5eb";
|
|
}
|
|
|
|
.la-discord:before {
|
|
content: "\f392";
|
|
}
|
|
|
|
.la-discourse:before {
|
|
content: "\f393";
|
|
}
|
|
|
|
.la-divide:before {
|
|
content: "\f529";
|
|
}
|
|
|
|
.la-dizzy:before {
|
|
content: "\f567";
|
|
}
|
|
|
|
.la-dna:before {
|
|
content: "\f471";
|
|
}
|
|
|
|
.la-dochub:before {
|
|
content: "\f394";
|
|
}
|
|
|
|
.la-docker:before {
|
|
content: "\f395";
|
|
}
|
|
|
|
.la-dog:before {
|
|
content: "\f6d3";
|
|
}
|
|
|
|
.la-dollar-sign:before {
|
|
content: "\f155";
|
|
}
|
|
|
|
.la-dolly:before {
|
|
content: "\f472";
|
|
}
|
|
|
|
.la-dolly-flatbed:before {
|
|
content: "\f474";
|
|
}
|
|
|
|
.la-donate:before {
|
|
content: "\f4b9";
|
|
}
|
|
|
|
.la-door-closed:before {
|
|
content: "\f52a";
|
|
}
|
|
|
|
.la-door-open:before {
|
|
content: "\f52b";
|
|
}
|
|
|
|
.la-dot-circle:before {
|
|
content: "\f192";
|
|
}
|
|
|
|
.la-dove:before {
|
|
content: "\f4ba";
|
|
}
|
|
|
|
.la-download:before {
|
|
content: "\f019";
|
|
}
|
|
|
|
.la-draft2digital:before {
|
|
content: "\f396";
|
|
}
|
|
|
|
.la-drafting-compass:before {
|
|
content: "\f568";
|
|
}
|
|
|
|
.la-dragon:before {
|
|
content: "\f6d5";
|
|
}
|
|
|
|
.la-draw-polygon:before {
|
|
content: "\f5ee";
|
|
}
|
|
|
|
.la-dribbble:before {
|
|
content: "\f17d";
|
|
}
|
|
|
|
.la-dribbble-square:before {
|
|
content: "\f397";
|
|
}
|
|
|
|
.la-dropbox:before {
|
|
content: "\f16b";
|
|
}
|
|
|
|
.la-drum:before {
|
|
content: "\f569";
|
|
}
|
|
|
|
.la-drum-steelpan:before {
|
|
content: "\f56a";
|
|
}
|
|
|
|
.la-drumstick-bite:before {
|
|
content: "\f6d7";
|
|
}
|
|
|
|
.la-drupal:before {
|
|
content: "\f1a9";
|
|
}
|
|
|
|
.la-dumbbell:before {
|
|
content: "\f44b";
|
|
}
|
|
|
|
.la-dumpster:before {
|
|
content: "\f793";
|
|
}
|
|
|
|
.la-dumpster-fire:before {
|
|
content: "\f794";
|
|
}
|
|
|
|
.la-dungeon:before {
|
|
content: "\f6d9";
|
|
}
|
|
|
|
.la-dyalog:before {
|
|
content: "\f399";
|
|
}
|
|
|
|
.la-earlybirds:before {
|
|
content: "\f39a";
|
|
}
|
|
|
|
.la-ebay:before {
|
|
content: "\f4f4";
|
|
}
|
|
|
|
.la-edge:before {
|
|
content: "\f282";
|
|
}
|
|
|
|
.la-edit:before {
|
|
content: "\f044";
|
|
}
|
|
|
|
.la-egg:before {
|
|
content: "\f7fb";
|
|
}
|
|
|
|
.la-eject:before {
|
|
content: "\f052";
|
|
}
|
|
|
|
.la-elementor:before {
|
|
content: "\f430";
|
|
}
|
|
|
|
.la-ellipsis-h:before {
|
|
content: "\f141";
|
|
}
|
|
|
|
.la-ellipsis-v:before {
|
|
content: "\f142";
|
|
}
|
|
|
|
.la-ello:before {
|
|
content: "\f5f1";
|
|
}
|
|
|
|
.la-ember:before {
|
|
content: "\f423";
|
|
}
|
|
|
|
.la-empire:before {
|
|
content: "\f1d1";
|
|
}
|
|
|
|
.la-envelope:before {
|
|
content: "\f0e0";
|
|
}
|
|
|
|
.la-envelope-open:before {
|
|
content: "\f2b6";
|
|
}
|
|
|
|
.la-envelope-open-text:before {
|
|
content: "\f658";
|
|
}
|
|
|
|
.la-envelope-square:before {
|
|
content: "\f199";
|
|
}
|
|
|
|
.la-envira:before {
|
|
content: "\f299";
|
|
}
|
|
|
|
.la-equals:before {
|
|
content: "\f52c";
|
|
}
|
|
|
|
.la-eraser:before {
|
|
content: "\f12d";
|
|
}
|
|
|
|
.la-erlang:before {
|
|
content: "\f39d";
|
|
}
|
|
|
|
.la-ethereum:before {
|
|
content: "\f42e";
|
|
}
|
|
|
|
.la-ethernet:before {
|
|
content: "\f796";
|
|
}
|
|
|
|
.la-etsy:before {
|
|
content: "\f2d7";
|
|
}
|
|
|
|
.la-euro-sign:before {
|
|
content: "\f153";
|
|
}
|
|
|
|
.la-evernote:before {
|
|
content: "\f839";
|
|
}
|
|
|
|
.la-exchange-alt:before {
|
|
content: "\f362";
|
|
}
|
|
|
|
.la-exclamation:before {
|
|
content: "\f12a";
|
|
}
|
|
|
|
.la-exclamation-circle:before {
|
|
content: "\f06a";
|
|
}
|
|
|
|
.la-exclamation-triangle:before {
|
|
content: "\f071";
|
|
}
|
|
|
|
.la-expand:before {
|
|
content: "\f065";
|
|
}
|
|
|
|
.la-expand-arrows-alt:before {
|
|
content: "\f31e";
|
|
}
|
|
|
|
.la-expeditedssl:before {
|
|
content: "\f23e";
|
|
}
|
|
|
|
.la-external-link-alt:before {
|
|
content: "\f35d";
|
|
}
|
|
|
|
.la-external-link-square-alt:before {
|
|
content: "\f360";
|
|
}
|
|
|
|
.la-eye:before {
|
|
content: "\f06e";
|
|
}
|
|
|
|
.la-eye-dropper:before {
|
|
content: "\f1fb";
|
|
}
|
|
|
|
.la-eye-slash:before {
|
|
content: "\f070";
|
|
}
|
|
|
|
.la-facebook:before {
|
|
content: "\f09a";
|
|
}
|
|
|
|
.la-facebook-f:before {
|
|
content: "\f39e";
|
|
}
|
|
|
|
.la-facebook-messenger:before {
|
|
content: "\f39f";
|
|
}
|
|
|
|
.la-facebook-square:before {
|
|
content: "\f082";
|
|
}
|
|
|
|
.la-fan:before {
|
|
content: "\f863";
|
|
}
|
|
|
|
.la-fantasy-flight-games:before {
|
|
content: "\f6dc";
|
|
}
|
|
|
|
.la-fast-backward:before {
|
|
content: "\f049";
|
|
}
|
|
|
|
.la-fast-forward:before {
|
|
content: "\f050";
|
|
}
|
|
|
|
.la-fax:before {
|
|
content: "\f1ac";
|
|
}
|
|
|
|
.la-feather:before {
|
|
content: "\f52d";
|
|
}
|
|
|
|
.la-feather-alt:before {
|
|
content: "\f56b";
|
|
}
|
|
|
|
.la-fedex:before {
|
|
content: "\f797";
|
|
}
|
|
|
|
.la-fedora:before {
|
|
content: "\f798";
|
|
}
|
|
|
|
.la-female:before {
|
|
content: "\f182";
|
|
}
|
|
|
|
.la-fighter-jet:before {
|
|
content: "\f0fb";
|
|
}
|
|
|
|
.la-figma:before {
|
|
content: "\f799";
|
|
}
|
|
|
|
.la-file:before {
|
|
content: "\f15b";
|
|
}
|
|
|
|
.la-file-alt:before {
|
|
content: "\f15c";
|
|
}
|
|
|
|
.la-file-archive:before {
|
|
content: "\f1c6";
|
|
}
|
|
|
|
.la-file-audio:before {
|
|
content: "\f1c7";
|
|
}
|
|
|
|
.la-file-code:before {
|
|
content: "\f1c9";
|
|
}
|
|
|
|
.la-file-contract:before {
|
|
content: "\f56c";
|
|
}
|
|
|
|
.la-file-csv:before {
|
|
content: "\f6dd";
|
|
}
|
|
|
|
.la-file-download:before {
|
|
content: "\f56d";
|
|
}
|
|
|
|
.la-file-excel:before {
|
|
content: "\f1c3";
|
|
}
|
|
|
|
.la-file-export:before {
|
|
content: "\f56e";
|
|
}
|
|
|
|
.la-file-image:before {
|
|
content: "\f1c5";
|
|
}
|
|
|
|
.la-file-import:before {
|
|
content: "\f56f";
|
|
}
|
|
|
|
.la-file-invoice:before {
|
|
content: "\f570";
|
|
}
|
|
|
|
.la-file-invoice-dollar:before {
|
|
content: "\f571";
|
|
}
|
|
|
|
.la-file-medical:before {
|
|
content: "\f477";
|
|
}
|
|
|
|
.la-file-medical-alt:before {
|
|
content: "\f478";
|
|
}
|
|
|
|
.la-file-pdf:before {
|
|
content: "\f1c1";
|
|
}
|
|
|
|
.la-file-powerpoint:before {
|
|
content: "\f1c4";
|
|
}
|
|
|
|
.la-file-prescription:before {
|
|
content: "\f572";
|
|
}
|
|
|
|
.la-file-signature:before {
|
|
content: "\f573";
|
|
}
|
|
|
|
.la-file-upload:before {
|
|
content: "\f574";
|
|
}
|
|
|
|
.la-file-video:before {
|
|
content: "\f1c8";
|
|
}
|
|
|
|
.la-file-word:before {
|
|
content: "\f1c2";
|
|
}
|
|
|
|
.la-fill:before {
|
|
content: "\f575";
|
|
}
|
|
|
|
.la-fill-drip:before {
|
|
content: "\f576";
|
|
}
|
|
|
|
.la-film:before {
|
|
content: "\f008";
|
|
}
|
|
|
|
.la-filter:before {
|
|
content: "\f0b0";
|
|
}
|
|
|
|
.la-fingerprint:before {
|
|
content: "\f577";
|
|
}
|
|
|
|
.la-fire:before {
|
|
content: "\f06d";
|
|
}
|
|
|
|
.la-fire-alt:before {
|
|
content: "\f7e4";
|
|
}
|
|
|
|
.la-fire-extinguisher:before {
|
|
content: "\f134";
|
|
}
|
|
|
|
.la-firefox:before {
|
|
content: "\f269";
|
|
}
|
|
|
|
.la-first-aid:before {
|
|
content: "\f479";
|
|
}
|
|
|
|
.la-first-order:before {
|
|
content: "\f2b0";
|
|
}
|
|
|
|
.la-first-order-alt:before {
|
|
content: "\f50a";
|
|
}
|
|
|
|
.la-firstdraft:before {
|
|
content: "\f3a1";
|
|
}
|
|
|
|
.la-fish:before {
|
|
content: "\f578";
|
|
}
|
|
|
|
.la-fist-raised:before {
|
|
content: "\f6de";
|
|
}
|
|
|
|
.la-flag:before {
|
|
content: "\f024";
|
|
}
|
|
|
|
.la-flag-checkered:before {
|
|
content: "\f11e";
|
|
}
|
|
|
|
.la-flag-usa:before {
|
|
content: "\f74d";
|
|
}
|
|
|
|
.la-flask:before {
|
|
content: "\f0c3";
|
|
}
|
|
|
|
.la-flickr:before {
|
|
content: "\f16e";
|
|
}
|
|
|
|
.la-flipboard:before {
|
|
content: "\f44d";
|
|
}
|
|
|
|
.la-flushed:before {
|
|
content: "\f579";
|
|
}
|
|
|
|
.la-fly:before {
|
|
content: "\f417";
|
|
}
|
|
|
|
.la-folder:before {
|
|
content: "\f07b";
|
|
}
|
|
|
|
.la-folder-minus:before {
|
|
content: "\f65d";
|
|
}
|
|
|
|
.la-folder-open:before {
|
|
content: "\f07c";
|
|
}
|
|
|
|
.la-folder-plus:before {
|
|
content: "\f65e";
|
|
}
|
|
|
|
.la-font:before {
|
|
content: "\f031";
|
|
}
|
|
|
|
.la-font-awesome:before {
|
|
content: "\f2b4";
|
|
}
|
|
|
|
.la-font-awesome-alt:before {
|
|
content: "\f35c";
|
|
}
|
|
|
|
.la-font-awesome-flag:before {
|
|
content: "\f425";
|
|
}
|
|
|
|
.la-fonticons:before {
|
|
content: "\f280";
|
|
}
|
|
|
|
.la-fonticons-fi:before {
|
|
content: "\f3a2";
|
|
}
|
|
|
|
.la-football-ball:before {
|
|
content: "\f44e";
|
|
}
|
|
|
|
.la-fort-awesome:before {
|
|
content: "\f286";
|
|
}
|
|
|
|
.la-fort-awesome-alt:before {
|
|
content: "\f3a3";
|
|
}
|
|
|
|
.la-forumbee:before {
|
|
content: "\f211";
|
|
}
|
|
|
|
.la-forward:before {
|
|
content: "\f04e";
|
|
}
|
|
|
|
.la-foursquare:before {
|
|
content: "\f180";
|
|
}
|
|
|
|
.la-free-code-camp:before {
|
|
content: "\f2c5";
|
|
}
|
|
|
|
.la-freebsd:before {
|
|
content: "\f3a4";
|
|
}
|
|
|
|
.la-frog:before {
|
|
content: "\f52e";
|
|
}
|
|
|
|
.la-frown:before {
|
|
content: "\f119";
|
|
}
|
|
|
|
.la-frown-open:before {
|
|
content: "\f57a";
|
|
}
|
|
|
|
.la-fulcrum:before {
|
|
content: "\f50b";
|
|
}
|
|
|
|
.la-funnel-dollar:before {
|
|
content: "\f662";
|
|
}
|
|
|
|
.la-futbol:before {
|
|
content: "\f1e3";
|
|
}
|
|
|
|
.la-galactic-republic:before {
|
|
content: "\f50c";
|
|
}
|
|
|
|
.la-galactic-senate:before {
|
|
content: "\f50d";
|
|
}
|
|
|
|
.la-gamepad:before {
|
|
content: "\f11b";
|
|
}
|
|
|
|
.la-gas-pump:before {
|
|
content: "\f52f";
|
|
}
|
|
|
|
.la-gavel:before {
|
|
content: "\f0e3";
|
|
}
|
|
|
|
.la-gem:before {
|
|
content: "\f3a5";
|
|
}
|
|
|
|
.la-genderless:before {
|
|
content: "\f22d";
|
|
}
|
|
|
|
.la-get-pocket:before {
|
|
content: "\f265";
|
|
}
|
|
|
|
.la-gg:before {
|
|
content: "\f260";
|
|
}
|
|
|
|
.la-gg-circle:before {
|
|
content: "\f261";
|
|
}
|
|
|
|
.la-ghost:before {
|
|
content: "\f6e2";
|
|
}
|
|
|
|
.la-gift:before {
|
|
content: "\f06b";
|
|
}
|
|
|
|
.la-gifts:before {
|
|
content: "\f79c";
|
|
}
|
|
|
|
.la-git:before {
|
|
content: "\f1d3";
|
|
}
|
|
|
|
.la-git-alt:before {
|
|
content: "\f841";
|
|
}
|
|
|
|
.la-git-square:before {
|
|
content: "\f1d2";
|
|
}
|
|
|
|
.la-github:before {
|
|
content: "\f09b";
|
|
}
|
|
|
|
.la-github-alt:before {
|
|
content: "\f113";
|
|
}
|
|
|
|
.la-github-square:before {
|
|
content: "\f092";
|
|
}
|
|
|
|
.la-gitkraken:before {
|
|
content: "\f3a6";
|
|
}
|
|
|
|
.la-gitlab:before {
|
|
content: "\f296";
|
|
}
|
|
|
|
.la-gitter:before {
|
|
content: "\f426";
|
|
}
|
|
|
|
.la-glass-cheers:before {
|
|
content: "\f79f";
|
|
}
|
|
|
|
.la-glass-martini:before {
|
|
content: "\f000";
|
|
}
|
|
|
|
.la-glass-martini-alt:before {
|
|
content: "\f57b";
|
|
}
|
|
|
|
.la-glass-whiskey:before {
|
|
content: "\f7a0";
|
|
}
|
|
|
|
.la-glasses:before {
|
|
content: "\f530";
|
|
}
|
|
|
|
.la-glide:before {
|
|
content: "\f2a5";
|
|
}
|
|
|
|
.la-glide-g:before {
|
|
content: "\f2a6";
|
|
}
|
|
|
|
.la-globe:before {
|
|
content: "\f0ac";
|
|
}
|
|
|
|
.la-globe-africa:before {
|
|
content: "\f57c";
|
|
}
|
|
|
|
.la-globe-americas:before {
|
|
content: "\f57d";
|
|
}
|
|
|
|
.la-globe-asia:before {
|
|
content: "\f57e";
|
|
}
|
|
|
|
.la-globe-europe:before {
|
|
content: "\f7a2";
|
|
}
|
|
|
|
.la-gofore:before {
|
|
content: "\f3a7";
|
|
}
|
|
|
|
.la-golf-ball:before {
|
|
content: "\f450";
|
|
}
|
|
|
|
.la-goodreads:before {
|
|
content: "\f3a8";
|
|
}
|
|
|
|
.la-goodreads-g:before {
|
|
content: "\f3a9";
|
|
}
|
|
|
|
.la-google:before {
|
|
content: "\f1a0";
|
|
}
|
|
|
|
.la-google-drive:before {
|
|
content: "\f3aa";
|
|
}
|
|
|
|
.la-google-play:before {
|
|
content: "\f3ab";
|
|
}
|
|
|
|
.la-google-plus:before {
|
|
content: "\f2b3";
|
|
}
|
|
|
|
.la-google-plus-g:before {
|
|
content: "\f0d5";
|
|
}
|
|
|
|
.la-google-plus-square:before {
|
|
content: "\f0d4";
|
|
}
|
|
|
|
.la-google-wallet:before {
|
|
content: "\f1ee";
|
|
}
|
|
|
|
.la-gopuram:before {
|
|
content: "\f664";
|
|
}
|
|
|
|
.la-graduation-cap:before {
|
|
content: "\f19d";
|
|
}
|
|
|
|
.la-gratipay:before {
|
|
content: "\f184";
|
|
}
|
|
|
|
.la-grav:before {
|
|
content: "\f2d6";
|
|
}
|
|
|
|
.la-greater-than:before {
|
|
content: "\f531";
|
|
}
|
|
|
|
.la-greater-than-equal:before {
|
|
content: "\f532";
|
|
}
|
|
|
|
.la-grimace:before {
|
|
content: "\f57f";
|
|
}
|
|
|
|
.la-grin:before {
|
|
content: "\f580";
|
|
}
|
|
|
|
.la-grin-alt:before {
|
|
content: "\f581";
|
|
}
|
|
|
|
.la-grin-beam:before {
|
|
content: "\f582";
|
|
}
|
|
|
|
.la-grin-beam-sweat:before {
|
|
content: "\f583";
|
|
}
|
|
|
|
.la-grin-hearts:before {
|
|
content: "\f584";
|
|
}
|
|
|
|
.la-grin-squint:before {
|
|
content: "\f585";
|
|
}
|
|
|
|
.la-grin-squint-tears:before {
|
|
content: "\f586";
|
|
}
|
|
|
|
.la-grin-stars:before {
|
|
content: "\f587";
|
|
}
|
|
|
|
.la-grin-tears:before {
|
|
content: "\f588";
|
|
}
|
|
|
|
.la-grin-tongue:before {
|
|
content: "\f589";
|
|
}
|
|
|
|
.la-grin-tongue-squint:before {
|
|
content: "\f58a";
|
|
}
|
|
|
|
.la-grin-tongue-wink:before {
|
|
content: "\f58b";
|
|
}
|
|
|
|
.la-grin-wink:before {
|
|
content: "\f58c";
|
|
}
|
|
|
|
.la-grip-horizontal:before {
|
|
content: "\f58d";
|
|
}
|
|
|
|
.la-grip-lines:before {
|
|
content: "\f7a4";
|
|
}
|
|
|
|
.la-grip-lines-vertical:before {
|
|
content: "\f7a5";
|
|
}
|
|
|
|
.la-grip-vertical:before {
|
|
content: "\f58e";
|
|
}
|
|
|
|
.la-gripfire:before {
|
|
content: "\f3ac";
|
|
}
|
|
|
|
.la-grunt:before {
|
|
content: "\f3ad";
|
|
}
|
|
|
|
.la-guitar:before {
|
|
content: "\f7a6";
|
|
}
|
|
|
|
.la-gulp:before {
|
|
content: "\f3ae";
|
|
}
|
|
|
|
.la-h-square:before {
|
|
content: "\f0fd";
|
|
}
|
|
|
|
.la-hacker-news:before {
|
|
content: "\f1d4";
|
|
}
|
|
|
|
.la-hacker-news-square:before {
|
|
content: "\f3af";
|
|
}
|
|
|
|
.la-hackerrank:before {
|
|
content: "\f5f7";
|
|
}
|
|
|
|
.la-hamburger:before {
|
|
content: "\f805";
|
|
}
|
|
|
|
.la-hammer:before {
|
|
content: "\f6e3";
|
|
}
|
|
|
|
.la-hamsa:before {
|
|
content: "\f665";
|
|
}
|
|
|
|
.la-hand-holding:before {
|
|
content: "\f4bd";
|
|
}
|
|
|
|
.la-hand-holding-heart:before {
|
|
content: "\f4be";
|
|
}
|
|
|
|
.la-hand-holding-usd:before {
|
|
content: "\f4c0";
|
|
}
|
|
|
|
.la-hand-lizard:before {
|
|
content: "\f258";
|
|
}
|
|
|
|
.la-hand-middle-finger:before {
|
|
content: "\f806";
|
|
}
|
|
|
|
.la-hand-paper:before {
|
|
content: "\f256";
|
|
}
|
|
|
|
.la-hand-peace:before {
|
|
content: "\f25b";
|
|
}
|
|
|
|
.la-hand-point-down:before {
|
|
content: "\f0a7";
|
|
}
|
|
|
|
.la-hand-point-left:before {
|
|
content: "\f0a5";
|
|
}
|
|
|
|
.la-hand-point-right:before {
|
|
content: "\f0a4";
|
|
}
|
|
|
|
.la-hand-point-up:before {
|
|
content: "\f0a6";
|
|
}
|
|
|
|
.la-hand-pointer:before {
|
|
content: "\f25a";
|
|
}
|
|
|
|
.la-hand-rock:before {
|
|
content: "\f255";
|
|
}
|
|
|
|
.la-hand-scissors:before {
|
|
content: "\f257";
|
|
}
|
|
|
|
.la-hand-spock:before {
|
|
content: "\f259";
|
|
}
|
|
|
|
.la-hands:before {
|
|
content: "\f4c2";
|
|
}
|
|
|
|
.la-hands-helping:before {
|
|
content: "\f4c4";
|
|
}
|
|
|
|
.la-handshake:before {
|
|
content: "\f2b5";
|
|
}
|
|
|
|
.la-hanukiah:before {
|
|
content: "\f6e6";
|
|
}
|
|
|
|
.la-hard-hat:before {
|
|
content: "\f807";
|
|
}
|
|
|
|
.la-hashtag:before {
|
|
content: "\f292";
|
|
}
|
|
|
|
.la-hat-wizard:before {
|
|
content: "\f6e8";
|
|
}
|
|
|
|
.la-haykal:before {
|
|
content: "\f666";
|
|
}
|
|
|
|
.la-hdd:before {
|
|
content: "\f0a0";
|
|
}
|
|
|
|
.la-heading:before {
|
|
content: "\f1dc";
|
|
}
|
|
|
|
.la-headphones:before {
|
|
content: "\f025";
|
|
}
|
|
|
|
.la-headphones-alt:before {
|
|
content: "\f58f";
|
|
}
|
|
|
|
.la-headset:before {
|
|
content: "\f590";
|
|
}
|
|
|
|
.la-heart:before {
|
|
content: "\f004";
|
|
}
|
|
|
|
.la-heart-broken:before {
|
|
content: "\f7a9";
|
|
}
|
|
|
|
.la-heartbeat:before {
|
|
content: "\f21e";
|
|
}
|
|
|
|
.la-helicopter:before {
|
|
content: "\f533";
|
|
}
|
|
|
|
.la-highlighter:before {
|
|
content: "\f591";
|
|
}
|
|
|
|
.la-hiking:before {
|
|
content: "\f6ec";
|
|
}
|
|
|
|
.la-hippo:before {
|
|
content: "\f6ed";
|
|
}
|
|
|
|
.la-hips:before {
|
|
content: "\f452";
|
|
}
|
|
|
|
.la-hire-a-helper:before {
|
|
content: "\f3b0";
|
|
}
|
|
|
|
.la-history:before {
|
|
content: "\f1da";
|
|
}
|
|
|
|
.la-hockey-puck:before {
|
|
content: "\f453";
|
|
}
|
|
|
|
.la-holly-berry:before {
|
|
content: "\f7aa";
|
|
}
|
|
|
|
.la-home:before {
|
|
content: "\f015";
|
|
}
|
|
|
|
.la-hooli:before {
|
|
content: "\f427";
|
|
}
|
|
|
|
.la-hornbill:before {
|
|
content: "\f592";
|
|
}
|
|
|
|
.la-horse:before {
|
|
content: "\f6f0";
|
|
}
|
|
|
|
.la-horse-head:before {
|
|
content: "\f7ab";
|
|
}
|
|
|
|
.la-hospital:before {
|
|
content: "\f0f8";
|
|
}
|
|
|
|
.la-hospital-alt:before {
|
|
content: "\f47d";
|
|
}
|
|
|
|
.la-hospital-symbol:before {
|
|
content: "\f47e";
|
|
}
|
|
|
|
.la-hot-tub:before {
|
|
content: "\f593";
|
|
}
|
|
|
|
.la-hotdog:before {
|
|
content: "\f80f";
|
|
}
|
|
|
|
.la-hotel:before {
|
|
content: "\f594";
|
|
}
|
|
|
|
.la-hotjar:before {
|
|
content: "\f3b1";
|
|
}
|
|
|
|
.la-hourglass:before {
|
|
content: "\f254";
|
|
}
|
|
|
|
.la-hourglass-end:before {
|
|
content: "\f253";
|
|
}
|
|
|
|
.la-hourglass-half:before {
|
|
content: "\f252";
|
|
}
|
|
|
|
.la-hourglass-start:before {
|
|
content: "\f251";
|
|
}
|
|
|
|
.la-house-damage:before {
|
|
content: "\f6f1";
|
|
}
|
|
|
|
.la-houzz:before {
|
|
content: "\f27c";
|
|
}
|
|
|
|
.la-hryvnia:before {
|
|
content: "\f6f2";
|
|
}
|
|
|
|
.la-html5:before {
|
|
content: "\f13b";
|
|
}
|
|
|
|
.la-hubspot:before {
|
|
content: "\f3b2";
|
|
}
|
|
|
|
.la-i-cursor:before {
|
|
content: "\f246";
|
|
}
|
|
|
|
.la-ice-cream:before {
|
|
content: "\f810";
|
|
}
|
|
|
|
.la-icicles:before {
|
|
content: "\f7ad";
|
|
}
|
|
|
|
.la-icons:before {
|
|
content: "\f86d";
|
|
}
|
|
|
|
.la-id-badge:before {
|
|
content: "\f2c1";
|
|
}
|
|
|
|
.la-id-card:before {
|
|
content: "\f2c2";
|
|
}
|
|
|
|
.la-id-card-alt:before {
|
|
content: "\f47f";
|
|
}
|
|
|
|
.la-igloo:before {
|
|
content: "\f7ae";
|
|
}
|
|
|
|
.la-image:before {
|
|
content: "\f03e";
|
|
}
|
|
|
|
.la-images:before {
|
|
content: "\f302";
|
|
}
|
|
|
|
.la-imdb:before {
|
|
content: "\f2d8";
|
|
}
|
|
|
|
.la-inbox:before {
|
|
content: "\f01c";
|
|
}
|
|
|
|
.la-indent:before {
|
|
content: "\f03c";
|
|
}
|
|
|
|
.la-industry:before {
|
|
content: "\f275";
|
|
}
|
|
|
|
.la-infinity:before {
|
|
content: "\f534";
|
|
}
|
|
|
|
.la-info:before {
|
|
content: "\f129";
|
|
}
|
|
|
|
.la-info-circle:before {
|
|
content: "\f05a";
|
|
}
|
|
|
|
.la-instagram:before {
|
|
content: "\f16d";
|
|
}
|
|
|
|
.la-intercom:before {
|
|
content: "\f7af";
|
|
}
|
|
|
|
.la-internet-explorer:before {
|
|
content: "\f26b";
|
|
}
|
|
|
|
.la-invision:before {
|
|
content: "\f7b0";
|
|
}
|
|
|
|
.la-ioxhost:before {
|
|
content: "\f208";
|
|
}
|
|
|
|
.la-italic:before {
|
|
content: "\f033";
|
|
}
|
|
|
|
.la-itch-io:before {
|
|
content: "\f83a";
|
|
}
|
|
|
|
.la-itunes:before {
|
|
content: "\f3b4";
|
|
}
|
|
|
|
.la-itunes-note:before {
|
|
content: "\f3b5";
|
|
}
|
|
|
|
.la-java:before {
|
|
content: "\f4e4";
|
|
}
|
|
|
|
.la-jedi:before {
|
|
content: "\f669";
|
|
}
|
|
|
|
.la-jedi-order:before {
|
|
content: "\f50e";
|
|
}
|
|
|
|
.la-jenkins:before {
|
|
content: "\f3b6";
|
|
}
|
|
|
|
.la-jira:before {
|
|
content: "\f7b1";
|
|
}
|
|
|
|
.la-joget:before {
|
|
content: "\f3b7";
|
|
}
|
|
|
|
.la-joint:before {
|
|
content: "\f595";
|
|
}
|
|
|
|
.la-joomla:before {
|
|
content: "\f1aa";
|
|
}
|
|
|
|
.la-journal-whills:before {
|
|
content: "\f66a";
|
|
}
|
|
|
|
.la-js:before {
|
|
content: "\f3b8";
|
|
}
|
|
|
|
.la-js-square:before {
|
|
content: "\f3b9";
|
|
}
|
|
|
|
.la-jsfiddle:before {
|
|
content: "\f1cc";
|
|
}
|
|
|
|
.la-kaaba:before {
|
|
content: "\f66b";
|
|
}
|
|
|
|
.la-kaggle:before {
|
|
content: "\f5fa";
|
|
}
|
|
|
|
.la-key:before {
|
|
content: "\f084";
|
|
}
|
|
|
|
.la-keybase:before {
|
|
content: "\f4f5";
|
|
}
|
|
|
|
.la-keyboard:before {
|
|
content: "\f11c";
|
|
}
|
|
|
|
.la-keycdn:before {
|
|
content: "\f3ba";
|
|
}
|
|
|
|
.la-khanda:before {
|
|
content: "\f66d";
|
|
}
|
|
|
|
.la-kickstarter:before {
|
|
content: "\f3bb";
|
|
}
|
|
|
|
.la-kickstarter-k:before {
|
|
content: "\f3bc";
|
|
}
|
|
|
|
.la-kiss:before {
|
|
content: "\f596";
|
|
}
|
|
|
|
.la-kiss-beam:before {
|
|
content: "\f597";
|
|
}
|
|
|
|
.la-kiss-wink-heart:before {
|
|
content: "\f598";
|
|
}
|
|
|
|
.la-kiwi-bird:before {
|
|
content: "\f535";
|
|
}
|
|
|
|
.la-korvue:before {
|
|
content: "\f42f";
|
|
}
|
|
|
|
.la-landmark:before {
|
|
content: "\f66f";
|
|
}
|
|
|
|
.la-language:before {
|
|
content: "\f1ab";
|
|
}
|
|
|
|
.la-laptop:before {
|
|
content: "\f109";
|
|
}
|
|
|
|
.la-laptop-code:before {
|
|
content: "\f5fc";
|
|
}
|
|
|
|
.la-laptop-medical:before {
|
|
content: "\f812";
|
|
}
|
|
|
|
.la-laravel:before {
|
|
content: "\f3bd";
|
|
}
|
|
|
|
.la-lastfm:before {
|
|
content: "\f202";
|
|
}
|
|
|
|
.la-lastfm-square:before {
|
|
content: "\f203";
|
|
}
|
|
|
|
.la-laugh:before {
|
|
content: "\f599";
|
|
}
|
|
|
|
.la-laugh-beam:before {
|
|
content: "\f59a";
|
|
}
|
|
|
|
.la-laugh-squint:before {
|
|
content: "\f59b";
|
|
}
|
|
|
|
.la-laugh-wink:before {
|
|
content: "\f59c";
|
|
}
|
|
|
|
.la-layer-group:before {
|
|
content: "\f5fd";
|
|
}
|
|
|
|
.la-leaf:before {
|
|
content: "\f06c";
|
|
}
|
|
|
|
.la-leanpub:before {
|
|
content: "\f212";
|
|
}
|
|
|
|
.la-lemon:before {
|
|
content: "\f094";
|
|
}
|
|
|
|
.la-less:before {
|
|
content: "\f41d";
|
|
}
|
|
|
|
.la-less-than:before {
|
|
content: "\f536";
|
|
}
|
|
|
|
.la-less-than-equal:before {
|
|
content: "\f537";
|
|
}
|
|
|
|
.la-level-down-alt:before {
|
|
content: "\f3be";
|
|
}
|
|
|
|
.la-level-up-alt:before {
|
|
content: "\f3bf";
|
|
}
|
|
|
|
.la-life-ring:before {
|
|
content: "\f1cd";
|
|
}
|
|
|
|
.la-lightbulb:before {
|
|
content: "\f0eb";
|
|
}
|
|
|
|
.la-line:before {
|
|
content: "\f3c0";
|
|
}
|
|
|
|
.la-link:before {
|
|
content: "\f0c1";
|
|
}
|
|
|
|
.la-linkedin:before {
|
|
content: "\f08c";
|
|
}
|
|
|
|
.la-linkedin-in:before {
|
|
content: "\f0e1";
|
|
}
|
|
|
|
.la-linode:before {
|
|
content: "\f2b8";
|
|
}
|
|
|
|
.la-linux:before {
|
|
content: "\f17c";
|
|
}
|
|
|
|
.la-lira-sign:before {
|
|
content: "\f195";
|
|
}
|
|
|
|
.la-list:before {
|
|
content: "\f03a";
|
|
}
|
|
|
|
.la-list-alt:before {
|
|
content: "\f022";
|
|
}
|
|
|
|
.la-list-ol:before {
|
|
content: "\f0cb";
|
|
}
|
|
|
|
.la-list-ul:before {
|
|
content: "\f0ca";
|
|
}
|
|
|
|
.la-location-arrow:before {
|
|
content: "\f124";
|
|
}
|
|
|
|
.la-lock:before {
|
|
content: "\f023";
|
|
}
|
|
|
|
.la-lock-open:before {
|
|
content: "\f3c1";
|
|
}
|
|
|
|
.la-long-arrow-alt-down:before {
|
|
content: "\f309";
|
|
}
|
|
|
|
.la-long-arrow-alt-left:before {
|
|
content: "\f30a";
|
|
}
|
|
|
|
.la-long-arrow-alt-right:before {
|
|
content: "\f30b";
|
|
}
|
|
|
|
.la-long-arrow-alt-up:before {
|
|
content: "\f30c";
|
|
}
|
|
|
|
.la-low-vision:before {
|
|
content: "\f2a8";
|
|
}
|
|
|
|
.la-luggage-cart:before {
|
|
content: "\f59d";
|
|
}
|
|
|
|
.la-lyft:before {
|
|
content: "\f3c3";
|
|
}
|
|
|
|
.la-magento:before {
|
|
content: "\f3c4";
|
|
}
|
|
|
|
.la-magic:before {
|
|
content: "\f0d0";
|
|
}
|
|
|
|
.la-magnet:before {
|
|
content: "\f076";
|
|
}
|
|
|
|
.la-mail-bulk:before {
|
|
content: "\f674";
|
|
}
|
|
|
|
.la-mailchimp:before {
|
|
content: "\f59e";
|
|
}
|
|
|
|
.la-male:before {
|
|
content: "\f183";
|
|
}
|
|
|
|
.la-mandalorian:before {
|
|
content: "\f50f";
|
|
}
|
|
|
|
.la-map:before {
|
|
content: "\f279";
|
|
}
|
|
|
|
.la-map-marked:before {
|
|
content: "\f59f";
|
|
}
|
|
|
|
.la-map-marked-alt:before {
|
|
content: "\f5a0";
|
|
}
|
|
|
|
.la-map-marker:before {
|
|
content: "\f041";
|
|
}
|
|
|
|
.la-map-marker-alt:before {
|
|
content: "\f3c5";
|
|
}
|
|
|
|
.la-map-pin:before {
|
|
content: "\f276";
|
|
}
|
|
|
|
.la-map-signs:before {
|
|
content: "\f277";
|
|
}
|
|
|
|
.la-markdown:before {
|
|
content: "\f60f";
|
|
}
|
|
|
|
.la-marker:before {
|
|
content: "\f5a1";
|
|
}
|
|
|
|
.la-mars:before {
|
|
content: "\f222";
|
|
}
|
|
|
|
.la-mars-double:before {
|
|
content: "\f227";
|
|
}
|
|
|
|
.la-mars-stroke:before {
|
|
content: "\f229";
|
|
}
|
|
|
|
.la-mars-stroke-h:before {
|
|
content: "\f22b";
|
|
}
|
|
|
|
.la-mars-stroke-v:before {
|
|
content: "\f22a";
|
|
}
|
|
|
|
.la-mask:before {
|
|
content: "\f6fa";
|
|
}
|
|
|
|
.la-mastodon:before {
|
|
content: "\f4f6";
|
|
}
|
|
|
|
.la-maxcdn:before {
|
|
content: "\f136";
|
|
}
|
|
|
|
.la-medal:before {
|
|
content: "\f5a2";
|
|
}
|
|
|
|
.la-medapps:before {
|
|
content: "\f3c6";
|
|
}
|
|
|
|
.la-medium:before {
|
|
content: "\f23a";
|
|
}
|
|
|
|
.la-medium-m:before {
|
|
content: "\f3c7";
|
|
}
|
|
|
|
.la-medkit:before {
|
|
content: "\f0fa";
|
|
}
|
|
|
|
.la-medrt:before {
|
|
content: "\f3c8";
|
|
}
|
|
|
|
.la-meetup:before {
|
|
content: "\f2e0";
|
|
}
|
|
|
|
.la-megaport:before {
|
|
content: "\f5a3";
|
|
}
|
|
|
|
.la-meh:before {
|
|
content: "\f11a";
|
|
}
|
|
|
|
.la-meh-blank:before {
|
|
content: "\f5a4";
|
|
}
|
|
|
|
.la-meh-rolling-eyes:before {
|
|
content: "\f5a5";
|
|
}
|
|
|
|
.la-memory:before {
|
|
content: "\f538";
|
|
}
|
|
|
|
.la-mendeley:before {
|
|
content: "\f7b3";
|
|
}
|
|
|
|
.la-menorah:before {
|
|
content: "\f676";
|
|
}
|
|
|
|
.la-mercury:before {
|
|
content: "\f223";
|
|
}
|
|
|
|
.la-meteor:before {
|
|
content: "\f753";
|
|
}
|
|
|
|
.la-microchip:before {
|
|
content: "\f2db";
|
|
}
|
|
|
|
.la-microphone:before {
|
|
content: "\f130";
|
|
}
|
|
|
|
.la-microphone-alt:before {
|
|
content: "\f3c9";
|
|
}
|
|
|
|
.la-microphone-alt-slash:before {
|
|
content: "\f539";
|
|
}
|
|
|
|
.la-microphone-slash:before {
|
|
content: "\f131";
|
|
}
|
|
|
|
.la-microscope:before {
|
|
content: "\f610";
|
|
}
|
|
|
|
.la-microsoft:before {
|
|
content: "\f3ca";
|
|
}
|
|
|
|
.la-minus:before {
|
|
content: "\f068";
|
|
}
|
|
|
|
.la-minus-circle:before {
|
|
content: "\f056";
|
|
}
|
|
|
|
.la-minus-square:before {
|
|
content: "\f146";
|
|
}
|
|
|
|
.la-mitten:before {
|
|
content: "\f7b5";
|
|
}
|
|
|
|
.la-mix:before {
|
|
content: "\f3cb";
|
|
}
|
|
|
|
.la-mixcloud:before {
|
|
content: "\f289";
|
|
}
|
|
|
|
.la-mizuni:before {
|
|
content: "\f3cc";
|
|
}
|
|
|
|
.la-mobile:before {
|
|
content: "\f10b";
|
|
}
|
|
|
|
.la-mobile-alt:before {
|
|
content: "\f3cd";
|
|
}
|
|
|
|
.la-modx:before {
|
|
content: "\f285";
|
|
}
|
|
|
|
.la-monero:before {
|
|
content: "\f3d0";
|
|
}
|
|
|
|
.la-money-bill:before {
|
|
content: "\f0d6";
|
|
}
|
|
|
|
.la-money-bill-alt:before {
|
|
content: "\f3d1";
|
|
}
|
|
|
|
.la-money-bill-wave:before {
|
|
content: "\f53a";
|
|
}
|
|
|
|
.la-money-bill-wave-alt:before {
|
|
content: "\f53b";
|
|
}
|
|
|
|
.la-money-check:before {
|
|
content: "\f53c";
|
|
}
|
|
|
|
.la-money-check-alt:before {
|
|
content: "\f53d";
|
|
}
|
|
|
|
.la-monument:before {
|
|
content: "\f5a6";
|
|
}
|
|
|
|
.la-moon:before {
|
|
content: "\f186";
|
|
}
|
|
|
|
.la-mortar-pestle:before {
|
|
content: "\f5a7";
|
|
}
|
|
|
|
.la-mosque:before {
|
|
content: "\f678";
|
|
}
|
|
|
|
.la-motorcycle:before {
|
|
content: "\f21c";
|
|
}
|
|
|
|
.la-mountain:before {
|
|
content: "\f6fc";
|
|
}
|
|
|
|
.la-mouse-pointer:before {
|
|
content: "\f245";
|
|
}
|
|
|
|
.la-mug-hot:before {
|
|
content: "\f7b6";
|
|
}
|
|
|
|
.la-music:before {
|
|
content: "\f001";
|
|
}
|
|
|
|
.la-napster:before {
|
|
content: "\f3d2";
|
|
}
|
|
|
|
.la-neos:before {
|
|
content: "\f612";
|
|
}
|
|
|
|
.la-network-wired:before {
|
|
content: "\f6ff";
|
|
}
|
|
|
|
.la-neuter:before {
|
|
content: "\f22c";
|
|
}
|
|
|
|
.la-newspaper:before {
|
|
content: "\f1ea";
|
|
}
|
|
|
|
.la-nimblr:before {
|
|
content: "\f5a8";
|
|
}
|
|
|
|
.la-node:before {
|
|
content: "\f419";
|
|
}
|
|
|
|
.la-node-js:before {
|
|
content: "\f3d3";
|
|
}
|
|
|
|
.la-not-equal:before {
|
|
content: "\f53e";
|
|
}
|
|
|
|
.la-notes-medical:before {
|
|
content: "\f481";
|
|
}
|
|
|
|
.la-npm:before {
|
|
content: "\f3d4";
|
|
}
|
|
|
|
.la-ns8:before {
|
|
content: "\f3d5";
|
|
}
|
|
|
|
.la-nutritionix:before {
|
|
content: "\f3d6";
|
|
}
|
|
|
|
.la-object-group:before {
|
|
content: "\f247";
|
|
}
|
|
|
|
.la-object-ungroup:before {
|
|
content: "\f248";
|
|
}
|
|
|
|
.la-odnoklassniki:before {
|
|
content: "\f263";
|
|
}
|
|
|
|
.la-odnoklassniki-square:before {
|
|
content: "\f264";
|
|
}
|
|
|
|
.la-oil-can:before {
|
|
content: "\f613";
|
|
}
|
|
|
|
.la-old-republic:before {
|
|
content: "\f510";
|
|
}
|
|
|
|
.la-om:before {
|
|
content: "\f679";
|
|
}
|
|
|
|
.la-opencart:before {
|
|
content: "\f23d";
|
|
}
|
|
|
|
.la-openid:before {
|
|
content: "\f19b";
|
|
}
|
|
|
|
.la-opera:before {
|
|
content: "\f26a";
|
|
}
|
|
|
|
.la-optin-monster:before {
|
|
content: "\f23c";
|
|
}
|
|
|
|
.la-osi:before {
|
|
content: "\f41a";
|
|
}
|
|
|
|
.la-otter:before {
|
|
content: "\f700";
|
|
}
|
|
|
|
.la-outdent:before {
|
|
content: "\f03b";
|
|
}
|
|
|
|
.la-page4:before {
|
|
content: "\f3d7";
|
|
}
|
|
|
|
.la-pagelines:before {
|
|
content: "\f18c";
|
|
}
|
|
|
|
.la-pager:before {
|
|
content: "\f815";
|
|
}
|
|
|
|
.la-paint-brush:before {
|
|
content: "\f1fc";
|
|
}
|
|
|
|
.la-paint-roller:before {
|
|
content: "\f5aa";
|
|
}
|
|
|
|
.la-palette:before {
|
|
content: "\f53f";
|
|
}
|
|
|
|
.la-palfed:before {
|
|
content: "\f3d8";
|
|
}
|
|
|
|
.la-pallet:before {
|
|
content: "\f482";
|
|
}
|
|
|
|
.la-paper-plane:before {
|
|
content: "\f1d8";
|
|
}
|
|
|
|
.la-paperclip:before {
|
|
content: "\f0c6";
|
|
}
|
|
|
|
.la-parachute-box:before {
|
|
content: "\f4cd";
|
|
}
|
|
|
|
.la-paragraph:before {
|
|
content: "\f1dd";
|
|
}
|
|
|
|
.la-parking:before {
|
|
content: "\f540";
|
|
}
|
|
|
|
.la-passport:before {
|
|
content: "\f5ab";
|
|
}
|
|
|
|
.la-pastafarianism:before {
|
|
content: "\f67b";
|
|
}
|
|
|
|
.la-paste:before {
|
|
content: "\f0ea";
|
|
}
|
|
|
|
.la-patreon:before {
|
|
content: "\f3d9";
|
|
}
|
|
|
|
.la-pause:before {
|
|
content: "\f04c";
|
|
}
|
|
|
|
.la-pause-circle:before {
|
|
content: "\f28b";
|
|
}
|
|
|
|
.la-paw:before {
|
|
content: "\f1b0";
|
|
}
|
|
|
|
.la-paypal:before {
|
|
content: "\f1ed";
|
|
}
|
|
|
|
.la-peace:before {
|
|
content: "\f67c";
|
|
}
|
|
|
|
.la-pen:before {
|
|
content: "\f304";
|
|
}
|
|
|
|
.la-pen-alt:before {
|
|
content: "\f305";
|
|
}
|
|
|
|
.la-pen-fancy:before {
|
|
content: "\f5ac";
|
|
}
|
|
|
|
.la-pen-nib:before {
|
|
content: "\f5ad";
|
|
}
|
|
|
|
.la-pen-square:before {
|
|
content: "\f14b";
|
|
}
|
|
|
|
.la-pencil-alt:before {
|
|
content: "\f303";
|
|
}
|
|
|
|
.la-pencil-ruler:before {
|
|
content: "\f5ae";
|
|
}
|
|
|
|
.la-penny-arcade:before {
|
|
content: "\f704";
|
|
}
|
|
|
|
.la-people-carry:before {
|
|
content: "\f4ce";
|
|
}
|
|
|
|
.la-pepper-hot:before {
|
|
content: "\f816";
|
|
}
|
|
|
|
.la-percent:before {
|
|
content: "\f295";
|
|
}
|
|
|
|
.la-percentage:before {
|
|
content: "\f541";
|
|
}
|
|
|
|
.la-periscope:before {
|
|
content: "\f3da";
|
|
}
|
|
|
|
.la-person-booth:before {
|
|
content: "\f756";
|
|
}
|
|
|
|
.la-phabricator:before {
|
|
content: "\f3db";
|
|
}
|
|
|
|
.la-phoenix-framework:before {
|
|
content: "\f3dc";
|
|
}
|
|
|
|
.la-phoenix-squadron:before {
|
|
content: "\f511";
|
|
}
|
|
|
|
.la-phone:before {
|
|
content: "\f095";
|
|
}
|
|
|
|
.la-phone-alt:before {
|
|
content: "\f879";
|
|
}
|
|
|
|
.la-phone-slash:before {
|
|
content: "\f3dd";
|
|
}
|
|
|
|
.la-phone-square:before {
|
|
content: "\f098";
|
|
}
|
|
|
|
.la-phone-square-alt:before {
|
|
content: "\f87b";
|
|
}
|
|
|
|
.la-phone-volume:before {
|
|
content: "\f2a0";
|
|
}
|
|
|
|
.la-photo-video:before {
|
|
content: "\f87c";
|
|
}
|
|
|
|
.la-php:before {
|
|
content: "\f457";
|
|
}
|
|
|
|
.la-pied-piper:before {
|
|
content: "\f2ae";
|
|
}
|
|
|
|
.la-pied-piper-alt:before {
|
|
content: "\f1a8";
|
|
}
|
|
|
|
.la-pied-piper-hat:before {
|
|
content: "\f4e5";
|
|
}
|
|
|
|
.la-pied-piper-pp:before {
|
|
content: "\f1a7";
|
|
}
|
|
|
|
.la-piggy-bank:before {
|
|
content: "\f4d3";
|
|
}
|
|
|
|
.la-pills:before {
|
|
content: "\f484";
|
|
}
|
|
|
|
.la-pinterest:before {
|
|
content: "\f0d2";
|
|
}
|
|
|
|
.la-pinterest-p:before {
|
|
content: "\f231";
|
|
}
|
|
|
|
.la-pinterest-square:before {
|
|
content: "\f0d3";
|
|
}
|
|
|
|
.la-pizza-slice:before {
|
|
content: "\f818";
|
|
}
|
|
|
|
.la-place-of-worship:before {
|
|
content: "\f67f";
|
|
}
|
|
|
|
.la-plane:before {
|
|
content: "\f072";
|
|
}
|
|
|
|
.la-plane-arrival:before {
|
|
content: "\f5af";
|
|
}
|
|
|
|
.la-plane-departure:before {
|
|
content: "\f5b0";
|
|
}
|
|
|
|
.la-play:before {
|
|
content: "\f04b";
|
|
}
|
|
|
|
.la-play-circle:before {
|
|
content: "\f144";
|
|
}
|
|
|
|
.la-playstation:before {
|
|
content: "\f3df";
|
|
}
|
|
|
|
.la-plug:before {
|
|
content: "\f1e6";
|
|
}
|
|
|
|
.la-plus:before {
|
|
content: "\f067";
|
|
}
|
|
|
|
.la-plus-circle:before {
|
|
content: "\f055";
|
|
}
|
|
|
|
.la-plus-square:before {
|
|
content: "\f0fe";
|
|
}
|
|
|
|
.la-podcast:before {
|
|
content: "\f2ce";
|
|
}
|
|
|
|
.la-poll:before {
|
|
content: "\f681";
|
|
}
|
|
|
|
.la-poll-h:before {
|
|
content: "\f682";
|
|
}
|
|
|
|
.la-poo:before {
|
|
content: "\f2fe";
|
|
}
|
|
|
|
.la-poo-storm:before {
|
|
content: "\f75a";
|
|
}
|
|
|
|
.la-poop:before {
|
|
content: "\f619";
|
|
}
|
|
|
|
.la-portrait:before {
|
|
content: "\f3e0";
|
|
}
|
|
|
|
.la-pound-sign:before {
|
|
content: "\f154";
|
|
}
|
|
|
|
.la-power-off:before {
|
|
content: "\f011";
|
|
}
|
|
|
|
.la-pray:before {
|
|
content: "\f683";
|
|
}
|
|
|
|
.la-praying-hands:before {
|
|
content: "\f684";
|
|
}
|
|
|
|
.la-prescription:before {
|
|
content: "\f5b1";
|
|
}
|
|
|
|
.la-prescription-bottle:before {
|
|
content: "\f485";
|
|
}
|
|
|
|
.la-prescription-bottle-alt:before {
|
|
content: "\f486";
|
|
}
|
|
|
|
.la-print:before {
|
|
content: "\f02f";
|
|
}
|
|
|
|
.la-procedures:before {
|
|
content: "\f487";
|
|
}
|
|
|
|
.la-product-hunt:before {
|
|
content: "\f288";
|
|
}
|
|
|
|
.la-project-diagram:before {
|
|
content: "\f542";
|
|
}
|
|
|
|
.la-pushed:before {
|
|
content: "\f3e1";
|
|
}
|
|
|
|
.la-puzzle-piece:before {
|
|
content: "\f12e";
|
|
}
|
|
|
|
.la-python:before {
|
|
content: "\f3e2";
|
|
}
|
|
|
|
.la-qq:before {
|
|
content: "\f1d6";
|
|
}
|
|
|
|
.la-qrcode:before {
|
|
content: "\f029";
|
|
}
|
|
|
|
.la-question:before {
|
|
content: "\f128";
|
|
}
|
|
|
|
.la-question-circle:before {
|
|
content: "\f059";
|
|
}
|
|
|
|
.la-quidditch:before {
|
|
content: "\f458";
|
|
}
|
|
|
|
.la-quinscape:before {
|
|
content: "\f459";
|
|
}
|
|
|
|
.la-quora:before {
|
|
content: "\f2c4";
|
|
}
|
|
|
|
.la-quote-left:before {
|
|
content: "\f10d";
|
|
}
|
|
|
|
.la-quote-right:before {
|
|
content: "\f10e";
|
|
}
|
|
|
|
.la-quran:before {
|
|
content: "\f687";
|
|
}
|
|
|
|
.la-r-project:before {
|
|
content: "\f4f7";
|
|
}
|
|
|
|
.la-radiation:before {
|
|
content: "\f7b9";
|
|
}
|
|
|
|
.la-radiation-alt:before {
|
|
content: "\f7ba";
|
|
}
|
|
|
|
.la-rainbow:before {
|
|
content: "\f75b";
|
|
}
|
|
|
|
.la-random:before {
|
|
content: "\f074";
|
|
}
|
|
|
|
.la-raspberry-pi:before {
|
|
content: "\f7bb";
|
|
}
|
|
|
|
.la-ravelry:before {
|
|
content: "\f2d9";
|
|
}
|
|
|
|
.la-react:before {
|
|
content: "\f41b";
|
|
}
|
|
|
|
.la-reacteurope:before {
|
|
content: "\f75d";
|
|
}
|
|
|
|
.la-readme:before {
|
|
content: "\f4d5";
|
|
}
|
|
|
|
.la-rebel:before {
|
|
content: "\f1d0";
|
|
}
|
|
|
|
.la-receipt:before {
|
|
content: "\f543";
|
|
}
|
|
|
|
.la-recycle:before {
|
|
content: "\f1b8";
|
|
}
|
|
|
|
.la-red-river:before {
|
|
content: "\f3e3";
|
|
}
|
|
|
|
.la-reddit:before {
|
|
content: "\f1a1";
|
|
}
|
|
|
|
.la-reddit-alien:before {
|
|
content: "\f281";
|
|
}
|
|
|
|
.la-reddit-square:before {
|
|
content: "\f1a2";
|
|
}
|
|
|
|
.la-redhat:before {
|
|
content: "\f7bc";
|
|
}
|
|
|
|
.la-redo:before {
|
|
content: "\f01e";
|
|
}
|
|
|
|
.la-redo-alt:before {
|
|
content: "\f2f9";
|
|
}
|
|
|
|
.la-registered:before {
|
|
content: "\f25d";
|
|
}
|
|
|
|
.la-remove-format:before {
|
|
content: "\f87d";
|
|
}
|
|
|
|
.la-renren:before {
|
|
content: "\f18b";
|
|
}
|
|
|
|
.la-reply:before {
|
|
content: "\f3e5";
|
|
}
|
|
|
|
.la-reply-all:before {
|
|
content: "\f122";
|
|
}
|
|
|
|
.la-replyd:before {
|
|
content: "\f3e6";
|
|
}
|
|
|
|
.la-republican:before {
|
|
content: "\f75e";
|
|
}
|
|
|
|
.la-researchgate:before {
|
|
content: "\f4f8";
|
|
}
|
|
|
|
.la-resolving:before {
|
|
content: "\f3e7";
|
|
}
|
|
|
|
.la-restroom:before {
|
|
content: "\f7bd";
|
|
}
|
|
|
|
.la-retweet:before {
|
|
content: "\f079";
|
|
}
|
|
|
|
.la-rev:before {
|
|
content: "\f5b2";
|
|
}
|
|
|
|
.la-ribbon:before {
|
|
content: "\f4d6";
|
|
}
|
|
|
|
.la-ring:before {
|
|
content: "\f70b";
|
|
}
|
|
|
|
.la-road:before {
|
|
content: "\f018";
|
|
}
|
|
|
|
.la-robot:before {
|
|
content: "\f544";
|
|
}
|
|
|
|
.la-rocket:before {
|
|
content: "\f135";
|
|
}
|
|
|
|
.la-rocketchat:before {
|
|
content: "\f3e8";
|
|
}
|
|
|
|
.la-rockrms:before {
|
|
content: "\f3e9";
|
|
}
|
|
|
|
.la-route:before {
|
|
content: "\f4d7";
|
|
}
|
|
|
|
.la-rss:before {
|
|
content: "\f09e";
|
|
}
|
|
|
|
.la-rss-square:before {
|
|
content: "\f143";
|
|
}
|
|
|
|
.la-ruble-sign:before {
|
|
content: "\f158";
|
|
}
|
|
|
|
.la-ruler:before {
|
|
content: "\f545";
|
|
}
|
|
|
|
.la-ruler-combined:before {
|
|
content: "\f546";
|
|
}
|
|
|
|
.la-ruler-horizontal:before {
|
|
content: "\f547";
|
|
}
|
|
|
|
.la-ruler-vertical:before {
|
|
content: "\f548";
|
|
}
|
|
|
|
.la-running:before {
|
|
content: "\f70c";
|
|
}
|
|
|
|
.la-rupee-sign:before {
|
|
content: "\f156";
|
|
}
|
|
|
|
.la-sad-cry:before {
|
|
content: "\f5b3";
|
|
}
|
|
|
|
.la-sad-tear:before {
|
|
content: "\f5b4";
|
|
}
|
|
|
|
.la-safari:before {
|
|
content: "\f267";
|
|
}
|
|
|
|
.la-salesforce:before {
|
|
content: "\f83b";
|
|
}
|
|
|
|
.la-sass:before {
|
|
content: "\f41e";
|
|
}
|
|
|
|
.la-satellite:before {
|
|
content: "\f7bf";
|
|
}
|
|
|
|
.la-satellite-dish:before {
|
|
content: "\f7c0";
|
|
}
|
|
|
|
.la-save:before {
|
|
content: "\f0c7";
|
|
}
|
|
|
|
.la-schlix:before {
|
|
content: "\f3ea";
|
|
}
|
|
|
|
.la-school:before {
|
|
content: "\f549";
|
|
}
|
|
|
|
.la-screwdriver:before {
|
|
content: "\f54a";
|
|
}
|
|
|
|
.la-scribd:before {
|
|
content: "\f28a";
|
|
}
|
|
|
|
.la-scroll:before {
|
|
content: "\f70e";
|
|
}
|
|
|
|
.la-sd-card:before {
|
|
content: "\f7c2";
|
|
}
|
|
|
|
.la-search:before {
|
|
content: "\f002";
|
|
}
|
|
|
|
.la-search-dollar:before {
|
|
content: "\f688";
|
|
}
|
|
|
|
.la-search-location:before {
|
|
content: "\f689";
|
|
}
|
|
|
|
.la-search-minus:before {
|
|
content: "\f010";
|
|
}
|
|
|
|
.la-search-plus:before {
|
|
content: "\f00e";
|
|
}
|
|
|
|
.la-searchengin:before {
|
|
content: "\f3eb";
|
|
}
|
|
|
|
.la-seedling:before {
|
|
content: "\f4d8";
|
|
}
|
|
|
|
.la-sellcast:before {
|
|
content: "\f2da";
|
|
}
|
|
|
|
.la-sellsy:before {
|
|
content: "\f213";
|
|
}
|
|
|
|
.la-server:before {
|
|
content: "\f233";
|
|
}
|
|
|
|
.la-servicestack:before {
|
|
content: "\f3ec";
|
|
}
|
|
|
|
.la-shapes:before {
|
|
content: "\f61f";
|
|
}
|
|
|
|
.la-share:before {
|
|
content: "\f064";
|
|
}
|
|
|
|
.la-share-alt:before {
|
|
content: "\f1e0";
|
|
}
|
|
|
|
.la-share-alt-square:before {
|
|
content: "\f1e1";
|
|
}
|
|
|
|
.la-share-square:before {
|
|
content: "\f14d";
|
|
}
|
|
|
|
.la-shekel-sign:before {
|
|
content: "\f20b";
|
|
}
|
|
|
|
.la-shield-alt:before {
|
|
content: "\f3ed";
|
|
}
|
|
|
|
.la-ship:before {
|
|
content: "\f21a";
|
|
}
|
|
|
|
.la-shipping-fast:before {
|
|
content: "\f48b";
|
|
}
|
|
|
|
.la-shirtsinbulk:before {
|
|
content: "\f214";
|
|
}
|
|
|
|
.la-shoe-prints:before {
|
|
content: "\f54b";
|
|
}
|
|
|
|
.la-shopping-bag:before {
|
|
content: "\f290";
|
|
}
|
|
|
|
.la-shopping-basket:before {
|
|
content: "\f291";
|
|
}
|
|
|
|
.la-shopping-cart:before {
|
|
content: "\f07a";
|
|
}
|
|
|
|
.la-shopware:before {
|
|
content: "\f5b5";
|
|
}
|
|
|
|
.la-shower:before {
|
|
content: "\f2cc";
|
|
}
|
|
|
|
.la-shuttle-van:before {
|
|
content: "\f5b6";
|
|
}
|
|
|
|
.la-sign:before {
|
|
content: "\f4d9";
|
|
}
|
|
|
|
.la-sign-in-alt:before {
|
|
content: "\f2f6";
|
|
}
|
|
|
|
.la-sign-language:before {
|
|
content: "\f2a7";
|
|
}
|
|
|
|
.la-sign-out-alt:before {
|
|
content: "\f2f5";
|
|
}
|
|
|
|
.la-signal:before {
|
|
content: "\f012";
|
|
}
|
|
|
|
.la-signature:before {
|
|
content: "\f5b7";
|
|
}
|
|
|
|
.la-sim-card:before {
|
|
content: "\f7c4";
|
|
}
|
|
|
|
.la-simplybuilt:before {
|
|
content: "\f215";
|
|
}
|
|
|
|
.la-sistrix:before {
|
|
content: "\f3ee";
|
|
}
|
|
|
|
.la-sitemap:before {
|
|
content: "\f0e8";
|
|
}
|
|
|
|
.la-sith:before {
|
|
content: "\f512";
|
|
}
|
|
|
|
.la-skating:before {
|
|
content: "\f7c5";
|
|
}
|
|
|
|
.la-sketch:before {
|
|
content: "\f7c6";
|
|
}
|
|
|
|
.la-skiing:before {
|
|
content: "\f7c9";
|
|
}
|
|
|
|
.la-skiing-nordic:before {
|
|
content: "\f7ca";
|
|
}
|
|
|
|
.la-skull:before {
|
|
content: "\f54c";
|
|
}
|
|
|
|
.la-skull-crossbones:before {
|
|
content: "\f714";
|
|
}
|
|
|
|
.la-skyatlas:before {
|
|
content: "\f216";
|
|
}
|
|
|
|
.la-skype:before {
|
|
content: "\f17e";
|
|
}
|
|
|
|
.la-slack:before {
|
|
content: "\f198";
|
|
}
|
|
|
|
.la-slack-hash:before {
|
|
content: "\f3ef";
|
|
}
|
|
|
|
.la-slash:before {
|
|
content: "\f715";
|
|
}
|
|
|
|
.la-sleigh:before {
|
|
content: "\f7cc";
|
|
}
|
|
|
|
.la-sliders-h:before {
|
|
content: "\f1de";
|
|
}
|
|
|
|
.la-slideshare:before {
|
|
content: "\f1e7";
|
|
}
|
|
|
|
.la-smile:before {
|
|
content: "\f118";
|
|
}
|
|
|
|
.la-smile-beam:before {
|
|
content: "\f5b8";
|
|
}
|
|
|
|
.la-smile-wink:before {
|
|
content: "\f4da";
|
|
}
|
|
|
|
.la-smog:before {
|
|
content: "\f75f";
|
|
}
|
|
|
|
.la-smoking:before {
|
|
content: "\f48d";
|
|
}
|
|
|
|
.la-smoking-ban:before {
|
|
content: "\f54d";
|
|
}
|
|
|
|
.la-sms:before {
|
|
content: "\f7cd";
|
|
}
|
|
|
|
.la-snapchat:before {
|
|
content: "\f2ab";
|
|
}
|
|
|
|
.la-snapchat-ghost:before {
|
|
content: "\f2ac";
|
|
}
|
|
|
|
.la-snapchat-square:before {
|
|
content: "\f2ad";
|
|
}
|
|
|
|
.la-snowboarding:before {
|
|
content: "\f7ce";
|
|
}
|
|
|
|
.la-snowflake:before {
|
|
content: "\f2dc";
|
|
}
|
|
|
|
.la-snowman:before {
|
|
content: "\f7d0";
|
|
}
|
|
|
|
.la-snowplow:before {
|
|
content: "\f7d2";
|
|
}
|
|
|
|
.la-socks:before {
|
|
content: "\f696";
|
|
}
|
|
|
|
.la-solar-panel:before {
|
|
content: "\f5ba";
|
|
}
|
|
|
|
.la-sort:before {
|
|
content: "\f0dc";
|
|
}
|
|
|
|
.la-sort-alpha-down:before {
|
|
content: "\f15d";
|
|
}
|
|
|
|
.la-sort-alpha-down-alt:before {
|
|
content: "\f881";
|
|
}
|
|
|
|
.la-sort-alpha-up:before {
|
|
content: "\f15e";
|
|
}
|
|
|
|
.la-sort-alpha-up-alt:before {
|
|
content: "\f882";
|
|
}
|
|
|
|
.la-sort-amount-down:before {
|
|
content: "\f160";
|
|
}
|
|
|
|
.la-sort-amount-down-alt:before {
|
|
content: "\f884";
|
|
}
|
|
|
|
.la-sort-amount-up:before {
|
|
content: "\f161";
|
|
}
|
|
|
|
.la-sort-amount-up-alt:before {
|
|
content: "\f885";
|
|
}
|
|
|
|
.la-sort-down:before {
|
|
content: "\f0dd";
|
|
}
|
|
|
|
.la-sort-numeric-down:before {
|
|
content: "\f162";
|
|
}
|
|
|
|
.la-sort-numeric-down-alt:before {
|
|
content: "\f886";
|
|
}
|
|
|
|
.la-sort-numeric-up:before {
|
|
content: "\f163";
|
|
}
|
|
|
|
.la-sort-numeric-up-alt:before {
|
|
content: "\f887";
|
|
}
|
|
|
|
.la-sort-up:before {
|
|
content: "\f0de";
|
|
}
|
|
|
|
.la-soundcloud:before {
|
|
content: "\f1be";
|
|
}
|
|
|
|
.la-sourcetree:before {
|
|
content: "\f7d3";
|
|
}
|
|
|
|
.la-spa:before {
|
|
content: "\f5bb";
|
|
}
|
|
|
|
.la-space-shuttle:before {
|
|
content: "\f197";
|
|
}
|
|
|
|
.la-speakap:before {
|
|
content: "\f3f3";
|
|
}
|
|
|
|
.la-speaker-deck:before {
|
|
content: "\f83c";
|
|
}
|
|
|
|
.la-spell-check:before {
|
|
content: "\f891";
|
|
}
|
|
|
|
.la-spider:before {
|
|
content: "\f717";
|
|
}
|
|
|
|
.la-spinner:before {
|
|
content: "\f110";
|
|
}
|
|
|
|
.la-splotch:before {
|
|
content: "\f5bc";
|
|
}
|
|
|
|
.la-spotify:before {
|
|
content: "\f1bc";
|
|
}
|
|
|
|
.la-spray-can:before {
|
|
content: "\f5bd";
|
|
}
|
|
|
|
.la-square:before {
|
|
content: "\f0c8";
|
|
}
|
|
|
|
.la-square-full:before {
|
|
content: "\f45c";
|
|
}
|
|
|
|
.la-square-root-alt:before {
|
|
content: "\f698";
|
|
}
|
|
|
|
.la-squarespace:before {
|
|
content: "\f5be";
|
|
}
|
|
|
|
.la-stack-exchange:before {
|
|
content: "\f18d";
|
|
}
|
|
|
|
.la-stack-overflow:before {
|
|
content: "\f16c";
|
|
}
|
|
|
|
.la-stackpath:before {
|
|
content: "\f842";
|
|
}
|
|
|
|
.la-stamp:before {
|
|
content: "\f5bf";
|
|
}
|
|
|
|
.la-star:before {
|
|
content: "\f005";
|
|
}
|
|
|
|
.la-star-and-crescent:before {
|
|
content: "\f699";
|
|
}
|
|
|
|
.la-star-half:before {
|
|
content: "\f089";
|
|
}
|
|
|
|
.la-star-half-alt:before {
|
|
content: "\f5c0";
|
|
}
|
|
|
|
.la-star-of-david:before {
|
|
content: "\f69a";
|
|
}
|
|
|
|
.la-star-of-life:before {
|
|
content: "\f621";
|
|
}
|
|
|
|
.la-staylinked:before {
|
|
content: "\f3f5";
|
|
}
|
|
|
|
.la-steam:before {
|
|
content: "\f1b6";
|
|
}
|
|
|
|
.la-steam-square:before {
|
|
content: "\f1b7";
|
|
}
|
|
|
|
.la-steam-symbol:before {
|
|
content: "\f3f6";
|
|
}
|
|
|
|
.la-step-backward:before {
|
|
content: "\f048";
|
|
}
|
|
|
|
.la-step-forward:before {
|
|
content: "\f051";
|
|
}
|
|
|
|
.la-stethoscope:before {
|
|
content: "\f0f1";
|
|
}
|
|
|
|
.la-sticker-mule:before {
|
|
content: "\f3f7";
|
|
}
|
|
|
|
.la-sticky-note:before {
|
|
content: "\f249";
|
|
}
|
|
|
|
.la-stop:before {
|
|
content: "\f04d";
|
|
}
|
|
|
|
.la-stop-circle:before {
|
|
content: "\f28d";
|
|
}
|
|
|
|
.la-stopwatch:before {
|
|
content: "\f2f2";
|
|
}
|
|
|
|
.la-store:before {
|
|
content: "\f54e";
|
|
}
|
|
|
|
.la-store-alt:before {
|
|
content: "\f54f";
|
|
}
|
|
|
|
.la-strava:before {
|
|
content: "\f428";
|
|
}
|
|
|
|
.la-stream:before {
|
|
content: "\f550";
|
|
}
|
|
|
|
.la-street-view:before {
|
|
content: "\f21d";
|
|
}
|
|
|
|
.la-strikethrough:before {
|
|
content: "\f0cc";
|
|
}
|
|
|
|
.la-stripe:before {
|
|
content: "\f429";
|
|
}
|
|
|
|
.la-stripe-s:before {
|
|
content: "\f42a";
|
|
}
|
|
|
|
.la-stroopwafel:before {
|
|
content: "\f551";
|
|
}
|
|
|
|
.la-studiovinari:before {
|
|
content: "\f3f8";
|
|
}
|
|
|
|
.la-stumbleupon:before {
|
|
content: "\f1a4";
|
|
}
|
|
|
|
.la-stumbleupon-circle:before {
|
|
content: "\f1a3";
|
|
}
|
|
|
|
.la-subscript:before {
|
|
content: "\f12c";
|
|
}
|
|
|
|
.la-subway:before {
|
|
content: "\f239";
|
|
}
|
|
|
|
.la-suitcase:before {
|
|
content: "\f0f2";
|
|
}
|
|
|
|
.la-suitcase-rolling:before {
|
|
content: "\f5c1";
|
|
}
|
|
|
|
.la-sun:before {
|
|
content: "\f185";
|
|
}
|
|
|
|
.la-superpowers:before {
|
|
content: "\f2dd";
|
|
}
|
|
|
|
.la-superscript:before {
|
|
content: "\f12b";
|
|
}
|
|
|
|
.la-supple:before {
|
|
content: "\f3f9";
|
|
}
|
|
|
|
.la-surprise:before {
|
|
content: "\f5c2";
|
|
}
|
|
|
|
.la-suse:before {
|
|
content: "\f7d6";
|
|
}
|
|
|
|
.la-swatchbook:before {
|
|
content: "\f5c3";
|
|
}
|
|
|
|
.la-swimmer:before {
|
|
content: "\f5c4";
|
|
}
|
|
|
|
.la-swimming-pool:before {
|
|
content: "\f5c5";
|
|
}
|
|
|
|
.la-symfony:before {
|
|
content: "\f83d";
|
|
}
|
|
|
|
.la-synagogue:before {
|
|
content: "\f69b";
|
|
}
|
|
|
|
.la-sync:before {
|
|
content: "\f021";
|
|
}
|
|
|
|
.la-sync-alt:before {
|
|
content: "\f2f1";
|
|
}
|
|
|
|
.la-syringe:before {
|
|
content: "\f48e";
|
|
}
|
|
|
|
.la-table:before {
|
|
content: "\f0ce";
|
|
}
|
|
|
|
.la-table-tennis:before {
|
|
content: "\f45d";
|
|
}
|
|
|
|
.la-tablet:before {
|
|
content: "\f10a";
|
|
}
|
|
|
|
.la-tablet-alt:before {
|
|
content: "\f3fa";
|
|
}
|
|
|
|
.la-tablets:before {
|
|
content: "\f490";
|
|
}
|
|
|
|
.la-tachometer-alt:before {
|
|
content: "\f3fd";
|
|
}
|
|
|
|
.la-tag:before {
|
|
content: "\f02b";
|
|
}
|
|
|
|
.la-tags:before {
|
|
content: "\f02c";
|
|
}
|
|
|
|
.la-tape:before {
|
|
content: "\f4db";
|
|
}
|
|
|
|
.la-tasks:before {
|
|
content: "\f0ae";
|
|
}
|
|
|
|
.la-taxi:before {
|
|
content: "\f1ba";
|
|
}
|
|
|
|
.la-teamspeak:before {
|
|
content: "\f4f9";
|
|
}
|
|
|
|
.la-teeth:before {
|
|
content: "\f62e";
|
|
}
|
|
|
|
.la-teeth-open:before {
|
|
content: "\f62f";
|
|
}
|
|
|
|
.la-telegram:before {
|
|
content: "\f2c6";
|
|
}
|
|
|
|
.la-telegram-plane:before {
|
|
content: "\f3fe";
|
|
}
|
|
|
|
.la-temperature-high:before {
|
|
content: "\f769";
|
|
}
|
|
|
|
.la-temperature-low:before {
|
|
content: "\f76b";
|
|
}
|
|
|
|
.la-tencent-weibo:before {
|
|
content: "\f1d5";
|
|
}
|
|
|
|
.la-tenge:before {
|
|
content: "\f7d7";
|
|
}
|
|
|
|
.la-terminal:before {
|
|
content: "\f120";
|
|
}
|
|
|
|
.la-text-height:before {
|
|
content: "\f034";
|
|
}
|
|
|
|
.la-text-width:before {
|
|
content: "\f035";
|
|
}
|
|
|
|
.la-th:before {
|
|
content: "\f00a";
|
|
}
|
|
|
|
.la-th-large:before {
|
|
content: "\f009";
|
|
}
|
|
|
|
.la-th-list:before {
|
|
content: "\f00b";
|
|
}
|
|
|
|
.la-the-red-yeti:before {
|
|
content: "\f69d";
|
|
}
|
|
|
|
.la-theater-masks:before {
|
|
content: "\f630";
|
|
}
|
|
|
|
.la-themeco:before {
|
|
content: "\f5c6";
|
|
}
|
|
|
|
.la-themeisle:before {
|
|
content: "\f2b2";
|
|
}
|
|
|
|
.la-thermometer:before {
|
|
content: "\f491";
|
|
}
|
|
|
|
.la-thermometer-empty:before {
|
|
content: "\f2cb";
|
|
}
|
|
|
|
.la-thermometer-full:before {
|
|
content: "\f2c7";
|
|
}
|
|
|
|
.la-thermometer-half:before {
|
|
content: "\f2c9";
|
|
}
|
|
|
|
.la-thermometer-quarter:before {
|
|
content: "\f2ca";
|
|
}
|
|
|
|
.la-thermometer-three-quarters:before {
|
|
content: "\f2c8";
|
|
}
|
|
|
|
.la-think-peaks:before {
|
|
content: "\f731";
|
|
}
|
|
|
|
.la-thumbs-down:before {
|
|
content: "\f165";
|
|
}
|
|
|
|
.la-thumbs-up:before {
|
|
content: "\f164";
|
|
}
|
|
|
|
.la-thumbtack:before {
|
|
content: "\f08d";
|
|
}
|
|
|
|
.la-ticket-alt:before {
|
|
content: "\f3ff";
|
|
}
|
|
|
|
.la-times:before {
|
|
content: "\f00d";
|
|
}
|
|
|
|
.la-times-circle:before {
|
|
content: "\f057";
|
|
}
|
|
|
|
.la-tint:before {
|
|
content: "\f043";
|
|
}
|
|
|
|
.la-tint-slash:before {
|
|
content: "\f5c7";
|
|
}
|
|
|
|
.la-tired:before {
|
|
content: "\f5c8";
|
|
}
|
|
|
|
.la-toggle-off:before {
|
|
content: "\f204";
|
|
}
|
|
|
|
.la-toggle-on:before {
|
|
content: "\f205";
|
|
}
|
|
|
|
.la-toilet:before {
|
|
content: "\f7d8";
|
|
}
|
|
|
|
.la-toilet-paper:before {
|
|
content: "\f71e";
|
|
}
|
|
|
|
.la-toolbox:before {
|
|
content: "\f552";
|
|
}
|
|
|
|
.la-tools:before {
|
|
content: "\f7d9";
|
|
}
|
|
|
|
.la-tooth:before {
|
|
content: "\f5c9";
|
|
}
|
|
|
|
.la-torah:before {
|
|
content: "\f6a0";
|
|
}
|
|
|
|
.la-torii-gate:before {
|
|
content: "\f6a1";
|
|
}
|
|
|
|
.la-tractor:before {
|
|
content: "\f722";
|
|
}
|
|
|
|
.la-trade-federation:before {
|
|
content: "\f513";
|
|
}
|
|
|
|
.la-trademark:before {
|
|
content: "\f25c";
|
|
}
|
|
|
|
.la-traffic-light:before {
|
|
content: "\f637";
|
|
}
|
|
|
|
.la-train:before {
|
|
content: "\f238";
|
|
}
|
|
|
|
.la-tram:before {
|
|
content: "\f7da";
|
|
}
|
|
|
|
.la-transgender:before {
|
|
content: "\f224";
|
|
}
|
|
|
|
.la-transgender-alt:before {
|
|
content: "\f225";
|
|
}
|
|
|
|
.la-trash:before {
|
|
content: "\f1f8";
|
|
}
|
|
|
|
.la-trash-alt:before {
|
|
content: "\f2ed";
|
|
}
|
|
|
|
.la-trash-restore:before {
|
|
content: "\f829";
|
|
}
|
|
|
|
.la-trash-restore-alt:before {
|
|
content: "\f82a";
|
|
}
|
|
|
|
.la-tree:before {
|
|
content: "\f1bb";
|
|
}
|
|
|
|
.la-trello:before {
|
|
content: "\f181";
|
|
}
|
|
|
|
.la-tripadvisor:before {
|
|
content: "\f262";
|
|
}
|
|
|
|
.la-trophy:before {
|
|
content: "\f091";
|
|
}
|
|
|
|
.la-truck:before {
|
|
content: "\f0d1";
|
|
}
|
|
|
|
.la-truck-loading:before {
|
|
content: "\f4de";
|
|
}
|
|
|
|
.la-truck-monster:before {
|
|
content: "\f63b";
|
|
}
|
|
|
|
.la-truck-moving:before {
|
|
content: "\f4df";
|
|
}
|
|
|
|
.la-truck-pickup:before {
|
|
content: "\f63c";
|
|
}
|
|
|
|
.la-tshirt:before {
|
|
content: "\f553";
|
|
}
|
|
|
|
.la-tty:before {
|
|
content: "\f1e4";
|
|
}
|
|
|
|
.la-tumblr:before {
|
|
content: "\f173";
|
|
}
|
|
|
|
.la-tumblr-square:before {
|
|
content: "\f174";
|
|
}
|
|
|
|
.la-tv:before {
|
|
content: "\f26c";
|
|
}
|
|
|
|
.la-twitch:before {
|
|
content: "\f1e8";
|
|
}
|
|
|
|
.la-twitter:before {
|
|
content: "\f099";
|
|
}
|
|
|
|
.la-twitter-square:before {
|
|
content: "\f081";
|
|
}
|
|
|
|
.la-typo3:before {
|
|
content: "\f42b";
|
|
}
|
|
|
|
.la-uber:before {
|
|
content: "\f402";
|
|
}
|
|
|
|
.la-ubuntu:before {
|
|
content: "\f7df";
|
|
}
|
|
|
|
.la-uikit:before {
|
|
content: "\f403";
|
|
}
|
|
|
|
.la-umbrella:before {
|
|
content: "\f0e9";
|
|
}
|
|
|
|
.la-umbrella-beach:before {
|
|
content: "\f5ca";
|
|
}
|
|
|
|
.la-underline:before {
|
|
content: "\f0cd";
|
|
}
|
|
|
|
.la-undo:before {
|
|
content: "\f0e2";
|
|
}
|
|
|
|
.la-undo-alt:before {
|
|
content: "\f2ea";
|
|
}
|
|
|
|
.la-uniregistry:before {
|
|
content: "\f404";
|
|
}
|
|
|
|
.la-universal-access:before {
|
|
content: "\f29a";
|
|
}
|
|
|
|
.la-university:before {
|
|
content: "\f19c";
|
|
}
|
|
|
|
.la-unlink:before {
|
|
content: "\f127";
|
|
}
|
|
|
|
.la-unlock:before {
|
|
content: "\f09c";
|
|
}
|
|
|
|
.la-unlock-alt:before {
|
|
content: "\f13e";
|
|
}
|
|
|
|
.la-untappd:before {
|
|
content: "\f405";
|
|
}
|
|
|
|
.la-upload:before {
|
|
content: "\f093";
|
|
}
|
|
|
|
.la-ups:before {
|
|
content: "\f7e0";
|
|
}
|
|
|
|
.la-usb:before {
|
|
content: "\f287";
|
|
}
|
|
|
|
.la-user:before {
|
|
content: "\f007";
|
|
}
|
|
|
|
.la-user-alt:before {
|
|
content: "\f406";
|
|
}
|
|
|
|
.la-user-alt-slash:before {
|
|
content: "\f4fa";
|
|
}
|
|
|
|
.la-user-astronaut:before {
|
|
content: "\f4fb";
|
|
}
|
|
|
|
.la-user-check:before {
|
|
content: "\f4fc";
|
|
}
|
|
|
|
.la-user-circle:before {
|
|
content: "\f2bd";
|
|
}
|
|
|
|
.la-user-clock:before {
|
|
content: "\f4fd";
|
|
}
|
|
|
|
.la-user-cog:before {
|
|
content: "\f4fe";
|
|
}
|
|
|
|
.la-user-edit:before {
|
|
content: "\f4ff";
|
|
}
|
|
|
|
.la-user-friends:before {
|
|
content: "\f500";
|
|
}
|
|
|
|
.la-user-graduate:before {
|
|
content: "\f501";
|
|
}
|
|
|
|
.la-user-injured:before {
|
|
content: "\f728";
|
|
}
|
|
|
|
.la-user-lock:before {
|
|
content: "\f502";
|
|
}
|
|
|
|
.la-user-md:before {
|
|
content: "\f0f0";
|
|
}
|
|
|
|
.la-user-minus:before {
|
|
content: "\f503";
|
|
}
|
|
|
|
.la-user-ninja:before {
|
|
content: "\f504";
|
|
}
|
|
|
|
.la-user-nurse:before {
|
|
content: "\f82f";
|
|
}
|
|
|
|
.la-user-plus:before {
|
|
content: "\f234";
|
|
}
|
|
|
|
.la-user-secret:before {
|
|
content: "\f21b";
|
|
}
|
|
|
|
.la-user-shield:before {
|
|
content: "\f505";
|
|
}
|
|
|
|
.la-user-slash:before {
|
|
content: "\f506";
|
|
}
|
|
|
|
.la-user-tag:before {
|
|
content: "\f507";
|
|
}
|
|
|
|
.la-user-tie:before {
|
|
content: "\f508";
|
|
}
|
|
|
|
.la-user-times:before {
|
|
content: "\f235";
|
|
}
|
|
|
|
.la-users:before {
|
|
content: "\f0c0";
|
|
}
|
|
|
|
.la-users-cog:before {
|
|
content: "\f509";
|
|
}
|
|
|
|
.la-usps:before {
|
|
content: "\f7e1";
|
|
}
|
|
|
|
.la-ussunnah:before {
|
|
content: "\f407";
|
|
}
|
|
|
|
.la-utensil-spoon:before {
|
|
content: "\f2e5";
|
|
}
|
|
|
|
.la-utensils:before {
|
|
content: "\f2e7";
|
|
}
|
|
|
|
.la-vaadin:before {
|
|
content: "\f408";
|
|
}
|
|
|
|
.la-vector-square:before {
|
|
content: "\f5cb";
|
|
}
|
|
|
|
.la-venus:before {
|
|
content: "\f221";
|
|
}
|
|
|
|
.la-venus-double:before {
|
|
content: "\f226";
|
|
}
|
|
|
|
.la-venus-mars:before {
|
|
content: "\f228";
|
|
}
|
|
|
|
.la-viacoin:before {
|
|
content: "\f237";
|
|
}
|
|
|
|
.la-viadeo:before {
|
|
content: "\f2a9";
|
|
}
|
|
|
|
.la-viadeo-square:before {
|
|
content: "\f2aa";
|
|
}
|
|
|
|
.la-vial:before {
|
|
content: "\f492";
|
|
}
|
|
|
|
.la-vials:before {
|
|
content: "\f493";
|
|
}
|
|
|
|
.la-viber:before {
|
|
content: "\f409";
|
|
}
|
|
|
|
.la-video:before {
|
|
content: "\f03d";
|
|
}
|
|
|
|
.la-video-slash:before {
|
|
content: "\f4e2";
|
|
}
|
|
|
|
.la-vihara:before {
|
|
content: "\f6a7";
|
|
}
|
|
|
|
.la-vimeo:before {
|
|
content: "\f40a";
|
|
}
|
|
|
|
.la-vimeo-square:before {
|
|
content: "\f194";
|
|
}
|
|
|
|
.la-vimeo-v:before {
|
|
content: "\f27d";
|
|
}
|
|
|
|
.la-vine:before {
|
|
content: "\f1ca";
|
|
}
|
|
|
|
.la-vk:before {
|
|
content: "\f189";
|
|
}
|
|
|
|
.la-vnv:before {
|
|
content: "\f40b";
|
|
}
|
|
|
|
.la-voicemail:before {
|
|
content: "\f897";
|
|
}
|
|
|
|
.la-volleyball-ball:before {
|
|
content: "\f45f";
|
|
}
|
|
|
|
.la-volume-down:before {
|
|
content: "\f027";
|
|
}
|
|
|
|
.la-volume-mute:before {
|
|
content: "\f6a9";
|
|
}
|
|
|
|
.la-volume-off:before {
|
|
content: "\f026";
|
|
}
|
|
|
|
.la-volume-up:before {
|
|
content: "\f028";
|
|
}
|
|
|
|
.la-vote-yea:before {
|
|
content: "\f772";
|
|
}
|
|
|
|
.la-vr-cardboard:before {
|
|
content: "\f729";
|
|
}
|
|
|
|
.la-vuejs:before {
|
|
content: "\f41f";
|
|
}
|
|
|
|
.la-walking:before {
|
|
content: "\f554";
|
|
}
|
|
|
|
.la-wallet:before {
|
|
content: "\f555";
|
|
}
|
|
|
|
.la-warehouse:before {
|
|
content: "\f494";
|
|
}
|
|
|
|
.la-water:before {
|
|
content: "\f773";
|
|
}
|
|
|
|
.la-wave-square:before {
|
|
content: "\f83e";
|
|
}
|
|
|
|
.la-waze:before {
|
|
content: "\f83f";
|
|
}
|
|
|
|
.la-weebly:before {
|
|
content: "\f5cc";
|
|
}
|
|
|
|
.la-weibo:before {
|
|
content: "\f18a";
|
|
}
|
|
|
|
.la-weight:before {
|
|
content: "\f496";
|
|
}
|
|
|
|
.la-weight-hanging:before {
|
|
content: "\f5cd";
|
|
}
|
|
|
|
.la-weixin:before {
|
|
content: "\f1d7";
|
|
}
|
|
|
|
.la-whatsapp:before {
|
|
content: "\f232";
|
|
}
|
|
|
|
.la-whatsapp-square:before {
|
|
content: "\f40c";
|
|
}
|
|
|
|
.la-wheelchair:before {
|
|
content: "\f193";
|
|
}
|
|
|
|
.la-whmcs:before {
|
|
content: "\f40d";
|
|
}
|
|
|
|
.la-wifi:before {
|
|
content: "\f1eb";
|
|
}
|
|
|
|
.la-wikipedia-w:before {
|
|
content: "\f266";
|
|
}
|
|
|
|
.la-wind:before {
|
|
content: "\f72e";
|
|
}
|
|
|
|
.la-window-close:before {
|
|
content: "\f410";
|
|
}
|
|
|
|
.la-window-maximize:before {
|
|
content: "\f2d0";
|
|
}
|
|
|
|
.la-window-minimize:before {
|
|
content: "\f2d1";
|
|
}
|
|
|
|
.la-window-restore:before {
|
|
content: "\f2d2";
|
|
}
|
|
|
|
.la-windows:before {
|
|
content: "\f17a";
|
|
}
|
|
|
|
.la-wine-bottle:before {
|
|
content: "\f72f";
|
|
}
|
|
|
|
.la-wine-glass:before {
|
|
content: "\f4e3";
|
|
}
|
|
|
|
.la-wine-glass-alt:before {
|
|
content: "\f5ce";
|
|
}
|
|
|
|
.la-wix:before {
|
|
content: "\f5cf";
|
|
}
|
|
|
|
.la-wizards-of-the-coast:before {
|
|
content: "\f730";
|
|
}
|
|
|
|
.la-wolf-pack-battalion:before {
|
|
content: "\f514";
|
|
}
|
|
|
|
.la-won-sign:before {
|
|
content: "\f159";
|
|
}
|
|
|
|
.la-wordpress:before {
|
|
content: "\f19a";
|
|
}
|
|
|
|
.la-wordpress-simple:before {
|
|
content: "\f411";
|
|
}
|
|
|
|
.la-wpbeginner:before {
|
|
content: "\f297";
|
|
}
|
|
|
|
.la-wpexplorer:before {
|
|
content: "\f2de";
|
|
}
|
|
|
|
.la-wpforms:before {
|
|
content: "\f298";
|
|
}
|
|
|
|
.la-wpressr:before {
|
|
content: "\f3e4";
|
|
}
|
|
|
|
.la-wrench:before {
|
|
content: "\f0ad";
|
|
}
|
|
|
|
.la-x-ray:before {
|
|
content: "\f497";
|
|
}
|
|
|
|
.la-xbox:before {
|
|
content: "\f412";
|
|
}
|
|
|
|
.la-xing:before {
|
|
content: "\f168";
|
|
}
|
|
|
|
.la-xing-square:before {
|
|
content: "\f169";
|
|
}
|
|
|
|
.la-y-combinator:before {
|
|
content: "\f23b";
|
|
}
|
|
|
|
.la-yahoo:before {
|
|
content: "\f19e";
|
|
}
|
|
|
|
.la-yammer:before {
|
|
content: "\f840";
|
|
}
|
|
|
|
.la-yandex:before {
|
|
content: "\f413";
|
|
}
|
|
|
|
.la-yandex-international:before {
|
|
content: "\f414";
|
|
}
|
|
|
|
.la-yarn:before {
|
|
content: "\f7e3";
|
|
}
|
|
|
|
.la-yelp:before {
|
|
content: "\f1e9";
|
|
}
|
|
|
|
.la-yen-sign:before {
|
|
content: "\f157";
|
|
}
|
|
|
|
.la-yin-yang:before {
|
|
content: "\f6ad";
|
|
}
|
|
|
|
.la-yoast:before {
|
|
content: "\f2b1";
|
|
}
|
|
|
|
.la-youtube:before {
|
|
content: "\f167";
|
|
}
|
|
|
|
.la-youtube-square:before {
|
|
content: "\f431";
|
|
}
|
|
|
|
.la-zhihu:before {
|
|
content: "\f63f";
|
|
}
|
|
|
|
.la-hat-cowboy:before {
|
|
content: "\f8c0";
|
|
}
|
|
|
|
.la-hat-cowboy-side:before {
|
|
content: "\f8c1";
|
|
}
|
|
|
|
.la-mdb:before {
|
|
content: "\f8ca";
|
|
}
|
|
|
|
.la-mouse:before {
|
|
content: "\f8cc";
|
|
}
|
|
|
|
.la-orcid:before {
|
|
content: "\f8d2";
|
|
}
|
|
|
|
.la-record-vinyl:before {
|
|
content: "\f8d9";
|
|
}
|
|
|
|
.la-swift:before {
|
|
content: "\f8e1";
|
|
}
|
|
|
|
.la-umbraco:before {
|
|
content: "\f8e8";
|
|
}
|
|
|
|
.la-buy-n-large:before {
|
|
content: "\f8a6";
|
|
}
|
|
|
|
.sr-only {
|
|
border: 0;
|
|
clip: rect(0, 0, 0, 0);
|
|
height: 1px;
|
|
margin: -1px;
|
|
overflow: hidden;
|
|
padding: 0;
|
|
position: absolute;
|
|
width: 1px;
|
|
}
|
|
|
|
.sr-only-focusable:active, .sr-only-focusable:focus {
|
|
clip: auto;
|
|
height: auto;
|
|
margin: 0;
|
|
overflow: visible;
|
|
position: static;
|
|
width: auto;
|
|
}
|
|
|
|
/*
|
|
i.la {
|
|
font-style:normal;
|
|
vertical-align:middle;
|
|
}
|
|
*/
|
|
a {
|
|
text-decoration: inherit;
|
|
}
|
|
a:hover {
|
|
text-decoration: inherit;
|
|
}
|
|
|
|
html {
|
|
--bs-btn-active-border-color:var(--bs-primary-border-subtle);
|
|
--bs-btn-active-bg:rgba(var(--bs-primary-rgb), 0.1);
|
|
--bs-border-color-translucent: rgba(0, 0, 0, 0.12);
|
|
}
|
|
|
|
body {
|
|
-webkit-font-smoothing: antialiased;
|
|
text-rendering: optimizelegibility;
|
|
-moz-osx-font-smoothing: grayscale;
|
|
background: var(--bs-body-bg);
|
|
width: 100%;
|
|
flex-direction: column;
|
|
}
|
|
|
|
b, strong {
|
|
font-weight: 600;
|
|
}
|
|
|
|
.navbar {
|
|
font-size: 0.875em;
|
|
}
|
|
|
|
/*
|
|
.bg-dark {
|
|
background-color: $success !important;
|
|
}
|
|
*/
|
|
.bg-body-secondary.navbar-fixed-top {
|
|
border-width: 0 0 1px 0;
|
|
}
|
|
.bg-body-secondary.navbar-fixed-bottom {
|
|
border-width: 1px 0 0 0;
|
|
}
|
|
|
|
html, body {
|
|
min-height: 100%;
|
|
display: flex;
|
|
text-rendering: optimizelegibility;
|
|
}
|
|
|
|
body > div#container, .small-nav, .main {
|
|
min-height: 100%;
|
|
width: 100%;
|
|
}
|
|
|
|
#container {
|
|
min-height: 100%;
|
|
display: flex;
|
|
flex-direction: row;
|
|
}
|
|
#container .main,
|
|
#container #preview {
|
|
transition: width 1s, transform 1s ease 0s, width 1s ease 0s, width 1s ease 0s, left 1s ease 0s, height 1s ease 0s;
|
|
transform-origin: top center;
|
|
}
|
|
#container #preview-separator {
|
|
position: absolute;
|
|
opacity: 0;
|
|
height: 100%;
|
|
}
|
|
#container #preview-separator > div {
|
|
top: 50%;
|
|
position: absolute;
|
|
border: 1px solid var(--bs-border-color);
|
|
overflow: hidden;
|
|
letter-spacing: 2px;
|
|
color: var(--bs-secondary);
|
|
background: var(--bs-body-bg);
|
|
display: inline-block;
|
|
letter-spacing: -1px;
|
|
cursor: col-resize;
|
|
line-height: 4px;
|
|
width: 15px;
|
|
height: 0px;
|
|
padding: 0px 3px;
|
|
overflow: hidden;
|
|
user-select: none;
|
|
border-radius: 8px;
|
|
transition: opacity 1s 1s;
|
|
}
|
|
#container #preview-separator > div:hover {
|
|
background-color: rgba(var(--bs-primary-rgb), 0.75);
|
|
color: var(--bs-light);
|
|
}
|
|
#container #preview-separator.active {
|
|
background-color: rgba(var(--bs-primary-rgb), 0.25);
|
|
width: 15px;
|
|
}
|
|
#container #preview {
|
|
width: 0;
|
|
overflow: hidden;
|
|
}
|
|
#container #preview iframe {
|
|
border: 0;
|
|
width: 100%;
|
|
height: 100%;
|
|
pointer-events: none;
|
|
}
|
|
|
|
.btn-preview .preview {
|
|
display: block;
|
|
}
|
|
.btn-preview .close {
|
|
display: none;
|
|
}
|
|
.btn-preview.btn.close {
|
|
background-color: var(--bs-body-bg);
|
|
color: var(--bs-body-color);
|
|
float: right;
|
|
margin-left: 1rem;
|
|
}
|
|
.btn-preview.btn.close .preview {
|
|
display: none;
|
|
}
|
|
.btn-preview.btn.close .close {
|
|
display: block;
|
|
}
|
|
|
|
.preview-responsive .percent input {
|
|
height: 100%;
|
|
margin-top: 0;
|
|
}
|
|
|
|
#content, .main {
|
|
display: flex;
|
|
flex-flow: column;
|
|
}
|
|
|
|
#container.preview {
|
|
background-color: var(--bs-border-color);
|
|
}
|
|
#container.preview .main,
|
|
#container.preview #preview {
|
|
width: 50%;
|
|
}
|
|
#container.preview .main iframe,
|
|
#container.preview #preview iframe {
|
|
margin: 0 auto;
|
|
display: block;
|
|
}
|
|
#container.preview .main.tablet iframe,
|
|
#container.preview #preview.tablet iframe {
|
|
width: 768px;
|
|
}
|
|
#container.preview .main.mobile iframe,
|
|
#container.preview #preview.mobile iframe {
|
|
width: 320px;
|
|
}
|
|
#container.preview .main {
|
|
background-color: var(--bs-body-bg);
|
|
border-right: 1px solid var(--bs-border-color);
|
|
}
|
|
#container.preview #preview-separator {
|
|
left: calc(50% + 14px);
|
|
opacity: 1;
|
|
}
|
|
#container.preview #preview-separator > div {
|
|
height: 32px;
|
|
}
|
|
|
|
/*
|
|
.content
|
|
{
|
|
padding:0rem 1rem;
|
|
margin:0rem 1rem;
|
|
}
|
|
*/
|
|
.btn {
|
|
/*box-shadow: 0px 1px 2px #eee;*/
|
|
cursor: pointer;
|
|
/*padding:0.5rem 2rem;*/
|
|
}
|
|
.btn:hover {
|
|
text-decoration: none;
|
|
}
|
|
|
|
.custom-select {
|
|
-webkit-appearance: none;
|
|
-moz-appearance: none;
|
|
}
|
|
|
|
/*.collapsing, .collapse { transition: height 0.01s; }*/
|
|
.btn-gray {
|
|
background: #f5f5f5;
|
|
border: 1px solid var(--bs-body-color-rgb);
|
|
color: var(--bs-body-color);
|
|
/*box-shadow: 0px 2px 3px #eee;*/
|
|
}
|
|
|
|
.btn-icon-single {
|
|
padding: 0rem;
|
|
margin: 0rem;
|
|
}
|
|
.btn-icon-single i:first-child {
|
|
display: inline-block;
|
|
padding: 0.7rem 1rem;
|
|
font-size: 18px;
|
|
vertical-align: middle;
|
|
line-height: 18px;
|
|
}
|
|
.btn-icon-single.btn-sm i:first-child, .btn-group-sm > .btn-icon-single.btn i:first-child {
|
|
padding: 0.4rem 0.6rem;
|
|
}
|
|
|
|
.btn-icon {
|
|
margin-bottom: 0px;
|
|
position: relative;
|
|
box-shadow: 0 4px 4px rgba(8, 8, 8, 0.0784313725), 0 1px 2px rgba(8, 8, 8, 0.2), inset 0 6px 12px rgba(255, 255, 255, 0.1215686275), inset 0 1px 1px rgba(255, 255, 255, 0.2);
|
|
box-shadow: 1px 1px 2px 1px rgba(var(--bs-body-color-rgb), 0.07), 1px 1px 2px 1px rgba(var(--bs-body-bg-rgb), 0.15) inset;
|
|
box-shadow: 0 4px 4px rgba(var(--bs-body-color-rgb), 0.08), 0 6px 12px rgba(var(--bs-body-color-rgb), 0.012), 0 6px 12px rgba(var(--bs-body-bg-rgb), 0.12) inset, 0 1px 1px rgba(var(--bs-body-bg-rgb), 0.2) inset;
|
|
font-weight: 500;
|
|
/*
|
|
i:first-child {
|
|
display: inline-block;
|
|
margin-right:0.3rem;
|
|
//font-size: 21px;
|
|
//opacity:0.7;
|
|
}
|
|
*/
|
|
}
|
|
.btn-icon.btn-outline-primary {
|
|
border-width: 0px;
|
|
box-shadow: rgba(0, 0, 0, 0) 0px 0px 0px 0px, rgba(0, 0, 0, 0) 0px 0px 0px 0px, rgba(var(--bs-primary-rgb), 0.15) 0px 1px 2px 0px, rgba(var(--bs-primary-rgb), 0.2) 0px 0px 0px 1px;
|
|
}
|
|
.btn-icon.btn-outline-primary:hover {
|
|
color: var(--bs-link-color);
|
|
background: var(--bs-border-color);
|
|
}
|
|
.btn-icon.btn-outline-primary i {
|
|
background: transparent;
|
|
}
|
|
.btn-icon.btn-outline-secondary, .btn-icon.btn-outline-success, .btn-icon.btn-outline-danger {
|
|
box-shadow: rgba(0, 0, 0, 0) 0px 0px 0px 0px, rgba(0, 0, 0, 0) 0px 0px 0px 0px, rgba(var(--bs-body-color-rgb), 0.12) 0px 1px 2px 0px, rgba(var(--bs-body-color-rgb), 0.08) 0px 0px 0px 1px;
|
|
border: none;
|
|
--bs-border-width:0;
|
|
}
|
|
.btn-icon.btn-secondary {
|
|
box-shadow: 1px 1px 2px 1px rgba(var(--bs-body-color-rgb), 0.07), -1px 1px 2px 0px rgba(var(--bs-body-bg-rgb), 0.15) inset;
|
|
}
|
|
.btn-icon.btn-secondary i {
|
|
background: transparent;
|
|
}
|
|
.btn-icon.btn-primary {
|
|
--bs-btn-border-color: rgba(var(--bs-primary-rgb), 0.5);
|
|
--bs-btn-bg:#0030C0;
|
|
padding-left: 1.2rem;
|
|
padding-right: 1.2rem;
|
|
}
|
|
.btn-icon.btn-primary i {
|
|
/*background: rgba(var(--bs-body-bg-rgb), 0.1);*/
|
|
}
|
|
.btn-icon.btn-sm, .btn-group-sm > .btn-icon.btn {
|
|
border: none;
|
|
}
|
|
.btn-icon.btn-sm i, .btn-group-sm > .btn-icon.btn i {
|
|
/*padding: 0.5rem 0.5rem;*/
|
|
}
|
|
.btn-icon:after {
|
|
content: ".";
|
|
background-image: linear-gradient(rgba(var(--bs-body-bg-rgb), 1), rgba(var(--bs-body-bg-rgb), 0));
|
|
position: absolute;
|
|
left: 0;
|
|
top: 0;
|
|
width: 100%;
|
|
height: 100%;
|
|
opacity: 0.16;
|
|
}
|
|
.btn-icon.btn-outline-secondary:after, .btn-icon.btn-outline-primary:after, .btn-icon.btn-outline-secondary:after {
|
|
background-image: linear-gradient(rgba(var(--bs-body-color-rgb), 0), rgba(var(--bs-body-color-rgb), 1));
|
|
opacity: 0.03;
|
|
}
|
|
|
|
.btn.btn-outline-dark {
|
|
border-color: var(--bs-border-color);
|
|
}
|
|
|
|
.btn.btn-outline-secondary {
|
|
/*
|
|
--bs-btn-color: var(--bs-body-color);
|
|
--bs-btn-border-color: var(--bs-body-color-rgb);
|
|
--bs-btn-hover-color:var(--bs-body-color);
|
|
--bs-btn-hover-bg:#eee;
|
|
--bs-btn-hover-border-color: var(--bs-border-color);
|
|
--bs-btn-active-bg:var(--bs-body-color-rgb);
|
|
--bs-btn-active-color:#222;*/
|
|
--bs-btn-bg:var(--bs-body-bg);
|
|
--bs-btn-border-color:var(--bs-border-color);
|
|
--bs-btn-hover-bg:var(--bs-primary-bg-subtle);
|
|
--bs-btn-hover-color:var(--bs-body-color);
|
|
--bs-btn-hover-border:var(--bs-body-color);
|
|
--bs-btn-hover-border-color:var(--bs-border-color);
|
|
--bs-btn-active-bg: var(--bs-border-color);
|
|
--bs-btn-active-color: var(--bs-body-color);
|
|
--bs-btn-active-border-color: var(--bs-border-color);
|
|
}
|
|
|
|
.btn-group > .save-btn {
|
|
border-right: 2px solid rgba(var(--bs-body-color-rgb), 0.2);
|
|
padding: 0.1rem 0.5rem 0.1rem 1rem;
|
|
}
|
|
.btn-group > .save-btn i {
|
|
font-size: 1rem;
|
|
line-height: 21px;
|
|
}
|
|
.save-btn.dropdown-toggle-split {
|
|
padding: 0 0.5rem;
|
|
box-shadow: none;
|
|
border-left: 1px solid rgba(var(--bs-body-bg-rgb), 0.2);
|
|
}
|
|
/*
|
|
.btn-light {
|
|
|
|
color: #111;
|
|
background-color: #f9f9f9;
|
|
border-color: #eee;
|
|
|
|
}
|
|
*/
|
|
/*
|
|
.badge.badge-outline
|
|
{
|
|
border:1px solid #aaa;
|
|
color:var(--bs-body-color);
|
|
}
|
|
.badge.badge-gray
|
|
{
|
|
border: 1px solid var(--bs-border-color);
|
|
color: var(--bs-body-color);
|
|
background: #f5f5f5f5;
|
|
}
|
|
*/
|
|
/*
|
|
.form-check-input {
|
|
|
|
~ .custom-control-indicator
|
|
{
|
|
border: 2px solid #eee;// $custom-control-indicator-bg;
|
|
background-color: var(--bs-gray-100);
|
|
}
|
|
|
|
|
|
&:checked ~ .custom-control-indicator {
|
|
border:none;
|
|
}
|
|
|
|
&:focus ~ .custom-control-indicator {
|
|
border:none;
|
|
}
|
|
|
|
&:active ~ .custom-control-indicator {
|
|
border:none;
|
|
}
|
|
|
|
&:disabled {
|
|
~ .custom-control-indicator {
|
|
border:none;
|
|
}
|
|
}
|
|
}
|
|
|
|
|
|
.form-check-label::before {
|
|
background-color: var(--bs-gray-100);
|
|
box-shadow: none;
|
|
border: 1px solid var(--bs-border-color);
|
|
}
|
|
*/
|
|
.input-group-addon i {
|
|
font-size: 18px;
|
|
line-height: 1;
|
|
}
|
|
|
|
/*
|
|
img[src=""]
|
|
{
|
|
min-width:100px;
|
|
min-height:50px;
|
|
position:relative;
|
|
display:block;
|
|
margin:auto;
|
|
}
|
|
img[src=""]::after
|
|
{
|
|
content: " ";
|
|
//font-family: "Ionicons";
|
|
width:100%;
|
|
height:100%;
|
|
position:absolute;
|
|
background-color:var(--bs-gray-100);
|
|
background:url(../img/image.svg);
|
|
background-size: contain;
|
|
background-repeat: no-repeat;
|
|
background-position: center center;
|
|
top:0;
|
|
left:0;
|
|
font-size: 3rem;
|
|
text-align: center;
|
|
vertical-align: middle;
|
|
}
|
|
*/
|
|
.main {
|
|
position: relative;
|
|
margin-bottom: 2rem;
|
|
}
|
|
.main #main-content, .main #content .content {
|
|
padding: 0rem 1rem;
|
|
}
|
|
.main #content,
|
|
.main #main-content {
|
|
min-height: 600px;
|
|
}
|
|
.main #content form,
|
|
.main #main-content form {
|
|
padding: 0rem;
|
|
}
|
|
.columns {
|
|
display: flex;
|
|
}
|
|
.columns .left-column {
|
|
width: auto;
|
|
flex: 1;
|
|
position: relative;
|
|
}
|
|
.columns .right-column {
|
|
width: 300px;
|
|
padding: 0rem 0 2rem;
|
|
border-left: 1px solid var(--bs-border-color);
|
|
}
|
|
.columns .right-column #featured-image-thumb {
|
|
cursor: pointer;
|
|
}
|
|
.columns .right-column label.header {
|
|
font-size: 13px;
|
|
font-weight: 600;
|
|
padding: 0.5rem 1rem;
|
|
}
|
|
.columns .right-column > label.header:first-child {
|
|
border: none;
|
|
}
|
|
.columns .right-column .section {
|
|
padding: 1rem 1rem;
|
|
}
|
|
|
|
div.actions {
|
|
margin: 0rem 0rem 1rem;
|
|
padding: 1.5rem 2rem 1rem;
|
|
border-bottom: 1px solid rgba(var(--bs-body-color-rgb), 0.08);
|
|
display: flex;
|
|
background-color: var(--bs-body-bg);
|
|
}
|
|
div.actions .title {
|
|
flex-grow: 1;
|
|
margin-bottom: 0.5rem;
|
|
}
|
|
div.actions .btns {
|
|
display: flex;
|
|
flex-wrap: wrap;
|
|
align-items: center;
|
|
justify-content: space-between;
|
|
}
|
|
div.actions .btns .btn, div.actions .btns .input-group {
|
|
margin-left: 0.5rem;
|
|
margin-bottom: 0.5rem;
|
|
}
|
|
div.actions .input-group .btn {
|
|
margin: 0;
|
|
}
|
|
div.actions h4, div.actions .h4 {
|
|
font-size: 1rem;
|
|
font-weight: normal;
|
|
margin-bottom: 0;
|
|
}
|
|
div.actions h4 i, div.actions .h4 i {
|
|
line-height: 1;
|
|
color: rgba(var(--bs-secondary-rgb), 0.5);
|
|
margin-right: 0.2rem;
|
|
}
|
|
div.actions > .nav-tabs {
|
|
bottom: -1px;
|
|
position: absolute;
|
|
}
|
|
|
|
td.actions {
|
|
text-align: center;
|
|
}
|
|
|
|
.secondary-actions {
|
|
visibility: hidden;
|
|
padding: 0;
|
|
position: absolute;
|
|
width: 100%;
|
|
z-index: 100;
|
|
bottom: -0.8rem;
|
|
}
|
|
.secondary-actions .btn-icon-single {
|
|
padding: 0rem 1rem 0 0;
|
|
}
|
|
.secondary-actions .btn-icon-single.btn-sm i:first-child, .secondary-actions .btn-group-sm > .btn-icon-single.btn i:first-child {
|
|
padding: 0.3rem 0.4rem;
|
|
}
|
|
.secondary-actions .btn-icon-single.btn-sm i:first-child, .secondary-actions .btn-group-sm > .btn-icon-single.btn i:first-child {
|
|
/*padding: 0.1rem 0.2rem;*/
|
|
}
|
|
|
|
td:hover .secondary-actions {
|
|
visibility: visible;
|
|
}
|
|
|
|
tr.no-items {
|
|
--bs-table-hover-bg: transparent;
|
|
}
|
|
|
|
.flat .card {
|
|
border: none;
|
|
padding-bottom: 0rem;
|
|
}
|
|
.flat .card .card-header {
|
|
background: transparent;
|
|
border-bottom: none;
|
|
/*border-top:1px solid rgba(var(--bs-body-color-rgb), 0.125);*/
|
|
font-weight: 600;
|
|
padding-left: 0rem;
|
|
}
|
|
.flat .card:first-child .card-header {
|
|
border-top: none;
|
|
}
|
|
|
|
/*
|
|
.accordion
|
|
{
|
|
.card
|
|
{
|
|
border:none;
|
|
.card-header
|
|
{
|
|
background:#fafbfc;
|
|
border-bottom:1px solid rgba(var(--bs-body-color-rgb), 0.05);
|
|
|
|
> span > a
|
|
{
|
|
color:var(--bs-body-color);
|
|
display:block;
|
|
}
|
|
|
|
.ion-plus
|
|
{
|
|
display:none;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
*/
|
|
.top-header {
|
|
margin-bottom: 0rem;
|
|
border-bottom: 1px solid rgba(var(--bs-body-color-rgb), 0.08);
|
|
border-bottom: 1px solid var(--bs-border-color);
|
|
}
|
|
.top-header .btn {
|
|
font-size: 12px;
|
|
}
|
|
.top-header .btn.btn-sm, .top-header .btn-group-sm > .btn {
|
|
padding: 0.35rem 0.5rem;
|
|
}
|
|
.top-header .btn .la, .top-header .btn .header-arrow {
|
|
margin-right: 0.1rem;
|
|
}
|
|
.top-header .btn-group .dropdown-toggle.btn, .top-header a.btn {
|
|
padding-top: 0.1rem;
|
|
padding-bottom: 0.1rem;
|
|
}
|
|
.top-header .btn-group .dropdown-toggle.btn i, .top-header a.btn i {
|
|
vertical-align: middle;
|
|
font-size: 1.2rem;
|
|
display: inline-block;
|
|
line-height: 1.4;
|
|
}
|
|
.top-header .btn-group .dropdown-toggle.btn span, .top-header a.btn span {
|
|
font-size: 12px;
|
|
}
|
|
.top-header .btn-group .dropdown-toggle.btn .badge, .top-header a.btn .badge {
|
|
font-size: 0.85em;
|
|
}
|
|
@media (max-width: 575.98px) {
|
|
.top-header {
|
|
/*
|
|
.btn-group {
|
|
width:40%;
|
|
}*/
|
|
}
|
|
.top-header .vr, .top-header .btn-light {
|
|
display: none;
|
|
}
|
|
}
|
|
.top-header .menu-toggle i, .top-header #color-theme-switch i {
|
|
font-size: 15px;
|
|
line-height: 1.4;
|
|
vertical-align: middle;
|
|
}
|
|
|
|
.sidebar {
|
|
/*
|
|
position: sticky;
|
|
float:left;
|
|
top: 0px;
|
|
bottom: 0;
|
|
left: 0;*/
|
|
min-width: 250px;
|
|
z-index: 1000;
|
|
display: block;
|
|
background-color: #fcfdfe;
|
|
/*
|
|
background:-moz-linear-gradient(left, var(--bs-body-bg); 75%, #fafbfc 100%);
|
|
background:-webkit-linear-gradient(left, var(--bs-body-bg); 75%, #fafbfc 100%);
|
|
background:linear-gradient(left, var(--bs-body-bg); 75%, #fafbfc 100%);
|
|
*/
|
|
/*box-shadow: -1px -3px 2px #eee inset;*/
|
|
/*box-shadow: -1px -2px 1px #f3f3f3 inset;*/
|
|
/*box-shadow: 2px 0px 7px rgba(var(--bs-body-color-rgb),0.07);*/
|
|
/*box-shadow:2px 0px 7px 2px rgba(var(--bs-body-color-rgb),0.02) inset;*/
|
|
border-right: 1px solid var(--bs-secondary-bg);
|
|
height: 100%;
|
|
}
|
|
.sidebar:hover {
|
|
bottom: auto;
|
|
}
|
|
.sidebar .logo {
|
|
align-items: center;
|
|
display: flex;
|
|
vertical-align: middle;
|
|
justify-content: space-between;
|
|
margin-bottom: 0rem;
|
|
margin: 4rem 0rem 0 2rem;
|
|
margin: 2rem 1.2rem 0rem 2rem;
|
|
position: relative;
|
|
}
|
|
.sidebar .logo #color-theme-switch {
|
|
position: absolute;
|
|
top: 0.2rem;
|
|
color: var(--bs-gray-500);
|
|
font-size: 1rem;
|
|
/*
|
|
width: 11px;
|
|
height: 11px;
|
|
background: transparent;
|
|
border: 1px solid var(--bs-gray-500);
|
|
border-radius: 50px;
|
|
*/
|
|
padding: 3px;
|
|
right: 42px;
|
|
cursor: pointer;
|
|
/*
|
|
&::after {
|
|
content: ".";
|
|
background: var(--bs-gray-500);
|
|
left: 0px;
|
|
top: 0px;
|
|
width: 50%;
|
|
height: 100%;
|
|
position: absolute;
|
|
color: transparent;
|
|
border-top-left-radius: 50px;
|
|
border-bottom-left-radius: 50px;
|
|
}*/
|
|
}
|
|
.sidebar .logo #search-btn {
|
|
color: var(--bs-gray-500);
|
|
font-size: 1rem;
|
|
padding: 3px;
|
|
cursor: pointer;
|
|
}
|
|
.sidebar .logo .img {
|
|
background-repeat: no-repeat;
|
|
width: 120px;
|
|
display: inline-block;
|
|
background-position-y: 11px;
|
|
}
|
|
.sidebar .logo .img [data-v-site-logo] {
|
|
display: block;
|
|
}
|
|
.sidebar .logo .img [data-v-site-logo-dark] {
|
|
display: none;
|
|
}
|
|
.sidebar .logo .img img {
|
|
max-width: 120px;
|
|
max-height: 80px;
|
|
}
|
|
.sidebar .logo .img div {
|
|
overflow: clip;
|
|
max-width: 130px;
|
|
margin-left: 0.3rem;
|
|
vertical-align: middle;
|
|
text-overflow: ellipsis;
|
|
display: inline-block;
|
|
}
|
|
.sidebar .logo a.menu-toggle {
|
|
font-size: 1rem;
|
|
margin-right: 1.4rem;
|
|
margin-left: 0.5rem;
|
|
margin-top: 0.3rem;
|
|
outline: none;
|
|
display: inline-block;
|
|
vertical-align: top;
|
|
cursor: pointer;
|
|
float: right;
|
|
}
|
|
.sidebar .logo a.menu-toggle i {
|
|
color: var(--bs-gray-500);
|
|
vertical-align: middle;
|
|
vertical-align: middle;
|
|
}
|
|
.sidebar .navbar-expand-md #search-btn {
|
|
right: auto;
|
|
}
|
|
.sidebar .navbar {
|
|
text-align: left;
|
|
margin: 1rem auto 0;
|
|
position: static;
|
|
padding: 0px;
|
|
width: 99%;
|
|
}
|
|
.sidebar .navbar .nav-item {
|
|
padding-left: 1.5rem;
|
|
margin: 0;
|
|
}
|
|
.sidebar .navbar .nav-item.no-permission {
|
|
display: none;
|
|
}
|
|
.sidebar .navbar .nav-item.align-top > .sub-menu {
|
|
bottom: 0;
|
|
top: auto;
|
|
}
|
|
.sidebar .navbar .nav-item.align-middle > .sub-menu {
|
|
bottom: 0;
|
|
top: auto;
|
|
margin-bottom: -50%;
|
|
}
|
|
.sidebar .navbar .nav-item.columns-2 > .sub-menu {
|
|
columns: 2;
|
|
min-width: 400px;
|
|
width: 200%;
|
|
}
|
|
.sidebar .navbar .nav-item.heading {
|
|
font-size: 10px;
|
|
margin-top: 0.5rem;
|
|
margin-bottom: 0.1rem;
|
|
}
|
|
.sidebar .navbar .nav-item.heading a {
|
|
font-weight: normal;
|
|
padding-bottom: 0.2rem;
|
|
}
|
|
.sidebar .navbar .nav-item.heading i {
|
|
display: none;
|
|
}
|
|
.sidebar .navbar .nav-item.heading span {
|
|
text-transform: uppercase;
|
|
color: rgba(var(--bs-secondary-rgb), 0.85);
|
|
}
|
|
.sidebar .navbar .nav-link {
|
|
padding-top: 0.5rem;
|
|
padding-bottom: 0.5rem;
|
|
margin: 0;
|
|
}
|
|
.sidebar .navbar .nav-link i, .sidebar .navbar .nav-link img {
|
|
color: var(--bs-secondary-color);
|
|
color: rgba(var(--bs-secondary-rgb), 0.8);
|
|
vertical-align: middle;
|
|
font-size: 1.25rem;
|
|
line-height: 1;
|
|
width: 24px;
|
|
margin-right: 0.35rem;
|
|
}
|
|
.sidebar .navbar .nav-link i.la-lg, .sidebar .navbar .nav-link img.la-lg {
|
|
font-size: 1.8rem;
|
|
}
|
|
.sidebar .navbar .nav-link img {
|
|
max-width: 24px;
|
|
}
|
|
.sidebar .navbar .sub-menu .nav-item.heading {
|
|
margin: 0;
|
|
}
|
|
.sidebar .navbar .sub-menu .nav-item.heading a {
|
|
padding-bottom: 0;
|
|
}
|
|
.sidebar .navbar .sub-menu .nav-item.heading a:hover {
|
|
background: var(--bs-gray-100);
|
|
}
|
|
.sidebar .navbar .sub-menu .nav-item .nav-link {
|
|
color: var(--bs-body-color);
|
|
}
|
|
.sidebar .navbar .sub-menu .nav-item .nav-link i, .sidebar .navbar .sub-menu .nav-item .nav-link img {
|
|
color: #999;
|
|
line-height: 1.1;
|
|
max-width: 24px;
|
|
max-height: 24px;
|
|
}
|
|
[data-bs-theme=dark] .sidebar .navbar .sub-menu .nav-item .nav-link img[src$=".svg"] {
|
|
filter: invert(93%) hue-rotate(180deg);
|
|
}
|
|
.sidebar .navbar .sub-menu .nav-item:hover {
|
|
background: #fafcff;
|
|
}
|
|
.sidebar .navbar .nav-link.items {
|
|
position: relative;
|
|
}
|
|
.sidebar .navbar .nav-link.items:after {
|
|
/*
|
|
border-top-color: #aaa;
|
|
display: inline-block;
|
|
width: 0;
|
|
height: 0;
|
|
margin-left: 0.3em;
|
|
vertical-align: middle;
|
|
content: "";
|
|
border-top: 0.3em solid;
|
|
border-right: 0.3em solid transparent;
|
|
border-left: 0.3em solid transparent;
|
|
|
|
|
|
background: $custom-select-indicator no-repeat right center;
|
|
width: 8px !important;
|
|
height: 8px !important;
|
|
border:none !important;
|
|
vertical-align:0em !important;
|
|
margin-right:1rem;
|
|
position:absolute;
|
|
right:0.5rem;
|
|
top:1rem;
|
|
opacity:0.5;
|
|
|
|
transform:rotate(270deg);
|
|
z-index:0;*/
|
|
content: "\f105";
|
|
font-family: "Line Awesome Free";
|
|
font-weight: 900;
|
|
margin-right: 1rem;
|
|
position: absolute;
|
|
right: 0.5rem;
|
|
top: 0.7rem;
|
|
opacity: 0.3;
|
|
transition: opacity 2s;
|
|
vertical-align: middle;
|
|
font-style: normal;
|
|
font-size: 12px;
|
|
}
|
|
.sidebar .navbar .dropdown-toggle:after {
|
|
border-top-color: #aaa;
|
|
}
|
|
.sidebar .navbar .logo {
|
|
display: none;
|
|
}
|
|
.sidebar .navbar:hover .nav-link.items:after {
|
|
opacity: 0.9 !important;
|
|
}
|
|
.sidebar .navbar ul {
|
|
list-style: none;
|
|
width: 100%;
|
|
}
|
|
.sidebar .navbar .sub-menu {
|
|
min-width: 200px;
|
|
border: none;
|
|
font-size: inherit;
|
|
float: none;
|
|
padding-left: 1rem;
|
|
padding-bottom: 0rem;
|
|
position: relative;
|
|
padding-top: 0rem;
|
|
padding-bottom: 0px;
|
|
margin-left: 0rem;
|
|
top: 0px;
|
|
border-left: 1px solid var(--bs-border-color);
|
|
border-radius: 0 3px 3px 0px;
|
|
box-shadow: none;
|
|
/* disable bootstrap stupid popper.js css */
|
|
transform: none !important;
|
|
left: auto !important;
|
|
position: relative !important;
|
|
/* disable bootstrap stupid popper.js css */
|
|
}
|
|
.small-nav .sidebar .navbar .sub-menu {
|
|
/*border: 1px solid #eee;*/
|
|
border-left: none;
|
|
}
|
|
.sidebar .navbar .sub-menu .nav-item {
|
|
padding: 0;
|
|
margin: 0;
|
|
}
|
|
.sidebar .navbar .sub-menu .nav-item a {
|
|
color: var(--bs-body-color);
|
|
padding: 0.7rem 1.1rem 0.6rem;
|
|
margin: 0;
|
|
}
|
|
.sidebar .navbar .sub-menu .nav-item a:hover {
|
|
background: #fafcff;
|
|
color: var(--bs-link-color);
|
|
}
|
|
.sidebar .navbar .sub-menu .nav-item.heading:hover, .sidebar .navbar .sub-menu .nav-item.heading a:hover {
|
|
background: transparent;
|
|
color: var(--bs-body-color);
|
|
}
|
|
.sidebar .navbar #user-info {
|
|
position: absolute;
|
|
bottom: 0px;
|
|
width: 100%;
|
|
margin-bottom: 2rem;
|
|
}
|
|
.sidebar .navbar #user-info i {
|
|
width: 50px;
|
|
display: inline-block;
|
|
text-align: center;
|
|
height: 50px;
|
|
vertical-align: middle;
|
|
font-size: 32px;
|
|
background: var(--bs-border-color);
|
|
border-radius: 50px;
|
|
}
|
|
.sidebar .navbar #user-info span {
|
|
color: #999;
|
|
font-size: 11px;
|
|
}
|
|
.sidebar.blue {
|
|
background: #f4f6f8;
|
|
}
|
|
.sidebar.blue .navbar .nav-link.items :after {
|
|
border-top-color: #aaa;
|
|
}
|
|
.sidebar.blue .navbar .dropdown-toggle:after {
|
|
border-top-color: #aaa;
|
|
}
|
|
html[data-bs-theme=dark] .sidebar {
|
|
background: #272a2f;
|
|
}
|
|
html[data-bs-theme=dark] .sidebar .logo .img [data-v-site-logo] {
|
|
display: none;
|
|
}
|
|
html[data-bs-theme=dark] .sidebar .logo .img [data-v-site-logo-dark] {
|
|
display: block;
|
|
}
|
|
html[data-bs-theme=dark] .sidebar .navbar .nav-item:hover {
|
|
background: var(--bs-gray-700);
|
|
color: var(--bs-white);
|
|
}
|
|
html[data-bs-theme=dark] .sidebar .navbar .nav-item:hover.heading {
|
|
background: transparent;
|
|
}
|
|
html[data-bs-theme=dark] .sidebar .navbar .nav-item:hover .nav-link {
|
|
color: var(--bs-white);
|
|
}
|
|
html[data-bs-theme=dark] .sidebar .navbar .nav-item:hover .nav-link i {
|
|
color: var(--bs-white);
|
|
}
|
|
html[data-bs-theme=dark] .sidebar .navbar .nav-item.heading .nav-link:hover {
|
|
background: transparent;
|
|
}
|
|
html[data-bs-theme=dark] .sidebar .navbar .nav-item ul.dropdown-menu {
|
|
background: var(--bs-gray-700);
|
|
}
|
|
html[data-bs-theme=dark] .sidebar .navbar .nav-item .sub-menu .nav-item a:hover {
|
|
background: var(--bs-gray-800);
|
|
}
|
|
html[data-bs-theme=dark] .sidebar .navbar .nav-item .sub-menu .nav-item.heading a:hover {
|
|
background: transparent;
|
|
}
|
|
html[data-bs-theme=dark] .sidebar .navbar .nav-item .nav-link.items :after {
|
|
border-top-color: #aaa;
|
|
}
|
|
html[data-bs-theme=dark] .sidebar .navbar .nav-item .dropdown-toggle:after {
|
|
border-top-color: #aaa;
|
|
}
|
|
html[data-bs-theme=dark] .sidebar .navbar .nav-item.heading span {
|
|
color: var(--bs-gray-500);
|
|
}
|
|
|
|
.small-nav {
|
|
transition: all 1s;
|
|
}
|
|
.small-nav .sidebar {
|
|
padding: 0rem;
|
|
min-width: 40px;
|
|
overflow-x: inherit;
|
|
overflow-y: inherit;
|
|
}
|
|
.small-nav .sidebar .navbar, .small-nav .sidebar .logo {
|
|
margin: 1rem 0rem 0rem 0rem;
|
|
padding: 0rem;
|
|
}
|
|
.small-nav .sidebar .logo {
|
|
flex-direction: column;
|
|
}
|
|
.small-nav .sidebar .logo .img {
|
|
max-width: 30px;
|
|
overflow-x: hidden;
|
|
}
|
|
.small-nav .sidebar .logo a {
|
|
display: block;
|
|
}
|
|
.small-nav .sidebar .logo a#color-theme-switch {
|
|
left: 0;
|
|
margin-left: 0.3rem;
|
|
}
|
|
.small-nav .sidebar .logo a i {
|
|
font-size: 1.1rem;
|
|
}
|
|
.small-nav .sidebar .logo #search-btn {
|
|
right: 10px;
|
|
top: 0;
|
|
}
|
|
.small-nav .sidebar .navbar .nav-link i, .small-nav .sidebar .navbar a i {
|
|
margin-right: 0;
|
|
}
|
|
html[data-bs-theme=dark] .small-nav .sidebar .navbar .nav-link i, html[data-bs-theme=dark] .small-nav .sidebar .navbar a i {
|
|
color: var(--bs-secondary);
|
|
}
|
|
.small-nav .sidebar .navbar .nav-link.items::after {
|
|
right: 0;
|
|
margin-top: 2px;
|
|
margin-right: 0px;
|
|
}
|
|
.small-nav .sidebar .navbar .dropdown-menu .nav-link.items::after {
|
|
margin-right: 10px;
|
|
}
|
|
.small-nav .sidebar .navbar .nav-item {
|
|
padding-left: 0;
|
|
}
|
|
.small-nav .sidebar .navbar .nav-item .badge {
|
|
position: absolute;
|
|
left: 0;
|
|
margin: 0;
|
|
padding: 0.2rem;
|
|
top: 0;
|
|
}
|
|
.small-nav .sidebar .navbar .nav-item .dropdown .dropdown-menu {
|
|
position: absolute;
|
|
/*border: 1px solid #eee;*/
|
|
border-left: none;
|
|
/*box-shadow: 1px 2px 2px #eee;*/
|
|
left: 22px;
|
|
}
|
|
.small-nav .sidebar .navbar .nav-item .nav-item.dropdown:hover .dropdown-menu {
|
|
display: block;
|
|
}
|
|
.small-nav .sidebar .navbar .nav-item > ul {
|
|
left: 38px !important;
|
|
}
|
|
.small-nav .sidebar .navbar .nav-item > ul .sub-menu {
|
|
left: 200px !important;
|
|
}
|
|
.small-nav .sidebar .navbar .dropdown-toggle::after {
|
|
display: none;
|
|
}
|
|
.small-nav .sidebar .title {
|
|
display: none;
|
|
}
|
|
.small-nav .main {
|
|
/*margin-left:50px;*/
|
|
}
|
|
.small-nav #user-info i {
|
|
margin: 0rem 0rem 0rem 0rem;
|
|
background: transparent;
|
|
}
|
|
.small-nav #user-info span {
|
|
display: none;
|
|
}
|
|
|
|
@media (min-width: 576px) {
|
|
.navbar .nav-item {
|
|
margin: 0.5rem 0rem;
|
|
position: relative;
|
|
}
|
|
.navbar .nav-item > ul:not(.show) {
|
|
display: none;
|
|
/* right: 0px; */
|
|
opacity: 1;
|
|
position: absolute !important;
|
|
/* top: 0px; */
|
|
left: 245px !important;
|
|
background: var(--bs-body-bg);
|
|
box-shadow: 0px 0px 2px 1px rgba(var(--bs-body-color-rgb), 0.5);
|
|
box-shadow: 2px 1px 3px 1px rgba(var(--bs-body-color-rgb), 0.1);
|
|
border-right: 1px solid rgba(var(--bs-body-color-rgb), 0.1);
|
|
border-top: none;
|
|
border-left: none;
|
|
border-bottom: 1px solid rgba(var(--bs-body-color-rgb), 0.1);
|
|
padding: 0px;
|
|
background-color: #fafbfc;
|
|
background: -moz-linear-gradient(left, var(--bs-body-bg) 85%, #fafbfc 100%);
|
|
background: -webkit-linear-gradient(left, var(--bs-body-bg) 85%, #fafbfc 100%);
|
|
background: linear-gradient(left, var(--bs-body-bg) 85%, #fafbfc 100%);
|
|
background: rgba(var(--bs-body-bg-rgb), 0.95);
|
|
}
|
|
.navbar .nav-item > ul:not(.show) li {
|
|
margin: 0px;
|
|
padding: 0;
|
|
}
|
|
.navbar .nav-item .dropdown-menu.show {
|
|
left: 0px !important;
|
|
padding: 0;
|
|
padding-left: 0px;
|
|
/*border-left:1px solid #eee;*/
|
|
background: transparent;
|
|
}
|
|
.navbar .nav-item:hover {
|
|
background: var(--bs-body-bg);
|
|
color: var(--bs-body-color);
|
|
}
|
|
.navbar .nav-item:hover.heading {
|
|
background: transparent;
|
|
}
|
|
.navbar .nav-item:hover > a {
|
|
color: var(--bs-body-color);
|
|
}
|
|
.navbar .nav-item:hover > a i {
|
|
color: #007bff;
|
|
}
|
|
.navbar .nav-item:hover > a span:after {
|
|
color: #007bff;
|
|
}
|
|
.navbar .nav-item:hover > ul {
|
|
display: block !important;
|
|
}
|
|
.small-nav .navbar .nav-item .show {
|
|
position: absolute !important;
|
|
display: none;
|
|
}
|
|
}
|
|
@media (max-width: 768px) {
|
|
body > div#container {
|
|
flex-direction: column;
|
|
}
|
|
.sidebar {
|
|
position: static;
|
|
width: 100%;
|
|
box-shadow: none;
|
|
border-bottom: 1px solid var(--bs-border-color);
|
|
padding: 0.5rem 1rem 0.5rem 1rem;
|
|
height: auto;
|
|
float: none;
|
|
}
|
|
.sidebar .navbar {
|
|
margin: 0rem;
|
|
padding: 0rem;
|
|
}
|
|
.sidebar .navbar .navbar-collapse {
|
|
margin: 1rem 0rem 0rem;
|
|
}
|
|
.sidebar .navbar .logo {
|
|
display: flex;
|
|
}
|
|
.sidebar .navbar .navbar-toggler {
|
|
font-size: 1.4rem;
|
|
/*background:var(--bs-gray-100);*/
|
|
}
|
|
.sidebar .navbar .nav-item.columns-2 .sub-menu {
|
|
columns: 1;
|
|
}
|
|
.sidebar .logo {
|
|
margin: 0rem;
|
|
display: none;
|
|
}
|
|
.main {
|
|
margin: 0px;
|
|
}
|
|
.filters div.btns .mb-3 {
|
|
margin-left: 0rem;
|
|
}
|
|
.columns {
|
|
display: block;
|
|
}
|
|
.columns .left-column {
|
|
width: auto;
|
|
}
|
|
.columns .right-column {
|
|
width: auto;
|
|
padding: 0rem;
|
|
margin: 0rem;
|
|
border: none;
|
|
}
|
|
.actions {
|
|
flex-direction: column;
|
|
padding: 1.5rem 0.5rem 1rem;
|
|
}
|
|
}
|
|
/*
|
|
@media (min-width: 1600px) {
|
|
|
|
.sidebar
|
|
{
|
|
width:300px;
|
|
|
|
.logo {
|
|
float: none;
|
|
//margin: 5rem 0rem 0 3.7rem;
|
|
}
|
|
|
|
.navbar
|
|
{
|
|
//margin: 3rem auto 0 2rem;
|
|
|
|
|
|
.nav-item
|
|
{
|
|
> ul {
|
|
left: 298px !important;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
|
|
.main
|
|
{
|
|
margin-left:300px;
|
|
}
|
|
|
|
|
|
}
|
|
*/
|
|
#main-footer {
|
|
font-size: 12px;
|
|
padding: 0.5rem 1rem;
|
|
position: fixed;
|
|
bottom: 0;
|
|
width: 100%;
|
|
text-align: right;
|
|
color: var(--bs-secondary-color);
|
|
}
|
|
|
|
.content-filters {
|
|
font-size: 12px;
|
|
}
|
|
|
|
.filters .btns {
|
|
text-align: right;
|
|
}
|
|
.filters .btns .mb-3 {
|
|
margin-left: 1rem;
|
|
}
|
|
.filters label {
|
|
margin-bottom: 0rem;
|
|
vertical-align: middle;
|
|
padding-top: 0.3rem;
|
|
}
|
|
.filters .custom-select {
|
|
/*
|
|
margin: 0px;
|
|
padding-left: 0px;
|
|
padding-top: 0px;
|
|
color: var(--bs-body-color);
|
|
margin-top: 0.7rem;
|
|
height: auto;*/
|
|
border: none;
|
|
margin-right: 1rem;
|
|
}
|
|
|
|
#filters .card {
|
|
border-style: dashed;
|
|
margin-bottom: 2rem;
|
|
}
|
|
|
|
body.login {
|
|
background: -moz-linear-gradient(top left, var(--bs-body-bg) 1%, rgba(var(--bs-secondary-color-rgb), 0.03) 100%);
|
|
background: -webkit-linear-gradient(top left, var(--bs-body-bg) 1%, rgba(var(--bs-secondary-color-rgb), 0.03) 100%);
|
|
background: rgba(var(--bs-tertiary-bg-rgb), 0.5);
|
|
background: var(--bs-light-bg-subtle);
|
|
background: rgba(var(--bs-secondary-color-rgb), 0.03);
|
|
background: linear-gradient(to top right, rgba(var(--bs-secondary-color-rgb), 0.04) 1%, var(--bs-body-bg) 100%);
|
|
}
|
|
body.login #color-theme-switch {
|
|
position: absolute;
|
|
top: 12px;
|
|
right: 24px;
|
|
color: var(--bs-gray-500);
|
|
font-size: 2.1rem;
|
|
padding: 3px;
|
|
cursor: pointer;
|
|
}
|
|
|
|
.login-container {
|
|
width: 100%;
|
|
}
|
|
.login-container .logo-content {
|
|
padding: 0rem 0 2.8rem;
|
|
text-align: center;
|
|
}
|
|
.login-container .logo-content a {
|
|
display: inline-block;
|
|
}
|
|
html[data-bs-theme=dark] .login-container .logo-content a img {
|
|
filter: brightness(5);
|
|
}
|
|
.login-container .login-form {
|
|
background: var(--bs-body-bg);
|
|
box-shadow: 0px 3px 21px 5px rgba(var(--bs-body-color-rgb), 0.02), 0px 3px 3px 0px rgba(var(--bs-body-color-rgb), 0.02), rgba(var(--bs-body-color-rgb), 0.01) 0px 16px 40px 0px;
|
|
border: 1px solid var(--bs-secondary-bg);
|
|
border-radius: 8px;
|
|
/*margin-bottom: 7rem;*/
|
|
}
|
|
.login-container .login-form form {
|
|
margin: 0;
|
|
}
|
|
.login-container .login-form .login-form-content {
|
|
padding: 2rem;
|
|
}
|
|
.login-container .login-form .btn {
|
|
padding: 0.8rem 1rem;
|
|
font-weight: 600;
|
|
}
|
|
|
|
@media (min-width: 768px) {
|
|
.login-container {
|
|
max-width: 640px;
|
|
}
|
|
.login-container .login-form .login-form-content {
|
|
padding: 4rem 3rem;
|
|
}
|
|
}
|
|
.form-control {
|
|
font-size: inherit;
|
|
box-shadow: rgba(var(--bs-body-color-rgb), 0.08) 0px 1px 2px 0px inset;
|
|
}
|
|
|
|
.login-form .mb-4 .form-control, .login-form .mb-4 .input-group-append button {
|
|
background: var(--bs-body-bg);
|
|
min-height: 3.4rem;
|
|
margin-top: 0.5rem;
|
|
font-size: 1.4rem;
|
|
padding: 0.5rem 1rem;
|
|
}
|
|
.login-form .mb-4 .input-group .form-control {
|
|
border-right: none;
|
|
}
|
|
.login-form .mb-4 .input-group-append button {
|
|
border: 1px solid var(--bs-border-color);
|
|
border-left: none;
|
|
border-top-left-radius: 0;
|
|
border-bottom-left-radius: 0;
|
|
}
|
|
.login-form .mb-3 .form-control:focus {
|
|
border-color: rgba(66, 133, 244, 0.5);
|
|
}
|
|
|
|
.login-form .mb-3 .form-control.input-dark:-ms-input-placeholder {
|
|
color: rgba(var(--bs-body-bg-rgb), 0.5);
|
|
}
|
|
|
|
.login-form .mb-3 .form-control.input-dark::-webkit-input-placeholder {
|
|
color: rgba(var(--bs-body-bg-rgb), 0.5);
|
|
}
|
|
|
|
.login-form .mb-3 .form-control.input-dark::-webkit-input-placeholder {
|
|
color: rgba(var(--bs-body-bg-rgb), 0.5);
|
|
}
|
|
|
|
.login-form .mb-3 .form-control.input-dark:-moz-placeholder {
|
|
color: rgba(var(--bs-body-bg-rgb), 0.5);
|
|
}
|
|
|
|
.login-form .mb-3 .form-control.input-dark::-moz-placeholder {
|
|
color: rgba(var(--bs-body-bg-rgb), 0.5);
|
|
}
|
|
|
|
.login-form .mb-3 .form-control.input-dark:-ms-input-placeholder {
|
|
color: rgba(var(--bs-body-bg-rgb), 0.5);
|
|
}
|
|
|
|
/*
|
|
select[name=visibility] option[value="public"] { }
|
|
*/
|
|
.grid-stack-item-content {
|
|
max-height: 100%;
|
|
}
|
|
.grid-stack-item-content .card {
|
|
/*display: block;*/
|
|
height: 100%;
|
|
--bs-card-border-color: var(--bs-border-color);
|
|
}
|
|
.grid-stack-item-content .card .table {
|
|
font-size: 90%;
|
|
}
|
|
.grid-stack-item-content .card .btn-close {
|
|
right: 10px;
|
|
top: 10px;
|
|
position: absolute;
|
|
display: none;
|
|
background: none;
|
|
}
|
|
.grid-stack-item-content .card:hover .btn-close {
|
|
display: block;
|
|
}
|
|
.grid-stack-item-content .card .card-title {
|
|
cursor: grabbing;
|
|
color: var(--bs-secondary);
|
|
font-weight: 500;
|
|
font-size: 1.2rem;
|
|
}
|
|
.grid-stack-item-content .card .card-body.info {
|
|
overflow-y: hidden;
|
|
display: flex;
|
|
vertical-align: middle;
|
|
align-items: center;
|
|
justify-content: space-around;
|
|
flex-wrap: wrap;
|
|
padding: 0;
|
|
}
|
|
.grid-stack-item-content .card .card-header {
|
|
cursor: grabbing;
|
|
}
|
|
.grid-stack-item-content .card .separator {
|
|
border-left: 1px dashed var(--bs-border-color);
|
|
padding: 0 1rem;
|
|
min-height: 80px;
|
|
}
|
|
.grid-stack-item-content .card .card-text {
|
|
border-left: 1px dashed var(--bs-secondary-border-subtle);
|
|
padding-left: 1.5rem;
|
|
padding-top: 0rem;
|
|
vertical-align: middle;
|
|
flex-grow: 1;
|
|
}
|
|
.grid-stack-item-content .card .icons {
|
|
display: flex;
|
|
vertical-align: middle;
|
|
place-content: space-between;
|
|
place-items: center;
|
|
}
|
|
.grid-stack-item-content i.icon {
|
|
font-size: 2rem;
|
|
line-height: 1.6;
|
|
padding: 0.2rem 1.4rem;
|
|
border-radius: 3px;
|
|
}
|
|
.grid-stack-item-content .number {
|
|
font-size: 2rem;
|
|
font-weight: 600;
|
|
padding: 0 0.5rem 0 1rem;
|
|
vertical-align: middle;
|
|
}
|
|
.grid-stack-item-content .card-block {
|
|
overflow-y: auto;
|
|
}
|
|
|
|
button.btn-close {
|
|
padding: 0;
|
|
background-color: transparent;
|
|
border: 0;
|
|
appearance: none;
|
|
vertical-align: middle;
|
|
}
|
|
|
|
/*
|
|
.btn-close {
|
|
//float: right;
|
|
//font-size: 1.2rem;
|
|
font-weight: 700;
|
|
line-height: 1;
|
|
//color: #000;
|
|
//text-shadow: 0 1px 0 var(--bs-gray-100);
|
|
opacity: .5;
|
|
}
|
|
*/
|
|
.editor {
|
|
overflow: hidden;
|
|
}
|
|
|
|
.left-column > .nav-tabs, .settings > .nav-tabs {
|
|
margin-bottom: 0rem;
|
|
}
|
|
.left-column > .nav-tabs .nav-link, .settings > .nav-tabs .nav-link {
|
|
padding: 0.7rem 1.2rem;
|
|
text-transform: capitalize;
|
|
color: var(--bs-body-color);
|
|
--bs-nav-link-padding-y:0.7rem;
|
|
--bs-nav-link-padding-x:1.4rem;
|
|
}
|
|
.left-column > .nav-tabs .nav-link:hover, .settings > .nav-tabs .nav-link:hover {
|
|
background: var(--bs-secondary-bg);
|
|
}
|
|
.left-column .tab-pane, .settings .tab-pane {
|
|
padding: 0.5rem;
|
|
}
|
|
.left-column .tab-pane[data-v-language], .settings .tab-pane[data-v-language] {
|
|
padding: 0;
|
|
}
|
|
|
|
/*.tab-content > .tab-pane
|
|
{
|
|
padding-top:2rem;
|
|
}
|
|
*/
|
|
/*
|
|
.nav-tabs.flat .nav-item.active .nav-link,
|
|
.nav-tabs.flat .nav-link.active,
|
|
.nav-tabs.flat .nav-item.show .nav-link
|
|
{
|
|
border:none;
|
|
border-bottom:2px solid #1e88e5;
|
|
color:#1e88e5;
|
|
}
|
|
*/
|
|
.nav-tabs .nav-item {
|
|
/*margin-bottom: 0px;*/
|
|
}
|
|
|
|
.table.middle-align {
|
|
--bs-table-hover-bg: var(--bs-light-bg-subtle);
|
|
--bs-table-hover-bg: rgba(var(--bs-secondary-color-rgb), 0.03);
|
|
--bs-table-border-color: var(--bs-light-border-subtle);
|
|
}
|
|
.table.middle-align thead {
|
|
border-radius: 2px;
|
|
}
|
|
.table.middle-align thead th {
|
|
color: var(--bs-secondary);
|
|
vertical-align: middle;
|
|
border-bottom-width: 1px;
|
|
border-top-width: 1px;
|
|
vertical-align: middle;
|
|
font-weight: normal;
|
|
font-weight: 500;
|
|
font-size: 13px;
|
|
padding: 0.7rem 0.7rem 0.7rem;
|
|
border-top: none;
|
|
}
|
|
.table.middle-align thead th i {
|
|
color: var(--bs-secondary-color);
|
|
margin-right: 0.3rem;
|
|
}
|
|
.table.middle-align thead th.col-cb {
|
|
width: 50px;
|
|
}
|
|
.table.middle-align tbody {
|
|
/*
|
|
&::before
|
|
{
|
|
content: '';
|
|
display: block;
|
|
height: 15px;
|
|
|
|
}
|
|
*/
|
|
}
|
|
.table.middle-align tbody td {
|
|
vertical-align: middle;
|
|
position: relative;
|
|
}
|
|
.table.middle-align tbody td.img {
|
|
text-align: center;
|
|
width: 100px;
|
|
}
|
|
.table.middle-align tbody td.col-cb {
|
|
width: 50px;
|
|
}
|
|
.table.middle-align tbody td.date, .table.middle-align tbody td.actions {
|
|
white-space: nowrap;
|
|
}
|
|
|
|
/*
|
|
table tr[data-v-product] td,
|
|
table tr[data-v-post] td,
|
|
table tr[data-v-menu] td {
|
|
padding: 1rem 0.7rem 1rem;
|
|
}
|
|
*/
|
|
table tr[data-v-product] td,
|
|
table tr[data-v-post] td,
|
|
table tr[data-v-comment] td,
|
|
table tr[data-v-menu] td {
|
|
position: relative;
|
|
}
|
|
|
|
table tr.pending {
|
|
border-left: 2px solid rgba(25, 135, 84, 0.5);
|
|
background-color: rgba(25, 135, 84, 0.1);
|
|
}
|
|
|
|
table tr.spam {
|
|
border-left: 2px solid rgba(255, 193, 7, 0.5);
|
|
background-color: rgba(255, 193, 7, 0.1);
|
|
}
|
|
|
|
table tr.trash {
|
|
border-left: 2px solid rgba(220, 53, 69, 0.5);
|
|
background-color: rgba(220, 53, 69, 0.1);
|
|
}
|
|
|
|
table a {
|
|
text-decoration: none;
|
|
}
|
|
|
|
/* 404 error animation */
|
|
.screen {
|
|
display: flex;
|
|
flex-flow: column;
|
|
align-content: center;
|
|
align-self: center;
|
|
}
|
|
|
|
.screen img {
|
|
/* box-shadow:0 3px 5px -3px #000000;
|
|
box-shadow:0 20px 20px -10px rgba(var(--bs-body-color-rgb), 0.7);*/
|
|
max-width: 90%;
|
|
/*
|
|
animation: 100s ease-out 0s 1 rotateearth;
|
|
animation-duration: 418s;
|
|
animation-timing-function: ease-out;
|
|
animation-delay: 0s;
|
|
animation-iteration-count: 100;
|
|
animation-name: rotateearth;
|
|
*/
|
|
}
|
|
|
|
@keyframes rotateearth {
|
|
0% {
|
|
-webkit-transform: rotate(0deg);
|
|
-moz-transform: rotate(0deg);
|
|
-o-transform: rotate(0deg);
|
|
transform: rotate(0deg);
|
|
}
|
|
100% {
|
|
-webkit-transform: rotate(360deg);
|
|
-moz-transform: rotate(360deg);
|
|
-o-transform: rotate(360deg);
|
|
transform: rotate(360deg);
|
|
}
|
|
}
|
|
.dropdown-toggle::after {
|
|
border: none;
|
|
font-family: "Line Awesome Free";
|
|
font-weight: 900;
|
|
font-size: 80%;
|
|
content: "\f107";
|
|
vertical-align: text-bottom;
|
|
}
|
|
|
|
.btn-icon.dropdown-toggle::before {
|
|
border: none;
|
|
font-family: "Line Awesome Free";
|
|
font-weight: 900;
|
|
font-size: 80%;
|
|
content: "\f107";
|
|
vertical-align: text-bottom;
|
|
}
|
|
|
|
.dropdown-toggle.chevron-big::after {
|
|
width: 12px !important;
|
|
height: 12px !important;
|
|
font-size: 100%;
|
|
}
|
|
|
|
.invalid-feedback {
|
|
font-size: 1rem;
|
|
}
|
|
|
|
td.img img {
|
|
max-height: 50px;
|
|
max-width: 50px;
|
|
}
|
|
|
|
.theme td.img img,
|
|
.plugin td.img img {
|
|
max-height: 300px;
|
|
max-width: 300px;
|
|
}
|
|
|
|
td.description {
|
|
width: 50%;
|
|
}
|
|
|
|
td figure {
|
|
margin: 0;
|
|
}
|
|
|
|
tr td .form-check-input {
|
|
display: inline-block;
|
|
position: relative;
|
|
}
|
|
tr.active .form-check-input::before {
|
|
content: " ";
|
|
background: green;
|
|
width: 6px;
|
|
height: 6px;
|
|
display: block;
|
|
position: absolute;
|
|
left: 30px;
|
|
top: 5px;
|
|
border-radius: 3px;
|
|
}
|
|
|
|
.table .thumb, .table .author {
|
|
padding: 0 2rem;
|
|
text-align: center;
|
|
}
|
|
.table .thumb img, .table .author img {
|
|
max-width: 48px;
|
|
}
|
|
[data-bs-theme=dark] .table .plugin img[src$=".svg"] {
|
|
filter: invert(93%) hue-rotate(180deg);
|
|
}
|
|
.table th {
|
|
font-weight: 500;
|
|
font-size: 13px;
|
|
padding: 0.7rem;
|
|
vertical-align: middle;
|
|
}
|
|
|
|
.checkbox_outer .custom-control {
|
|
min-height: auto;
|
|
}
|
|
|
|
.grid-stack > div.grid-stack-item > div.grid-stack-item-content .card-block {
|
|
overflow-y: hidden;
|
|
}
|
|
|
|
.grid-stack > div.grid-stack-item > div.grid-stack-item-content:hover .card-block {
|
|
overflow-y: auto;
|
|
}
|
|
|
|
/*
|
|
.table th, .table td
|
|
{
|
|
border-top:none;
|
|
border-bottom:1px solid #dee2e6;
|
|
}
|
|
*/
|
|
.card-header {
|
|
font-weight: 600;
|
|
font-size: 12px;
|
|
background: transparent;
|
|
}
|
|
|
|
.custom-control.large {
|
|
padding-left: 0px;
|
|
}
|
|
|
|
.custom-checkbox.large .form-check-label::before,
|
|
.custom-checkbox.large .form-check-label::after {
|
|
top: -4px;
|
|
left: -3px;
|
|
width: 30px;
|
|
height: 30px;
|
|
border-color: var(--bs-body-color-rgb);
|
|
}
|
|
|
|
/*
|
|
.modal-backdrop
|
|
{
|
|
background:rgba(var(--bs-body-bg-rgb),0.8);
|
|
}
|
|
|
|
.modal-backdrop.show
|
|
{
|
|
opacity:1;
|
|
}
|
|
*/
|
|
.modal-full .modal-dialog.modal-xl {
|
|
max-width: 90%;
|
|
}
|
|
|
|
@media (min-width: 1400px) {
|
|
.modal-xl {
|
|
max-width: none;
|
|
}
|
|
}
|
|
.custom-checkbox .form-check-input:indeterminate ~ .form-check-label::before {
|
|
border-color: var(--bs-border-color);
|
|
background-color: transparent;
|
|
}
|
|
|
|
.badge {
|
|
font-weight: 600;
|
|
vertical-align: middle;
|
|
}
|
|
|
|
.btn.loading {
|
|
position: relative;
|
|
}
|
|
.btn.loading .loading {
|
|
display: block;
|
|
}
|
|
.btn.loading .button-text {
|
|
display: none;
|
|
}
|
|
.btn.loading .progress-text {
|
|
display: block;
|
|
font-size: 70%;
|
|
position: absolute;
|
|
color: var(--bs-body-color);
|
|
margin-bottom: 0.3rem;
|
|
bottom: -30px;
|
|
}
|
|
|
|
.theme-check input {
|
|
background-color: rgba(var(--bs-body-bg-rgb), 0.7);
|
|
}
|
|
|
|
.themes .list-card {
|
|
position: relative;
|
|
}
|
|
.themes .list-card .theme-check {
|
|
position: absolute;
|
|
top: 0px;
|
|
right: 3px;
|
|
z-index: 2;
|
|
font-size: 1.4rem;
|
|
}
|
|
.themes .list-card .theme-check input {
|
|
margin: 0;
|
|
}
|
|
.themes .list-card .btn-outline-primary, .themes .list-card .btn-outline-danger {
|
|
--bs-btn-border-color: var(--bs-border-color);
|
|
}
|
|
.themes .list-card .card-img-top {
|
|
display: flex;
|
|
flex: 1 1 auto;
|
|
object-fit: cover;
|
|
vertical-align: middle;
|
|
align-items: center;
|
|
background: rgba(var(--bs-body-color-rgb), 0.02);
|
|
}
|
|
.themes .list-card .card-img-top img {
|
|
margin: auto;
|
|
}
|
|
.themes .list-card .card-body {
|
|
bottom: 3rem;
|
|
border-top: 1px solid rgba(var(--bs-body-color-rgb), 0.1);
|
|
width: 100%;
|
|
flex: none;
|
|
}
|
|
.themes .list-card .card-title {
|
|
font-weight: normal;
|
|
}
|
|
.themes .list-card .card-footer {
|
|
background-color: var(--bs-body-bg);
|
|
border: 1px solid var(--bs-border-color);
|
|
}
|
|
.themes .list-card.active .card-footer {
|
|
background-color: rgba(var(--bs-primary-rgb), 0.05);
|
|
}
|
|
.themes .list-card.active .card {
|
|
border-color: var(--bs-primary-bg-subtle);
|
|
}
|
|
.plugins-table.active tr.plugin {
|
|
display: none;
|
|
}
|
|
.plugins-table.active tr.active {
|
|
display: revert;
|
|
}
|
|
.plugins-table.inactive tr.active {
|
|
display: none;
|
|
}
|
|
|
|
#plugin-check {
|
|
width: 100%;
|
|
background: var(--bs-warning-bg-subtle);
|
|
}
|
|
|
|
.list-card .card {
|
|
padding: 0;
|
|
border-radius: 4px;
|
|
box-shadow: hsl(0, 0%, 80%) 0 0 16px;
|
|
box-shadow: rgba(var(--bs-body-bg-rgb), 0.1) 0 0 6px inset, rgba(var(--bs-body-color-rgb), 0.2) 1px 1px 16px -6px;
|
|
border-color: var(--bs-border-color);
|
|
overflow: hidden;
|
|
display: -ms-flexbox;
|
|
display: flex;
|
|
width: 100%;
|
|
height: 100%;
|
|
-ms-flex-direction: column;
|
|
flex-direction: column;
|
|
}
|
|
.list-card .card .btn-preview {
|
|
display: none;
|
|
}
|
|
.list-card .card p {
|
|
overflow-wrap: anywhere;
|
|
}
|
|
|
|
.list-card .card .info {
|
|
float: left;
|
|
}
|
|
|
|
.list-card .card .buttons {
|
|
float: right;
|
|
}
|
|
|
|
.list-card .card .card-body .plugin-image {
|
|
max-width: 128px;
|
|
width: 128px;
|
|
margin: auto;
|
|
}
|
|
|
|
.list-card .card .card-footer {
|
|
border-color: rgba(var(--bs-body-color-rgb), 0.05);
|
|
--bs-card-cap-bg: rgba(var(--bs-body-color-rgb), 0.015);
|
|
}
|
|
.list-card .card .card-footer .plugin-card-bottom {
|
|
font-size: 85%;
|
|
}
|
|
|
|
.list-card .card:hover .card-footer {
|
|
opacity: 1;
|
|
}
|
|
.list-card .card:hover .btn-preview {
|
|
display: inline-block;
|
|
}
|
|
|
|
.list {
|
|
display: -ms-flexbox;
|
|
display: flex;
|
|
-ms-flex-wrap: wrap;
|
|
flex-wrap: wrap;
|
|
-ms-flex-pack: center;
|
|
justify-content: center;
|
|
list-style: none;
|
|
}
|
|
|
|
@supports (display: grid) {
|
|
.list {
|
|
display: -ms-grid;
|
|
display: grid;
|
|
grid-template-columns: repeat(auto-fill, minmax(320px, 1fr));
|
|
}
|
|
@media only screen and (min-width: 1600px) {
|
|
.list {
|
|
grid-template-columns: repeat(auto-fill, minmax(30%, 1fr));
|
|
}
|
|
}
|
|
@media only screen and (min-width: 2100px) {
|
|
.list {
|
|
grid-template-columns: repeat(auto-fill, minmax(25%, 1fr));
|
|
}
|
|
}
|
|
}
|
|
/* card area */
|
|
.list-card {
|
|
-ms-flex: 1 0 30%;
|
|
flex: 1 0 30%;
|
|
min-width: 0;
|
|
margin: 16px;
|
|
}
|
|
|
|
@media (min-width: 640px) {
|
|
.list-card {
|
|
min-width: 320px;
|
|
}
|
|
}
|
|
#import-iframe {
|
|
min-height: 500px;
|
|
width: 100%;
|
|
height: 100%;
|
|
border: none;
|
|
display: none;
|
|
}
|
|
|
|
.alert {
|
|
border-left-width: 0.2rem;
|
|
padding: 0.5rem 1rem;
|
|
}
|
|
.alert .icon {
|
|
background: rgba(var(--bs-body-bg-rgb), 0.7);
|
|
border-radius: 80%;
|
|
margin-right: 1rem;
|
|
padding: 0 0.5rem;
|
|
align-self: center;
|
|
font-size: 1.8rem;
|
|
vertical-align: middle;
|
|
line-height: 1;
|
|
}
|
|
.alert .icon .la, .alert .icon .header-arrow {
|
|
line-height: 1.4;
|
|
}
|
|
|
|
.alert-info {
|
|
background-color: rgba(var(--bs-info-bg-rgb), 0.07);
|
|
--bs-alert-border-color: rgba(var(--bs-info-rgb), 0.15);
|
|
}
|
|
|
|
.alert-danger {
|
|
background-color: rgba(var(--bs-danger-rgb), 0.07);
|
|
--bs-alert-border-color: rgba(var(--bs-danger-rgb), 0.15);
|
|
}
|
|
|
|
.alert-primary {
|
|
background-color: rgba(var(--bs-primary-rgb), 0.07);
|
|
--bs-alert-border-color: rgba(var(--bs-primary-rgb), 0.15);
|
|
}
|
|
|
|
.alert-success {
|
|
background-color: rgba(var(--bs-success-rgb), 0.07);
|
|
border-color: rgba(var(--bs-success-rgb), 0.15);
|
|
}
|
|
|
|
.alert-warning {
|
|
background-color: rgba(var(--bs-warning-rgb), 0.07);
|
|
}
|
|
|
|
/*
|
|
.form-check .form-check-input {
|
|
position:relative;
|
|
box-shadow:0px 0px 2px 1px rgba(var(--bs-body-color-rgb), 0.07) inset;
|
|
}
|
|
|
|
|
|
label.form-check .form-check-input {
|
|
float:none;
|
|
vertical-align:middle;
|
|
margin-right: 0.2rem;
|
|
}
|
|
*/
|
|
.language-nav {
|
|
margin-right: 0;
|
|
background: var(--bs-body-bg);
|
|
justify-content: end;
|
|
margin-bottom: 1rem;
|
|
}
|
|
|
|
.dd-list .language-nav {
|
|
margin-top: -0.65rem;
|
|
}
|
|
|
|
.pills-border {
|
|
--bs-nav-link-color: var(--bs-body-color);
|
|
}
|
|
.pills-border .nav-item {
|
|
margin-right: 0.3rem;
|
|
border: 1px solid rgba(var(--bs-body-color-rgb), 0.07) !important;
|
|
border-radius: 5px;
|
|
/*
|
|
a {
|
|
color:var(--bs-body-color);
|
|
&:hover {
|
|
color:var(--bs-link-color);
|
|
}
|
|
&.active:hover {
|
|
color:$white;
|
|
}
|
|
}*/
|
|
}
|
|
.pills-border label.btn {
|
|
border: 1px solid rgba(var(--bs-body-color-rgb), 0.07);
|
|
border-radius: 5px;
|
|
padding: 0.15rem 1em;
|
|
}
|
|
.pills-border label.btn:hover {
|
|
color: var(--bs-link-color);
|
|
}
|
|
.pills-border.small .nav-item a {
|
|
padding: 0.15rem 1em;
|
|
}
|
|
|
|
.bg-orange {
|
|
/* --bs-bg-opacity: 1;*/
|
|
background-color: rgba(241, 82, 35, var(--bs-bg-opacity)) !important;
|
|
}
|
|
|
|
.bg-purple {
|
|
/* --bs-bg-opacity: 1;*/
|
|
background-color: rgba(150, 35, 241, var(--bs-bg-opacity)) !important;
|
|
}
|
|
|
|
.alert .bg-info-semi i {
|
|
background: rgba(13, 202, 240, 0.1);
|
|
}
|
|
|
|
.categories-list {
|
|
max-height: 200px;
|
|
overflow-y: auto;
|
|
overflow-x: hidden;
|
|
border: 1px solid var(--bs-border-color);
|
|
border-radius: 4px;
|
|
box-shadow: 1px 1px 3px 0px rgba(var(--bs-body-color-rgb), 0.05) inset;
|
|
padding: 0.2rem;
|
|
white-space: nowrap;
|
|
resize: both;
|
|
}
|
|
.categories-list ul {
|
|
list-style: none;
|
|
}
|
|
|
|
/* upload collapse */
|
|
/*,.upload-collapse input[type=file]::file-selector-button */
|
|
.upload-collapse {
|
|
margin: 1rem 1rem 1rem 0.5rem;
|
|
padding: 0rem;
|
|
border: 1px dashed var(--bs-border-color);
|
|
border-radius: 4px;
|
|
background: var(--bs-light-bg-subtle);
|
|
position: relative;
|
|
min-height: 180px;
|
|
}
|
|
.upload-collapse h3, .upload-collapse .h3 {
|
|
padding: 2rem 4rem;
|
|
}
|
|
.upload-collapse button#upload-close {
|
|
position: absolute;
|
|
right: 1rem;
|
|
top: 1rem;
|
|
z-index: 1000;
|
|
}
|
|
.upload-collapse input[type=file] {
|
|
position: absolute;
|
|
z-index: 100;
|
|
top: 0;
|
|
left: 0;
|
|
width: 100%;
|
|
height: 100%;
|
|
padding: 6rem 4rem 4rem;
|
|
display: block !important;
|
|
font-size: 1rem;
|
|
}
|
|
.upload-collapse input[type=file]::-webkit-file-upload-button {
|
|
visibility: hidden;
|
|
}
|
|
.upload-collapse input[type=file]::before {
|
|
content: "Choose files";
|
|
color: white;
|
|
display: inline-block;
|
|
background: gradient(top, rgba(var(--bs-link-color-rgb), 0.85), var(--bs-link-color));
|
|
background: -webkit-linear-gradient(top, rgba(var(--bs-primary-rgb), 0.75), var(--bs-primary));
|
|
border: 1px solid var(--bs-link-color-rgb);
|
|
border-radius: 3px;
|
|
padding: 0.5rem 1.4rem;
|
|
outline: none;
|
|
white-space: nowrap;
|
|
-webkit-user-select: none;
|
|
cursor: pointer;
|
|
font-size: 1rem;
|
|
box-shadow: 1px 1px 2px 1px rgba(var(--bs-body-color-rgb), 0.07), -1px 1px 2px 0px rgba(var(--bs-body-bg-rgb), 0.15) inset;
|
|
}
|
|
.upload-collapse input[type=file]:hover::before {
|
|
border-color: rgba(var(--bs-link-color-rgb), 0.7);
|
|
}
|
|
.upload-collapse input[type=file]:active {
|
|
outline: 0;
|
|
}
|
|
.upload-collapse input[type=file]:active::before {
|
|
background: gradient(top, var(--bs-link-color), rgba(var(--bs-link-color-rgb), 0.85));
|
|
background: -webkit-linear-gradient(top, var(--bs-primary), rgba(var(--bs-primary-rgb), 0.75));
|
|
}
|
|
|
|
.menutree > ul {
|
|
padding: 0;
|
|
margin: 0;
|
|
}
|
|
|
|
.menutree li {
|
|
list-style: none;
|
|
padding: 7px;
|
|
border-bottom: 1px solid #eee;
|
|
}
|
|
|
|
.menutree li:last-child {
|
|
border: 0;
|
|
}
|
|
|
|
.menutree a {
|
|
display: block;
|
|
width: 100%;
|
|
text-decoration: none;
|
|
color: var(--bs-body-color);
|
|
}
|
|
|
|
.menutree label.expand-label {
|
|
position: relative;
|
|
display: block;
|
|
width: 100%;
|
|
cursor: pointer;
|
|
}
|
|
|
|
.menutree input[type=checkbox] {
|
|
display: none;
|
|
/* Hide ugly checkbox */
|
|
}
|
|
|
|
/* Hide/expand by default */
|
|
li.expand > ul {
|
|
visibility: hidden;
|
|
opacity: 0;
|
|
padding: 0;
|
|
max-height: 0;
|
|
/* CSS bug. Cannot animate height... */
|
|
transition: all 0.5s;
|
|
}
|
|
|
|
.menutree li label {
|
|
margin: 0;
|
|
}
|
|
|
|
label.expand-label::after {
|
|
font: normal normal normal 16px/1 "Line Awesome Free";
|
|
content: "\f112";
|
|
position: absolute;
|
|
top: 0;
|
|
right: 0;
|
|
transition: all 0.5s;
|
|
}
|
|
|
|
/* Show when checked */
|
|
li.expand input:checked ~ ul {
|
|
visibility: visible;
|
|
opacity: 1;
|
|
max-height: 999px;
|
|
/* Just give a big enough height for animation */
|
|
}
|
|
|
|
li.expand input:checked ~ label.expand-label::after {
|
|
transform: rotate(90deg);
|
|
}
|
|
|
|
.tags-input .badge {
|
|
color: var(--bs-body-color);
|
|
font-weight: normal;
|
|
}
|
|
|
|
.bulk-actions {
|
|
display: inline-block;
|
|
}
|
|
|
|
.vtooltip {
|
|
position: relative;
|
|
display: inline;
|
|
}
|
|
|
|
.vtooltip:after {
|
|
display: block;
|
|
visibility: hidden;
|
|
position: absolute;
|
|
bottom: 0;
|
|
left: 20%;
|
|
opacity: 0;
|
|
content: attr(title); /* might also use attr(title) */
|
|
height: auto;
|
|
min-width: 220px;
|
|
padding: 15px 8px;
|
|
z-index: 999;
|
|
color: var(--bs-gray-100);
|
|
text-decoration: none;
|
|
text-align: center;
|
|
background: rgba(var(--bs-body-color-rgb), 0.75);
|
|
-webkit-border-radius: 5px;
|
|
-moz-border-radius: 5px;
|
|
border-radius: 5px;
|
|
}
|
|
|
|
.vtooltip:before {
|
|
position: absolute;
|
|
visibility: hidden;
|
|
width: 0;
|
|
height: 0;
|
|
left: 50%;
|
|
bottom: 0px;
|
|
opacity: 0;
|
|
content: "";
|
|
border-style: solid;
|
|
border-width: 6px 6px 0 6px;
|
|
border-color: rgba(var(--bs-body-color-rgb), 0.85) transparent transparent transparent;
|
|
}
|
|
|
|
.vtooltip:hover::after {
|
|
visibility: visible;
|
|
opacity: 1;
|
|
bottom: 20px;
|
|
}
|
|
|
|
/*
|
|
.sidebar .navbar .mega-menu .sub-menu {
|
|
display:block;
|
|
}
|
|
|
|
.sidebar .navbar .mega-menu > .sub-menu .sub-menu {
|
|
position:static !important;
|
|
} */
|
|
.product-images .card {
|
|
height: 100%;
|
|
}
|
|
.product-images .card .card-img-top {
|
|
margin: auto;
|
|
}
|
|
|
|
/* order */
|
|
.billing_address .display,
|
|
.customer_details .display,
|
|
.shipping_address .display,
|
|
.order_details .display {
|
|
display: block;
|
|
}
|
|
.billing_address .edit,
|
|
.customer_details .edit,
|
|
.shipping_address .edit,
|
|
.order_details .edit {
|
|
display: none;
|
|
}
|
|
.billing_address.edit .display,
|
|
.customer_details.edit .display,
|
|
.shipping_address.edit .display,
|
|
.order_details.edit .display {
|
|
display: none;
|
|
}
|
|
.billing_address.edit .edit,
|
|
.customer_details.edit .edit,
|
|
.shipping_address.edit .edit,
|
|
.order_details.edit .edit {
|
|
display: block;
|
|
}
|
|
|
|
.order-table .option, .order-table .subscription {
|
|
margin-top: 0.5rem;
|
|
font-size: 80%;
|
|
color: var(--bs-secondary);
|
|
}
|
|
|
|
summary::marker {
|
|
color: var(--bs-secondary-color);
|
|
font-size: 12px;
|
|
}
|
|
|
|
summary::-webkit-details-marker {
|
|
color: var(--bs-border-color);
|
|
font-size: 12px;
|
|
}
|
|
|
|
details[open] summary {
|
|
margin-bottom: 1rem;
|
|
}
|
|
|
|
.revisions-dropdown {
|
|
font-size: 0.9rem;
|
|
}
|
|
|
|
.breadcrumb {
|
|
--bs-breadcrumb-divider-color:var(--bs-secondary-border-subtle);
|
|
}
|
|
|
|
.toast {
|
|
-ms-transform: translateY(20px);
|
|
transform: translateY(20px);
|
|
opacity: 0;
|
|
display: block;
|
|
visibility: hidden;
|
|
transition: opacity 0.5s cubic-bezier(0.19, 1, 0.22, 1), transform 0.5s cubic-bezier(0.19, 1, 0.22, 1), right 0s linear 0.5s;
|
|
}
|
|
.toast.fade {
|
|
visibility: visible;
|
|
display: block;
|
|
}
|
|
.toast.showing, .toast.show {
|
|
transform: translateY(0);
|
|
opacity: 1;
|
|
visibility: visible;
|
|
transition: opacity 0.5s cubic-bezier(0.19, 1, 0.22, 1), transform 0.5s cubic-bezier(0.19, 1, 0.22, 1);
|
|
}
|
|
.toast.show {
|
|
visibility: visible;
|
|
}
|
|
|
|
.tox .tox-edit-area__iframe {
|
|
background: transparent;
|
|
}
|
|
|
|
.top-notifications .dropdown-menu {
|
|
columns: 3;
|
|
}
|
|
.top-notifications .dropdown-item a {
|
|
color: inherit;
|
|
}
|
|
.top-notifications .dropdown-divider {
|
|
border: none;
|
|
}
|
|
.top-notifications [data-v-group] {
|
|
display: inline-block;
|
|
width: 100%;
|
|
}
|
|
.top-notifications [data-v-group]:last-child .dropdown-divider {
|
|
display: none;
|
|
}
|
|
|
|
img[src="#"], img[src=""] {
|
|
display: none;
|
|
}
|
|
|
|
#option.nav-pills .nav-link {
|
|
margin-bottom: 0.5rem;
|
|
}
|
|
#option.nav-pills .nav-link i {
|
|
float: right;
|
|
line-height: 1.2;
|
|
color: var(--bs-body-bg);
|
|
}
|
|
#option.nav-pills .nav-link:not(.active) {
|
|
border: 1px solid var(--bs-border-color);
|
|
}
|
|
#option.nav-pills .nav-link:not(.active) i {
|
|
color: var(--bs-danger);
|
|
}
|
|
|
|
.field-group.card {
|
|
margin-bottom: 1rem;
|
|
}
|
|
.field-group > .header {
|
|
font-size: 1rem;
|
|
border-top: none;
|
|
}
|
|
.field-group .section {
|
|
padding: 0rem;
|
|
border-top: 1px solid var(--bs-border-color);
|
|
}
|
|
.field-group input.header_check:checked + div.section {
|
|
padding: 1rem;
|
|
}
|
|
.field-group .header-arrow {
|
|
padding: 0.2rem 0.5rem;
|
|
top: 4px;
|
|
}
|
|
|
|
.fields .col {
|
|
align-self: center;
|
|
}
|
|
|
|
.field-types .dropdown-item i {
|
|
background: rgba(var(--bs-body-color-rgb), 0.02);
|
|
padding: 0.3rem 0.3rem;
|
|
margin-right: 0.3rem;
|
|
border-radius: 5px;
|
|
border: 1px solid rgba(var(--bs-body-color-rgb), 0.15);
|
|
}
|
|
|
|
/* field groups */
|
|
.field_group .nav-link {
|
|
font-size: 14px;
|
|
--bs-nav-link-padding-y: 0.7rem;
|
|
--bs-nav-link-padding-x: 1.5rem;
|
|
}
|
|
.field_group .accordion-header {
|
|
position: relative;
|
|
}
|
|
.field_group .accordion-header .buttons {
|
|
visibility: hidden;
|
|
position: absolute;
|
|
z-index: 2;
|
|
right: 4rem;
|
|
top: 0.8rem;
|
|
}
|
|
.field_group .accordion-item:hover .buttons {
|
|
visibility: visible;
|
|
}
|
|
.field_group .rule .btn-danger {
|
|
visibility: hidden;
|
|
}
|
|
.field_group .rule:hover .btn-danger {
|
|
visibility: visible;
|
|
}
|
|
.field_group .nav-tabs .nav-item i[class^=icon-] {
|
|
font-size: 1.2rem;
|
|
line-height: 1;
|
|
margin-right: 0.5rem;
|
|
color: var(--bs-secondary);
|
|
}
|
|
.field_group #group-conditionals .m-3 .group label {
|
|
margin-top: 0.5rem;
|
|
}
|
|
.field_group #group-conditionals .m-3 .group .group-label {
|
|
display: none;
|
|
}
|
|
.field_group #group-conditionals .m-3 .group .or-label {
|
|
display: block;
|
|
}
|
|
.field_group #group-conditionals .m-3 .group:first-child .group-label {
|
|
display: block;
|
|
}
|
|
.field_group #group-conditionals .m-3 .group:first-child .or-label {
|
|
display: none;
|
|
}
|
|
|
|
#page-loading-status {
|
|
position: fixed;
|
|
top: 0px;
|
|
left: 0;
|
|
width: 0%;
|
|
z-index: 10;
|
|
--bs-progress-bg: transparent;
|
|
--bs-progress-bar-bg: var(--bs-link-hover-color);
|
|
--bs-progress-height: 2px;
|
|
}
|
|
|
|
#searchModal .modal-content {
|
|
box-shadow: 0 2.8px 2.2px rgba(0, 0, 0, 0.02), 0 6.7px 5.3px rgba(0, 0, 0, 0.028), 0 12.5px 10px rgba(0, 0, 0, 0.035), 0 22.3px 17.9px rgba(0, 0, 0, 0.042), 0 41.8px 33.4px rgba(0, 0, 0, 0.05), 0 100px 80px rgba(0, 0, 0, 0.07);
|
|
}
|
|
#searchModal .modal-dialog {
|
|
padding-top: 8rem;
|
|
}
|
|
#searchModal input {
|
|
box-shadow: none;
|
|
}
|
|
#searchModal .btn-close {
|
|
margin-top: 6.3rem;
|
|
position: absolute;
|
|
top: 0;
|
|
right: 10px;
|
|
z-index: 100;
|
|
cursor: pointer;
|
|
}
|
|
#searchModal .search-results {
|
|
padding: 0 1rem;
|
|
}
|
|
|
|
.modal-backdrop.show {
|
|
background: linear-gradient(to right bottom, rgba(0, 0, 0, 0.9), rgba(0, 0, 0, 0.3));
|
|
}
|
|
|
|
.dropdown-menu.show {
|
|
box-shadow: 0 0 0 1px rgba(var(--bs-body-color-rgb), 0.04), 0 7px 20px -5px rgba(var(--bs-body-color-rgb), 0.15);
|
|
border: none;
|
|
}
|
|
|
|
img.avatar {
|
|
object-fit: cover;
|
|
aspect-ratio: 1/1;
|
|
} |